package com.android.server.am;
+import static android.Manifest.permission.CHANGE_CONFIGURATION;
+import static android.Manifest.permission.CHANGE_DEVICE_IDLE_TEMP_WHITELIST;
import static android.Manifest.permission.INTERACT_ACROSS_USERS;
import static android.Manifest.permission.INTERACT_ACROSS_USERS_FULL;
+import static android.Manifest.permission.INTERNAL_SYSTEM_WINDOW;
+import static android.Manifest.permission.MANAGE_ACTIVITY_STACKS;
+import static android.Manifest.permission.READ_FRAME_BUFFER;
import static android.Manifest.permission.START_TASKS_FROM_RECENTS;
+import static android.app.ActivityManager.DOCKED_STACK_CREATE_MODE_TOP_OR_LEFT;
+import static android.app.ActivityManager.RESIZE_MODE_PRESERVE_WINDOW;
+import static android.app.ActivityManager.StackId.DOCKED_STACK_ID;
+import static android.app.ActivityManager.StackId.FREEFORM_WORKSPACE_STACK_ID;
+import static android.app.ActivityManager.StackId.FIRST_DYNAMIC_STACK_ID;
+import static android.app.ActivityManager.StackId.FULLSCREEN_WORKSPACE_STACK_ID;
+import static android.app.ActivityManager.StackId.INVALID_STACK_ID;
+import static android.app.ActivityManager.StackId.PINNED_STACK_ID;
+import static android.content.pm.PackageManager.FEATURE_ACTIVITIES_ON_SECONDARY_DISPLAYS;
+import static android.content.pm.PackageManager.FEATURE_FREEFORM_WINDOW_MANAGEMENT;
+import static android.content.pm.PackageManager.FEATURE_LEANBACK_ONLY;
+import static android.content.pm.PackageManager.FEATURE_PICTURE_IN_PICTURE;
+import static android.content.pm.PackageManager.GET_PROVIDERS;
+import static android.content.pm.PackageManager.MATCH_ANY_USER;
+import static android.content.pm.PackageManager.MATCH_DEBUG_TRIAGED_MISSING;
+import static android.content.pm.PackageManager.MATCH_DIRECT_BOOT_AWARE;
+import static android.content.pm.PackageManager.MATCH_DIRECT_BOOT_UNAWARE;
+import static android.content.pm.PackageManager.MATCH_SYSTEM_ONLY;
+import static android.content.pm.PackageManager.MATCH_UNINSTALLED_PACKAGES;
import static android.content.pm.PackageManager.PERMISSION_GRANTED;
+import static android.content.res.Configuration.UI_MODE_TYPE_TELEVISION;
+import static android.net.NetworkPolicyManager.isProcStateAllowedWhileIdleOrPowerSaveMode;
+import static android.net.NetworkPolicyManager.isProcStateAllowedWhileOnRestrictBackground;
+import static android.os.Build.VERSION_CODES.N;
+import static android.os.Process.BLUETOOTH_UID;
+import static android.os.Process.FIRST_APPLICATION_UID;
+import static android.os.Process.FIRST_ISOLATED_UID;
+import static android.os.Process.LAST_ISOLATED_UID;
+import static android.os.Process.NFC_UID;
+import static android.os.Process.PHONE_UID;
+import static android.os.Process.PROC_CHAR;
+import static android.os.Process.PROC_OUT_LONG;
+import static android.os.Process.PROC_PARENS;
+import static android.os.Process.PROC_SPACE_TERM;
+import static android.os.Process.ProcessStartResult;
+import static android.os.Process.ROOT_UID;
+import static android.os.Process.SCHED_FIFO;
+import static android.os.Process.SCHED_OTHER;
+import static android.os.Process.SCHED_RESET_ON_FORK;
+import static android.os.Process.SHELL_UID;
+import static android.os.Process.SIGNAL_QUIT;
+import static android.os.Process.SIGNAL_USR1;
+import static android.os.Process.SYSTEM_UID;
+import static android.os.Process.THREAD_GROUP_BG_NONINTERACTIVE;
+import static android.os.Process.THREAD_GROUP_DEFAULT;
+import static android.os.Process.THREAD_GROUP_TOP_APP;
+import static android.os.Process.THREAD_PRIORITY_BACKGROUND;
+import static android.os.Process.THREAD_PRIORITY_FOREGROUND;
+import static android.os.Process.getFreeMemory;
+import static android.os.Process.getTotalMemory;
+import static android.os.Process.isThreadInProcess;
+import static android.os.Process.killProcess;
+import static android.os.Process.killProcessQuiet;
+import static android.os.Process.myPid;
+import static android.os.Process.myUid;
+import static android.os.Process.readProcFile;
+import static android.os.Process.removeAllProcessGroups;
+import static android.os.Process.sendSignal;
+import static android.os.Process.setProcessGroup;
+import static android.os.Process.setThreadPriority;
+import static android.os.Process.setThreadScheduler;
+import static android.os.Process.startWebView;
+import static android.os.Process.zygoteProcess;
+import static android.provider.Settings.Global.ALWAYS_FINISH_ACTIVITIES;
+import static android.provider.Settings.Global.DEBUG_APP;
+import static android.provider.Settings.Global.DEVELOPMENT_ENABLE_FREEFORM_WINDOWS_SUPPORT;
+import static android.provider.Settings.Global.DEVELOPMENT_FORCE_RESIZABLE_ACTIVITIES;
+import static android.provider.Settings.Global.DEVELOPMENT_FORCE_RTL;
+import static android.provider.Settings.Global.NETWORK_ACCESS_TIMEOUT_MS;
+import static android.provider.Settings.Global.WAIT_FOR_DEBUGGER;
+import static android.provider.Settings.System.FONT_SCALE;
+import static android.service.voice.VoiceInteractionSession.SHOW_SOURCE_APPLICATION;
+import static android.text.format.DateUtils.DAY_IN_MILLIS;
+import static android.view.Display.DEFAULT_DISPLAY;
+import static android.view.Display.INVALID_DISPLAY;
import static com.android.internal.util.XmlUtils.readBooleanAttribute;
import static com.android.internal.util.XmlUtils.readIntAttribute;
import static com.android.internal.util.XmlUtils.readLongAttribute;
import static com.android.internal.util.XmlUtils.writeBooleanAttribute;
import static com.android.internal.util.XmlUtils.writeIntAttribute;
import static com.android.internal.util.XmlUtils.writeLongAttribute;
-import static com.android.server.Watchdog.NATIVE_STACKS_OF_INTEREST;
-import static com.android.server.am.ActivityManagerDebugConfig.*;
-import static com.android.server.am.ActivityStackSupervisor.HOME_STACK_ID;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_ALL;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_ANR;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_BACKGROUND_CHECK;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_BACKUP;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_BROADCAST;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_BROADCAST_BACKGROUND;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_BROADCAST_LIGHT;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_CLEANUP;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_CONFIGURATION;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_FOCUS;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_IMMERSIVE;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_LOCKTASK;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_LRU;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_MU;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_NETWORK;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_OOM_ADJ;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_OOM_ADJ_REASON;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_PERMISSIONS_REVIEW;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_POWER;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_PROCESSES;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_PROCESS_OBSERVERS;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_PROVIDER;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_PSS;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_RECENTS;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_SERVICE;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_STACK;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_SWITCH;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_TASKS;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_UID_OBSERVERS;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_URI_PERMISSION;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_USAGE_STATS;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_VISIBILITY;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_WHITELISTS;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_BACKUP;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_BROADCAST;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_CLEANUP;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_CONFIGURATION;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_FOCUS;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_IMMERSIVE;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_LOCKSCREEN;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_LOCKTASK;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_LRU;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_MU;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_NETWORK;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_OOM_ADJ;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_POWER;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_PROCESSES;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_PROCESS_OBSERVERS;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_PROVIDER;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_PSS;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_RECENTS;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_SERVICE;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_STACK;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_SWITCH;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_UID_OBSERVERS;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_URI_PERMISSION;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_VISIBILITY;
+import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_VISIBLE_BEHIND;
+import static com.android.server.am.ActivityManagerDebugConfig.TAG_AM;
+import static com.android.server.am.ActivityManagerDebugConfig.TAG_WITH_CLASS_NAME;
+import static com.android.server.am.ActivityStackSupervisor.CREATE_IF_NEEDED;
+import static com.android.server.am.ActivityStackSupervisor.DEFER_RESUME;
+import static com.android.server.am.ActivityStackSupervisor.MATCH_TASK_IN_STACKS_ONLY;
+import static com.android.server.am.ActivityStackSupervisor.MATCH_TASK_IN_STACKS_OR_RECENT_TASKS;
+import static com.android.server.am.ActivityStackSupervisor.ON_TOP;
+import static com.android.server.am.ActivityStackSupervisor.PRESERVE_WINDOWS;
+import static com.android.server.am.ActivityStackSupervisor.REMOVE_FROM_RECENTS;
import static com.android.server.am.TaskRecord.INVALID_TASK_ID;
import static com.android.server.am.TaskRecord.LOCK_TASK_AUTH_DONT_LOCK;
import static com.android.server.am.TaskRecord.LOCK_TASK_AUTH_LAUNCHABLE_PRIV;
import static com.android.server.am.TaskRecord.LOCK_TASK_AUTH_PINNABLE;
+import static com.android.server.am.TaskRecord.REPARENT_KEEP_STACK_AT_FRONT;
+import static com.android.server.am.TaskRecord.REPARENT_LEAVE_STACK_IN_PLACE;
+import static com.android.server.wm.AppTransition.TRANSIT_ACTIVITY_OPEN;
+import static com.android.server.wm.AppTransition.TRANSIT_ACTIVITY_RELAUNCH;
+import static com.android.server.wm.AppTransition.TRANSIT_NONE;
+import static com.android.server.wm.AppTransition.TRANSIT_TASK_IN_PLACE;
+import static com.android.server.wm.AppTransition.TRANSIT_TASK_OPEN;
+import static com.android.server.wm.AppTransition.TRANSIT_TASK_TO_FRONT;
import static org.xmlpull.v1.XmlPullParser.END_DOCUMENT;
import static org.xmlpull.v1.XmlPullParser.START_TAG;
import android.Manifest;
-import android.app.AppOpsManager;
-import android.app.ApplicationThreadNative;
-import android.app.BroadcastOptions;
-import android.app.IActivityContainer;
-import android.app.IActivityContainerCallback;
-import android.app.IAppTask;
-import android.app.ITaskStackListener;
-import android.app.ProfilerInfo;
-import android.app.assist.AssistContent;
-import android.app.assist.AssistStructure;
-import android.app.usage.UsageEvents;
-import android.app.usage.UsageStatsManagerInternal;
-import android.appwidget.AppWidgetManager;
-import android.content.pm.PermissionInfo;
-import android.content.res.Resources;
-import android.graphics.Bitmap;
-import android.graphics.Point;
-import android.graphics.Rect;
-import android.os.BatteryStats;
-import android.os.PersistableBundle;
-import android.os.PowerManager;
-import android.os.Trace;
-import android.os.TransactionTooLargeException;
-import android.os.WorkSource;
-import android.os.storage.IMountService;
-import android.os.storage.MountServiceInternal;
-import android.os.storage.StorageManager;
-import android.service.voice.IVoiceInteractionSession;
-import android.service.voice.VoiceInteractionSession;
-import android.util.ArrayMap;
-import android.util.ArraySet;
-import android.util.DebugUtils;
-import android.util.SparseIntArray;
-import android.view.Display;
-
-import com.android.internal.R;
-import com.android.internal.annotations.GuardedBy;
-import com.android.internal.app.AssistUtils;
-import com.android.internal.app.DumpHeapActivity;
-import com.android.internal.app.IAppOpsService;
-import com.android.internal.app.IVoiceInteractor;
-import com.android.internal.app.ProcessMap;
-import com.android.internal.app.ProcessStats;
-import com.android.internal.os.BackgroundThread;
-import com.android.internal.os.BatteryStatsImpl;
-import com.android.internal.os.IResultReceiver;
-import com.android.internal.os.ProcessCpuTracker;
-import com.android.internal.os.TransferPipe;
-import com.android.internal.os.Zygote;
-import com.android.internal.util.ArrayUtils;
-import com.android.internal.util.FastPrintWriter;
-import com.android.internal.util.FastXmlSerializer;
-import com.android.internal.util.MemInfoReader;
-import com.android.internal.util.Preconditions;
-import com.android.server.AppOpsService;
-import com.android.server.AttributeCache;
-import com.android.server.DeviceIdleController;
-import com.android.server.IntentResolver;
-import com.android.server.LocalServices;
-import com.android.server.ServiceThread;
-import com.android.server.SystemService;
-import com.android.server.SystemServiceManager;
-import com.android.server.Watchdog;
-import com.android.server.am.ActivityStack.ActivityState;
-import com.android.server.firewall.IntentFirewall;
-import com.android.server.pm.Installer;
-import com.android.server.pm.UserManagerService;
-import com.android.server.statusbar.StatusBarManagerInternal;
-import com.android.server.wm.AppTransition;
-import com.android.server.wm.WindowManagerService;
-import com.google.android.collect.Lists;
-import com.google.android.collect.Maps;
-
-import libcore.io.IoUtils;
-import libcore.util.EmptyArray;
-
-import org.xmlpull.v1.XmlPullParser;
-import org.xmlpull.v1.XmlPullParserException;
-import org.xmlpull.v1.XmlSerializer;
-
+import android.Manifest.permission;
+import android.annotation.NonNull;
+import android.annotation.Nullable;
+import android.annotation.UserIdInt;
import android.app.Activity;
import android.app.ActivityManager;
import android.app.ActivityManager.RunningTaskInfo;
+import android.app.ActivityManager.StackId;
import android.app.ActivityManager.StackInfo;
+import android.app.ActivityManager.TaskSnapshot;
+import android.app.ActivityManager.TaskThumbnailInfo;
import android.app.ActivityManagerInternal;
import android.app.ActivityManagerInternal.SleepToken;
-import android.app.ActivityManagerNative;
import android.app.ActivityOptions;
import android.app.ActivityThread;
import android.app.AlertDialog;
import android.app.AppGlobals;
+import android.app.AppOpsManager;
import android.app.ApplicationErrorReport;
+import android.app.ApplicationThreadConstants;
+import android.app.BroadcastOptions;
+import android.app.ContentProviderHolder;
import android.app.Dialog;
import android.app.IActivityController;
+import android.app.IActivityManager;
+import android.app.IAppTask;
import android.app.IApplicationThread;
import android.app.IInstrumentationWatcher;
import android.app.INotificationManager;
import android.app.IProcessObserver;
import android.app.IServiceConnection;
import android.app.IStopUserCallback;
-import android.app.IUidObserver;
+import android.app.ITaskStackListener;
import android.app.IUiAutomationConnection;
+import android.app.IUidObserver;
import android.app.IUserSwitchObserver;
import android.app.Instrumentation;
import android.app.Notification;
import android.app.NotificationManager;
import android.app.PendingIntent;
-import android.app.backup.IBackupManager;
+import android.app.PictureInPictureParams;
+import android.app.ProfilerInfo;
+import android.app.RemoteAction;
+import android.app.WaitResult;
import android.app.admin.DevicePolicyManager;
+import android.app.assist.AssistContent;
+import android.app.assist.AssistStructure;
+import android.app.backup.IBackupManager;
+import android.app.usage.UsageEvents;
+import android.app.usage.UsageStatsManagerInternal;
+import android.appwidget.AppWidgetManager;
import android.content.ActivityNotFoundException;
import android.content.BroadcastReceiver;
import android.content.ClipData;
import android.content.IIntentSender;
import android.content.Intent;
import android.content.IntentFilter;
-import android.content.IntentSender;
import android.content.pm.ActivityInfo;
import android.content.pm.ApplicationInfo;
import android.content.pm.ConfigurationInfo;
import android.content.pm.InstrumentationInfo;
import android.content.pm.PackageInfo;
import android.content.pm.PackageManager;
-import android.content.pm.ParceledListSlice;
-import android.content.pm.UserInfo;
import android.content.pm.PackageManager.NameNotFoundException;
+import android.content.pm.PackageManagerInternal;
+import android.content.pm.ParceledListSlice;
import android.content.pm.PathPermission;
+import android.content.pm.PermissionInfo;
import android.content.pm.ProviderInfo;
import android.content.pm.ResolveInfo;
+import android.content.pm.SELinuxUtil;
import android.content.pm.ServiceInfo;
+import android.content.pm.UserInfo;
import android.content.res.CompatibilityInfo;
import android.content.res.Configuration;
+import android.content.res.Resources;
+import android.database.ContentObserver;
+import android.graphics.Bitmap;
+import android.graphics.Point;
+import android.graphics.Rect;
+import android.location.LocationManager;
+import android.media.audiofx.AudioEffect;
+import android.metrics.LogMaker;
import android.net.Proxy;
import android.net.ProxyInfo;
import android.net.Uri;
+import android.os.BatteryStats;
import android.os.Binder;
import android.os.Build;
import android.os.Bundle;
import android.os.FileUtils;
import android.os.Handler;
import android.os.IBinder;
+import android.os.IDeviceIdentifiersPolicyService;
import android.os.IPermissionController;
import android.os.IProcessInfoService;
-import android.os.IRemoteCallback;
-import android.os.IUserManager;
+import android.os.IProgressListener;
+import android.os.LocaleList;
import android.os.Looper;
import android.os.Message;
import android.os.Parcel;
import android.os.ParcelFileDescriptor;
+import android.os.PersistableBundle;
+import android.os.PowerManager;
import android.os.PowerManagerInternal;
import android.os.Process;
import android.os.RemoteCallbackList;
import android.os.RemoteException;
-import android.os.SELinux;
+import android.os.ResultReceiver;
import android.os.ServiceManager;
+import android.os.ShellCallback;
import android.os.StrictMode;
import android.os.SystemClock;
import android.os.SystemProperties;
+import android.os.Trace;
+import android.os.TransactionTooLargeException;
import android.os.UpdateLock;
import android.os.UserHandle;
import android.os.UserManager;
+import android.os.WorkSource;
+import android.os.storage.IStorageManager;
+import android.os.storage.StorageManager;
+import android.os.storage.StorageManagerInternal;
import android.provider.Downloads;
import android.provider.Settings;
+import android.service.voice.IVoiceInteractionSession;
+import android.service.voice.VoiceInteractionManagerInternal;
+import android.service.voice.VoiceInteractionSession;
import android.telecom.TelecomManager;
+import android.text.TextUtils;
import android.text.format.DateUtils;
import android.text.format.Time;
+import android.text.style.SuggestionSpan;
+import android.util.ArrayMap;
+import android.util.ArraySet;
import android.util.AtomicFile;
+import android.util.TimingsTraceLog;
+import android.util.DebugUtils;
+import android.util.DisplayMetrics;
import android.util.EventLog;
import android.util.Log;
import android.util.Pair;
import android.util.PrintWriterPrinter;
import android.util.Slog;
import android.util.SparseArray;
+import android.util.SparseIntArray;
import android.util.TimeUtils;
import android.util.Xml;
import android.view.Gravity;
import android.view.View;
import android.view.WindowManager;
-import dalvik.system.VMRuntime;
+import com.android.server.job.JobSchedulerInternal;
+import com.google.android.collect.Lists;
+import com.google.android.collect.Maps;
+
+import com.android.internal.R;
+import com.android.internal.annotations.GuardedBy;
+import com.android.internal.annotations.VisibleForTesting;
+import com.android.internal.app.AssistUtils;
+import com.android.internal.app.DumpHeapActivity;
+import com.android.internal.app.IAppOpsCallback;
+import com.android.internal.app.IAppOpsService;
+import com.android.internal.app.IVoiceInteractor;
+import com.android.internal.app.ProcessMap;
+import com.android.internal.app.SystemUserHomeActivity;
+import com.android.internal.app.procstats.ProcessStats;
+import com.android.internal.logging.MetricsLogger;
+import com.android.internal.logging.nano.MetricsProto.MetricsEvent;
+import com.android.internal.messages.nano.SystemMessageProto.SystemMessage;
+import com.android.internal.notification.SystemNotificationChannels;
+import com.android.internal.os.BackgroundThread;
+import com.android.internal.os.BatteryStatsImpl;
+import com.android.internal.os.IResultReceiver;
+import com.android.internal.os.ProcessCpuTracker;
+import com.android.internal.os.TransferPipe;
+import com.android.internal.os.Zygote;
+import com.android.internal.policy.IKeyguardDismissCallback;
+import com.android.internal.telephony.TelephonyIntents;
+import com.android.internal.util.ArrayUtils;
+import com.android.internal.util.DumpUtils;
+import com.android.internal.util.FastPrintWriter;
+import com.android.internal.util.FastXmlSerializer;
+import com.android.internal.util.MemInfoReader;
+import com.android.internal.util.Preconditions;
+import com.android.server.AppOpsService;
+import com.android.server.AttributeCache;
+import com.android.server.DeviceIdleController;
+import com.android.server.IntentResolver;
+import com.android.server.LocalServices;
+import com.android.server.LockGuard;
+import com.android.server.NetworkManagementInternal;
+import com.android.server.RescueParty;
+import com.android.server.ServiceThread;
+import com.android.server.SystemConfig;
+import com.android.server.SystemService;
+import com.android.server.SystemServiceManager;
+import com.android.server.ThreadPriorityBooster;
+import com.android.server.Watchdog;
+import com.android.server.am.ActivityStack.ActivityState;
+import com.android.server.firewall.IntentFirewall;
+import com.android.server.pm.Installer;
+import com.android.server.pm.Installer.InstallerException;
+import com.android.server.statusbar.StatusBarManagerInternal;
+import com.android.server.vr.VrManagerInternal;
+import com.android.server.wm.PinnedStackWindowController;
+import com.android.server.wm.WindowManagerService;
+
+import java.text.SimpleDateFormat;
+import org.xmlpull.v1.XmlPullParser;
+import org.xmlpull.v1.XmlPullParserException;
+import org.xmlpull.v1.XmlSerializer;
-import java.io.BufferedInputStream;
-import java.io.BufferedOutputStream;
-import java.io.DataInputStream;
-import java.io.DataOutputStream;
import java.io.File;
import java.io.FileDescriptor;
import java.io.FileInputStream;
import java.io.InputStreamReader;
import java.io.PrintWriter;
import java.io.StringWriter;
+import java.io.UnsupportedEncodingException;
import java.lang.ref.WeakReference;
import java.nio.charset.StandardCharsets;
+import java.text.DateFormat;
import java.util.ArrayList;
import java.util.Arrays;
import java.util.Collections;
import java.util.Comparator;
+import java.util.Date;
import java.util.HashMap;
import java.util.HashSet;
import java.util.Iterator;
import java.util.List;
import java.util.Locale;
import java.util.Map;
+import java.util.Objects;
import java.util.Set;
+import java.util.concurrent.CountDownLatch;
import java.util.concurrent.atomic.AtomicBoolean;
import java.util.concurrent.atomic.AtomicLong;
-public final class ActivityManagerService extends ActivityManagerNative
+import dalvik.system.VMRuntime;
+import libcore.io.IoUtils;
+import libcore.util.EmptyArray;
+
+public class ActivityManagerService extends IActivityManager.Stub
implements Watchdog.Monitor, BatteryStatsImpl.BatteryCallback {
- // File that stores last updated system version and called preboot receivers
- static final String CALLED_PRE_BOOTS_FILENAME = "called_pre_boots.dat";
+ /**
+ * Priority we boost main thread and RT of top app to.
+ */
+ public static final int TOP_APP_PRIORITY_BOOST = -10;
private static final String TAG = TAG_WITH_CLASS_NAME ? "ActivityManagerService" : TAG_AM;
private static final String TAG_BACKUP = TAG + POSTFIX_BACKUP;
private static final String TAG_CONFIGURATION = TAG + POSTFIX_CONFIGURATION;
private static final String TAG_FOCUS = TAG + POSTFIX_FOCUS;
private static final String TAG_IMMERSIVE = TAG + POSTFIX_IMMERSIVE;
- private static final String TAG_LOCKSCREEN = TAG + POSTFIX_LOCKSCREEN;
private static final String TAG_LOCKTASK = TAG + POSTFIX_LOCKTASK;
private static final String TAG_LRU = TAG + POSTFIX_LRU;
private static final String TAG_MU = TAG + POSTFIX_MU;
+ private static final String TAG_NETWORK = TAG + POSTFIX_NETWORK;
private static final String TAG_OOM_ADJ = TAG + POSTFIX_OOM_ADJ;
private static final String TAG_POWER = TAG + POSTFIX_POWER;
private static final String TAG_PROCESS_OBSERVERS = TAG + POSTFIX_PROCESS_OBSERVERS;
private static final String TAG_UID_OBSERVERS = TAG + POSTFIX_UID_OBSERVERS;
private static final String TAG_URI_PERMISSION = TAG + POSTFIX_URI_PERMISSION;
private static final String TAG_VISIBILITY = TAG + POSTFIX_VISIBILITY;
- private static final String TAG_VISIBLE_BEHIND = TAG + POSTFIX_VISIBLE_BEHIND;
+
+ // Mock "pretend we're idle now" broadcast action to the job scheduler; declared
+ // here so that while the job scheduler can depend on AMS, the other way around
+ // need not be the case.
+ public static final String ACTION_TRIGGER_IDLE = "com.android.server.ACTION_TRIGGER_IDLE";
/** Control over CPU and battery monitoring */
// write battery stats every 30 minutes.
// The flags that are set for all calls we make to the package manager.
static final int STOCK_PM_FLAGS = PackageManager.GET_SHARED_LIBRARY_FILES;
- private static final String SYSTEM_DEBUGGABLE = "ro.debuggable";
-
- static final boolean IS_USER_BUILD = "user".equals(Build.TYPE);
+ static final String SYSTEM_DEBUGGABLE = "ro.debuggable";
// Amount of time after a call to stopAppSwitches() during which we will
// prevent further untrusted switches from happening.
// could take much longer than usual.
static final int PROC_START_TIMEOUT_WITH_WRAPPER = 1200*1000;
- // How long to wait after going idle before forcing apps to GC.
- static final int GC_TIMEOUT = 5*1000;
-
- // The minimum amount of time between successive GC requests for a process.
- static final int GC_MIN_INTERVAL = 60*1000;
-
- // The minimum amount of time between successive PSS requests for a process.
- static final int FULL_PSS_MIN_INTERVAL = 10*60*1000;
-
- // The minimum amount of time between successive PSS requests for a process
- // when the request is due to the memory state being lowered.
- static final int FULL_PSS_LOWERED_INTERVAL = 2*60*1000;
-
- // The rate at which we check for apps using excessive power -- 15 mins.
- static final int POWER_CHECK_DELAY = (DEBUG_POWER_QUICK ? 2 : 15) * 60*1000;
-
- // The minimum sample duration we will allow before deciding we have
- // enough data on wake locks to start killing things.
- static final int WAKE_LOCK_MIN_CHECK_DURATION = (DEBUG_POWER_QUICK ? 1 : 5) * 60*1000;
-
- // The minimum sample duration we will allow before deciding we have
- // enough data on CPU usage to start killing things.
- static final int CPU_MIN_CHECK_DURATION = (DEBUG_POWER_QUICK ? 1 : 5) * 60*1000;
-
// How long we allow a receiver to run before giving up on it.
static final int BROADCAST_FG_TIMEOUT = 10*1000;
static final int BROADCAST_BG_TIMEOUT = 60*1000;
// How long we wait until we timeout on key dispatching during instrumentation.
static final int INSTRUMENTATION_KEY_DISPATCHING_TIMEOUT = 60*1000;
- // Amount of time we wait for observers to handle a user switch before
- // giving up on them and unfreezing the screen.
- static final int USER_SWITCH_TIMEOUT = 2*1000;
-
- // This is the amount of time an app needs to be running a foreground service before
- // we will consider it to be doing interaction for usage stats.
- static final int SERVICE_USAGE_INTERACTION_TIME = 30*60*1000;
-
- // Maximum amount of time we will allow to elapse before re-reporting usage stats
- // interaction with foreground processes.
- static final long USAGE_STATS_INTERACTION_INTERVAL = 24*60*60*1000L;
-
- // Maximum number of users we allow to be running at a time.
- static final int MAX_RUNNING_USERS = 3;
-
// How long to wait in getAssistContextExtras for the activity and foreground services
// to respond with the result.
static final int PENDING_ASSIST_EXTRAS_TIMEOUT = 500;
// on getting this result before starting to launch its UI).
static final int PENDING_ASSIST_EXTRAS_LONG_TIMEOUT = 2000;
+ // How long to wait in getAutofillAssistStructure() for the activity to respond with the result.
+ static final int PENDING_AUTOFILL_ASSIST_STRUCTURE_TIMEOUT = 2000;
+
// Maximum number of persisted Uri grants a package is allowed
static final int MAX_PERSISTED_URI_GRANTS = 128;
- static final int MY_PID = Process.myPid();
+ static final int MY_PID = myPid();
static final String[] EMPTY_STRING_ARRAY = new String[0];
// How many bytes to write into the dropbox log before truncating
- static final int DROPBOX_MAX_SIZE = 256 * 1024;
+ static final int DROPBOX_MAX_SIZE = 192 * 1024;
+ // Assumes logcat entries average around 100 bytes; that's not perfect stack traces count
+ // as one line, but close enough for now.
+ static final int RESERVED_BYTES_PER_LOGCAT_LINE = 100;
// Access modes for handleIncomingUser.
static final int ALLOW_NON_FULL = 0;
static final int ALLOW_NON_FULL_IN_PROFILE = 1;
static final int ALLOW_FULL_ONLY = 2;
- static final int LAST_PREBOOT_DELIVERED_FILE_VERSION = 10000;
-
- // Delay in notifying task stack change listeners (in millis)
- static final int NOTIFY_TASK_STACK_CHANGE_LISTENERS_DELAY = 1000;
-
// Necessary ApplicationInfo flags to mark an app as persistent
private static final int PERSISTENT_MASK =
ApplicationInfo.FLAG_SYSTEM|ApplicationInfo.FLAG_PERSISTENT;
+ // Intent sent when remote bugreport collection has been completed
+ private static final String INTENT_REMOTE_BUGREPORT_FINISHED =
+ "com.android.internal.intent.action.REMOTE_BUGREPORT_FINISHED";
+
+ // Used to indicate that an app transition should be animated.
+ static final boolean ANIMATE = true;
+
+ // Determines whether to take full screen screenshots
+ static final boolean TAKE_FULLSCREEN_SCREENSHOTS = true;
+
+ /**
+ * Default value for {@link Settings.Global#NETWORK_ACCESS_TIMEOUT_MS}.
+ */
+ private static final long NETWORK_ACCESS_TIMEOUT_DEFAULT_MS = 200; // 0.2 sec
+
+ /**
+ * State indicating that there is no need for any blocking for network.
+ */
+ @VisibleForTesting
+ static final int NETWORK_STATE_NO_CHANGE = 0;
+
+ /**
+ * State indicating that the main thread needs to be informed about the network wait.
+ */
+ @VisibleForTesting
+ static final int NETWORK_STATE_BLOCK = 1;
+
+ /**
+ * State indicating that any threads waiting for network state to get updated can be unblocked.
+ */
+ @VisibleForTesting
+ static final int NETWORK_STATE_UNBLOCK = 2;
- // Delay to disable app launch boost
- static final int APP_BOOST_MESSAGE_DELAY = 3000;
- // Lower delay than APP_BOOST_MESSAGE_DELAY to disable the boost
- static final int APP_BOOST_TIMEOUT = 2500;
+ // Max character limit for a notification title. If the notification title is larger than this
+ // the notification will not be legible to the user.
+ private static final int MAX_BUGREPORT_TITLE_SIZE = 50;
- private static native int nativeMigrateToBoost();
- private static native int nativeMigrateFromBoost();
- private boolean mIsBoosted = false;
- private long mBoostStartTime = 0;
+ private static final int NATIVE_DUMP_TIMEOUT_MS = 2000; // 2 seconds;
/** All system services */
SystemServiceManager mSystemServiceManager;
+ AssistUtils mAssistUtils;
private Installer mInstaller;
/** Run all ActivityStacks through this */
- ActivityStackSupervisor mStackSupervisor;
+ final ActivityStackSupervisor mStackSupervisor;
+ private final KeyguardController mKeyguardController;
+
+ final ActivityStarter mActivityStarter;
- /** Task stack change listeners. */
- private RemoteCallbackList<ITaskStackListener> mTaskStackListeners =
- new RemoteCallbackList<ITaskStackListener>();
+ final TaskChangeNotificationController mTaskChangeNotificationController;
- public IntentFirewall mIntentFirewall;
+ final InstrumentationReporter mInstrumentationReporter = new InstrumentationReporter();
+
+ final ArrayList<ActiveInstrumentation> mActiveInstrumentation = new ArrayList<>();
+
+ public final IntentFirewall mIntentFirewall;
// Whether we should show our dialogs (ANR, crash, etc) or just perform their
- // default actuion automatically. Important for devices without direct input
+ // default action automatically. Important for devices without direct input
// devices.
private boolean mShowDialogs = true;
+ private final VrController mVrController;
+
+ // VR Vr2d Display Id.
+ int mVr2dDisplayId = INVALID_DISPLAY;
+
+ // Whether we should use SCHED_FIFO for UI and RenderThreads.
+ private boolean mUseFifoUiScheduling = false;
+
BroadcastQueue mFgBroadcastQueue;
BroadcastQueue mBgBroadcastQueue;
// Convenient for easy iteration over the queues. Foreground is first
// so that dispatch of foreground broadcasts gets precedence.
final BroadcastQueue[] mBroadcastQueues = new BroadcastQueue[2];
+ BroadcastStats mLastBroadcastStats;
+ BroadcastStats mCurBroadcastStats;
+
BroadcastQueue broadcastQueueForIntent(Intent intent) {
final boolean isFg = (intent.getFlags() & Intent.FLAG_RECEIVER_FOREGROUND) != 0;
if (DEBUG_BROADCAST_BACKGROUND) Slog.i(TAG_BROADCAST,
}
/**
- * Activity we have told the window manager to have key focus.
- */
- ActivityRecord mFocusedActivity = null;
-
- /**
- * User id of the last activity mFocusedActivity was set to.
+ * The last resumed activity. This is identical to the current resumed activity most
+ * of the time but could be different when we're pausing one activity before we resume
+ * another activity.
*/
- private int mLastFocusedUserId;
+ private ActivityRecord mLastResumedActivity;
/**
* If non-null, we are tracking the time the user spends in the currently focused app.
/**
* List of intents that were used to start the most recent tasks.
*/
- private final RecentTasks mRecentTasks;
+ final RecentTasks mRecentTasks;
/**
* For addAppTask: cached of the last activity component that was added.
*/
String mDeviceOwnerName;
+ final UserController mUserController;
+
+ final AppErrors mAppErrors;
+
+ /**
+ * Dump of the activity state at the time of the last ANR. Cleared after
+ * {@link WindowManagerService#LAST_ANR_LIFETIME_DURATION_MSECS}
+ */
+ String mLastANRState;
+
+ /**
+ * Indicates the maximum time spent waiting for the network rules to get updated.
+ */
+ @VisibleForTesting
+ long mWaitForNetworkTimeoutMs;
+
+ public boolean canShowErrorDialogs() {
+ return mShowDialogs && !mSleeping && !mShuttingDown
+ && !mKeyguardController.isKeyguardShowing(DEFAULT_DISPLAY)
+ && !(UserManager.isDeviceInDemoMode(mContext)
+ && mUserController.getCurrentUser().isDemo());
+ }
+
+ private static ThreadPriorityBooster sThreadPriorityBooster = new ThreadPriorityBooster(
+ THREAD_PRIORITY_FOREGROUND, LockGuard.INDEX_ACTIVITY);
+
+ static void boostPriorityForLockedSection() {
+ sThreadPriorityBooster.boost();
+ }
+
+ static void resetPriorityAfterLockedSection() {
+ sThreadPriorityBooster.reset();
+ }
+
public class PendingAssistExtras extends Binder implements Runnable {
public final ActivityRecord activity;
+ public boolean isHome;
public final Bundle extras;
public final Intent intent;
public final String hint;
public Bundle result = null;
public AssistStructure structure = null;
public AssistContent content = null;
+ public Bundle receiverExtras;
+
public PendingAssistExtras(ActivityRecord _activity, Bundle _extras, Intent _intent,
- String _hint, IResultReceiver _receiver, int _userHandle) {
+ String _hint, IResultReceiver _receiver, Bundle _receiverExtras, int _userHandle) {
activity = _activity;
extras = _extras;
intent = _intent;
hint = _hint;
receiver = _receiver;
+ receiverExtras = _receiverExtras;
userHandle = _userHandle;
}
+
@Override
public void run() {
Slog.w(TAG, "getAssistContextExtras failed: timeout retrieving from " + activity);
ProcessRecord mHeavyWeightProcess = null;
/**
- * The last time that various processes have crashed.
- */
- final ProcessMap<Long> mProcessCrashTimes = new ProcessMap<Long>();
-
- /**
- * Information about a process that is currently marked as bad.
+ * Non-persistent appId whitelist for background restrictions
*/
- static final class BadProcessInfo {
- BadProcessInfo(long time, String shortMsg, String longMsg, String stack) {
- this.time = time;
- this.shortMsg = shortMsg;
- this.longMsg = longMsg;
- this.stack = stack;
- }
-
- final long time;
- final String shortMsg;
- final String longMsg;
- final String stack;
- }
+ int[] mBackgroundAppIdWhitelist = new int[] {
+ BLUETOOTH_UID
+ };
/**
- * Set of applications that we consider to be bad, and will reject
- * incoming broadcasts from (which the user has no control over).
- * Processes are added to this set when they have crashed twice within
- * a minimum amount of time; they are removed from it when they are
- * later restarted (hopefully due to some user action). The value is the
- * time it was added to the list.
+ * Broadcast actions that will always be deliverable to unlaunched/background apps
*/
- final ProcessMap<BadProcessInfo> mBadProcesses = new ProcessMap<BadProcessInfo>();
+ ArraySet<String> mBackgroundLaunchBroadcasts;
/**
* All of the processes we currently have running organized by pid.
final SparseArray<ProcessRecord> mPidsSelfLocked = new SparseArray<ProcessRecord>();
/**
- * All of the processes that have been forced to be foreground. The key
+ * All of the processes that have been forced to be important. The key
* is the pid of the caller who requested it (we hold a death
* link on it).
*/
- abstract class ForegroundToken implements IBinder.DeathRecipient {
- int pid;
- IBinder token;
+ abstract class ImportanceToken implements IBinder.DeathRecipient {
+ final int pid;
+ final IBinder token;
+ final String reason;
+
+ ImportanceToken(int _pid, IBinder _token, String _reason) {
+ pid = _pid;
+ token = _token;
+ reason = _reason;
+ }
+
+ @Override
+ public String toString() {
+ return "ImportanceToken { " + Integer.toHexString(System.identityHashCode(this))
+ + " " + reason + " " + pid + " " + token + " }";
+ }
}
- final SparseArray<ForegroundToken> mForegroundProcesses = new SparseArray<ForegroundToken>();
+ final SparseArray<ImportanceToken> mImportantProcesses = new SparseArray<ImportanceToken>();
/**
* List of records for processes that someone had tried to start before the
*/
final ArrayList<ProcessRecord> mPendingPssProcesses = new ArrayList<ProcessRecord>();
+ private boolean mBinderTransactionTrackingEnabled = false;
+
/**
* Last time we requested PSS data of all processes.
*/
final SparseArray<UidRecord> mActiveUids = new SparseArray<>();
/**
- * Which users have been started, so are allowed to run code.
- */
- final SparseArray<UserState> mStartedUsers = new SparseArray<>();
-
- /**
- * LRU list of history of current users. Most recently current is at the end.
- */
- final ArrayList<Integer> mUserLru = new ArrayList<Integer>();
-
- /**
- * Constant array of the users that are currently started.
- */
- int[] mStartedUserArray = new int[] { 0 };
-
- /**
- * Registered observers of the user switching mechanics.
+ * This is for verifying the UID report flow.
*/
- final RemoteCallbackList<IUserSwitchObserver> mUserSwitchObservers
- = new RemoteCallbackList<IUserSwitchObserver>();
-
- /**
- * Currently active user switch.
- */
- Object mCurUserSwitchCallback;
+ static final boolean VALIDATE_UID_STATES = true;
+ final SparseArray<UidRecord> mValidateUids = new SparseArray<>();
/**
* Packages that the user has asked to have run in screen size
int mNesting;
long mStartTime;
+ // states of the source process when the bind occurred.
+ int mLastState = ActivityManager.MAX_PROCESS_STATE + 1;
+ long mLastStateUptime;
+ long[] mStateTimes = new long[ActivityManager.MAX_PROCESS_STATE
+ - ActivityManager.MIN_PROCESS_STATE+1];
+
Association(int sourceUid, String sourceProcess, int targetUid,
ComponentName targetComponent, String targetProcess) {
mSourceUid = sourceUid;
@Override
public String toString() {
- String result = Integer.toString(sourceUserId) + " @ " + uri.toString();
+ String result = uri.toString() + " [user " + sourceUserId + "]";
if (prefix) result += " [prefix]";
return result;
}
public String toSafeString() {
- String result = Integer.toString(sourceUserId) + " @ " + uri.toSafeString();
+ String result = uri.toSafeString() + " [user " + sourceUserId + "]";
if (prefix) result += " [prefix]";
return result;
}
CoreSettingsObserver mCoreSettingsObserver;
+ FontScaleSettingObserver mFontScaleSettingObserver;
+
+ private final class FontScaleSettingObserver extends ContentObserver {
+ private final Uri mFontScaleUri = Settings.System.getUriFor(FONT_SCALE);
+
+ public FontScaleSettingObserver() {
+ super(mHandler);
+ ContentResolver resolver = mContext.getContentResolver();
+ resolver.registerContentObserver(mFontScaleUri, false, this, UserHandle.USER_ALL);
+ }
+
+ @Override
+ public void onChange(boolean selfChange, Uri uri, @UserIdInt int userId) {
+ if (mFontScaleUri.equals(uri)) {
+ updateFontScaleIfNeeded(userId);
+ }
+ }
+ }
+
/**
* Thread-local storage used to carry caller permissions over through
* indirect content-provider access.
DeviceIdleController.LocalService mLocalDeviceIdleController;
/**
- * Information about and control over application operations
+ * Set of app ids that are whitelisted for device idle and thus background check.
*/
- final AppOpsService mAppOpsService;
+ int[] mDeviceIdleWhitelist = new int[0];
/**
- * Save recent tasks information across reboots.
+ * Set of app ids that are temporarily allowed to escape bg check due to high-pri message
*/
- final TaskPersister mTaskPersister;
+ int[] mDeviceIdleTempWhitelist = new int[0];
- /**
- * Current configuration information. HistoryRecord objects are given
- * a reference to this object to indicate which configuration they are
- * currently running in, so this object must be kept immutable.
- */
- Configuration mConfiguration = new Configuration();
+ static final class PendingTempWhitelist {
+ final int targetUid;
+ final long duration;
+ final String tag;
- /**
- * Current sequencing integer of the configuration, for skipping old
- * configurations.
- */
- int mConfigurationSeq = 0;
+ PendingTempWhitelist(int _targetUid, long _duration, String _tag) {
+ targetUid = _targetUid;
+ duration = _duration;
+ tag = _tag;
+ }
+ }
+
+ final SparseArray<PendingTempWhitelist> mPendingTempWhitelist = new SparseArray<>();
+
+ /**
+ * Information about and control over application operations
+ */
+ final AppOpsService mAppOpsService;
+
+ /** Current sequencing integer of the configuration, for skipping old configurations. */
+ private int mConfigurationSeq;
+
+ /**
+ * Temp object used when global and/or display override configuration is updated. It is also
+ * sent to outer world instead of {@link #getGlobalConfiguration} because we don't trust
+ * anyone...
+ */
+ private Configuration mTempConfig = new Configuration();
+
+ private final UpdateConfigurationResult mTmpUpdateConfigurationResult =
+ new UpdateConfigurationResult();
+ private static final class UpdateConfigurationResult {
+ // Configuration changes that were updated.
+ int changes;
+ // If the activity was relaunched to match the new configuration.
+ boolean activityRelaunched;
+
+ void reset() {
+ changes = 0;
+ activityRelaunched = false;
+ }
+ }
+
+ boolean mSuppressResizeConfigChanges;
/**
* Hardware-reported OpenGLES version.
ComponentName mTopComponent;
String mTopAction = Intent.ACTION_MAIN;
String mTopData;
- boolean mProcessesReady = false;
- boolean mSystemReady = false;
- boolean mBooting = false;
- boolean mCallFinishBooting = false;
- boolean mBootAnimationComplete = false;
- boolean mWaitingUpdate = false;
- boolean mDidUpdate = false;
- boolean mOnBattery = false;
- boolean mLaunchWarningShown = false;
- Context mContext;
+ volatile boolean mProcessesReady = false;
+ volatile boolean mSystemReady = false;
+ volatile boolean mOnBattery = false;
+ volatile int mFactoryTest;
- int mFactoryTest;
+ @GuardedBy("this") boolean mBooting = false;
+ @GuardedBy("this") boolean mCallFinishBooting = false;
+ @GuardedBy("this") boolean mBootAnimationComplete = false;
+ @GuardedBy("this") boolean mLaunchWarningShown = false;
+ @GuardedBy("this") boolean mCheckedForSetup = false;
- boolean mCheckedForSetup;
+ final Context mContext;
+
+ /**
+ * This Context is themable and meant for UI display (AlertDialogs, etc.). The theme can
+ * change at runtime. Use mContext for non-UI purposes.
+ */
+ final Context mUiContext;
/**
* The time at which we will allow normal application switches again,
boolean mDidAppSwitch;
/**
- * Last time (in realtime) at which we checked for power usage.
- */
- long mLastPowerCheckRealtime;
-
- /**
* Last time (in uptime) at which we checked for power usage.
*/
long mLastPowerCheckUptime;
/**
* Set while we are wanting to sleep, to prevent any
* activities from being started/resumed.
+ *
+ * TODO(b/33594039): Clarify the actual state transitions represented by mSleeping.
+ *
+ * Currently mSleeping is set to true when transitioning into the sleep state, and remains true
+ * while in the sleep state until there is a pending transition out of sleep, in which case
+ * mSleeping is set to false, and remains false while awake.
+ *
+ * Whether mSleeping can quickly toggled between true/false without the device actually
+ * display changing states is undefined.
*/
private boolean mSleeping = false;
* Set while we are running a voice interaction. This overrides
* sleeping while it is active.
*/
- private IVoiceInteractionSession mRunningVoice;
+ IVoiceInteractionSession mRunningVoice;
/**
* For some direct access we need to power manager.
private int mWakefulness = PowerManagerInternal.WAKEFULNESS_AWAKE;
/**
- * A list of tokens that cause the top activity to be put to sleep.
- * They are used by components that may hide and block interaction with underlying
- * activities.
- */
- final ArrayList<SleepToken> mSleepTokens = new ArrayList<SleepToken>();
-
- static final int LOCK_SCREEN_HIDDEN = 0;
- static final int LOCK_SCREEN_LEAVING = 1;
- static final int LOCK_SCREEN_SHOWN = 2;
- /**
- * State of external call telling us if the lock screen is shown.
- */
- int mLockScreenShown = LOCK_SCREEN_HIDDEN;
-
- /**
* Set if we are shutting down the system, similar to sleeping.
*/
boolean mShuttingDown = false;
= new ProcessMap<ArrayList<ProcessRecord>>();
/**
- * This is set if we had to do a delayed dexopt of an app before launching
- * it, to increase the ANR timeouts in that case.
- */
- boolean mDidDexOpt;
-
- /**
* Set if the systemServer made a call to enterSafeMode.
*/
boolean mSafeMode;
String mOrigDebugApp = null;
boolean mOrigWaitForDebugger = false;
boolean mAlwaysFinishActivities = false;
+ boolean mForceResizableActivities;
+ /**
+ * Flag that indicates if multi-window is enabled.
+ *
+ * For any particular form of multi-window to be enabled, generic multi-window must be enabled
+ * in {@link com.android.internal.R.bool#config_supportsMultiWindow} config or
+ * {@link Settings.Global#DEVELOPMENT_FORCE_RESIZABLE_ACTIVITIES} development option set.
+ * At least one of the forms of multi-window must be enabled in order for this flag to be
+ * initialized to 'true'.
+ *
+ * @see #mSupportsSplitScreenMultiWindow
+ * @see #mSupportsFreeformWindowManagement
+ * @see #mSupportsPictureInPicture
+ * @see #mSupportsMultiDisplay
+ */
+ boolean mSupportsMultiWindow;
+ boolean mSupportsSplitScreenMultiWindow;
+ boolean mSupportsFreeformWindowManagement;
+ boolean mSupportsPictureInPicture;
+ boolean mSupportsMultiDisplay;
+ boolean mSupportsLeanbackOnly;
IActivityController mController = null;
+ boolean mControllerIsAMonkey = false;
String mProfileApp = null;
ProcessRecord mProfileProc = null;
- String mProfileFile;
- ParcelFileDescriptor mProfileFd;
- int mSamplingInterval = 0;
- boolean mAutoStopProfiler = false;
+ ProfilerInfo mProfilerInfo = null;
int mProfileType = 0;
- String mOpenGlTraceApp = null;
final ProcessMap<Pair<Long, String>> mMemWatchProcesses = new ProcessMap<>();
String mMemWatchDumpProcName;
String mMemWatchDumpFile;
int mMemWatchDumpPid;
int mMemWatchDumpUid;
+ String mTrackAllocationApp = null;
+ String mNativeDebuggingApp = null;
- final long[] mTmpLong = new long[1];
+ final long[] mTmpLong = new long[2];
+
+ private final ArraySet<BroadcastQueue> mTmpBroadcastQueue = new ArraySet();
+
+ /**
+ * A global counter for generating sequence numbers.
+ * This value will be used when incrementing sequence numbers in individual uidRecords.
+ *
+ * Having a global counter ensures that seq numbers are monotonically increasing for a
+ * particular uid even when the uidRecord is re-created.
+ */
+ @GuardedBy("this")
+ @VisibleForTesting
+ long mProcStateSeqCounter = 0;
+
+ private final Injector mInjector;
static final class ProcessChangeItem {
static final int CHANGE_ACTIVITIES = 1<<0;
- static final int CHANGE_PROCESS_STATE = 1<<1;
int changes;
int uid;
int pid;
boolean foregroundActivities;
}
+ static final class UidObserverRegistration {
+ final int uid;
+ final String pkg;
+ final int which;
+ final int cutpoint;
+
+ final SparseIntArray lastProcStates;
+
+ UidObserverRegistration(int _uid, String _pkg, int _which, int _cutpoint) {
+ uid = _uid;
+ pkg = _pkg;
+ which = _which;
+ cutpoint = _cutpoint;
+ if (cutpoint >= ActivityManager.MIN_PROCESS_STATE) {
+ lastProcStates = new SparseIntArray();
+ } else {
+ lastProcStates = null;
+ }
+ }
+ }
+
final RemoteCallbackList<IProcessObserver> mProcessObservers = new RemoteCallbackList<>();
ProcessChangeItem[] mActiveProcessChanges = new ProcessChangeItem[5];
final ArrayList<UidRecord.ChangeItem> mPendingUidChanges = new ArrayList<>();
final ArrayList<UidRecord.ChangeItem> mAvailUidChanges = new ArrayList<>();
+ OomAdjObserver mCurOomAdjObserver;
+ int mCurOomAdjUid;
+
+ interface OomAdjObserver {
+ void onOomAdjMessage(String msg);
+ }
+
/**
* Runtime CPU use collection thread. This object's lock is used to
* perform synchronization with the thread (notifying it to run).
MONITOR_THREAD_CPU_USAGE);
final AtomicLong mLastCpuTime = new AtomicLong(0);
final AtomicBoolean mProcessCpuMutexFree = new AtomicBoolean(true);
+ final CountDownLatch mProcessCpuInitLatch = new CountDownLatch(1);
long mLastWriteTime = 0;
*/
boolean mBooted = false;
- int mProcessLimit = ProcessList.MAX_CACHED_APPS;
- int mProcessLimitOverride = -1;
-
WindowManagerService mWindowManager;
-
final ActivityThread mSystemThread;
- // Holds the current foreground user's id
- int mCurrentUserId = 0;
- // Holds the target user's id during a user switch
- int mTargetUserId = UserHandle.USER_NULL;
- // If there are multiple profiles for the current user, their ids are here
- // Currently only the primary user can have managed profiles
- int[] mCurrentProfileIds = new int[] {UserHandle.USER_OWNER}; // Accessed by ActivityStack
-
- /**
- * Mapping from each known user ID to the profile group ID it is associated with.
- */
- SparseIntArray mUserProfileGroupIdsSelfLocked = new SparseIntArray();
-
- private UserManagerService mUserManager;
-
private final class AppDeathRecipient implements IBinder.DeathRecipient {
final ProcessRecord mApp;
final int mPid;
}
}
- static final int SHOW_ERROR_MSG = 1;
- static final int SHOW_NOT_RESPONDING_MSG = 2;
- static final int SHOW_FACTORY_ERROR_MSG = 3;
+ static final int SHOW_ERROR_UI_MSG = 1;
+ static final int SHOW_NOT_RESPONDING_UI_MSG = 2;
+ static final int SHOW_FACTORY_ERROR_UI_MSG = 3;
static final int UPDATE_CONFIGURATION_MSG = 4;
static final int GC_BACKGROUND_PROCESSES_MSG = 5;
- static final int WAIT_FOR_DEBUGGER_MSG = 6;
+ static final int WAIT_FOR_DEBUGGER_UI_MSG = 6;
static final int SERVICE_TIMEOUT_MSG = 12;
static final int UPDATE_TIME_ZONE = 13;
- static final int SHOW_UID_ERROR_MSG = 14;
- static final int SHOW_FINGERPRINT_ERROR_MSG = 15;
+ static final int SHOW_UID_ERROR_UI_MSG = 14;
+ static final int SHOW_FINGERPRINT_ERROR_UI_MSG = 15;
static final int PROC_START_TIMEOUT_MSG = 20;
static final int DO_PENDING_ACTIVITY_LAUNCHES_MSG = 21;
static final int KILL_APPLICATION_MSG = 22;
static final int FINALIZE_PENDING_INTENT_MSG = 23;
static final int POST_HEAVY_NOTIFICATION_MSG = 24;
static final int CANCEL_HEAVY_NOTIFICATION_MSG = 25;
- static final int SHOW_STRICT_MODE_VIOLATION_MSG = 26;
- static final int CHECK_EXCESSIVE_WAKE_LOCKS_MSG = 27;
+ static final int SHOW_STRICT_MODE_VIOLATION_UI_MSG = 26;
+ static final int CHECK_EXCESSIVE_POWER_USE_MSG = 27;
static final int CLEAR_DNS_CACHE_MSG = 28;
static final int UPDATE_HTTP_PROXY_MSG = 29;
- static final int SHOW_COMPAT_MODE_DIALOG_MSG = 30;
- static final int DISPATCH_PROCESSES_CHANGED = 31;
- static final int DISPATCH_PROCESS_DIED = 32;
+ static final int SHOW_COMPAT_MODE_DIALOG_UI_MSG = 30;
+ static final int DISPATCH_PROCESSES_CHANGED_UI_MSG = 31;
+ static final int DISPATCH_PROCESS_DIED_UI_MSG = 32;
static final int REPORT_MEM_USAGE_MSG = 33;
static final int REPORT_USER_SWITCH_MSG = 34;
static final int CONTINUE_USER_SWITCH_MSG = 35;
static final int PERSIST_URI_GRANTS_MSG = 38;
static final int REQUEST_ALL_PSS_MSG = 39;
static final int START_PROFILES_MSG = 40;
- static final int UPDATE_TIME = 41;
+ static final int UPDATE_TIME_PREFERENCE_MSG = 41;
static final int SYSTEM_USER_START_MSG = 42;
static final int SYSTEM_USER_CURRENT_MSG = 43;
static final int ENTER_ANIMATION_COMPLETE_MSG = 44;
static final int FINISH_BOOTING_MSG = 45;
- static final int START_USER_SWITCH_MSG = 46;
+ static final int START_USER_SWITCH_UI_MSG = 46;
static final int SEND_LOCALE_TO_MOUNT_DAEMON_MSG = 47;
- static final int DISMISS_DIALOG_MSG = 48;
- static final int NOTIFY_TASK_STACK_CHANGE_LISTENERS_MSG = 49;
- static final int NOTIFY_CLEARTEXT_NETWORK_MSG = 50;
- static final int POST_DUMP_HEAP_NOTIFICATION_MSG = 51;
- static final int DELETE_DUMPHEAP_MSG = 52;
- static final int FOREGROUND_PROFILE_CHANGED_MSG = 53;
- static final int DISPATCH_UIDS_CHANGED_MSG = 54;
- static final int REPORT_TIME_TRACKER_MSG = 55;
- static final int REPORT_USER_SWITCH_COMPLETE_MSG = 56;
- static final int SHUTDOWN_UI_AUTOMATION_CONNECTION_MSG = 57;
- static final int APP_BOOST_DEACTIVATE_MSG = 58;
- static final int CONTENT_PROVIDER_PUBLISH_TIMEOUT_MSG = 59;
+ static final int DISMISS_DIALOG_UI_MSG = 48;
+ static final int NOTIFY_CLEARTEXT_NETWORK_MSG = 49;
+ static final int POST_DUMP_HEAP_NOTIFICATION_MSG = 50;
+ static final int DELETE_DUMPHEAP_MSG = 51;
+ static final int FOREGROUND_PROFILE_CHANGED_MSG = 52;
+ static final int DISPATCH_UIDS_CHANGED_UI_MSG = 53;
+ static final int REPORT_TIME_TRACKER_MSG = 54;
+ static final int REPORT_USER_SWITCH_COMPLETE_MSG = 55;
+ static final int SHUTDOWN_UI_AUTOMATION_CONNECTION_MSG = 56;
+ static final int CONTENT_PROVIDER_PUBLISH_TIMEOUT_MSG = 57;
+ static final int IDLE_UIDS_MSG = 58;
+ static final int SYSTEM_USER_UNLOCK_MSG = 59;
+ static final int LOG_STACK_STATE = 60;
+ static final int VR_MODE_CHANGE_MSG = 61;
+ static final int SHOW_UNSUPPORTED_DISPLAY_SIZE_DIALOG_MSG = 62;
+ static final int HANDLE_TRUST_STORAGE_UPDATE_MSG = 63;
+ static final int REPORT_LOCKED_BOOT_COMPLETE_MSG = 64;
+ static final int NOTIFY_VR_SLEEPING_MSG = 65;
+ static final int SERVICE_FOREGROUND_TIMEOUT_MSG = 66;
+ static final int DISPATCH_PENDING_INTENT_CANCEL_MSG = 67;
+ static final int PUSH_TEMP_WHITELIST_UI_MSG = 68;
+ static final int SERVICE_FOREGROUND_CRASH_MSG = 69;
+ static final int DISPATCH_OOM_ADJ_OBSERVER_MSG = 70;
+ static final int START_USER_SWITCH_FG_MSG = 712;
+ static final int NOTIFY_VR_KEYGUARD_MSG = 74;
static final int FIRST_ACTIVITY_STACK_MSG = 100;
static final int FIRST_BROADCAST_QUEUE_MSG = 200;
static final int FIRST_COMPAT_MODE_MSG = 300;
static final int FIRST_SUPERVISOR_STACK_MSG = 100;
+ static ServiceThread sKillThread = null;
+ static KillHandler sKillHandler = null;
+
CompatModeDialog mCompatModeDialog;
+ UnsupportedDisplaySizeDialog mUnsupportedDisplaySizeDialog;
long mLastMemUsageReportTime = 0;
/**
/** The dimensions of the thumbnails in the Recents UI. */
int mThumbnailWidth;
int mThumbnailHeight;
+ float mFullscreenThumbnailScale;
final ServiceThread mHandlerThread;
final MainHandler mHandler;
- final UiHandler mUiHandler;
+ final Handler mUiHandler;
+
+ final ActivityManagerConstants mConstants;
+
+ PackageManagerInternal mPackageManagerInt;
+
+ // VoiceInteraction session ID that changes for each new request except when
+ // being called for multiwindow assist in a single session.
+ private int mViSessionId = 1000;
+
+ final boolean mPermissionReviewRequired;
+
+ private static String sTheRealBuildSerial = Build.UNKNOWN;
+
+ /**
+ * Current global configuration information. Contains general settings for the entire system,
+ * also corresponds to the merged configuration of the default display.
+ */
+ Configuration getGlobalConfiguration() {
+ return mStackSupervisor.getConfiguration();
+ }
+
+ final class KillHandler extends Handler {
+ static final int KILL_PROCESS_GROUP_MSG = 4000;
+
+ public KillHandler(Looper looper) {
+ super(looper, null, true);
+ }
+
+ @Override
+ public void handleMessage(Message msg) {
+ switch (msg.what) {
+ case KILL_PROCESS_GROUP_MSG:
+ {
+ Trace.traceBegin(Trace.TRACE_TAG_ACTIVITY_MANAGER, "killProcessGroup");
+ Process.killProcessGroup(msg.arg1 /* uid */, msg.arg2 /* pid */);
+ Trace.traceEnd(Trace.TRACE_TAG_ACTIVITY_MANAGER);
+ }
+ break;
+
+ default:
+ super.handleMessage(msg);
+ }
+ }
+ }
final class UiHandler extends Handler {
public UiHandler() {
@Override
public void handleMessage(Message msg) {
switch (msg.what) {
- case SHOW_ERROR_MSG: {
- HashMap<String, Object> data = (HashMap<String, Object>) msg.obj;
- boolean showBackground = Settings.Secure.getInt(mContext.getContentResolver(),
- Settings.Secure.ANR_SHOW_BACKGROUND, 0) != 0;
- synchronized (ActivityManagerService.this) {
- ProcessRecord proc = (ProcessRecord)data.get("app");
- AppErrorResult res = (AppErrorResult) data.get("result");
- if (proc != null && proc.crashDialog != null) {
- Slog.e(TAG, "App already has crash dialog: " + proc);
- if (res != null) {
- res.set(0);
- }
- return;
- }
- boolean isBackground = (UserHandle.getAppId(proc.uid)
- >= Process.FIRST_APPLICATION_UID
- && proc.pid != MY_PID);
- for (int userId : mCurrentProfileIds) {
- isBackground &= (proc.userId != userId);
- }
- if (isBackground && !showBackground) {
- Slog.w(TAG, "Skipping crash dialog of " + proc + ": background");
- if (res != null) {
- res.set(0);
- }
- return;
- }
- if (mShowDialogs && !mSleeping && !mShuttingDown) {
- Dialog d = new AppErrorDialog(mContext,
- ActivityManagerService.this, res, proc);
- d.show();
- proc.crashDialog = d;
- } else {
- // The device is asleep, so just pretend that the user
- // saw a crash dialog and hit "force quit".
- if (res != null) {
- res.set(0);
- }
- }
- }
-
+ case SHOW_ERROR_UI_MSG: {
+ mAppErrors.handleShowAppErrorUi(msg);
ensureBootCompleted();
} break;
- case SHOW_NOT_RESPONDING_MSG: {
- synchronized (ActivityManagerService.this) {
- HashMap<String, Object> data = (HashMap<String, Object>) msg.obj;
- ProcessRecord proc = (ProcessRecord)data.get("app");
- if (proc != null && proc.anrDialog != null) {
- Slog.e(TAG, "App already has anr dialog: " + proc);
- return;
- }
-
- Intent intent = new Intent("android.intent.action.ANR");
- if (!mProcessesReady) {
- intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY
- | Intent.FLAG_RECEIVER_FOREGROUND);
- }
- broadcastIntentLocked(null, null, intent,
- null, null, 0, null, null, null, AppOpsManager.OP_NONE,
- null, false, false, MY_PID, Process.SYSTEM_UID, 0 /* TODO: Verify */);
-
- if (mShowDialogs) {
- Dialog d = new AppNotRespondingDialog(ActivityManagerService.this,
- mContext, proc, (ActivityRecord)data.get("activity"),
- msg.arg1 != 0);
- d.show();
- proc.anrDialog = d;
- } else {
- // Just kill the app if there is no dialog to be shown.
- killAppAtUsersRequest(proc, null);
- }
- }
-
+ case SHOW_NOT_RESPONDING_UI_MSG: {
+ mAppErrors.handleShowAnrUi(msg);
ensureBootCompleted();
} break;
- case SHOW_STRICT_MODE_VIOLATION_MSG: {
+ case SHOW_STRICT_MODE_VIOLATION_UI_MSG: {
HashMap<String, Object> data = (HashMap<String, Object>) msg.obj;
synchronized (ActivityManagerService.this) {
ProcessRecord proc = (ProcessRecord) data.get("app");
}
AppErrorResult res = (AppErrorResult) data.get("result");
if (mShowDialogs && !mSleeping && !mShuttingDown) {
- Dialog d = new StrictModeViolationDialog(mContext,
+ Dialog d = new StrictModeViolationDialog(mUiContext,
ActivityManagerService.this, res, proc);
d.show();
proc.crashDialog = d;
}
ensureBootCompleted();
} break;
- case SHOW_FACTORY_ERROR_MSG: {
+ case SHOW_FACTORY_ERROR_UI_MSG: {
Dialog d = new FactoryErrorDialog(
- mContext, msg.getData().getCharSequence("msg"));
+ mUiContext, msg.getData().getCharSequence("msg"));
d.show();
ensureBootCompleted();
} break;
- case WAIT_FOR_DEBUGGER_MSG: {
+ case WAIT_FOR_DEBUGGER_UI_MSG: {
synchronized (ActivityManagerService.this) {
ProcessRecord app = (ProcessRecord)msg.obj;
if (msg.arg1 != 0) {
if (!app.waitedForDebugger) {
Dialog d = new AppWaitingForDebuggerDialog(
ActivityManagerService.this,
- mContext, app);
+ mUiContext, app);
app.waitDialog = d;
app.waitedForDebugger = true;
d.show();
}
}
} break;
- case SHOW_UID_ERROR_MSG: {
+ case SHOW_UID_ERROR_UI_MSG: {
if (mShowDialogs) {
- AlertDialog d = new BaseErrorDialog(mContext);
+ AlertDialog d = new BaseErrorDialog(mUiContext);
d.getWindow().setType(WindowManager.LayoutParams.TYPE_SYSTEM_ERROR);
d.setCancelable(false);
- d.setTitle(mContext.getText(R.string.android_system_label));
- d.setMessage(mContext.getText(R.string.system_error_wipe_data));
- d.setButton(DialogInterface.BUTTON_POSITIVE, mContext.getText(R.string.ok),
- obtainMessage(DISMISS_DIALOG_MSG, d));
+ d.setTitle(mUiContext.getText(R.string.android_system_label));
+ d.setMessage(mUiContext.getText(R.string.system_error_wipe_data));
+ d.setButton(DialogInterface.BUTTON_POSITIVE, mUiContext.getText(R.string.ok),
+ obtainMessage(DISMISS_DIALOG_UI_MSG, d));
d.show();
}
} break;
- case SHOW_FINGERPRINT_ERROR_MSG: {
+ case SHOW_FINGERPRINT_ERROR_UI_MSG: {
if (mShowDialogs) {
- AlertDialog d = new BaseErrorDialog(mContext);
+ AlertDialog d = new BaseErrorDialog(mUiContext);
d.getWindow().setType(WindowManager.LayoutParams.TYPE_SYSTEM_ERROR);
d.setCancelable(false);
- d.setTitle(mContext.getText(R.string.android_system_label));
- d.setMessage(mContext.getText(R.string.system_error_manufacturer));
- d.setButton(DialogInterface.BUTTON_POSITIVE, mContext.getText(R.string.ok),
- obtainMessage(DISMISS_DIALOG_MSG, d));
+ d.setTitle(mUiContext.getText(R.string.android_system_label));
+ d.setMessage(mUiContext.getText(R.string.system_error_manufacturer));
+ d.setButton(DialogInterface.BUTTON_POSITIVE, mUiContext.getText(R.string.ok),
+ obtainMessage(DISMISS_DIALOG_UI_MSG, d));
d.show();
}
} break;
- case SHOW_COMPAT_MODE_DIALOG_MSG: {
+ case SHOW_COMPAT_MODE_DIALOG_UI_MSG: {
synchronized (ActivityManagerService.this) {
ActivityRecord ar = (ActivityRecord) msg.obj;
if (mCompatModeDialog != null) {
if (mode == ActivityManager.COMPAT_MODE_DISABLED
|| mode == ActivityManager.COMPAT_MODE_ENABLED) {
mCompatModeDialog = new CompatModeDialog(
- ActivityManagerService.this, mContext,
+ ActivityManagerService.this, mUiContext,
ar.info.applicationInfo);
mCompatModeDialog.show();
}
}
break;
}
- case START_USER_SWITCH_MSG: {
- showUserSwitchDialog(msg.arg1, (String) msg.obj);
+ case SHOW_UNSUPPORTED_DISPLAY_SIZE_DIALOG_MSG: {
+ synchronized (ActivityManagerService.this) {
+ final ActivityRecord ar = (ActivityRecord) msg.obj;
+ if (mUnsupportedDisplaySizeDialog != null) {
+ mUnsupportedDisplaySizeDialog.dismiss();
+ mUnsupportedDisplaySizeDialog = null;
+ }
+ if (ar != null && mCompatModePackages.getPackageNotifyUnsupportedZoomLocked(
+ ar.packageName)) {
+ // TODO(multi-display): Show dialog on appropriate display.
+ mUnsupportedDisplaySizeDialog = new UnsupportedDisplaySizeDialog(
+ ActivityManagerService.this, mUiContext, ar.info.applicationInfo);
+ mUnsupportedDisplaySizeDialog.show();
+ }
+ }
+ break;
+ }
+ case START_USER_SWITCH_UI_MSG: {
+ mUserController.showUserSwitchDialog((Pair<UserInfo, UserInfo>) msg.obj);
break;
}
- case DISMISS_DIALOG_MSG: {
+ case DISMISS_DIALOG_UI_MSG: {
final Dialog d = (Dialog) msg.obj;
d.dismiss();
break;
}
- case DISPATCH_PROCESSES_CHANGED: {
+ case DISPATCH_PROCESSES_CHANGED_UI_MSG: {
dispatchProcessesChanged();
break;
}
- case DISPATCH_PROCESS_DIED: {
+ case DISPATCH_PROCESS_DIED_UI_MSG: {
final int pid = msg.arg1;
final int uid = msg.arg2;
dispatchProcessDied(pid, uid);
break;
}
- case DISPATCH_UIDS_CHANGED_MSG: {
+ case DISPATCH_UIDS_CHANGED_UI_MSG: {
dispatchUidsChanged();
} break;
+ case DISPATCH_OOM_ADJ_OBSERVER_MSG: {
+ dispatchOomAdjObserver((String)msg.obj);
+ } break;
+ case PUSH_TEMP_WHITELIST_UI_MSG: {
+ pushTempWhitelist();
+ } break;
}
}
}
switch (msg.what) {
case UPDATE_CONFIGURATION_MSG: {
final ContentResolver resolver = mContext.getContentResolver();
- Settings.System.putConfiguration(resolver, (Configuration) msg.obj);
+ Settings.System.putConfigurationForUser(resolver, (Configuration) msg.obj,
+ msg.arg1);
} break;
case GC_BACKGROUND_PROCESSES_MSG: {
synchronized (ActivityManagerService.this) {
}
} break;
case SERVICE_TIMEOUT_MSG: {
- if (mDidDexOpt) {
- mDidDexOpt = false;
- Message nmsg = mHandler.obtainMessage(SERVICE_TIMEOUT_MSG);
- nmsg.obj = msg.obj;
- mHandler.sendMessageDelayed(nmsg, ActiveServices.SERVICE_TIMEOUT);
- return;
- }
mServices.serviceTimeout((ProcessRecord)msg.obj);
} break;
+ case SERVICE_FOREGROUND_TIMEOUT_MSG: {
+ mServices.serviceForegroundTimeout((ServiceRecord)msg.obj);
+ } break;
+ case SERVICE_FOREGROUND_CRASH_MSG: {
+ mServices.serviceForegroundCrash((ProcessRecord)msg.obj);
+ } break;
+ case DISPATCH_PENDING_INTENT_CANCEL_MSG: {
+ RemoteCallbackList<IResultReceiver> callbacks
+ = (RemoteCallbackList<IResultReceiver>)msg.obj;
+ int N = callbacks.beginBroadcast();
+ for (int i = 0; i < N; i++) {
+ try {
+ callbacks.getBroadcastItem(i).send(Activity.RESULT_CANCELED, null);
+ } catch (RemoteException e) {
+ }
+ }
+ callbacks.finishBroadcast();
+ } break;
case UPDATE_TIME_ZONE: {
synchronized (ActivityManagerService.this) {
for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) {
}
} break;
case PROC_START_TIMEOUT_MSG: {
- if (mDidDexOpt) {
- mDidDexOpt = false;
- Message nmsg = mHandler.obtainMessage(PROC_START_TIMEOUT_MSG);
- nmsg.obj = msg.obj;
- mHandler.sendMessageDelayed(nmsg, PROC_START_TIMEOUT);
- return;
- }
ProcessRecord app = (ProcessRecord)msg.obj;
synchronized (ActivityManagerService.this) {
processStartTimedOutLocked(app);
} break;
case DO_PENDING_ACTIVITY_LAUNCHES_MSG: {
synchronized (ActivityManagerService.this) {
- mStackSupervisor.doPendingActivityLaunchesLocked(true);
+ mActivityStarter.doPendingActivityLaunchesLocked(true);
}
} break;
case KILL_APPLICATION_MSG: {
synchronized (ActivityManagerService.this) {
- int appid = msg.arg1;
- boolean restart = (msg.arg2 == 1);
+ final int appId = msg.arg1;
+ final int userId = msg.arg2;
Bundle bundle = (Bundle)msg.obj;
String pkg = bundle.getString("pkg");
String reason = bundle.getString("reason");
- forceStopPackageLocked(pkg, appid, restart, false, true, false,
- false, UserHandle.USER_ALL, reason);
+ forceStopPackageLocked(pkg, appId, false, false, true, false,
+ false, userId, reason);
}
} break;
case FINALIZE_PENDING_INTENT_MSG: {
Context context = mContext.createPackageContext(process.info.packageName, 0);
String text = mContext.getString(R.string.heavy_weight_notification,
context.getApplicationInfo().loadLabel(context.getPackageManager()));
- Notification notification = new Notification.Builder(context)
+ Notification notification =
+ new Notification.Builder(context, SystemNotificationChannels.DEVELOPER)
.setSmallIcon(com.android.internal.R.drawable.stat_sys_adb)
.setWhen(0)
.setOngoing(true)
new UserHandle(root.userId)))
.build();
try {
- int[] outId = new int[1];
inm.enqueueNotificationWithTag("android", "android", null,
- R.string.heavy_weight_notification,
- notification, outId, root.userId);
+ SystemMessage.NOTE_HEAVY_WEIGHT_NOTIFICATION,
+ notification, root.userId);
} catch (RuntimeException e) {
Slog.w(ActivityManagerService.TAG,
"Error showing notification for heavy-weight app", e);
}
try {
inm.cancelNotificationWithTag("android", null,
- R.string.heavy_weight_notification, msg.arg1);
+ SystemMessage.NOTE_HEAVY_WEIGHT_NOTIFICATION, msg.arg1);
} catch (RuntimeException e) {
Slog.w(ActivityManagerService.TAG,
"Error canceling notification for service", e);
} catch (RemoteException e) {
}
} break;
- case CHECK_EXCESSIVE_WAKE_LOCKS_MSG: {
+ case CHECK_EXCESSIVE_POWER_USE_MSG: {
synchronized (ActivityManagerService.this) {
- checkExcessivePowerUsageLocked(true);
- removeMessages(CHECK_EXCESSIVE_WAKE_LOCKS_MSG);
- Message nmsg = obtainMessage(CHECK_EXCESSIVE_WAKE_LOCKS_MSG);
- sendMessageDelayed(nmsg, POWER_CHECK_DELAY);
+ checkExcessivePowerUsageLocked();
+ removeMessages(CHECK_EXCESSIVE_POWER_USE_MSG);
+ Message nmsg = obtainMessage(CHECK_EXCESSIVE_POWER_USE_MSG);
+ sendMessageDelayed(nmsg, mConstants.POWER_CHECK_INTERVAL);
}
} break;
case REPORT_MEM_USAGE_MSG: {
thread.start();
break;
}
+ case START_USER_SWITCH_FG_MSG: {
+ mUserController.startUserInForeground(msg.arg1);
+ break;
+ }
case REPORT_USER_SWITCH_MSG: {
- dispatchUserSwitch((UserState) msg.obj, msg.arg1, msg.arg2);
+ mUserController.dispatchUserSwitch((UserState) msg.obj, msg.arg1, msg.arg2);
break;
}
case CONTINUE_USER_SWITCH_MSG: {
- continueUserSwitch((UserState) msg.obj, msg.arg1, msg.arg2);
+ mUserController.continueUserSwitch((UserState) msg.obj, msg.arg1, msg.arg2);
break;
}
case USER_SWITCH_TIMEOUT_MSG: {
- timeoutUserSwitch((UserState) msg.obj, msg.arg1, msg.arg2);
+ mUserController.timeoutUserSwitch((UserState) msg.obj, msg.arg1, msg.arg2);
break;
}
case IMMERSIVE_MODE_LOCK_MSG: {
}
case START_PROFILES_MSG: {
synchronized (ActivityManagerService.this) {
- startProfilesLocked();
+ mUserController.startProfilesLocked();
}
break;
}
- case UPDATE_TIME: {
+ case UPDATE_TIME_PREFERENCE_MSG: {
+ // The user's time format preference might have changed.
+ // For convenience we re-use the Intent extra values.
synchronized (ActivityManagerService.this) {
- for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) {
+ for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
ProcessRecord r = mLruProcesses.get(i);
if (r.thread != null) {
try {
- r.thread.updateTimePrefs(msg.arg1 == 0 ? false : true);
+ r.thread.updateTimePrefs(msg.arg1);
} catch (RemoteException ex) {
- Slog.w(TAG, "Failed to update preferences for: " + r.info.processName);
+ Slog.w(TAG, "Failed to update preferences for: "
+ + r.info.processName);
}
}
}
mSystemServiceManager.startUser(msg.arg1);
break;
}
+ case SYSTEM_USER_UNLOCK_MSG: {
+ final int userId = msg.arg1;
+ mSystemServiceManager.unlockUser(userId);
+ synchronized (ActivityManagerService.this) {
+ mRecentTasks.loadUserRecentsLocked(userId);
+ }
+ if (userId == UserHandle.USER_SYSTEM) {
+ startPersistentApps(PackageManager.MATCH_DIRECT_BOOT_UNAWARE);
+ }
+ installEncryptionUnawareProviders(userId);
+ mUserController.finishUserUnlocked((UserState) msg.obj);
+ break;
+ }
case SYSTEM_USER_CURRENT_MSG: {
mBatteryStatsService.noteEvent(
BatteryStats.HistoryItem.EVENT_USER_FOREGROUND_FINISH,
}
case FINISH_BOOTING_MSG: {
if (msg.arg1 != 0) {
+ Trace.traceBegin(Trace.TRACE_TAG_ACTIVITY_MANAGER, "FinishBooting");
finishBooting();
+ Trace.traceEnd(Trace.TRACE_TAG_ACTIVITY_MANAGER);
}
if (msg.arg2 != 0) {
enableScreenAfterBoot();
try {
Locale l = (Locale) msg.obj;
IBinder service = ServiceManager.getService("mount");
- IMountService mountService = IMountService.Stub.asInterface(service);
+ IStorageManager storageManager = IStorageManager.Stub.asInterface(service);
Log.d(TAG, "Storing locale " + l.toLanguageTag() + " for decryption UI");
- mountService.setField(StorageManager.SYSTEM_LOCALE_KEY, l.toLanguageTag());
+ storageManager.setField(StorageManager.SYSTEM_LOCALE_KEY, l.toLanguageTag());
} catch (RemoteException e) {
Log.e(TAG, "Error storing locale for decryption UI", e);
}
break;
}
- case NOTIFY_TASK_STACK_CHANGE_LISTENERS_MSG: {
- synchronized (ActivityManagerService.this) {
- int i = mTaskStackListeners.beginBroadcast();
- while (i > 0) {
- i--;
- try {
- // Make a one-way callback to the listener
- mTaskStackListeners.getBroadcastItem(i).onTaskStackChanged();
- } catch (RemoteException e){
- // Handled by the RemoteCallbackList
- }
- }
- mTaskStackListeners.finishBroadcast();
- }
- break;
- }
case NOTIFY_CLEARTEXT_NETWORK_MSG: {
final int uid = msg.arg1;
final byte[] firstPacket = (byte[]) msg.obj;
intent.putExtra(DumpHeapActivity.KEY_DIRECT_LAUNCH, reportPackage);
}
int userId = UserHandle.getUserId(uid);
- Notification notification = new Notification.Builder(mContext)
+ Notification notification =
+ new Notification.Builder(mContext, SystemNotificationChannels.DEVELOPER)
.setSmallIcon(com.android.internal.R.drawable.stat_sys_adb)
.setWhen(0)
.setOngoing(true)
intent, PendingIntent.FLAG_CANCEL_CURRENT, null,
new UserHandle(userId)))
.setDeleteIntent(PendingIntent.getBroadcastAsUser(mContext, 0,
- deleteIntent, 0, UserHandle.OWNER))
+ deleteIntent, 0, UserHandle.SYSTEM))
.build();
try {
- int[] outId = new int[1];
inm.enqueueNotificationWithTag("android", "android", null,
- R.string.dump_heap_notification,
- notification, outId, userId);
+ SystemMessage.NOTE_DUMP_HEAP_NOTIFICATION,
+ notification, userId);
} catch (RuntimeException e) {
Slog.w(ActivityManagerService.TAG,
"Error showing notification for dump heap", e);
} break;
case DELETE_DUMPHEAP_MSG: {
revokeUriPermission(ActivityThread.currentActivityThread().getApplicationThread(),
- DumpHeapActivity.JAVA_URI,
+ null, DumpHeapActivity.JAVA_URI,
Intent.FLAG_GRANT_READ_URI_PERMISSION
| Intent.FLAG_GRANT_WRITE_URI_PERMISSION,
UserHandle.myUserId());
}
} break;
case FOREGROUND_PROFILE_CHANGED_MSG: {
- dispatchForegroundProfileChanged(msg.arg1);
+ mUserController.dispatchForegroundProfileChanged(msg.arg1);
} break;
case REPORT_TIME_TRACKER_MSG: {
AppTimeTracker tracker = (AppTimeTracker)msg.obj;
tracker.deliverResult(mContext);
} break;
case REPORT_USER_SWITCH_COMPLETE_MSG: {
- dispatchUserSwitchComplete(msg.arg1);
+ mUserController.dispatchUserSwitchComplete(msg.arg1);
+ } break;
+ case REPORT_LOCKED_BOOT_COMPLETE_MSG: {
+ mUserController.dispatchLockedBootComplete(msg.arg1);
} break;
case SHUTDOWN_UI_AUTOMATION_CONNECTION_MSG: {
IUiAutomationConnection connection = (IUiAutomationConnection) msg.obj;
// it is finished we make sure it is reset to its default.
mUserIsMonkey = false;
} break;
- case APP_BOOST_DEACTIVATE_MSG : {
- synchronized(ActivityManagerService.this) {
- if (mIsBoosted) {
- if (mBoostStartTime < (SystemClock.uptimeMillis() - APP_BOOST_TIMEOUT)) {
- nativeMigrateFromBoost();
- mIsBoosted = false;
- mBoostStartTime = 0;
- } else {
- Message newmsg = mHandler.obtainMessage(APP_BOOST_DEACTIVATE_MSG);
- mHandler.sendMessageDelayed(newmsg, APP_BOOST_TIMEOUT);
+ case IDLE_UIDS_MSG: {
+ idleUids();
+ } break;
+ case VR_MODE_CHANGE_MSG: {
+ if (!mVrController.onVrModeChanged((ActivityRecord) msg.obj)) {
+ return;
+ }
+ synchronized (ActivityManagerService.this) {
+ final boolean disableNonVrUi = mVrController.shouldDisableNonVrUiLocked();
+ mWindowManager.disableNonVrUi(disableNonVrUi);
+ if (disableNonVrUi) {
+ // If we are in a VR mode where Picture-in-Picture mode is unsupported,
+ // then remove the pinned stack.
+ final PinnedActivityStack pinnedStack = mStackSupervisor.getStack(
+ PINNED_STACK_ID);
+ if (pinnedStack != null) {
+ mStackSupervisor.removeStackLocked(PINNED_STACK_ID);
+ }
+ }
+ }
+ } break;
+ case NOTIFY_VR_SLEEPING_MSG: {
+ notifyVrManagerOfSleepState(msg.arg1 != 0);
+ } break;
+ case NOTIFY_VR_KEYGUARD_MSG: {
+ notifyVrManagerOfKeyguardState(msg.arg1 != 0);
+ } break;
+ case HANDLE_TRUST_STORAGE_UPDATE_MSG: {
+ synchronized (ActivityManagerService.this) {
+ for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) {
+ ProcessRecord r = mLruProcesses.get(i);
+ if (r.thread != null) {
+ try {
+ r.thread.handleTrustStorageUpdate();
+ } catch (RemoteException ex) {
+ Slog.w(TAG, "Failed to handle trust storage update for: " +
+ r.info.processName);
+ }
}
}
}
if (memInfo != null) {
updateCpuStatsNow();
long nativeTotalPss = 0;
+ final List<ProcessCpuTracker.Stats> stats;
synchronized (mProcessCpuTracker) {
- final int N = mProcessCpuTracker.countStats();
- for (int j=0; j<N; j++) {
- ProcessCpuTracker.Stats st = mProcessCpuTracker.getStats(j);
- if (st.vsize <= 0 || st.uid >= Process.FIRST_APPLICATION_UID) {
- // This is definitely an application process; skip it.
+ stats = mProcessCpuTracker.getStats( (st)-> {
+ return st.vsize > 0 && st.uid < FIRST_APPLICATION_UID;
+ });
+ }
+ final int N = stats.size();
+ for (int j = 0; j < N; j++) {
+ synchronized (mPidsSelfLocked) {
+ if (mPidsSelfLocked.indexOfKey(stats.get(j).pid) >= 0) {
+ // This is one of our own processes; skip it.
continue;
}
- synchronized (mPidsSelfLocked) {
- if (mPidsSelfLocked.indexOfKey(st.pid) >= 0) {
- // This is one of our own processes; skip it.
- continue;
- }
- }
- nativeTotalPss += Debug.getPss(st.pid, null, null);
}
+ nativeTotalPss += Debug.getPss(stats.get(j).pid, null, null);
}
memInfo.readMemInfo();
synchronized (ActivityManagerService.this) {
}
int num = 0;
- long[] tmp = new long[1];
+ long[] tmp = new long[2];
do {
ProcessRecord proc;
int procState;
if (pss != 0 && proc.thread != null && proc.setProcState == procState
&& proc.pid == pid && proc.lastPssTime == lastPssTime) {
num++;
- recordPssSampleLocked(proc, procState, pss, tmp[0],
+ recordPssSampleLocked(proc, procState, pss, tmp[0], tmp[1],
SystemClock.uptimeMillis());
}
}
ServiceManager.addService("processinfo", new ProcessInfoService(this));
ApplicationInfo info = mContext.getPackageManager().getApplicationInfo(
- "android", STOCK_PM_FLAGS);
+ "android", STOCK_PM_FLAGS | MATCH_SYSTEM_ONLY);
mSystemThread.installSystemApplicationInfo(info, getClass().getClassLoader());
synchronized (this) {
public void setWindowManager(WindowManagerService wm) {
mWindowManager = wm;
mStackSupervisor.setWindowManager(wm);
+ mActivityStarter.setWindowManager(wm);
}
public void setUsageStatsManager(UsageStatsManagerInternal usageStatsManager) {
@Override
protected void dump(FileDescriptor fd, PrintWriter pw, String[] args) {
- if (mActivityManagerService.checkCallingPermission(android.Manifest.permission.DUMP)
- != PackageManager.PERMISSION_GRANTED) {
- pw.println("Permission Denial: can't dump meminfo from from pid="
- + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid()
- + " without permission " + android.Manifest.permission.DUMP);
- return;
- }
-
+ if (!DumpUtils.checkDumpAndUsageStatsPermission(mActivityManagerService.mContext,
+ "meminfo", pw)) return;
mActivityManagerService.dumpApplicationMemoryUsage(fd, pw, " ", args, false, null);
}
}
@Override
protected void dump(FileDescriptor fd, PrintWriter pw, String[] args) {
- if (mActivityManagerService.checkCallingPermission(android.Manifest.permission.DUMP)
- != PackageManager.PERMISSION_GRANTED) {
- pw.println("Permission Denial: can't dump gfxinfo from from pid="
- + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid()
- + " without permission " + android.Manifest.permission.DUMP);
- return;
- }
-
+ if (!DumpUtils.checkDumpAndUsageStatsPermission(mActivityManagerService.mContext,
+ "gfxinfo", pw)) return;
mActivityManagerService.dumpGraphicsHardwareUsage(fd, pw, args);
}
}
@Override
protected void dump(FileDescriptor fd, PrintWriter pw, String[] args) {
- if (mActivityManagerService.checkCallingPermission(android.Manifest.permission.DUMP)
- != PackageManager.PERMISSION_GRANTED) {
- pw.println("Permission Denial: can't dump dbinfo from from pid="
- + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid()
- + " without permission " + android.Manifest.permission.DUMP);
- return;
- }
-
+ if (!DumpUtils.checkDumpAndUsageStatsPermission(mActivityManagerService.mContext,
+ "dbinfo", pw)) return;
mActivityManagerService.dumpDbInfo(fd, pw, args);
}
}
@Override
protected void dump(FileDescriptor fd, PrintWriter pw, String[] args) {
- if (mActivityManagerService.checkCallingPermission(android.Manifest.permission.DUMP)
- != PackageManager.PERMISSION_GRANTED) {
- pw.println("Permission Denial: can't dump cpuinfo from from pid="
- + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid()
- + " without permission " + android.Manifest.permission.DUMP);
- return;
- }
-
+ if (!DumpUtils.checkDumpAndUsageStatsPermission(mActivityManagerService.mContext,
+ "cpuinfo", pw)) return;
synchronized (mActivityManagerService.mProcessCpuTracker) {
pw.print(mActivityManagerService.mProcessCpuTracker.printCurrentLoad());
pw.print(mActivityManagerService.mProcessCpuTracker.printCurrentState(
mService.start();
}
+ @Override
+ public void onCleanupUser(int userId) {
+ mService.mBatteryStatsService.onCleanupUser(userId);
+ }
+
public ActivityManagerService getService() {
return mService;
}
}
+ @VisibleForTesting
+ public ActivityManagerService(Injector injector) {
+ mInjector = injector;
+ mContext = mInjector.getContext();
+ mUiContext = null;
+ GL_ES_VERSION = 0;
+ mActivityStarter = null;
+ mAppErrors = null;
+ mAppOpsService = mInjector.getAppOpsService(null, null);
+ mBatteryStatsService = null;
+ mCompatModePackages = null;
+ mConstants = null;
+ mGrantFile = null;
+ mHandler = null;
+ mHandlerThread = null;
+ mIntentFirewall = null;
+ mKeyguardController = null;
+ mPermissionReviewRequired = false;
+ mProcessCpuThread = null;
+ mProcessStats = null;
+ mProviderMap = null;
+ mRecentTasks = null;
+ mServices = null;
+ mStackSupervisor = null;
+ mSystemThread = null;
+ mTaskChangeNotificationController = null;
+ mUiHandler = injector.getUiHandler(null);
+ mUserController = null;
+ mVrController = null;
+ }
+
// Note: This method is invoked on the main thread but may need to attach various
// handlers to other threads. So take care to be explicit about the looper.
public ActivityManagerService(Context systemContext) {
+ LockGuard.installLock(this, LockGuard.INDEX_ACTIVITY);
+ mInjector = new Injector();
mContext = systemContext;
+
mFactoryTest = FactoryTest.getMode();
mSystemThread = ActivityThread.currentActivityThread();
+ mUiContext = mSystemThread.getSystemUiContext();
Slog.i(TAG, "Memory class: " + ActivityManager.staticGetMemoryClass());
+ mPermissionReviewRequired = mContext.getResources().getBoolean(
+ com.android.internal.R.bool.config_permissionReviewRequired);
+
mHandlerThread = new ServiceThread(TAG,
- android.os.Process.THREAD_PRIORITY_FOREGROUND, false /*allowIo*/);
+ THREAD_PRIORITY_FOREGROUND, false /*allowIo*/);
mHandlerThread.start();
mHandler = new MainHandler(mHandlerThread.getLooper());
- mUiHandler = new UiHandler();
+ mUiHandler = mInjector.getUiHandler(this);
+
+ mConstants = new ActivityManagerConstants(this, mHandler);
+
+ /* static; one-time init here */
+ if (sKillHandler == null) {
+ sKillThread = new ServiceThread(TAG + ":kill",
+ THREAD_PRIORITY_BACKGROUND, true /* allowIo */);
+ sKillThread.start();
+ sKillHandler = new KillHandler(sKillThread.getLooper());
+ }
mFgBroadcastQueue = new BroadcastQueue(this, mHandler,
"foreground", BROADCAST_FG_TIMEOUT, false);
mServices = new ActiveServices(this);
mProviderMap = new ProviderMap(this);
+ mAppErrors = new AppErrors(mUiContext, this);
// TODO: Move creation of battery stats service outside of activity manager service.
File dataDir = Environment.getDataDirectory();
File systemDir = new File(dataDir, "system");
systemDir.mkdirs();
- mBatteryStatsService = new BatteryStatsService(systemDir, mHandler);
+ mBatteryStatsService = new BatteryStatsService(systemContext, systemDir, mHandler);
mBatteryStatsService.getActiveStatistics().readLocked();
mBatteryStatsService.scheduleWriteToDisk();
mOnBattery = DEBUG_POWER ? true
mProcessStats = new ProcessStatsService(this, new File(systemDir, "procstats"));
- mAppOpsService = new AppOpsService(new File(systemDir, "appops.xml"), mHandler);
+ mAppOpsService = mInjector.getAppOpsService(new File(systemDir, "appops.xml"), mHandler);
+ mAppOpsService.startWatchingMode(AppOpsManager.OP_RUN_IN_BACKGROUND, null,
+ new IAppOpsCallback.Stub() {
+ @Override public void opChanged(int op, int uid, String packageName) {
+ if (op == AppOpsManager.OP_RUN_IN_BACKGROUND && packageName != null) {
+ if (mAppOpsService.checkOperation(op, uid, packageName)
+ != AppOpsManager.MODE_ALLOWED) {
+ runInBackgroundDisabled(uid);
+ }
+ }
+ }
+ });
mGrantFile = new AtomicFile(new File(systemDir, "urigrants.xml"));
- // User 0 is the first and only user that runs at boot.
- mStartedUsers.put(UserHandle.USER_OWNER, new UserState(UserHandle.OWNER, true));
- mUserLru.add(UserHandle.USER_OWNER);
- updateStartedUserArrayLocked();
+ mUserController = new UserController(this);
+
+ mVrController = new VrController(this);
GL_ES_VERSION = SystemProperties.getInt("ro.opengles.version",
ConfigurationInfo.GL_ES_VERSION_UNDEFINED);
- mTrackingAssociations = "1".equals(SystemProperties.get("debug.track-associations"));
-
- mConfiguration.setToDefaults();
- mConfiguration.setLocale(Locale.getDefault());
-
- mConfigurationSeq = mConfiguration.seq = 1;
- mProcessCpuTracker.init();
+ if (SystemProperties.getInt("sys.use_fifo_ui", 0) != 0) {
+ mUseFifoUiScheduling = true;
+ }
+ mTrackingAssociations = "1".equals(SystemProperties.get("debug.track-associations"));
+ mTempConfig.setToDefaults();
+ mTempConfig.setLocales(LocaleList.getDefault());
+ mConfigurationSeq = mTempConfig.seq = 1;
+ mStackSupervisor = createStackSupervisor();
+ mStackSupervisor.onConfigurationChanged(mTempConfig);
+ mKeyguardController = mStackSupervisor.mKeyguardController;
mCompatModePackages = new CompatModePackages(this, systemDir, mHandler);
mIntentFirewall = new IntentFirewall(new IntentFirewallInterface(), mHandler);
- mRecentTasks = new RecentTasks(this);
- mStackSupervisor = new ActivityStackSupervisor(this, mRecentTasks);
- mTaskPersister = new TaskPersister(systemDir, mStackSupervisor, mRecentTasks);
+ mTaskChangeNotificationController =
+ new TaskChangeNotificationController(this, mStackSupervisor, mHandler);
+ mActivityStarter = new ActivityStarter(this, mStackSupervisor);
+ mRecentTasks = new RecentTasks(this, mStackSupervisor);
mProcessCpuThread = new Thread("CpuTracker") {
@Override
public void run() {
+ synchronized (mProcessCpuTracker) {
+ mProcessCpuInitLatch.countDown();
+ mProcessCpuTracker.init();
+ }
while (true) {
try {
try {
Watchdog.getInstance().addThread(mHandler);
}
+ protected ActivityStackSupervisor createStackSupervisor() {
+ return new ActivityStackSupervisor(this, mHandler.getLooper());
+ }
+
public void setSystemServiceManager(SystemServiceManager mgr) {
mSystemServiceManager = mgr;
}
}
private void start() {
- Process.removeAllProcessGroups();
+ removeAllProcessGroups();
mProcessCpuThread.start();
- mBatteryStatsService.publish(mContext);
+ mBatteryStatsService.publish();
mAppOpsService.publish(mContext);
Slog.d("AppOps", "AppOpsService published");
LocalServices.addService(ActivityManagerInternal.class, new LocalService());
+ // Wait for the synchronized block started in mProcessCpuThread,
+ // so that any other acccess to mProcessCpuTracker from main thread
+ // will be blocked during mProcessCpuTracker initialization.
+ try {
+ mProcessCpuInitLatch.await();
+ } catch (InterruptedException e) {
+ Slog.wtf(TAG, "Interrupted wait during start", e);
+ Thread.currentThread().interrupt();
+ throw new IllegalStateException("Interrupted wait during start");
+ }
+ }
+
+ void onUserStoppedLocked(int userId) {
+ mRecentTasks.unloadUserDataFromMemoryLocked(userId);
}
public void initPowerManagement() {
mVoiceWakeLock.setReferenceCounted(false);
}
+ private ArraySet<String> getBackgroundLaunchBroadcasts() {
+ if (mBackgroundLaunchBroadcasts == null) {
+ mBackgroundLaunchBroadcasts = SystemConfig.getInstance().getAllowImplicitBroadcasts();
+ }
+ return mBackgroundLaunchBroadcasts;
+ }
+
@Override
public boolean onTransact(int code, Parcel data, Parcel reply, int flags)
throws RemoteException {
for (int i=0; i<N; i++) {
Parcel data2 = Parcel.obtain();
try {
- procs.get(i).transact(IBinder.SYSPROPS_TRANSACTION, data2, null, 0);
+ procs.get(i).transact(IBinder.SYSPROPS_TRANSACTION, data2, null,
+ Binder.FLAG_ONEWAY);
} catch (RemoteException e) {
}
data2.recycle();
// The activity manager only throws security exceptions, so let's
// log all others.
if (!(e instanceof SecurityException)) {
- Slog.wtf(TAG, "Activity Manager Crash", e);
+ Slog.wtf(TAG, "Activity Manager Crash."
+ + " UID:" + Binder.getCallingUid()
+ + " PID:" + Binder.getCallingPid()
+ + " TRANS:" + code, e);
}
throw e;
}
}
ps.addCpuTimeLocked(st.rel_utime, st.rel_stime);
pr.curCpuTime += st.rel_utime + st.rel_stime;
+ if (pr.lastCpuTime == 0) {
+ pr.lastCpuTime = pr.curCpuTime;
+ }
} else {
BatteryStatsImpl.Uid.Proc ps = st.batteryStats;
if (ps == null || !ps.isActive()) {
@Override
public void batterySendBroadcast(Intent intent) {
- broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null,
- AppOpsManager.OP_NONE, null, false, false,
- -1, Process.SYSTEM_UID, UserHandle.USER_ALL);
+ synchronized (this) {
+ broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null,
+ AppOpsManager.OP_NONE, null, false, false,
+ -1, SYSTEM_UID, UserHandle.USER_ALL);
+ }
}
/**
return mAppBindArgs;
}
- final void setFocusedActivityLocked(ActivityRecord r, String reason) {
- if (r != null && mFocusedActivity != r) {
- if (DEBUG_FOCUS) Slog.d(TAG_FOCUS, "setFocusedActivityLocked: r=" + r);
- ActivityRecord last = mFocusedActivity;
- mFocusedActivity = r;
- if (r.task.taskType != ActivityRecord.HOME_ACTIVITY_TYPE
- && r.task.taskType != ActivityRecord.RECENTS_ACTIVITY_TYPE) {
- if (mCurAppTimeTracker != r.appTimeTracker) {
- // We are switching app tracking. Complete the current one.
- if (mCurAppTimeTracker != null) {
- mCurAppTimeTracker.stop();
- mHandler.obtainMessage(REPORT_TIME_TRACKER_MSG,
- mCurAppTimeTracker).sendToTarget();
- mStackSupervisor.clearOtherAppTimeTrackers(r.appTimeTracker);
- mCurAppTimeTracker = null;
- }
- if (r.appTimeTracker != null) {
- mCurAppTimeTracker = r.appTimeTracker;
- startTimeTrackingFocusedActivityLocked();
- }
- } else {
+ /**
+ * Update AMS states when an activity is resumed. This should only be called by
+ * {@link ActivityStack#setResumedActivityLocked} when an activity is resumed.
+ */
+ void setResumedActivityUncheckLocked(ActivityRecord r, String reason) {
+ final TaskRecord task = r.getTask();
+ if (task.isApplicationTask()) {
+ if (mCurAppTimeTracker != r.appTimeTracker) {
+ // We are switching app tracking. Complete the current one.
+ if (mCurAppTimeTracker != null) {
+ mCurAppTimeTracker.stop();
+ mHandler.obtainMessage(
+ REPORT_TIME_TRACKER_MSG, mCurAppTimeTracker).sendToTarget();
+ mStackSupervisor.clearOtherAppTimeTrackers(r.appTimeTracker);
+ mCurAppTimeTracker = null;
+ }
+ if (r.appTimeTracker != null) {
+ mCurAppTimeTracker = r.appTimeTracker;
startTimeTrackingFocusedActivityLocked();
}
} else {
- r.appTimeTracker = null;
+ startTimeTrackingFocusedActivityLocked();
}
- if (r.task != null && r.task.voiceInteractor != null) {
- startRunningVoiceLocked(r.task.voiceSession, r.info.applicationInfo.uid);
- } else {
- finishRunningVoiceLocked();
- if (last != null && last.task.voiceSession != null) {
+ } else {
+ r.appTimeTracker = null;
+ }
+ // TODO: VI Maybe r.task.voiceInteractor || r.voiceInteractor != null
+ // TODO: Probably not, because we don't want to resume voice on switching
+ // back to this activity
+ if (task.voiceInteractor != null) {
+ startRunningVoiceLocked(task.voiceSession, r.info.applicationInfo.uid);
+ } else {
+ finishRunningVoiceLocked();
+
+ if (mLastResumedActivity != null) {
+ final IVoiceInteractionSession session;
+
+ final TaskRecord lastResumedActivityTask = mLastResumedActivity.getTask();
+ if (lastResumedActivityTask != null
+ && lastResumedActivityTask.voiceSession != null) {
+ session = lastResumedActivityTask.voiceSession;
+ } else {
+ session = mLastResumedActivity.voiceSession;
+ }
+
+ if (session != null) {
// We had been in a voice interaction session, but now focused has
// move to something different. Just finish the session, we can't
// return to it and retain the proper state and synchronization with
// the voice interaction service.
- finishVoiceTask(last.task.voiceSession);
+ finishVoiceTask(session);
}
}
- if (mStackSupervisor.setFocusedStack(r, reason + " setFocusedActivity")) {
- mWindowManager.setFocusedApp(r.appToken, true);
- }
- applyUpdateLockStateLocked(r);
- if (mFocusedActivity.userId != mLastFocusedUserId) {
- mHandler.removeMessages(FOREGROUND_PROFILE_CHANGED_MSG);
- mHandler.sendMessage(mHandler.obtainMessage(FOREGROUND_PROFILE_CHANGED_MSG,
- mFocusedActivity.userId, 0));
- mLastFocusedUserId = mFocusedActivity.userId;
- }
}
- EventLog.writeEvent(EventLogTags.AM_FOCUSED_ACTIVITY,
- mFocusedActivity == null ? -1 : mFocusedActivity.userId,
- mFocusedActivity == null ? "NULL" : mFocusedActivity.shortComponentName);
- }
- final void clearFocusedActivity(ActivityRecord r) {
- if (mFocusedActivity == r) {
- ActivityStack stack = mStackSupervisor.getFocusedStack();
- if (stack != null) {
- ActivityRecord top = stack.topActivity();
- if (top != null && top.userId != mLastFocusedUserId) {
- mHandler.removeMessages(FOREGROUND_PROFILE_CHANGED_MSG);
- mHandler.sendMessage(mHandler.obtainMessage(FOREGROUND_PROFILE_CHANGED_MSG,
- top.userId, 0));
- mLastFocusedUserId = top.userId;
- }
- }
- mFocusedActivity = null;
- EventLog.writeEvent(EventLogTags.AM_FOCUSED_ACTIVITY, -1, "NULL");
+ if (mLastResumedActivity != null && r.userId != mLastResumedActivity.userId) {
+ mHandler.removeMessages(FOREGROUND_PROFILE_CHANGED_MSG);
+ mHandler.obtainMessage(
+ FOREGROUND_PROFILE_CHANGED_MSG, r.userId, 0).sendToTarget();
}
+ mLastResumedActivity = r;
+
+ mWindowManager.setFocusedApp(r.appToken, true);
+
+ applyUpdateLockStateLocked(r);
+ applyUpdateVrModeLocked(r);
+
+ EventLogTags.writeAmSetResumedActivity(
+ r == null ? -1 : r.userId,
+ r == null ? "NULL" : r.shortComponentName,
+ reason);
}
@Override
public void setFocusedStack(int stackId) {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "setFocusedStack()");
if (DEBUG_FOCUS) Slog.d(TAG_FOCUS, "setFocusedStack: stackId=" + stackId);
- synchronized (ActivityManagerService.this) {
- ActivityStack stack = mStackSupervisor.getStack(stackId);
- if (stack != null) {
- ActivityRecord r = stack.topRunningActivityLocked(null);
- if (r != null) {
- setFocusedActivityLocked(r, "setFocusedStack");
- mStackSupervisor.resumeTopActivitiesLocked(stack, null, null);
+ final long callingId = Binder.clearCallingIdentity();
+ try {
+ synchronized (this) {
+ final ActivityStack stack = mStackSupervisor.getStack(stackId);
+ if (stack == null) {
+ return;
+ }
+ final ActivityRecord r = stack.topRunningActivityLocked();
+ if (mStackSupervisor.moveFocusableActivityStackToFrontLocked(r, "setFocusedStack")) {
+ mStackSupervisor.resumeFocusedStackTopActivityLocked();
}
}
+ } finally {
+ Binder.restoreCallingIdentity(callingId);
}
}
- /** Sets the task stack listener that gets callbacks when a task stack changes. */
@Override
- public void registerTaskStackListener(ITaskStackListener listener) throws RemoteException {
- synchronized (ActivityManagerService.this) {
- if (listener != null) {
- mTaskStackListeners.register(listener);
+ public void setFocusedTask(int taskId) {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "setFocusedTask()");
+ if (DEBUG_FOCUS) Slog.d(TAG_FOCUS, "setFocusedTask: taskId=" + taskId);
+ final long callingId = Binder.clearCallingIdentity();
+ try {
+ synchronized (this) {
+ final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId);
+ if (task == null) {
+ return;
+ }
+ final ActivityRecord r = task.topRunningActivityLocked();
+ if (mStackSupervisor.moveFocusableActivityStackToFrontLocked(r, "setFocusedTask")) {
+ mStackSupervisor.resumeFocusedStackTopActivityLocked();
+ }
}
+ } finally {
+ Binder.restoreCallingIdentity(callingId);
}
}
+ /** Sets the task stack listener that gets callbacks when a task stack changes. */
+ @Override
+ public void registerTaskStackListener(ITaskStackListener listener) throws RemoteException {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "registerTaskStackListener()");
+ mTaskChangeNotificationController.registerTaskStackListener(listener);
+ }
+
+ /**
+ * Unregister a task stack listener so that it stops receiving callbacks.
+ */
+ @Override
+ public void unregisterTaskStackListener(ITaskStackListener listener) throws RemoteException {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "unregisterTaskStackListener()");
+ mTaskChangeNotificationController.unregisterTaskStackListener(listener);
+ }
+
@Override
public void notifyActivityDrawn(IBinder token) {
if (DEBUG_VISIBILITY) Slog.d(TAG_VISIBILITY, "notifyActivityDrawn: token=" + token);
synchronized (this) {
ActivityRecord r = mStackSupervisor.isInAnyStackLocked(token);
if (r != null) {
- r.task.stack.notifyActivityDrawnLocked(r);
+ r.getStack().notifyActivityDrawnLocked(r);
}
}
}
mHandler.obtainMessage(IMMERSIVE_MODE_LOCK_MSG, (nextState) ? 1 : 0, 0, r));
}
+ final void applyUpdateVrModeLocked(ActivityRecord r) {
+ // VR apps are expected to run in a main display. If an app is turning on VR for
+ // itself, but lives in a dynamic stack, then make sure that it is moved to the main
+ // fullscreen stack before enabling VR Mode.
+ // TODO: The goal of this code is to keep the VR app on the main display. When the
+ // stack implementation changes in the future, keep in mind that the use of the fullscreen
+ // stack is a means to move the activity to the main display and a moveActivityToDisplay()
+ // option would be a better choice here.
+ if (r.requestedVrComponent != null && r.getStackId() >= FIRST_DYNAMIC_STACK_ID) {
+ Slog.i(TAG, "Moving " + r.shortComponentName + " from stack " + r.getStackId()
+ + " to main stack for VR");
+ moveTaskToStack(r.getTask().taskId, FULLSCREEN_WORKSPACE_STACK_ID, true /* toTop */);
+ }
+ mHandler.sendMessage(
+ mHandler.obtainMessage(VR_MODE_CHANGE_MSG, 0, 0, r));
+ }
+
+ private void sendNotifyVrManagerOfSleepState(boolean isSleeping) {
+ mHandler.sendMessage(
+ mHandler.obtainMessage(NOTIFY_VR_SLEEPING_MSG, isSleeping ? 1 : 0, 0));
+ }
+
+ private void notifyVrManagerOfSleepState(boolean isSleeping) {
+ final VrManagerInternal vrService = LocalServices.getService(VrManagerInternal.class);
+ if (vrService == null) {
+ return;
+ }
+ vrService.onSleepStateChanged(isSleeping);
+ }
+
+ private void sendNotifyVrManagerOfKeyguardState(boolean isShowing) {
+ mHandler.sendMessage(
+ mHandler.obtainMessage(NOTIFY_VR_KEYGUARD_MSG, isShowing ? 1 : 0, 0));
+ }
+
+ private void notifyVrManagerOfKeyguardState(boolean isShowing) {
+ final VrManagerInternal vrService = LocalServices.getService(VrManagerInternal.class);
+ if (vrService == null) {
+ return;
+ }
+ vrService.onKeyguardStateChanged(isShowing);
+ }
+
final void showAskCompatModeDialogLocked(ActivityRecord r) {
Message msg = Message.obtain();
- msg.what = SHOW_COMPAT_MODE_DIALOG_MSG;
- msg.obj = r.task.askedCompatMode ? null : r;
+ msg.what = SHOW_COMPAT_MODE_DIALOG_UI_MSG;
+ msg.obj = r.getTask().askedCompatMode ? null : r;
mUiHandler.sendMessage(msg);
}
+ final void showUnsupportedZoomDialogIfNeededLocked(ActivityRecord r) {
+ final Configuration globalConfig = getGlobalConfiguration();
+ if (globalConfig.densityDpi != DisplayMetrics.DENSITY_DEVICE_STABLE
+ && r.appInfo.requiresSmallestWidthDp > globalConfig.smallestScreenWidthDp) {
+ final Message msg = Message.obtain();
+ msg.what = SHOW_UNSUPPORTED_DISPLAY_SIZE_DIALOG_MSG;
+ msg.obj = r;
+ mUiHandler.sendMessage(msg);
+ }
+ }
+
private int updateLruProcessInternalLocked(ProcessRecord app, long now, int index,
String what, Object obj, ProcessRecord srcApp) {
app.lastActivityTime = now;
return index;
}
- private static void killProcessGroup(int uid, int pid) {
- Trace.traceBegin(Trace.TRACE_TAG_ACTIVITY_MANAGER, "killProcessGroup");
- Process.killProcessGroup(uid, pid);
- Trace.traceEnd(Trace.TRACE_TAG_ACTIVITY_MANAGER);
+ static void killProcessGroup(int uid, int pid) {
+ if (sKillHandler != null) {
+ sKillHandler.sendMessage(
+ sKillHandler.obtainMessage(KillHandler.KILL_PROCESS_GROUP_MSG, uid, pid));
+ } else {
+ Slog.w(TAG, "Asked to kill process group before system bringup!");
+ Process.killProcessGroup(uid, pid);
+ }
}
final void removeLruProcessLocked(ProcessRecord app) {
if (lrui >= 0) {
if (!app.killed) {
Slog.wtfStack(TAG, "Removing process that hasn't been killed: " + app);
- Process.killProcessQuiet(app.pid);
+ killProcessQuiet(app.pid);
killProcessGroup(app.uid, app.pid);
}
if (lrui <= mLruProcessActivityStart) {
}
final ProcessRecord getProcessRecordLocked(String processName, int uid, boolean keepIfLarge) {
- if (uid == Process.SYSTEM_UID) {
+ if (uid == SYSTEM_UID) {
// The system gets to run in any process. If there are multiple
// processes with the same uid, just pick the first (this
// should never happen).
final int procCount = procs.size();
for (int i = 0; i < procCount; i++) {
final int procUid = procs.keyAt(i);
- if (UserHandle.isApp(procUid) || !UserHandle.isSameUser(procUid, uid)) {
+ if (UserHandle.isApp(procUid) || !UserHandle.isSameUser(procUid, uid)
+ || UserHandle.isIsolated(procUid)) {
// Don't use an app process or different user process for system component.
continue;
}
return proc;
}
- void ensurePackageDexOpt(String packageName) {
- IPackageManager pm = AppGlobals.getPackageManager();
- try {
- if (pm.performDexOptIfNeeded(packageName, null /* instruction set */)) {
- mDidDexOpt = true;
- }
- } catch (RemoteException e) {
+ void notifyPackageUse(String packageName, int reason) {
+ synchronized(this) {
+ getPackageManagerInternalLocked().notifyPackageUse(packageName, reason);
}
}
boolean isNextTransitionForward() {
int transit = mWindowManager.getPendingAppTransition();
- return transit == AppTransition.TRANSIT_ACTIVITY_OPEN
- || transit == AppTransition.TRANSIT_TASK_OPEN
- || transit == AppTransition.TRANSIT_TASK_TO_FRONT;
+ return transit == TRANSIT_ACTIVITY_OPEN
+ || transit == TRANSIT_TASK_OPEN
+ || transit == TRANSIT_TASK_TO_FRONT;
}
int startIsolatedProcess(String entryPoint, String[] entryPointArgs,
// closest thing to a parent's uid is SYSTEM_UID.
// The only important thing here is to keep AI.uid != PR.uid, in order to trigger
// the |isolated| logic in the ProcessRecord constructor.
- info.uid = Process.SYSTEM_UID;
+ info.uid = SYSTEM_UID;
info.processName = processName;
info.className = entryPoint;
info.packageName = "android";
+ info.seInfoUser = SELinuxUtil.COMPLETE_STR;
ProcessRecord proc = startProcessLocked(processName, info /* info */,
false /* knownToBeDead */, 0 /* intentFlags */, "" /* hostingType */,
null /* hostingName */, true /* allowWhileBooting */, true /* isolated */,
if ((intentFlags & Intent.FLAG_FROM_BACKGROUND) != 0) {
// If we are in the background, then check to see if this process
// is bad. If so, we will just silently fail.
- if (mBadProcesses.get(info.processName, info.uid) != null) {
+ if (mAppErrors.isBadProcessLocked(info)) {
if (DEBUG_PROCESSES) Slog.v(TAG, "Bad process: " + info.uid
+ "/" + info.processName);
return null;
// if it had been bad.
if (DEBUG_PROCESSES) Slog.v(TAG, "Clearing bad process: " + info.uid
+ "/" + info.processName);
- mProcessCrashTimes.remove(info.processName, info.uid);
- if (mBadProcesses.get(info.processName, info.uid) != null) {
+ mAppErrors.resetProcessCrashTimeLocked(info);
+ if (mAppErrors.isBadProcessLocked(info)) {
EventLog.writeEvent(EventLogTags.AM_PROC_GOOD,
UserHandle.getUserId(info.uid), info.uid,
info.processName);
- mBadProcesses.remove(info.processName, info.uid);
+ mAppErrors.clearBadProcessLocked(info);
if (app != null) {
app.bad = false;
}
app = null;
}
- // app launch boost for big.little configurations
- // use cpusets to migrate freshly launched tasks to big cores
- synchronized(ActivityManagerService.this) {
- nativeMigrateToBoost();
- mIsBoosted = true;
- mBoostStartTime = SystemClock.uptimeMillis();
- Message msg = mHandler.obtainMessage(APP_BOOST_DEACTIVATE_MSG);
- mHandler.sendMessageDelayed(msg, APP_BOOST_MESSAGE_DELAY);
- }
-
// We don't have to do anything more if:
// (1) There is an existing application record; and
// (2) The caller doesn't think it is dead, OR there is no thread
+ " thread=" + (app != null ? app.thread : null)
+ " pid=" + (app != null ? app.pid : -1));
if (app != null && app.pid > 0) {
- if (!knownToBeDead || app.thread == null) {
+ if ((!knownToBeDead && !app.killed) || app.thread == null) {
// We already have the app running, or are waiting for it to
// come up (we have a pid but not yet its thread), so keep it.
if (DEBUG_PROCESSES) Slog.v(TAG_PROCESSES, "App already running: " + app);
try {
try {
- if (AppGlobals.getPackageManager().isPackageFrozen(app.info.packageName)) {
- // This is caught below as if we had failed to fork zygote
- throw new RuntimeException("Package " + app.info.packageName + " is frozen!");
- }
+ final int userId = UserHandle.getUserId(app.uid);
+ AppGlobals.getPackageManager().checkPackageStartable(app.info.packageName, userId);
} catch (RemoteException e) {
throw e.rethrowAsRuntimeException();
}
try {
checkTime(startTime, "startProcess: getting gids from package manager");
final IPackageManager pm = AppGlobals.getPackageManager();
- permGids = pm.getPackageGids(app.info.packageName, app.userId);
- MountServiceInternal mountServiceInternal = LocalServices.getService(
- MountServiceInternal.class);
- mountExternal = mountServiceInternal.getExternalStorageMountMode(uid,
+ permGids = pm.getPackageGids(app.info.packageName,
+ MATCH_DEBUG_TRIAGED_MISSING, app.userId);
+ StorageManagerInternal storageManagerInternal = LocalServices.getService(
+ StorageManagerInternal.class);
+ mountExternal = storageManagerInternal.getExternalStorageMountMode(uid,
app.info.packageName);
} catch (RemoteException e) {
throw e.rethrowAsRuntimeException();
* resources like shared libraries and access user-wide resources
*/
if (ArrayUtils.isEmpty(permGids)) {
- gids = new int[2];
+ gids = new int[3];
} else {
- gids = new int[permGids.length + 2];
- System.arraycopy(permGids, 0, gids, 2, permGids.length);
+ gids = new int[permGids.length + 3];
+ System.arraycopy(permGids, 0, gids, 3, permGids.length);
}
gids[0] = UserHandle.getSharedAppGid(UserHandle.getAppId(uid));
- gids[1] = UserHandle.getUserGid(UserHandle.getUserId(uid));
+ gids[1] = UserHandle.getCacheAppGid(UserHandle.getAppId(uid));
+ gids[2] = UserHandle.getUserGid(UserHandle.getUserId(uid));
}
checkTime(startTime, "startProcess: building args");
if (mFactoryTest != FactoryTest.FACTORY_TEST_OFF) {
}
int debugFlags = 0;
if ((app.info.flags & ApplicationInfo.FLAG_DEBUGGABLE) != 0) {
- debugFlags |= Zygote.DEBUG_ENABLE_DEBUGGER;
+ debugFlags |= Zygote.DEBUG_ENABLE_JDWP;
+ debugFlags |= Zygote.DEBUG_JAVA_DEBUGGABLE;
// Also turn on CheckJNI for debuggable apps. It's quite
// awkward to turn on otherwise.
debugFlags |= Zygote.DEBUG_ENABLE_CHECKJNI;
if ("1".equals(SystemProperties.get("debug.checkjni"))) {
debugFlags |= Zygote.DEBUG_ENABLE_CHECKJNI;
}
- String jitDebugProperty = SystemProperties.get("debug.usejit");
- if ("true".equals(jitDebugProperty)) {
- debugFlags |= Zygote.DEBUG_ENABLE_JIT;
- } else if (!"false".equals(jitDebugProperty)) {
- // If we didn't force disable by setting false, defer to the dalvik vm options.
- if ("true".equals(SystemProperties.get("dalvik.vm.usejit"))) {
- debugFlags |= Zygote.DEBUG_ENABLE_JIT;
- }
- }
String genDebugInfoProperty = SystemProperties.get("debug.generate-debug-info");
if ("true".equals(genDebugInfoProperty)) {
debugFlags |= Zygote.DEBUG_GENERATE_DEBUG_INFO;
if ("1".equals(SystemProperties.get("debug.assert"))) {
debugFlags |= Zygote.DEBUG_ENABLE_ASSERT;
}
+ if (mNativeDebuggingApp != null && mNativeDebuggingApp.equals(app.processName)) {
+ // Enable all debug flags required by the native debugger.
+ debugFlags |= Zygote.DEBUG_ALWAYS_JIT; // Don't interpret anything
+ debugFlags |= Zygote.DEBUG_GENERATE_DEBUG_INFO; // Generate debug info
+ debugFlags |= Zygote.DEBUG_NATIVE_DEBUGGABLE; // Disbale optimizations
+ mNativeDebuggingApp = null;
+ }
+
+ String invokeWith = null;
+ if ((app.info.flags & ApplicationInfo.FLAG_DEBUGGABLE) != 0) {
+ // Debuggable apps may include a wrapper script with their library directory.
+ String wrapperFileName = app.info.nativeLibraryDir + "/wrap.sh";
+ StrictMode.ThreadPolicy oldPolicy = StrictMode.allowThreadDiskReads();
+ try {
+ if (new File(wrapperFileName).exists()) {
+ invokeWith = "/system/bin/logwrapper " + wrapperFileName;
+ }
+ } finally {
+ StrictMode.setThreadPolicy(oldPolicy);
+ }
+ }
String requiredAbi = (abiOverride != null) ? abiOverride : app.info.primaryCpuAbi;
if (requiredAbi == null) {
app.requiredAbi = requiredAbi;
app.instructionSet = instructionSet;
+ // the per-user SELinux context must be set
+ if (TextUtils.isEmpty(app.info.seInfoUser)) {
+ Slog.wtf(TAG, "SELinux tag not defined",
+ new IllegalStateException("SELinux tag not defined for "
+ + app.info.packageName + " (uid " + app.uid + ")"));
+ }
+ final String seInfo = app.info.seInfo
+ + (TextUtils.isEmpty(app.info.seInfoUser) ? "" : app.info.seInfoUser);
// Start the process. It will either succeed and return a result containing
// the PID of the new process, or else throw a RuntimeException.
boolean isActivityProcess = (entryPoint == null);
Trace.traceBegin(Trace.TRACE_TAG_ACTIVITY_MANAGER, "Start proc: " +
app.processName);
checkTime(startTime, "startProcess: asking zygote to start proc");
- Process.ProcessStartResult startResult = Process.start(entryPoint,
- app.processName, uid, uid, gids, debugFlags, mountExternal,
- app.info.targetSdkVersion, app.info.seinfo, requiredAbi, instructionSet,
- app.info.dataDir, entryPointArgs);
+ ProcessStartResult startResult;
+ if (hostingType.equals("webview_service")) {
+ startResult = startWebView(entryPoint,
+ app.processName, uid, uid, gids, debugFlags, mountExternal,
+ app.info.targetSdkVersion, seInfo, requiredAbi, instructionSet,
+ app.info.dataDir, null, entryPointArgs);
+ } else {
+ startResult = Process.start(entryPoint,
+ app.processName, uid, uid, gids, debugFlags, mountExternal,
+ app.info.targetSdkVersion, seInfo, requiredAbi, instructionSet,
+ app.info.dataDir, invokeWith, entryPointArgs);
+ }
checkTime(startTime, "startProcess: returned from zygote!");
Trace.traceEnd(Trace.TRACE_TAG_ACTIVITY_MANAGER);
- if (app.isolated) {
- mBatteryStatsService.addIsolatedUid(app.uid, app.info.uid);
- }
mBatteryStatsService.noteProcessStart(app.processName, app.info.uid);
checkTime(startTime, "startProcess: done updating battery stats");
app.processName, hostingType,
hostingNameStr != null ? hostingNameStr : "");
+ try {
+ AppGlobals.getPackageManager().logAppProcessStartIfNeeded(app.processName, app.uid,
+ seInfo, app.info.sourceDir, startResult.pid);
+ } catch (RemoteException ex) {
+ // Ignore
+ }
+
if (app.persistent) {
Watchdog.getInstance().processStarted(app.processName, startResult.pid);
}
}
checkTime(startTime, "startProcess: done updating pids map");
} catch (RuntimeException e) {
- // XXX do better error recovery.
- app.setPid(0);
- mBatteryStatsService.noteProcessFinish(app.processName, app.info.uid);
- if (app.isolated) {
- mBatteryStatsService.removeIsolatedUid(app.uid, app.info.uid);
- }
Slog.e(TAG, "Failure starting process " + app.processName, e);
+
+ // Something went very wrong while trying to start this process; one
+ // common case is when the package is frozen due to an active
+ // upgrade. To recover, clean up any active bookkeeping related to
+ // starting this process. (We already invoked this method once when
+ // the package was initially frozen through KILL_APPLICATION_MSG, so
+ // it doesn't hurt to use it again.)
+ forceStopPackageLocked(app.info.packageName, UserHandle.getAppId(app.uid), false,
+ false, true, false, false, UserHandle.getUserId(app.userId), "start failure");
}
}
Intent getHomeIntent() {
Intent intent = new Intent(mTopAction, mTopData != null ? Uri.parse(mTopData) : null);
intent.setComponent(mTopComponent);
+ intent.addFlags(Intent.FLAG_DEBUG_TRIAGED_MISSING);
if (mFactoryTest != FactoryTest.FACTORY_TEST_LOW_LEVEL) {
intent.addCategory(Intent.CATEGORY_HOME);
}
return false;
}
Intent intent = getHomeIntent();
- ActivityInfo aInfo =
- resolveActivityInfo(intent, STOCK_PM_FLAGS, userId);
+ ActivityInfo aInfo = resolveActivityInfo(intent, STOCK_PM_FLAGS, userId);
if (aInfo != null) {
- intent.setComponent(new ComponentName(
- aInfo.applicationInfo.packageName, aInfo.name));
+ intent.setComponent(new ComponentName(aInfo.applicationInfo.packageName, aInfo.name));
// Don't do this if the home app is currently being
// instrumented.
aInfo = new ActivityInfo(aInfo);
aInfo.applicationInfo = getAppInfoForUser(aInfo.applicationInfo, userId);
ProcessRecord app = getProcessRecordLocked(aInfo.processName,
aInfo.applicationInfo.uid, true);
- if (app == null || app.instrumentationClass == null) {
+ if (app == null || app.instr == null) {
intent.setFlags(intent.getFlags() | Intent.FLAG_ACTIVITY_NEW_TASK);
- mStackSupervisor.startHomeActivity(intent, aInfo, reason);
+ final int resolvedUserId = UserHandle.getUserId(aInfo.applicationInfo.uid);
+ // For ANR debugging to verify if the user activity is the one that actually
+ // launched.
+ final String myReason = reason + ":" + userId + ":" + resolvedUserId;
+ mActivityStarter.startHomeActivityLocked(intent, aInfo, myReason);
}
+ } else {
+ Slog.wtf(TAG, "No home screen found for " + intent, new Throwable());
}
return true;
mCheckedForSetup = true;
// See if we should be showing the platform update setup UI.
- Intent intent = new Intent(Intent.ACTION_UPGRADE_SETUP);
- List<ResolveInfo> ris = mContext.getPackageManager()
- .queryIntentActivities(intent, PackageManager.GET_META_DATA);
-
- // We don't allow third party apps to replace this.
- ResolveInfo ri = null;
- for (int i=0; ris != null && i<ris.size(); i++) {
- if ((ris.get(i).activityInfo.applicationInfo.flags
- & ApplicationInfo.FLAG_SYSTEM) != 0) {
- ri = ris.get(i);
- break;
- }
- }
-
- if (ri != null) {
+ final Intent intent = new Intent(Intent.ACTION_UPGRADE_SETUP);
+ final List<ResolveInfo> ris = mContext.getPackageManager().queryIntentActivities(intent,
+ PackageManager.MATCH_SYSTEM_ONLY | PackageManager.GET_META_DATA);
+ if (!ris.isEmpty()) {
+ final ResolveInfo ri = ris.get(0);
String vers = ri.activityInfo.metaData != null
? ri.activityInfo.metaData.getString(Intent.METADATA_SETUP_VERSION)
: null;
intent.setFlags(Intent.FLAG_ACTIVITY_NEW_TASK);
intent.setComponent(new ComponentName(
ri.activityInfo.packageName, ri.activityInfo.name));
- mStackSupervisor.startActivityLocked(null, intent, null, ri.activityInfo,
- null, null, null, null, 0, 0, 0, null, 0, 0, 0, null, false, false,
- null, null, null);
+ mActivityStarter.startActivityLocked(null, intent, null /*ephemeralIntent*/,
+ null, ri.activityInfo, null /*rInfo*/, null, null, null, null, 0, 0, 0,
+ null, 0, 0, 0, null, false, false, null, null, "startSetupActivity");
}
}
}
}
void enforceShellRestriction(String restriction, int userHandle) {
- if (Binder.getCallingUid() == Process.SHELL_UID) {
- if (userHandle < 0
- || mUserManager.hasUserRestriction(restriction, userHandle)) {
+ if (Binder.getCallingUid() == SHELL_UID) {
+ if (userHandle < 0 || mUserController.hasUserRestriction(restriction, userHandle)) {
throw new SecurityException("Shell does not have permission to access user "
+ userHandle);
}
@Override
public int getPackageProcessState(String packageName, String callingPackage) {
if (!hasUsageStatsPermission(callingPackage)) {
- enforceCallingPermission(android.Manifest.permission.GET_PACKAGE_IMPORTANCE,
+ enforceCallingPermission(android.Manifest.permission.PACKAGE_USAGE_STATS,
"getPackageProcessState");
}
synchronized (this) {
for (int i=mLruProcesses.size()-1; i>=0; i--) {
final ProcessRecord proc = mLruProcesses.get(i);
- if (procState == ActivityManager.PROCESS_STATE_NONEXISTENT
- || procState > proc.setProcState) {
- boolean found = false;
- for (int j=proc.pkgList.size()-1; j>=0 && !found; j--) {
- if (proc.pkgList.keyAt(j).equals(packageName)) {
- procState = proc.setProcState;
- found = true;
- }
- }
- if (proc.pkgDeps != null && !found) {
- for (int j=proc.pkgDeps.size()-1; j>=0; j--) {
- if (proc.pkgDeps.valueAt(j).equals(packageName)) {
- procState = proc.setProcState;
- break;
- }
- }
+ if (procState > proc.setProcState) {
+ if (proc.pkgList.containsKey(packageName) ||
+ (proc.pkgDeps != null && proc.pkgDeps.contains(packageName))) {
+ procState = proc.setProcState;
}
}
}
}
@Override
- public boolean setProcessMemoryTrimLevel(String process, int userId, int level) {
+ public boolean setProcessMemoryTrimLevel(String process, int userId, int level)
+ throws RemoteException {
synchronized (this) {
final ProcessRecord app = findProcessLocked(process, userId, "setProcessMemoryTrimLevel");
if (app == null) {
- return false;
+ throw new IllegalArgumentException("Unknown process: " + process);
}
- if (app.trimMemoryLevel < level && app.thread != null &&
- (level < ComponentCallbacks2.TRIM_MEMORY_UI_HIDDEN ||
- app.curProcState >= ActivityManager.PROCESS_STATE_IMPORTANT_BACKGROUND)) {
- try {
- app.thread.scheduleTrimMemory(level);
- app.trimMemoryLevel = level;
- return true;
- } catch (RemoteException e) {
- // Fallthrough to failure case.
- }
+ if (app.thread == null) {
+ throw new IllegalArgumentException("Process has no app thread");
}
+ if (app.trimMemoryLevel >= level) {
+ throw new IllegalArgumentException(
+ "Unable to set a higher trim level than current level");
+ }
+ if (!(level < ComponentCallbacks2.TRIM_MEMORY_UI_HIDDEN ||
+ app.curProcState > ActivityManager.PROCESS_STATE_IMPORTANT_FOREGROUND)) {
+ throw new IllegalArgumentException("Unable to set a background trim level "
+ + "on a foreground process");
+ }
+ app.thread.scheduleTrimMemory(level);
+ app.trimMemoryLevel = level;
+ return true;
}
- return false;
}
private void dispatchProcessesChanged() {
observer.onForegroundActivitiesChanged(item.pid, item.uid,
item.foregroundActivities);
}
- if ((item.changes&ProcessChangeItem.CHANGE_PROCESS_STATE) != 0) {
- if (DEBUG_PROCESS_OBSERVERS) Slog.i(TAG_PROCESS_OBSERVERS,
- "PROCSTATE CHANGED pid=" + item.pid + " uid=" + item.uid
- + ": " + item.processState);
- observer.onProcessStateChanged(item.pid, item.uid, item.processState);
- }
}
} catch (RemoteException e) {
}
mProcessObservers.finishBroadcast();
}
- private void dispatchUidsChanged() {
+ @VisibleForTesting
+ void dispatchUidsChanged() {
int N;
synchronized (this) {
N = mPendingUidChanges.size();
for (int i=0; i<N; i++) {
final UidRecord.ChangeItem change = mPendingUidChanges.get(i);
mActiveUidChanges[i] = change;
- change.uidRecord.pendingChange = null;
- change.uidRecord = null;
+ if (change.uidRecord != null) {
+ change.uidRecord.pendingChange = null;
+ change.uidRecord = null;
+ }
}
mPendingUidChanges.clear();
if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
"*** Delivering " + N + " uid changes");
}
- if (mLocalPowerManager != null) {
- for (int j=0; j<N; j++) {
- UidRecord.ChangeItem item = mActiveUidChanges[j];
- if (item.gone) {
- mLocalPowerManager.uidGone(item.uid);
+ int i = mUidObservers.beginBroadcast();
+ while (i > 0) {
+ i--;
+ dispatchUidsChangedForObserver(mUidObservers.getBroadcastItem(i),
+ (UidObserverRegistration) mUidObservers.getBroadcastCookie(i), N);
+ }
+ mUidObservers.finishBroadcast();
+
+ if (VALIDATE_UID_STATES && mUidObservers.getRegisteredCallbackCount() > 0) {
+ for (int j = 0; j < N; ++j) {
+ final UidRecord.ChangeItem item = mActiveUidChanges[j];
+ if ((item.change & UidRecord.CHANGE_GONE) != 0) {
+ mValidateUids.remove(item.uid);
} else {
- mLocalPowerManager.updateUidProcState(item.uid, item.processState);
+ UidRecord validateUid = mValidateUids.get(item.uid);
+ if (validateUid == null) {
+ validateUid = new UidRecord(item.uid);
+ mValidateUids.put(item.uid, validateUid);
+ }
+ if ((item.change & UidRecord.CHANGE_IDLE) != 0) {
+ validateUid.idle = true;
+ } else if ((item.change & UidRecord.CHANGE_ACTIVE) != 0) {
+ validateUid.idle = false;
+ }
+ validateUid.curProcState = validateUid.setProcState = item.processState;
+ validateUid.lastDispatchedProcStateSeq = item.procStateSeq;
}
}
}
- int i = mUidObservers.beginBroadcast();
- while (i > 0) {
- i--;
- final IUidObserver observer = mUidObservers.getBroadcastItem(i);
- if (observer != null) {
- try {
- for (int j=0; j<N; j++) {
- UidRecord.ChangeItem item = mActiveUidChanges[j];
- if (item.gone) {
- if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
- "UID gone uid=" + item.uid);
- observer.onUidGone(item.uid);
- } else {
- if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
- "UID CHANGED uid=" + item.uid
- + ": " + item.processState);
- observer.onUidStateChanged(item.uid, item.processState);
+ synchronized (this) {
+ for (int j = 0; j < N; j++) {
+ mAvailUidChanges.add(mActiveUidChanges[j]);
+ }
+ }
+ }
+
+ private void dispatchUidsChangedForObserver(IUidObserver observer,
+ UidObserverRegistration reg, int changesSize) {
+ if (observer == null) {
+ return;
+ }
+ try {
+ for (int j = 0; j < changesSize; j++) {
+ UidRecord.ChangeItem item = mActiveUidChanges[j];
+ final int change = item.change;
+ if (change == UidRecord.CHANGE_PROCSTATE &&
+ (reg.which & ActivityManager.UID_OBSERVER_PROCSTATE) == 0) {
+ // No-op common case: no significant change, the observer is not
+ // interested in all proc state changes.
+ continue;
+ }
+ if ((change & UidRecord.CHANGE_IDLE) != 0) {
+ if ((reg.which & ActivityManager.UID_OBSERVER_IDLE) != 0) {
+ if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
+ "UID idle uid=" + item.uid);
+ observer.onUidIdle(item.uid, item.ephemeral);
+ }
+ } else if ((change & UidRecord.CHANGE_ACTIVE) != 0) {
+ if ((reg.which & ActivityManager.UID_OBSERVER_ACTIVE) != 0) {
+ if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
+ "UID active uid=" + item.uid);
+ observer.onUidActive(item.uid);
+ }
+ }
+ if ((reg.which & ActivityManager.UID_OBSERVER_CACHED) != 0) {
+ if ((change & UidRecord.CHANGE_CACHED) != 0) {
+ if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
+ "UID cached uid=" + item.uid);
+ observer.onUidCachedChanged(item.uid, true);
+ } else if ((change & UidRecord.CHANGE_UNCACHED) != 0) {
+ if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
+ "UID active uid=" + item.uid);
+ observer.onUidCachedChanged(item.uid, false);
+ }
+ }
+ if ((change & UidRecord.CHANGE_GONE) != 0) {
+ if ((reg.which & ActivityManager.UID_OBSERVER_GONE) != 0) {
+ if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
+ "UID gone uid=" + item.uid);
+ observer.onUidGone(item.uid, item.ephemeral);
+ }
+ if (reg.lastProcStates != null) {
+ reg.lastProcStates.delete(item.uid);
+ }
+ } else {
+ if ((reg.which & ActivityManager.UID_OBSERVER_PROCSTATE) != 0) {
+ if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
+ "UID CHANGED uid=" + item.uid
+ + ": " + item.processState);
+ boolean doReport = true;
+ if (reg.cutpoint >= ActivityManager.MIN_PROCESS_STATE) {
+ final int lastState = reg.lastProcStates.get(item.uid,
+ ActivityManager.PROCESS_STATE_UNKNOWN);
+ if (lastState != ActivityManager.PROCESS_STATE_UNKNOWN) {
+ final boolean lastAboveCut = lastState <= reg.cutpoint;
+ final boolean newAboveCut = item.processState <= reg.cutpoint;
+ doReport = lastAboveCut != newAboveCut;
+ } else {
+ doReport = item.processState
+ != ActivityManager.PROCESS_STATE_NONEXISTENT;
+ }
+ }
+ if (doReport) {
+ if (reg.lastProcStates != null) {
+ reg.lastProcStates.put(item.uid, item.processState);
+ }
+ observer.onUidStateChanged(item.uid, item.processState,
+ item.procStateSeq);
}
}
- } catch (RemoteException e) {
}
}
+ } catch (RemoteException e) {
}
- mUidObservers.finishBroadcast();
+ }
+ void dispatchOomAdjObserver(String msg) {
+ OomAdjObserver observer;
synchronized (this) {
- for (int j=0; j<N; j++) {
- mAvailUidChanges.add(mActiveUidChanges[j]);
- }
+ observer = mCurOomAdjObserver;
+ }
+
+ if (observer != null) {
+ observer.onOomAdjMessage(msg);
+ }
+ }
+
+ void setOomAdjObserver(int uid, OomAdjObserver observer) {
+ synchronized (this) {
+ mCurOomAdjUid = uid;
+ mCurOomAdjObserver = observer;
+ }
+ }
+
+ void clearOomAdjObserver() {
+ synchronized (this) {
+ mCurOomAdjUid = -1;
+ mCurOomAdjObserver = null;
+ }
+ }
+
+ void reportOomAdjMessageLocked(String tag, String msg) {
+ Slog.d(tag, msg);
+ if (mCurOomAdjObserver != null) {
+ mUiHandler.obtainMessage(DISPATCH_OOM_ADJ_OBSERVER_MSG, msg).sendToTarget();
}
}
@Override
public final int startActivity(IApplicationThread caller, String callingPackage,
Intent intent, String resolvedType, IBinder resultTo, String resultWho, int requestCode,
- int startFlags, ProfilerInfo profilerInfo, Bundle options) {
+ int startFlags, ProfilerInfo profilerInfo, Bundle bOptions) {
return startActivityAsUser(caller, callingPackage, intent, resolvedType, resultTo,
- resultWho, requestCode, startFlags, profilerInfo, options,
- UserHandle.getCallingUserId());
+ resultWho, requestCode, startFlags, profilerInfo, bOptions,
+ UserHandle.getCallingUserId());
}
@Override
public final int startActivityAsUser(IApplicationThread caller, String callingPackage,
Intent intent, String resolvedType, IBinder resultTo, String resultWho, int requestCode,
- int startFlags, ProfilerInfo profilerInfo, Bundle options, int userId) {
+ int startFlags, ProfilerInfo profilerInfo, Bundle bOptions, int userId) {
enforceNotIsolatedCaller("startActivity");
- userId = handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(), userId,
- false, ALLOW_FULL_ONLY, "startActivity", null);
+ userId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(),
+ userId, false, ALLOW_FULL_ONLY, "startActivity", null);
// TODO: Switch to user app stacks here.
- return mStackSupervisor.startActivityMayWait(caller, -1, callingPackage, intent,
+ return mActivityStarter.startActivityMayWait(caller, -1, callingPackage, intent,
resolvedType, null, null, resultTo, resultWho, requestCode, startFlags,
- profilerInfo, null, null, options, false, userId, null, null);
+ profilerInfo, null, null, bOptions, false, userId, null, "startActivityAsUser");
}
@Override
public final int startActivityAsCaller(IApplicationThread caller, String callingPackage,
Intent intent, String resolvedType, IBinder resultTo, String resultWho, int requestCode,
- int startFlags, ProfilerInfo profilerInfo, Bundle options, boolean ignoreTargetSecurity,
+ int startFlags, ProfilerInfo profilerInfo, Bundle bOptions, boolean ignoreTargetSecurity,
int userId) {
// This is very dangerous -- it allows you to perform a start activity (including
if (sourceRecord.app == null) {
throw new SecurityException("Called without a process attached to activity");
}
- if (UserHandle.getAppId(sourceRecord.app.uid) != Process.SYSTEM_UID) {
+ if (UserHandle.getAppId(sourceRecord.app.uid) != SYSTEM_UID) {
// This is still okay, as long as this activity is running under the
// uid of the original calling activity.
if (sourceRecord.app.uid != sourceRecord.launchedFromUid) {
// TODO: Switch to user app stacks here.
try {
- int ret = mStackSupervisor.startActivityMayWait(null, targetUid, targetPackage, intent,
+ int ret = mActivityStarter.startActivityMayWait(null, targetUid, targetPackage, intent,
resolvedType, null, null, resultTo, resultWho, requestCode, startFlags, null,
- null, null, options, ignoreTargetSecurity, userId, null, null);
+ null, null, bOptions, ignoreTargetSecurity, userId, null,
+ "startActivityAsCaller");
return ret;
} catch (SecurityException e) {
// XXX need to figure out how to propagate to original app.
@Override
public final WaitResult startActivityAndWait(IApplicationThread caller, String callingPackage,
Intent intent, String resolvedType, IBinder resultTo, String resultWho, int requestCode,
- int startFlags, ProfilerInfo profilerInfo, Bundle options, int userId) {
+ int startFlags, ProfilerInfo profilerInfo, Bundle bOptions, int userId) {
enforceNotIsolatedCaller("startActivityAndWait");
- userId = handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(), userId,
- false, ALLOW_FULL_ONLY, "startActivityAndWait", null);
+ userId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(),
+ userId, false, ALLOW_FULL_ONLY, "startActivityAndWait", null);
WaitResult res = new WaitResult();
// TODO: Switch to user app stacks here.
- mStackSupervisor.startActivityMayWait(caller, -1, callingPackage, intent, resolvedType,
+ mActivityStarter.startActivityMayWait(caller, -1, callingPackage, intent, resolvedType,
null, null, resultTo, resultWho, requestCode, startFlags, profilerInfo, res, null,
- options, false, userId, null, null);
+ bOptions, false, userId, null, "startActivityAndWait");
return res;
}
@Override
public final int startActivityWithConfig(IApplicationThread caller, String callingPackage,
Intent intent, String resolvedType, IBinder resultTo, String resultWho, int requestCode,
- int startFlags, Configuration config, Bundle options, int userId) {
+ int startFlags, Configuration config, Bundle bOptions, int userId) {
enforceNotIsolatedCaller("startActivityWithConfig");
- userId = handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(), userId,
- false, ALLOW_FULL_ONLY, "startActivityWithConfig", null);
+ userId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(),
+ userId, false, ALLOW_FULL_ONLY, "startActivityWithConfig", null);
// TODO: Switch to user app stacks here.
- int ret = mStackSupervisor.startActivityMayWait(caller, -1, callingPackage, intent,
+ int ret = mActivityStarter.startActivityMayWait(caller, -1, callingPackage, intent,
resolvedType, null, null, resultTo, resultWho, requestCode, startFlags,
- null, null, config, options, false, userId, null, null);
+ null, null, config, bOptions, false, userId, null, "startActivityWithConfig");
return ret;
}
@Override
- public int startActivityIntentSender(IApplicationThread caller, IntentSender intent,
- Intent fillInIntent, String resolvedType, IBinder resultTo, String resultWho,
- int requestCode, int flagsMask, int flagsValues, Bundle options)
+ public int startActivityIntentSender(IApplicationThread caller, IIntentSender target,
+ IBinder whitelistToken, Intent fillInIntent, String resolvedType, IBinder resultTo,
+ String resultWho, int requestCode, int flagsMask, int flagsValues, Bundle bOptions)
throws TransactionTooLargeException {
enforceNotIsolatedCaller("startActivityIntentSender");
// Refuse possible leaked file descriptors
throw new IllegalArgumentException("File descriptors passed in Intent");
}
- IIntentSender sender = intent.getTarget();
- if (!(sender instanceof PendingIntentRecord)) {
+ if (!(target instanceof PendingIntentRecord)) {
throw new IllegalArgumentException("Bad PendingIntent object");
}
- PendingIntentRecord pir = (PendingIntentRecord)sender;
+ PendingIntentRecord pir = (PendingIntentRecord)target;
synchronized (this) {
// If this is coming from the currently resumed activity, it is
mAppSwitchesAllowedTime = 0;
}
}
- int ret = pir.sendInner(0, fillInIntent, resolvedType, null, null,
- resultTo, resultWho, requestCode, flagsMask, flagsValues, options, null);
+ int ret = pir.sendInner(0, fillInIntent, resolvedType, whitelistToken, null, null,
+ resultTo, resultWho, requestCode, flagsMask, flagsValues, bOptions);
return ret;
}
public int startVoiceActivity(String callingPackage, int callingPid, int callingUid,
Intent intent, String resolvedType, IVoiceInteractionSession session,
IVoiceInteractor interactor, int startFlags, ProfilerInfo profilerInfo,
- Bundle options, int userId) {
+ Bundle bOptions, int userId) {
if (checkCallingPermission(Manifest.permission.BIND_VOICE_INTERACTION)
!= PackageManager.PERMISSION_GRANTED) {
String msg = "Permission Denial: startVoiceActivity() from pid="
if (session == null || interactor == null) {
throw new NullPointerException("null session or interactor");
}
- userId = handleIncomingUser(callingPid, callingUid, userId,
- false, ALLOW_FULL_ONLY, "startVoiceActivity", null);
+ userId = mUserController.handleIncomingUser(callingPid, callingUid, userId, false,
+ ALLOW_FULL_ONLY, "startVoiceActivity", null);
// TODO: Switch to user app stacks here.
- return mStackSupervisor.startActivityMayWait(null, callingUid, callingPackage, intent,
+ return mActivityStarter.startActivityMayWait(null, callingUid, callingPackage, intent,
resolvedType, session, interactor, null, null, 0, startFlags, profilerInfo, null,
- null, options, false, userId, null, null);
+ null, bOptions, false, userId, null, "startVoiceActivity");
+ }
+
+ @Override
+ public int startAssistantActivity(String callingPackage, int callingPid, int callingUid,
+ Intent intent, String resolvedType, Bundle bOptions, int userId) {
+ if (checkCallingPermission(Manifest.permission.BIND_VOICE_INTERACTION)
+ != PackageManager.PERMISSION_GRANTED) {
+ final String msg = "Permission Denial: startAssistantActivity() from pid="
+ + Binder.getCallingPid()
+ + ", uid=" + Binder.getCallingUid()
+ + " requires " + Manifest.permission.BIND_VOICE_INTERACTION;
+ Slog.w(TAG, msg);
+ throw new SecurityException(msg);
+ }
+ userId = mUserController.handleIncomingUser(callingPid, callingUid, userId, false,
+ ALLOW_FULL_ONLY, "startAssistantActivity", null);
+ return mActivityStarter.startActivityMayWait(null, callingUid, callingPackage, intent,
+ resolvedType, null, null, null, null, 0, 0, null, null, null, bOptions, false,
+ userId, null, "startAssistantActivity");
+ }
+
+ @Override
+ public void startLocalVoiceInteraction(IBinder callingActivity, Bundle options)
+ throws RemoteException {
+ Slog.i(TAG, "Activity tried to startVoiceInteraction");
+ synchronized (this) {
+ ActivityRecord activity = getFocusedStack().topActivity();
+ if (ActivityRecord.forTokenLocked(callingActivity) != activity) {
+ throw new SecurityException("Only focused activity can call startVoiceInteraction");
+ }
+ if (mRunningVoice != null || activity.getTask().voiceSession != null
+ || activity.voiceSession != null) {
+ Slog.w(TAG, "Already in a voice interaction, cannot start new voice interaction");
+ return;
+ }
+ if (activity.pendingVoiceInteractionStart) {
+ Slog.w(TAG, "Pending start of voice interaction already.");
+ return;
+ }
+ activity.pendingVoiceInteractionStart = true;
+ }
+ LocalServices.getService(VoiceInteractionManagerInternal.class)
+ .startLocalVoiceInteraction(callingActivity, options);
+ }
+
+ @Override
+ public void stopLocalVoiceInteraction(IBinder callingActivity) throws RemoteException {
+ LocalServices.getService(VoiceInteractionManagerInternal.class)
+ .stopLocalVoiceInteraction(callingActivity);
+ }
+
+ @Override
+ public boolean supportsLocalVoiceInteraction() throws RemoteException {
+ return LocalServices.getService(VoiceInteractionManagerInternal.class)
+ .supportsLocalVoiceInteraction();
+ }
+
+ void onLocalVoiceInteractionStartedLocked(IBinder activity,
+ IVoiceInteractionSession voiceSession, IVoiceInteractor voiceInteractor) {
+ ActivityRecord activityToCallback = ActivityRecord.forTokenLocked(activity);
+ if (activityToCallback == null) return;
+ activityToCallback.setVoiceSessionLocked(voiceSession);
+
+ // Inform the activity
+ try {
+ activityToCallback.app.thread.scheduleLocalVoiceInteractionStarted(activity,
+ voiceInteractor);
+ long token = Binder.clearCallingIdentity();
+ try {
+ startRunningVoiceLocked(voiceSession, activityToCallback.appInfo.uid);
+ } finally {
+ Binder.restoreCallingIdentity(token);
+ }
+ // TODO: VI Should we cache the activity so that it's easier to find later
+ // rather than scan through all the stacks and activities?
+ } catch (RemoteException re) {
+ activityToCallback.clearVoiceSessionLocked();
+ // TODO: VI Should this terminate the voice session?
+ }
}
@Override
@Override
public boolean startNextMatchingActivity(IBinder callingActivity,
- Intent intent, Bundle options) {
+ Intent intent, Bundle bOptions) {
// Refuse possible leaked file descriptors
if (intent != null && intent.hasFileDescriptors() == true) {
throw new IllegalArgumentException("File descriptors passed in Intent");
}
+ ActivityOptions options = ActivityOptions.fromBundle(bOptions);
synchronized (this) {
final ActivityRecord r = ActivityRecord.isInStackLocked(callingActivity);
AppGlobals.getPackageManager().queryIntentActivities(
intent, r.resolvedType,
PackageManager.MATCH_DEFAULT_ONLY | STOCK_PM_FLAGS,
- UserHandle.getCallingUserId());
+ UserHandle.getCallingUserId()).getList();
// Look for the original activity in the list...
final int N = resolves != null ? resolves.size() : 0;
if (debug) {
Slog.v(TAG, "Next matching activity: found current " + r.packageName
+ "/" + r.info.name);
- Slog.v(TAG, "Next matching activity: next is " + aInfo.packageName
- + "/" + aInfo.name);
+ Slog.v(TAG, "Next matching activity: next is " + ((aInfo == null)
+ ? "null" : aInfo.packageName + "/" + aInfo.name));
}
break;
}
}
final long origId = Binder.clearCallingIdentity();
- int res = mStackSupervisor.startActivityLocked(r.app.thread, intent,
- r.resolvedType, aInfo, null, null, resultTo != null ? resultTo.appToken : null,
- resultWho, requestCode, -1, r.launchedFromUid, r.launchedFromPackage,
- -1, r.launchedFromUid, 0, options, false, false, null, null, null);
+ int res = mActivityStarter.startActivityLocked(r.app.thread, intent,
+ null /*ephemeralIntent*/, r.resolvedType, aInfo, null /*rInfo*/, null,
+ null, resultTo != null ? resultTo.appToken : null, resultWho, requestCode, -1,
+ r.launchedFromUid, r.launchedFromPackage, -1, r.launchedFromUid, 0, options,
+ false, false, null, null, "startNextMatchingActivity");
Binder.restoreCallingIdentity(origId);
r.finishing = wasFinishing;
}
@Override
- public final int startActivityFromRecents(int taskId, Bundle options) {
+ public final int startActivityFromRecents(int taskId, Bundle bOptions) {
if (checkCallingPermission(START_TASKS_FROM_RECENTS) != PackageManager.PERMISSION_GRANTED) {
String msg = "Permission Denial: startActivityFromRecents called without " +
START_TASKS_FROM_RECENTS;
Slog.w(TAG, msg);
throw new SecurityException(msg);
}
- return startActivityFromRecentsInner(taskId, options);
- }
-
- final int startActivityFromRecentsInner(int taskId, Bundle options) {
- final TaskRecord task;
- final int callingUid;
- final String callingPackage;
- final Intent intent;
- final int userId;
- synchronized (this) {
- task = mStackSupervisor.anyTaskForIdLocked(taskId);
- if (task == null) {
- throw new IllegalArgumentException("Task " + taskId + " not found.");
- }
- if (task.getRootActivity() != null) {
- moveTaskToFrontLocked(task.taskId, 0, null);
- return ActivityManager.START_TASK_TO_FRONT;
+ final long origId = Binder.clearCallingIdentity();
+ try {
+ synchronized (this) {
+ return mStackSupervisor.startActivityFromRecentsInner(taskId, bOptions);
}
- callingUid = task.mCallingUid;
- callingPackage = task.mCallingPackage;
- intent = task.intent;
- intent.addFlags(Intent.FLAG_ACTIVITY_LAUNCHED_FROM_HISTORY);
- userId = task.userId;
+ } finally {
+ Binder.restoreCallingIdentity(origId);
}
- return startActivityInPackage(callingUid, callingPackage, intent, null, null, null, 0, 0,
- options, userId, null, task);
}
final int startActivityInPackage(int uid, String callingPackage,
Intent intent, String resolvedType, IBinder resultTo,
- String resultWho, int requestCode, int startFlags, Bundle options, int userId,
- IActivityContainer container, TaskRecord inTask) {
+ String resultWho, int requestCode, int startFlags, Bundle bOptions, int userId,
+ TaskRecord inTask, String reason) {
- userId = handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(), userId,
- false, ALLOW_FULL_ONLY, "startActivityInPackage", null);
+ userId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(),
+ userId, false, ALLOW_FULL_ONLY, "startActivityInPackage", null);
// TODO: Switch to user app stacks here.
- int ret = mStackSupervisor.startActivityMayWait(null, uid, callingPackage, intent,
- resolvedType, null, null, resultTo, resultWho, requestCode, startFlags,
- null, null, null, options, false, userId, container, inTask);
- return ret;
+ return mActivityStarter.startActivityMayWait(null, uid, ActivityStarter.PID_NULL, uid,
+ callingPackage, intent, resolvedType, null, null, resultTo, resultWho, requestCode,
+ startFlags, null, null, null, bOptions, false, userId, inTask, reason);
}
@Override
public final int startActivities(IApplicationThread caller, String callingPackage,
- Intent[] intents, String[] resolvedTypes, IBinder resultTo, Bundle options,
+ Intent[] intents, String[] resolvedTypes, IBinder resultTo, Bundle bOptions,
int userId) {
- enforceNotIsolatedCaller("startActivities");
- userId = handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(), userId,
- false, ALLOW_FULL_ONLY, "startActivity", null);
+ final String reason = "startActivities";
+ enforceNotIsolatedCaller(reason);
+ userId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(),
+ userId, false, ALLOW_FULL_ONLY, reason, null);
// TODO: Switch to user app stacks here.
- int ret = mStackSupervisor.startActivities(caller, -1, callingPackage, intents,
- resolvedTypes, resultTo, options, userId);
+ int ret = mActivityStarter.startActivities(caller, -1, callingPackage, intents,
+ resolvedTypes, resultTo, bOptions, userId, reason);
return ret;
}
final int startActivitiesInPackage(int uid, String callingPackage,
Intent[] intents, String[] resolvedTypes, IBinder resultTo,
- Bundle options, int userId) {
+ Bundle bOptions, int userId) {
+ return startActivitiesInPackage(uid, ActivityStarter.PID_NULL, UserHandle.USER_NULL,
+ callingPackage, intents, resolvedTypes, resultTo, bOptions, userId);
+ }
- userId = handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(), userId,
- false, ALLOW_FULL_ONLY, "startActivityInPackage", null);
+ final int startActivitiesInPackage(int uid, int realCallingPid, int realCallingUid,
+ String callingPackage, Intent[] intents, String[] resolvedTypes,
+ IBinder resultTo, Bundle bOptions, int userId) {
+
+ final String reason = "startActivityInPackage";
+ userId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(),
+ userId, false, ALLOW_FULL_ONLY, reason, null);
// TODO: Switch to user app stacks here.
- int ret = mStackSupervisor.startActivities(null, uid, callingPackage, intents, resolvedTypes,
- resultTo, options, userId);
+ int ret = mActivityStarter.startActivities(null, uid, realCallingPid, realCallingUid,
+ callingPackage, intents, resolvedTypes, resultTo, bOptions, userId, reason);
return ret;
}
@Override
- public void reportActivityFullyDrawn(IBinder token) {
+ public void reportActivityFullyDrawn(IBinder token, boolean restoredFromBundle) {
synchronized (this) {
ActivityRecord r = ActivityRecord.isInStackLocked(token);
if (r == null) {
return;
}
- r.reportFullyDrawnLocked();
+ r.reportFullyDrawnLocked(restoredFromBundle);
}
}
if (r == null) {
return;
}
- if (r.task != null && r.task.mResizeable) {
- // Fixed screen orientation isn't supported with resizeable activities.
- return;
- }
final long origId = Binder.clearCallingIdentity();
- mWindowManager.setAppOrientation(r.appToken, requestedOrientation);
- Configuration config = mWindowManager.updateOrientationFromAppTokens(
- mConfiguration, r.mayFreezeScreenLocked(r.app) ? r.appToken : null);
- if (config != null) {
- r.frozenBeforeDestroy = true;
- if (!updateConfigurationLocked(config, r, false, false)) {
- mStackSupervisor.resumeTopActivitiesLocked();
- }
+ try {
+ r.setRequestedOrientation(requestedOrientation);
+ } finally {
+ Binder.restoreCallingIdentity(origId);
}
- Binder.restoreCallingIdentity(origId);
}
}
if (r == null) {
return ActivityInfo.SCREEN_ORIENTATION_UNSPECIFIED;
}
- return mWindowManager.getAppOrientation(r.appToken);
+ return r.getRequestedOrientation();
+ }
+ }
+
+ @Override
+ public final void requestActivityRelaunch(IBinder token) {
+ synchronized(this) {
+ ActivityRecord r = ActivityRecord.isInStackLocked(token);
+ if (r == null) {
+ return;
+ }
+ final long origId = Binder.clearCallingIdentity();
+ try {
+ r.forceNewConfig = true;
+ r.ensureActivityConfigurationLocked(0 /* globalChanges */,
+ true /* preserveWindow */);
+ } finally {
+ Binder.restoreCallingIdentity(origId);
+ }
}
}
* @param token The Binder token referencing the Activity we want to finish.
* @param resultCode Result code, if any, from this Activity.
* @param resultData Result data (Intent), if any, from this Activity.
- * @param finishTask Whether to finish the task associated with this Activity. Only applies to
- * the root Activity in the task.
+ * @param finishTask Whether to finish the task associated with this Activity.
*
* @return Returns true if the activity successfully finished, or false if it is still running.
*/
@Override
public final boolean finishActivity(IBinder token, int resultCode, Intent resultData,
- boolean finishTask) {
+ int finishTask) {
// Refuse possible leaked file descriptors
if (resultData != null && resultData.hasFileDescriptors() == true) {
throw new IllegalArgumentException("File descriptors passed in Intent");
return true;
}
// Keep track of the root activity of the task before we finish it
- TaskRecord tr = r.task;
+ TaskRecord tr = r.getTask();
ActivityRecord rootR = tr.getRootActivity();
if (rootR == null) {
Slog.w(TAG, "Finishing task with all activities already finished");
}
if (mController != null) {
// Find the first activity that is not finishing.
- ActivityRecord next = r.task.stack.topRunningActivityLocked(token, 0);
+ ActivityRecord next = r.getStack().topRunningActivityLocked(token, 0);
if (next != null) {
// ask watcher if this is allowed
boolean resumeOK = true;
final long origId = Binder.clearCallingIdentity();
try {
boolean res;
- if (finishTask && r == rootR) {
+ final boolean finishWithRootActivity =
+ finishTask == Activity.FINISH_TASK_WITH_ROOT_ACTIVITY;
+ if (finishTask == Activity.FINISH_TASK_WITH_ACTIVITY
+ || (finishWithRootActivity && r == rootR)) {
// If requested, remove the task that is associated to this activity only if it
// was the root activity in the task. The result code and data is ignored
- // because we don't support returning them across task boundaries.
- res = removeTaskByIdLocked(tr.taskId, false);
+ // because we don't support returning them across task boundaries. Also, to
+ // keep backwards compatibility we remove the task from recents when finishing
+ // task with root activity.
+ res = mStackSupervisor.removeTaskByIdLocked(tr.taskId, false, finishWithRootActivity);
if (!res) {
Slog.i(TAG, "Removing task failed to finish activity");
}
} else {
- res = tr.stack.requestFinishActivityLocked(token, resultCode,
+ res = tr.getStack().requestFinishActivityLocked(token, resultCode,
resultData, "app-request", true);
if (!res) {
Slog.i(TAG, "Failed to finish by app-request");
for (int i = 0; i < activities.size(); i++) {
ActivityRecord r = activities.get(i);
if (!r.finishing && r.isInStackLocked()) {
- r.task.stack.finishActivityLocked(r, Activity.RESULT_CANCELED,
+ r.getStack().finishActivityLocked(r, Activity.RESULT_CANCELED,
null, "finish-heavy", true);
}
}
}
@Override
- public void crashApplication(int uid, int initialPid, String packageName,
+ public void crashApplication(int uid, int initialPid, String packageName, int userId,
String message) {
if (checkCallingPermission(android.Manifest.permission.FORCE_STOP_PACKAGES)
!= PackageManager.PERMISSION_GRANTED) {
}
synchronized(this) {
- ProcessRecord proc = null;
-
- // Figure out which process to kill. We don't trust that initialPid
- // still has any relation to current pids, so must scan through the
- // list.
- synchronized (mPidsSelfLocked) {
- for (int i=0; i<mPidsSelfLocked.size(); i++) {
- ProcessRecord p = mPidsSelfLocked.valueAt(i);
- if (p.uid != uid) {
- continue;
- }
- if (p.pid == initialPid) {
- proc = p;
- break;
- }
- if (p.pkgList.containsKey(packageName)) {
- proc = p;
- }
- }
- }
-
- if (proc == null) {
- Slog.w(TAG, "crashApplication: nothing for uid=" + uid
- + " initialPid=" + initialPid
- + " packageName=" + packageName);
- return;
- }
-
- if (proc.thread != null) {
- if (proc.pid == Process.myPid()) {
- Log.w(TAG, "crashApplication: trying to crash self!");
- return;
- }
- long ident = Binder.clearCallingIdentity();
- try {
- proc.thread.scheduleCrash(message);
- } catch (RemoteException e) {
- }
- Binder.restoreCallingIdentity(ident);
- }
- }
- }
+ mAppErrors.scheduleAppCrashLocked(uid, initialPid, packageName, userId, message);
+ }
+ }
@Override
public final void finishSubActivity(IBinder token, String resultWho,
final long origId = Binder.clearCallingIdentity();
ActivityRecord r = ActivityRecord.isInStackLocked(token);
if (r != null) {
- r.task.stack.finishSubActivityLocked(r, resultWho, requestCode);
+ r.getStack().finishSubActivityLocked(r, resultWho, requestCode);
}
Binder.restoreCallingIdentity(origId);
}
// Do not allow task to finish if last task in lockTask mode. Launchable priv-apps
// can finish.
- final TaskRecord task = r.task;
+ final TaskRecord task = r.getTask();
if (task.mLockTaskAuth != LOCK_TASK_AUTH_LAUNCHABLE_PRIV &&
mStackSupervisor.isLastLockedTask(task) && task.getRootActivity() == r) {
mStackSupervisor.showLockTaskToast();
return false;
}
- return task.stack.finishActivityAffinityLocked(r);
+ return task.getStack().finishActivityAffinityLocked(r);
} finally {
Binder.restoreCallingIdentity(origId);
}
@Override
public void finishVoiceTask(IVoiceInteractionSession session) {
- synchronized(this) {
+ synchronized (this) {
final long origId = Binder.clearCallingIdentity();
try {
+ // TODO: VI Consider treating local voice interactions and voice tasks
+ // differently here
mStackSupervisor.finishVoiceTask(session);
} finally {
Binder.restoreCallingIdentity(origId);
if (r == null) {
return false;
}
- return r.task.stack.safelyDestroyActivityLocked(r, "app-req");
+ return r.getStack().safelyDestroyActivityLocked(r, "app-req");
} finally {
Binder.restoreCallingIdentity(origId);
}
app.activities.clear();
- if (app.instrumentationClass != null) {
+ if (app.instr != null) {
Slog.w(TAG, "Crash of app " + app.processName
- + " running instrumentation " + app.instrumentationClass);
+ + " running instrumentation " + app.instr.mClass);
Bundle info = new Bundle();
info.putString("shortMsg", "Process crashed.");
finishInstrumentationLocked(app, Activity.RESULT_CANCELED, info);
}
- if (!restarting && hasVisibleActivities && !mStackSupervisor.resumeTopActivitiesLocked()) {
- // If there was nothing to resume, and we are not already
- // restarting this process, but there is a visible activity that
- // is hosted by the process... then make sure all visible
- // activities are running, taking care of restarting this
- // process.
- mStackSupervisor.ensureActivitiesVisibleLocked(null, 0);
+ mWindowManager.deferSurfaceLayout();
+ try {
+ if (!restarting && hasVisibleActivities
+ && !mStackSupervisor.resumeFocusedStackTopActivityLocked()) {
+ // If there was nothing to resume, and we are not already restarting this process, but
+ // there is a visible activity that is hosted by the process... then make sure all
+ // visible activities are running, taking care of restarting this process.
+ mStackSupervisor.ensureActivitiesVisibleLocked(null, 0, !PRESERVE_WINDOWS);
+ }
+ } finally {
+ mWindowManager.continueSurfaceLayout();
}
}
private final int getLRURecordIndexForAppLocked(IApplicationThread thread) {
- IBinder threadBinder = thread.asBinder();
+ final IBinder threadBinder = thread.asBinder();
// Find the application record.
for (int i=mLruProcesses.size()-1; i>=0; i--) {
- ProcessRecord rec = mLruProcesses.get(i);
+ final ProcessRecord rec = mLruProcesses.get(i);
if (rec.thread != null && rec.thread.asBinder() == threadBinder) {
return i;
}
}
int appIndex = getLRURecordIndexForAppLocked(thread);
- return appIndex >= 0 ? mLruProcesses.get(appIndex) : null;
+ if (appIndex >= 0) {
+ return mLruProcesses.get(appIndex);
+ }
+
+ // Validation: if it isn't in the LRU list, it shouldn't exist, but let's
+ // double-check that.
+ final IBinder threadBinder = thread.asBinder();
+ final ArrayMap<String, SparseArray<ProcessRecord>> pmap = mProcessNames.getMap();
+ for (int i = pmap.size()-1; i >= 0; i--) {
+ final SparseArray<ProcessRecord> procs = pmap.valueAt(i);
+ for (int j = procs.size()-1; j >= 0; j--) {
+ final ProcessRecord proc = procs.valueAt(j);
+ if (proc.thread != null && proc.thread.asBinder() == threadBinder) {
+ Slog.wtf(TAG, "getRecordForApp: exists in name list but not in LRU list: "
+ + proc);
+ return proc;
+ }
+ }
+ }
+
+ return null;
}
final void doLowMemReportIfNeededLocked(ProcessRecord dyingProc) {
memInfos.add(new ProcessMemInfo(rec.processName, rec.pid, rec.setAdj,
rec.setProcState, rec.adjType, rec.makeAdjReason()));
}
- if ((rec.lastLowMemory+GC_MIN_INTERVAL) <= now) {
+ if ((rec.lastLowMemory+mConstants.GC_MIN_INTERVAL) <= now) {
// The low memory report is overriding any current
// state for a GC request. Make sure to do
// heavy/important/visible/foreground processes first.
if (!app.killed) {
if (!fromBinderDied) {
- Process.killProcessQuiet(pid);
+ killProcessQuiet(pid);
}
killProcessGroup(app.uid, pid);
app.killed = true;
// Clean up already done if the process has been re-started.
if (app.pid == pid && app.thread != null &&
app.thread.asBinder() == thread.asBinder()) {
- boolean doLowMem = app.instrumentationClass == null;
+ boolean doLowMem = app.instr == null;
boolean doOomAdj = doLowMem;
if (!app.killedByAm) {
- Slog.i(TAG, "Process " + app.processName + " (pid " + pid
- + ") has died");
+ Slog.i(TAG, "Process " + app.processName + " (pid " + pid + ") has died: "
+ + ProcessList.makeOomAdjString(app.setAdj)
+ + ProcessList.makeProcStateString(app.setProcState));
mAllowLowerMemLevel = true;
} else {
// Note that we always want to do oom adj to update our state with the
mAllowLowerMemLevel = false;
doLowMem = false;
}
- EventLog.writeEvent(EventLogTags.AM_PROC_DIED, app.userId, app.pid, app.processName);
+ EventLog.writeEvent(EventLogTags.AM_PROC_DIED, app.userId, app.pid, app.processName,
+ app.setAdj, app.setProcState);
if (DEBUG_CLEANUP) Slog.v(TAG_CLEANUP,
"Dying app: " + app + ", pid: " + pid + ", thread: " + thread.asBinder());
handleAppDiedLocked(app, false, true);
* appended to any existing file content.
* @param firstPids of dalvik VM processes to dump stack traces for first
* @param lastPids of dalvik VM processes to dump stack traces for last
- * @param nativeProcs optional list of native process names to dump stack crawls
- * @return file containing stack traces, or null if no dump file is configured
+ * @param nativePids optional list of native pids to dump stack crawls
*/
public static File dumpStackTraces(boolean clearTraces, ArrayList<Integer> firstPids,
- ProcessCpuTracker processCpuTracker, SparseArray<Boolean> lastPids, String[] nativeProcs) {
- String tracesPath = SystemProperties.get("dalvik.vm.stack-trace-file", null);
- if (tracesPath == null || tracesPath.length() == 0) {
- return null;
+ ProcessCpuTracker processCpuTracker, SparseArray<Boolean> lastPids,
+ ArrayList<Integer> nativePids) {
+ ArrayList<Integer> extraPids = null;
+
+ // Measure CPU usage as soon as we're called in order to get a realistic sampling
+ // of the top users at the time of the request.
+ if (processCpuTracker != null) {
+ processCpuTracker.init();
+ try {
+ Thread.sleep(200);
+ } catch (InterruptedException ignored) {
+ }
+
+ processCpuTracker.update();
+
+ // We'll take the stack crawls of just the top apps using CPU.
+ final int N = processCpuTracker.countWorkingStats();
+ extraPids = new ArrayList<>();
+ for (int i = 0; i < N && extraPids.size() < 5; i++) {
+ ProcessCpuTracker.Stats stats = processCpuTracker.getWorkingStats(i);
+ if (lastPids.indexOfKey(stats.pid) >= 0) {
+ if (DEBUG_ANR) Slog.d(TAG, "Collecting stacks for extra pid " + stats.pid);
+
+ extraPids.add(stats.pid);
+ } else if (DEBUG_ANR) {
+ Slog.d(TAG, "Skipping next CPU consuming process, not a java proc: "
+ + stats.pid);
+ }
+ }
}
- File tracesFile = new File(tracesPath);
- try {
- File tracesDir = tracesFile.getParentFile();
- if (!tracesDir.exists()) {
- tracesDir.mkdirs();
- if (!SELinux.restorecon(tracesDir)) {
- return null;
+ boolean useTombstonedForJavaTraces = false;
+ File tracesFile;
+
+ final String tracesDirProp = SystemProperties.get("dalvik.vm.stack-trace-dir", "");
+ if (tracesDirProp.isEmpty()) {
+ // When dalvik.vm.stack-trace-dir is not set, we are using the "old" trace
+ // dumping scheme. All traces are written to a global trace file (usually
+ // "/data/anr/traces.txt") so the code below must take care to unlink and recreate
+ // the file if requested.
+ //
+ // This mode of operation will be removed in the near future.
+
+
+ String globalTracesPath = SystemProperties.get("dalvik.vm.stack-trace-file", null);
+ if (globalTracesPath.isEmpty()) {
+ Slog.w(TAG, "dumpStackTraces: no trace path configured");
+ return null;
+ }
+
+ tracesFile = new File(globalTracesPath);
+ try {
+ if (clearTraces && tracesFile.exists()) {
+ tracesFile.delete();
}
+
+ tracesFile.createNewFile();
+ FileUtils.setPermissions(globalTracesPath, 0666, -1, -1); // -rw-rw-rw-
+ } catch (IOException e) {
+ Slog.w(TAG, "Unable to prepare ANR traces file: " + tracesFile, e);
+ return null;
+ }
+ } else {
+ File tracesDir = new File(tracesDirProp);
+ // When dalvik.vm.stack-trace-dir is set, we use the "new" trace dumping scheme.
+ // Each set of ANR traces is written to a separate file and dumpstate will process
+ // all such files and add them to a captured bug report if they're recent enough.
+ maybePruneOldTraces(tracesDir);
+
+ // NOTE: We should consider creating the file in native code atomically once we've
+ // gotten rid of the old scheme of dumping and lot of the code that deals with paths
+ // can be removed.
+ tracesFile = createAnrDumpFile(tracesDir);
+ if (tracesFile == null) {
+ return null;
}
- FileUtils.setPermissions(tracesDir.getPath(), 0775, -1, -1); // drwxrwxr-x
- if (clearTraces && tracesFile.exists()) tracesFile.delete();
- tracesFile.createNewFile();
- FileUtils.setPermissions(tracesFile.getPath(), 0666, -1, -1); // -rw-rw-rw-
- } catch (IOException e) {
- Slog.w(TAG, "Unable to prepare ANR traces file: " + tracesPath, e);
- return null;
+ useTombstonedForJavaTraces = true;
}
- dumpStackTraces(tracesPath, firstPids, processCpuTracker, lastPids, nativeProcs);
+ dumpStackTraces(tracesFile.getAbsolutePath(), firstPids, nativePids, extraPids,
+ useTombstonedForJavaTraces);
return tracesFile;
}
- private static void dumpStackTraces(String tracesPath, ArrayList<Integer> firstPids,
- ProcessCpuTracker processCpuTracker, SparseArray<Boolean> lastPids, String[] nativeProcs) {
- // Use a FileObserver to detect when traces finish writing.
- // The order of traces is considered important to maintain for legibility.
- FileObserver observer = new FileObserver(tracesPath, FileObserver.CLOSE_WRITE) {
- @Override
- public synchronized void onEvent(int event, String path) { notify(); }
- };
+ @GuardedBy("ActivityManagerService.class")
+ private static SimpleDateFormat sAnrFileDateFormat;
+
+ private static synchronized File createAnrDumpFile(File tracesDir) {
+ if (sAnrFileDateFormat == null) {
+ sAnrFileDateFormat = new SimpleDateFormat("yyyy-MM-dd-HH-mm-ss-SSS");
+ }
+
+ final String formattedDate = sAnrFileDateFormat.format(new Date());
+ final File anrFile = new File(tracesDir, "anr_" + formattedDate);
try {
- observer.startWatching();
+ if (anrFile.createNewFile()) {
+ FileUtils.setPermissions(anrFile.getAbsolutePath(), 0600, -1, -1); // -rw-------
+ return anrFile;
+ } else {
+ Slog.w(TAG, "Unable to create ANR dump file: createNewFile failed");
+ }
+ } catch (IOException ioe) {
+ Slog.w(TAG, "Exception creating ANR dump file:", ioe);
+ }
- // First collect all of the stacks of the most important pids.
- if (firstPids != null) {
- try {
- int num = firstPids.size();
- for (int i = 0; i < num; i++) {
- synchronized (observer) {
- Process.sendSignal(firstPids.get(i), Process.SIGNAL_QUIT);
- observer.wait(200); // Wait for write-close, give up after 200msec
- }
+ return null;
+ }
+
+ /**
+ * Prune all trace files that are more than a day old.
+ *
+ * NOTE: It might make sense to move this functionality to tombstoned eventually, along with a
+ * shift away from anr_XX and tombstone_XX to a more descriptive name. We do it here for now
+ * since it's the system_server that creates trace files for most ANRs.
+ */
+ private static void maybePruneOldTraces(File tracesDir) {
+ final long now = System.currentTimeMillis();
+ final File[] traceFiles = tracesDir.listFiles();
+
+ if (traceFiles != null) {
+ for (File file : traceFiles) {
+ if ((now - file.lastModified()) > DAY_IN_MILLIS) {
+ if (!file.delete()) {
+ Slog.w(TAG, "Unable to prune stale trace file: " + file);
}
+ }
+ }
+ }
+ }
+
+ /**
+ * Legacy code, do not use. Existing users will be deleted.
+ *
+ * @deprecated
+ */
+ @Deprecated
+ public static class DumpStackFileObserver extends FileObserver {
+ // Keep in sync with frameworks/native/cmds/dumpstate/utils.cpp
+ private static final int TRACE_DUMP_TIMEOUT_MS = 10000; // 10 seconds
+
+ private final String mTracesPath;
+ private boolean mClosed;
+
+ public DumpStackFileObserver(String tracesPath) {
+ super(tracesPath, FileObserver.CLOSE_WRITE);
+ mTracesPath = tracesPath;
+ }
+
+ @Override
+ public synchronized void onEvent(int event, String path) {
+ mClosed = true;
+ notify();
+ }
+
+ public long dumpWithTimeout(int pid, long timeout) {
+ sendSignal(pid, SIGNAL_QUIT);
+ final long start = SystemClock.elapsedRealtime();
+
+ final long waitTime = Math.min(timeout, TRACE_DUMP_TIMEOUT_MS);
+ synchronized (this) {
+ try {
+ wait(waitTime); // Wait for traces file to be closed.
} catch (InterruptedException e) {
Slog.wtf(TAG, e);
}
}
- // Next collect the stacks of the native pids
- if (nativeProcs != null) {
- int[] pids = Process.getPidsForCommands(nativeProcs);
- if (pids != null) {
- for (int pid : pids) {
- Debug.dumpNativeBacktraceToFile(pid, tracesPath);
+ // This avoids a corner case of passing a negative time to the native
+ // trace in case we've already hit the overall timeout.
+ final long timeWaited = SystemClock.elapsedRealtime() - start;
+ if (timeWaited >= timeout) {
+ return timeWaited;
+ }
+
+ if (!mClosed) {
+ Slog.w(TAG, "Didn't see close of " + mTracesPath + " for pid " + pid +
+ ". Attempting native stack collection.");
+
+ final long nativeDumpTimeoutMs = Math.min(
+ NATIVE_DUMP_TIMEOUT_MS, timeout - timeWaited);
+
+ Debug.dumpNativeBacktraceToFileTimeout(pid, mTracesPath,
+ (int) (nativeDumpTimeoutMs / 1000));
+ }
+
+ final long end = SystemClock.elapsedRealtime();
+ mClosed = false;
+
+ return (end - start);
+ }
+ }
+
+ /**
+ * Dump java traces for process {@code pid} to the specified file. If java trace dumping
+ * fails, a native backtrace is attempted. Note that the timeout {@code timeoutMs} only applies
+ * to the java section of the trace, a further {@code NATIVE_DUMP_TIMEOUT_MS} might be spent
+ * attempting to obtain native traces in the case of a failure. Returns the total time spent
+ * capturing traces.
+ */
+ private static long dumpJavaTracesTombstoned(int pid, String fileName, long timeoutMs) {
+ final long timeStart = SystemClock.elapsedRealtime();
+ if (!Debug.dumpJavaBacktraceToFileTimeout(pid, fileName, (int) (timeoutMs / 1000))) {
+ Debug.dumpNativeBacktraceToFileTimeout(pid, fileName,
+ (NATIVE_DUMP_TIMEOUT_MS / 1000));
+ }
+
+ return SystemClock.elapsedRealtime() - timeStart;
+ }
+
+ private static void dumpStackTraces(String tracesFile, ArrayList<Integer> firstPids,
+ ArrayList<Integer> nativePids, ArrayList<Integer> extraPids,
+ boolean useTombstonedForJavaTraces) {
+
+ // We don't need any sort of inotify based monitoring when we're dumping traces via
+ // tombstoned. Data is piped to an "intercept" FD installed in tombstoned so we're in full
+ // control of all writes to the file in question.
+ final DumpStackFileObserver observer;
+ if (useTombstonedForJavaTraces) {
+ observer = null;
+ } else {
+ // Use a FileObserver to detect when traces finish writing.
+ // The order of traces is considered important to maintain for legibility.
+ observer = new DumpStackFileObserver(tracesFile);
+ }
+
+ // We must complete all stack dumps within 20 seconds.
+ long remainingTime = 20 * 1000;
+ try {
+ if (observer != null) {
+ observer.startWatching();
+ }
+
+ // First collect all of the stacks of the most important pids.
+ if (firstPids != null) {
+ int num = firstPids.size();
+ for (int i = 0; i < num; i++) {
+ if (DEBUG_ANR) Slog.d(TAG, "Collecting stacks for pid "
+ + firstPids.get(i));
+ final long timeTaken;
+ if (useTombstonedForJavaTraces) {
+ timeTaken = dumpJavaTracesTombstoned(firstPids.get(i), tracesFile, remainingTime);
+ } else {
+ timeTaken = observer.dumpWithTimeout(firstPids.get(i), remainingTime);
+ }
+
+ remainingTime -= timeTaken;
+ if (remainingTime <= 0) {
+ Slog.e(TAG, "Aborting stack trace dump (current firstPid=" + firstPids.get(i) +
+ "); deadline exceeded.");
+ return;
+ }
+
+ if (DEBUG_ANR) {
+ Slog.d(TAG, "Done with pid " + firstPids.get(i) + " in " + timeTaken + "ms");
}
}
}
- // Lastly, measure CPU usage.
- if (processCpuTracker != null) {
- processCpuTracker.init();
- System.gc();
- processCpuTracker.update();
- try {
- synchronized (processCpuTracker) {
- processCpuTracker.wait(500); // measure over 1/2 second.
+ // Next collect the stacks of the native pids
+ if (nativePids != null) {
+ for (int pid : nativePids) {
+ if (DEBUG_ANR) Slog.d(TAG, "Collecting stacks for native pid " + pid);
+ final long nativeDumpTimeoutMs = Math.min(NATIVE_DUMP_TIMEOUT_MS, remainingTime);
+
+ final long start = SystemClock.elapsedRealtime();
+ Debug.dumpNativeBacktraceToFileTimeout(
+ pid, tracesFile, (int) (nativeDumpTimeoutMs / 1000));
+ final long timeTaken = SystemClock.elapsedRealtime() - start;
+
+ remainingTime -= timeTaken;
+ if (remainingTime <= 0) {
+ Slog.e(TAG, "Aborting stack trace dump (current native pid=" + pid +
+ "); deadline exceeded.");
+ return;
+ }
+
+ if (DEBUG_ANR) {
+ Slog.d(TAG, "Done with native pid " + pid + " in " + timeTaken + "ms");
}
- } catch (InterruptedException e) {
}
- processCpuTracker.update();
+ }
- // We'll take the stack crawls of just the top apps using CPU.
- final int N = processCpuTracker.countWorkingStats();
- int numProcs = 0;
- for (int i=0; i<N && numProcs<5; i++) {
- ProcessCpuTracker.Stats stats = processCpuTracker.getWorkingStats(i);
- if (lastPids.indexOfKey(stats.pid) >= 0) {
- numProcs++;
- try {
- synchronized (observer) {
- Process.sendSignal(stats.pid, Process.SIGNAL_QUIT);
- observer.wait(200); // Wait for write-close, give up after 200msec
- }
- } catch (InterruptedException e) {
- Slog.wtf(TAG, e);
- }
+ // Lastly, dump stacks for all extra PIDs from the CPU tracker.
+ if (extraPids != null) {
+ for (int pid : extraPids) {
+ if (DEBUG_ANR) Slog.d(TAG, "Collecting stacks for extra pid " + pid);
+
+ final long timeTaken;
+ if (useTombstonedForJavaTraces) {
+ timeTaken = dumpJavaTracesTombstoned(pid, tracesFile, remainingTime);
+ } else {
+ timeTaken = observer.dumpWithTimeout(pid, remainingTime);
+ }
+
+ remainingTime -= timeTaken;
+ if (remainingTime <= 0) {
+ Slog.e(TAG, "Aborting stack trace dump (current extra pid=" + pid +
+ "); deadline exceeded.");
+ return;
+ }
+ if (DEBUG_ANR) {
+ Slog.d(TAG, "Done with extra pid " + pid + " in " + timeTaken + "ms");
}
}
}
} finally {
- observer.stopWatching();
+ if (observer != null) {
+ observer.stopWatching();
+ }
}
}
final void logAppTooSlow(ProcessRecord app, long startTime, String msg) {
- if (true || IS_USER_BUILD) {
+ if (true || Build.IS_USER) {
return;
}
String tracesPath = SystemProperties.get("dalvik.vm.stack-trace-file", null);
final File tracesDir = tracesFile.getParentFile();
final File tracesTmp = new File(tracesDir, "__tmp__");
try {
- if (!tracesDir.exists()) {
- tracesDir.mkdirs();
- if (!SELinux.restorecon(tracesDir.getPath())) {
- return;
- }
- }
- FileUtils.setPermissions(tracesDir.getPath(), 0775, -1, -1); // drwxrwxr-x
-
if (tracesFile.exists()) {
tracesTmp.delete();
tracesFile.renameTo(tracesTmp);
if (app != null) {
ArrayList<Integer> firstPids = new ArrayList<Integer>();
firstPids.add(app.pid);
- dumpStackTraces(tracesPath, firstPids, null, null, null);
+ dumpStackTraces(tracesPath, firstPids, null, null, true /* useTombstoned */);
}
File lastTracesFile = null;
}
}
- final void appNotResponding(ProcessRecord app, ActivityRecord activity,
- ActivityRecord parent, boolean aboveSystem, final String annotation) {
- ArrayList<Integer> firstPids = new ArrayList<Integer>(5);
- SparseArray<Boolean> lastPids = new SparseArray<Boolean>(20);
-
- if (mController != null) {
- try {
- // 0 == continue, -1 = kill process immediately
- int res = mController.appEarlyNotResponding(app.processName, app.pid, annotation);
- if (res < 0 && app.pid != MY_PID) {
- app.kill("anr", true);
- }
- } catch (RemoteException e) {
- mController = null;
- Watchdog.getInstance().setActivityController(null);
- }
- }
-
- long anrTime = SystemClock.uptimeMillis();
- if (MONITOR_CPU_USAGE) {
- updateCpuStatsNow();
- }
-
- synchronized (this) {
- // PowerManager.reboot() can block for a long time, so ignore ANRs while shutting down.
- if (mShuttingDown) {
- Slog.i(TAG, "During shutdown skipping ANR: " + app + " " + annotation);
- return;
- } else if (app.notResponding) {
- Slog.i(TAG, "Skipping duplicate ANR: " + app + " " + annotation);
- return;
- } else if (app.crashing) {
- Slog.i(TAG, "Crashing app skipping ANR: " + app + " " + annotation);
- return;
- }
-
- // In case we come through here for the same app before completing
- // this one, mark as anring now so we will bail out.
- app.notResponding = true;
-
- // Log the ANR to the event log.
- EventLog.writeEvent(EventLogTags.AM_ANR, app.userId, app.pid,
- app.processName, app.info.flags, annotation);
-
- // Dump thread traces as quickly as we can, starting with "interesting" processes.
- firstPids.add(app.pid);
-
- int parentPid = app.pid;
- if (parent != null && parent.app != null && parent.app.pid > 0) parentPid = parent.app.pid;
- if (parentPid != app.pid) firstPids.add(parentPid);
-
- if (MY_PID != app.pid && MY_PID != parentPid) firstPids.add(MY_PID);
-
- for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
- ProcessRecord r = mLruProcesses.get(i);
- if (r != null && r.thread != null) {
- int pid = r.pid;
- if (pid > 0 && pid != app.pid && pid != parentPid && pid != MY_PID) {
- if (r.persistent) {
- firstPids.add(pid);
- } else {
- lastPids.put(pid, Boolean.TRUE);
- }
- }
- }
- }
- }
-
- // Log the ANR to the main log.
- StringBuilder info = new StringBuilder();
- info.setLength(0);
- info.append("ANR in ").append(app.processName);
- if (activity != null && activity.shortComponentName != null) {
- info.append(" (").append(activity.shortComponentName).append(")");
- }
- info.append("\n");
- info.append("PID: ").append(app.pid).append("\n");
- if (annotation != null) {
- info.append("Reason: ").append(annotation).append("\n");
- }
- if (parent != null && parent != activity) {
- info.append("Parent: ").append(parent.shortComponentName).append("\n");
- }
-
- final ProcessCpuTracker processCpuTracker = new ProcessCpuTracker(true);
-
- File tracesFile = dumpStackTraces(true, firstPids, processCpuTracker, lastPids,
- NATIVE_STACKS_OF_INTEREST);
-
- String cpuInfo = null;
- if (MONITOR_CPU_USAGE) {
- updateCpuStatsNow();
- synchronized (mProcessCpuTracker) {
- cpuInfo = mProcessCpuTracker.printCurrentState(anrTime);
- }
- info.append(processCpuTracker.printCurrentLoad());
- info.append(cpuInfo);
- }
-
- info.append(processCpuTracker.printCurrentState(anrTime));
-
- Slog.e(TAG, info.toString());
- if (tracesFile == null) {
- // There is no trace file, so dump (only) the alleged culprit's threads to the log
- Process.sendSignal(app.pid, Process.SIGNAL_QUIT);
- }
-
- addErrorToDropBox("anr", app, app.processName, activity, parent, annotation,
- cpuInfo, tracesFile, null);
-
- if (mController != null) {
- try {
- // 0 == show dialog, 1 = keep waiting, -1 = kill process immediately
- int res = mController.appNotResponding(app.processName, app.pid, info.toString());
- if (res != 0) {
- if (res < 0 && app.pid != MY_PID) {
- app.kill("anr", true);
- } else {
- synchronized (this) {
- mServices.scheduleServiceTimeoutLocked(app);
- }
- }
- return;
- }
- } catch (RemoteException e) {
- mController = null;
- Watchdog.getInstance().setActivityController(null);
- }
- }
-
- // Unless configured otherwise, swallow ANRs in background processes & kill the process.
- boolean showBackground = Settings.Secure.getInt(mContext.getContentResolver(),
- Settings.Secure.ANR_SHOW_BACKGROUND, 0) != 0;
-
- synchronized (this) {
- mBatteryStatsService.noteProcessAnr(app.processName, app.uid);
-
- if (!showBackground && !app.isInterestingToUserLocked() && app.pid != MY_PID) {
- app.kill("bg anr", true);
- return;
- }
-
- // Set the app's notResponding state, and look up the errorReportReceiver
- makeAppNotRespondingLocked(app,
- activity != null ? activity.shortComponentName : null,
- annotation != null ? "ANR " + annotation : "ANR",
- info.toString());
-
- // Bring up the infamous App Not Responding dialog
- Message msg = Message.obtain();
- HashMap<String, Object> map = new HashMap<String, Object>();
- msg.what = SHOW_NOT_RESPONDING_MSG;
- msg.obj = map;
- msg.arg1 = aboveSystem ? 1 : 0;
- map.put("app", app);
- if (activity != null) {
- map.put("activity", activity);
- }
-
- mUiHandler.sendMessage(msg);
- }
- }
-
final void showLaunchWarningLocked(final ActivityRecord cur, final ActivityRecord next) {
if (!mLaunchWarningShown) {
mLaunchWarningShown = true;
public boolean clearApplicationUserData(final String packageName,
final IPackageDataObserver observer, int userId) {
enforceNotIsolatedCaller("clearApplicationUserData");
- if (packageName != null && packageName.equals(mDeviceOwnerName)) {
- throw new SecurityException("Clearing DeviceOwner data is forbidden.");
- }
int uid = Binder.getCallingUid();
int pid = Binder.getCallingPid();
- userId = handleIncomingUser(pid, uid,
- userId, false, ALLOW_FULL_ONLY, "clearApplicationUserData", null);
+ final int resolvedUserId = mUserController.handleIncomingUser(pid, uid, userId, false,
+ ALLOW_FULL_ONLY, "clearApplicationUserData", null);
+
+ final ApplicationInfo appInfo;
+ final boolean isInstantApp;
+
long callingId = Binder.clearCallingIdentity();
try {
IPackageManager pm = AppGlobals.getPackageManager();
- int pkgUid = -1;
synchronized(this) {
+ // Instant packages are not protected
+ if (getPackageManagerInternalLocked().isPackageDataProtected(
+ resolvedUserId, packageName)) {
+ throw new SecurityException(
+ "Cannot clear data for a protected package: " + packageName);
+ }
+
+ ApplicationInfo applicationInfo = null;
try {
- pkgUid = pm.getPackageUid(packageName, userId);
+ applicationInfo = pm.getApplicationInfo(packageName,
+ MATCH_UNINSTALLED_PACKAGES, resolvedUserId);
} catch (RemoteException e) {
+ /* ignore */
}
- if (pkgUid == -1) {
+ appInfo = applicationInfo;
+
+ final boolean clearingOwnUidData = appInfo != null && appInfo.uid == uid;
+
+ if (!clearingOwnUidData && checkComponentPermission(permission.CLEAR_APP_USER_DATA,
+ pid, uid, -1, true) != PackageManager.PERMISSION_GRANTED) {
+ throw new SecurityException("PID " + pid + " does not have permission "
+ + android.Manifest.permission.CLEAR_APP_USER_DATA + " to clear data"
+ + " of package " + packageName);
+ }
+
+ final boolean hasInstantMetadata = getPackageManagerInternalLocked()
+ .hasInstantApplicationMetadata(packageName, resolvedUserId);
+ final boolean isUninstalledAppWithoutInstantMetadata =
+ (appInfo == null && !hasInstantMetadata);
+ isInstantApp = (appInfo != null && appInfo.isInstantApp())
+ || hasInstantMetadata;
+ final boolean canAccessInstantApps = checkComponentPermission(
+ permission.ACCESS_INSTANT_APPS, pid, uid, -1, true)
+ == PackageManager.PERMISSION_GRANTED;
+
+ if (isUninstalledAppWithoutInstantMetadata || (isInstantApp
+ && !canAccessInstantApps)) {
Slog.w(TAG, "Invalid packageName: " + packageName);
if (observer != null) {
try {
}
return false;
}
- if (uid == pkgUid || checkComponentPermission(
- android.Manifest.permission.CLEAR_APP_USER_DATA,
- pid, uid, -1, true)
- == PackageManager.PERMISSION_GRANTED) {
- forceStopPackageLocked(packageName, pkgUid, "clear data");
- } else {
- throw new SecurityException("PID " + pid + " does not have permission "
- + android.Manifest.permission.CLEAR_APP_USER_DATA + " to clear data"
- + " of package " + packageName);
- }
- // Remove all tasks match the cleared application package and user
- for (int i = mRecentTasks.size() - 1; i >= 0; i--) {
- final TaskRecord tr = mRecentTasks.get(i);
- final String taskPackageName =
- tr.getBaseIntent().getComponent().getPackageName();
- if (tr.userId != userId) continue;
- if (!taskPackageName.equals(packageName)) continue;
- removeTaskByIdLocked(tr.taskId, false);
+ if (appInfo != null) {
+ forceStopPackageLocked(packageName, appInfo.uid, "clear data");
+ // Remove all tasks match the cleared application package and user
+ for (int i = mRecentTasks.size() - 1; i >= 0; i--) {
+ final TaskRecord tr = mRecentTasks.get(i);
+ final String taskPackageName =
+ tr.getBaseIntent().getComponent().getPackageName();
+ if (tr.userId != resolvedUserId) continue;
+ if (!taskPackageName.equals(packageName)) continue;
+ mStackSupervisor.removeTaskByIdLocked(tr.taskId, false,
+ REMOVE_FROM_RECENTS);
+ }
}
}
+ final IPackageDataObserver localObserver = new IPackageDataObserver.Stub() {
+ @Override
+ public void onRemoveCompleted(String packageName, boolean succeeded)
+ throws RemoteException {
+ if (appInfo != null) {
+ synchronized (ActivityManagerService.this) {
+ finishForceStopPackageLocked(packageName, appInfo.uid);
+ }
+ }
+ final Intent intent = new Intent(Intent.ACTION_PACKAGE_DATA_CLEARED,
+ Uri.fromParts("package", packageName, null));
+ intent.addFlags(Intent.FLAG_RECEIVER_INCLUDE_BACKGROUND);
+ intent.putExtra(Intent.EXTRA_UID, (appInfo != null) ? appInfo.uid : -1);
+ intent.putExtra(Intent.EXTRA_USER_HANDLE, resolvedUserId);
+ if (isInstantApp) {
+ intent.putExtra(Intent.EXTRA_PACKAGE_NAME, packageName);
+ broadcastIntentInPackage("android", SYSTEM_UID, intent, null, null, 0,
+ null, null, permission.ACCESS_INSTANT_APPS, null, false, false,
+ resolvedUserId);
+ } else {
+ broadcastIntentInPackage("android", SYSTEM_UID, intent, null, null, 0,
+ null, null, null, null, false, false, resolvedUserId);
+ }
+
+ if (observer != null) {
+ observer.onRemoveCompleted(packageName, succeeded);
+ }
+ }
+ };
+
try {
// Clear application user data
- pm.clearApplicationUserData(packageName, observer, userId);
+ pm.clearApplicationUserData(packageName, localObserver, resolvedUserId);
- synchronized(this) {
- // Remove all permissions granted from/to this package
- removeUriPermissionsForPackageLocked(packageName, userId, true);
- }
+ if (appInfo != null) {
+ synchronized (this) {
+ // Remove all permissions granted from/to this package
+ removeUriPermissionsForPackageLocked(packageName, resolvedUserId, true);
+ }
- Intent intent = new Intent(Intent.ACTION_PACKAGE_DATA_CLEARED,
- Uri.fromParts("package", packageName, null));
- intent.putExtra(Intent.EXTRA_UID, pkgUid);
- broadcastIntentInPackage("android", Process.SYSTEM_UID, intent,
- null, null, 0, null, null, null, null, false, false, userId);
+ // Reset notification settings.
+ INotificationManager inm = NotificationManager.getService();
+ inm.clearData(packageName, appInfo.uid, uid == appInfo.uid);
+ }
} catch (RemoteException e) {
}
} finally {
throw new SecurityException(msg);
}
- userId = handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(),
+ userId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(),
userId, true, ALLOW_FULL_ONLY, "killBackgroundProcesses", null);
long callingId = Binder.clearCallingIdentity();
try {
synchronized(this) {
int appId = -1;
try {
- appId = UserHandle.getAppId(pm.getPackageUid(packageName, 0));
+ appId = UserHandle.getAppId(
+ pm.getPackageUid(packageName, MATCH_DEBUG_TRIAGED_MISSING, userId));
} catch (RemoteException e) {
}
if (appId == -1) {
public void killAllBackgroundProcesses() {
if (checkCallingPermission(android.Manifest.permission.KILL_BACKGROUND_PROCESSES)
!= PackageManager.PERMISSION_GRANTED) {
- String msg = "Permission Denial: killAllBackgroundProcesses() from pid="
- + Binder.getCallingPid()
- + ", uid=" + Binder.getCallingUid()
+ final String msg = "Permission Denial: killAllBackgroundProcesses() from pid="
+ + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid()
+ " requires " + android.Manifest.permission.KILL_BACKGROUND_PROCESSES;
Slog.w(TAG, msg);
throw new SecurityException(msg);
}
- long callingId = Binder.clearCallingIdentity();
+ final long callingId = Binder.clearCallingIdentity();
try {
- synchronized(this) {
- ArrayList<ProcessRecord> procs = new ArrayList<ProcessRecord>();
+ synchronized (this) {
+ final ArrayList<ProcessRecord> procs = new ArrayList<>();
final int NP = mProcessNames.getMap().size();
- for (int ip=0; ip<NP; ip++) {
- SparseArray<ProcessRecord> apps = mProcessNames.getMap().valueAt(ip);
+ for (int ip = 0; ip < NP; ip++) {
+ final SparseArray<ProcessRecord> apps = mProcessNames.getMap().valueAt(ip);
final int NA = apps.size();
- for (int ia=0; ia<NA; ia++) {
- ProcessRecord app = apps.valueAt(ia);
+ for (int ia = 0; ia < NA; ia++) {
+ final ProcessRecord app = apps.valueAt(ia);
if (app.persistent) {
- // we don't kill persistent processes
+ // We don't kill persistent processes.
continue;
}
if (app.removed) {
}
}
- int N = procs.size();
- for (int i=0; i<N; i++) {
+ final int N = procs.size();
+ for (int i = 0; i < N; i++) {
removeProcessLocked(procs.get(i), false, true, "kill all background");
}
+
mAllowLowerMemLevel = true;
+
updateOomAdjLocked();
doLowMemReportIfNeededLocked(null);
}
}
}
+ /**
+ * Kills all background processes, except those matching any of the
+ * specified properties.
+ *
+ * @param minTargetSdk the target SDK version at or above which to preserve
+ * processes, or {@code -1} to ignore the target SDK
+ * @param maxProcState the process state at or below which to preserve
+ * processes, or {@code -1} to ignore the process state
+ */
+ private void killAllBackgroundProcessesExcept(int minTargetSdk, int maxProcState) {
+ if (checkCallingPermission(android.Manifest.permission.KILL_BACKGROUND_PROCESSES)
+ != PackageManager.PERMISSION_GRANTED) {
+ final String msg = "Permission Denial: killAllBackgroundProcessesExcept() from pid="
+ + Binder.getCallingPid() + ", uid=" + Binder.getCallingUid()
+ + " requires " + android.Manifest.permission.KILL_BACKGROUND_PROCESSES;
+ Slog.w(TAG, msg);
+ throw new SecurityException(msg);
+ }
+
+ final long callingId = Binder.clearCallingIdentity();
+ try {
+ synchronized (this) {
+ final ArrayList<ProcessRecord> procs = new ArrayList<>();
+ final int NP = mProcessNames.getMap().size();
+ for (int ip = 0; ip < NP; ip++) {
+ final SparseArray<ProcessRecord> apps = mProcessNames.getMap().valueAt(ip);
+ final int NA = apps.size();
+ for (int ia = 0; ia < NA; ia++) {
+ final ProcessRecord app = apps.valueAt(ia);
+ if (app.removed) {
+ procs.add(app);
+ } else if ((minTargetSdk < 0 || app.info.targetSdkVersion < minTargetSdk)
+ && (maxProcState < 0 || app.setProcState > maxProcState)) {
+ app.removed = true;
+ procs.add(app);
+ }
+ }
+ }
+
+ final int N = procs.size();
+ for (int i = 0; i < N; i++) {
+ removeProcessLocked(procs.get(i), false, true, "kill all background except");
+ }
+ }
+ } finally {
+ Binder.restoreCallingIdentity(callingId);
+ }
+ }
+
@Override
public void forceStopPackage(final String packageName, int userId) {
if (checkCallingPermission(android.Manifest.permission.FORCE_STOP_PACKAGES)
throw new SecurityException(msg);
}
final int callingPid = Binder.getCallingPid();
- userId = handleIncomingUser(callingPid, Binder.getCallingUid(),
+ userId = mUserController.handleIncomingUser(callingPid, Binder.getCallingUid(),
userId, true, ALLOW_FULL_ONLY, "forceStopPackage", null);
long callingId = Binder.clearCallingIdentity();
try {
IPackageManager pm = AppGlobals.getPackageManager();
synchronized(this) {
int[] users = userId == UserHandle.USER_ALL
- ? getUsersLocked() : new int[] { userId };
+ ? mUserController.getUsers() : new int[] { userId };
for (int user : users) {
int pkgUid = -1;
try {
- pkgUid = pm.getPackageUid(packageName, user);
+ pkgUid = pm.getPackageUid(packageName, MATCH_DEBUG_TRIAGED_MISSING,
+ user);
} catch (RemoteException e) {
}
if (pkgUid == -1) {
Slog.w(TAG, "Failed trying to unstop package "
+ packageName + ": " + e);
}
- if (isUserRunningLocked(user, false)) {
+ if (mUserController.isUserRunningLocked(user, 0)) {
forceStopPackageLocked(packageName, pkgUid, "from pid " + callingPid);
+ finishForceStopPackageLocked(packageName, pkgUid);
}
}
}
public void addPackageDependency(String packageName) {
synchronized (this) {
int callingPid = Binder.getCallingPid();
- if (callingPid == Process.myPid()) {
+ if (callingPid == myPid()) {
// Yeah, um, no.
return;
}
* The pkg name and app id have to be specified.
*/
@Override
- public void killApplicationWithAppId(String pkg, int appid, String reason) {
+ public void killApplication(String pkg, int appId, int userId, String reason) {
if (pkg == null) {
return;
}
// Make sure the uid is valid.
- if (appid < 0) {
+ if (appId < 0) {
Slog.w(TAG, "Invalid appid specified for pkg : " + pkg);
return;
}
int callerUid = Binder.getCallingUid();
// Only the system server can kill an application
- if (UserHandle.getAppId(callerUid) == Process.SYSTEM_UID) {
+ if (UserHandle.getAppId(callerUid) == SYSTEM_UID) {
// Post an aysnc message to kill the application
Message msg = mHandler.obtainMessage(KILL_APPLICATION_MSG);
- msg.arg1 = appid;
- msg.arg2 = 0;
+ msg.arg1 = appId;
+ msg.arg2 = userId;
Bundle bundle = new Bundle();
bundle.putString("pkg", pkg);
bundle.putString("reason", reason);
synchronized (this) {
// Only allow this from foreground processes, so that background
// applications can't abuse it to prevent system UI from being shown.
- if (uid >= Process.FIRST_APPLICATION_UID) {
+ if (uid >= FIRST_APPLICATION_UID) {
ProcessRecord proc;
synchronized (mPidsSelfLocked) {
proc = mPidsSelfLocked.get(pid);
broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null,
AppOpsManager.OP_NONE, null, false, false,
- -1, Process.SYSTEM_UID, UserHandle.USER_ALL);
+ -1, SYSTEM_UID, UserHandle.USER_ALL);
}
@Override
int callerUid = Binder.getCallingUid();
// Only the system server can kill an application
- if (callerUid == Process.SYSTEM_UID) {
+ if (callerUid == SYSTEM_UID) {
synchronized (this) {
ProcessRecord app = getProcessRecordLocked(processName, uid, true);
if (app != null && app.thread != null) {
private void forceStopPackageLocked(final String packageName, int uid, String reason) {
forceStopPackageLocked(packageName, UserHandle.getAppId(uid), false,
false, true, false, false, UserHandle.getUserId(uid), reason);
+ }
+
+ private void finishForceStopPackageLocked(final String packageName, int uid) {
Intent intent = new Intent(Intent.ACTION_PACKAGE_RESTARTED,
Uri.fromParts("package", packageName, null));
if (!mProcessesReady) {
intent.putExtra(Intent.EXTRA_USER_HANDLE, UserHandle.getUserId(uid));
broadcastIntentLocked(null, null, intent,
null, null, 0, null, null, null, AppOpsManager.OP_NONE,
- null, false, false, MY_PID, Process.SYSTEM_UID, UserHandle.getUserId(uid));
+ null, false, false, MY_PID, SYSTEM_UID, UserHandle.getUserId(uid));
}
- private void forceStopUserLocked(int userId, String reason) {
- forceStopPackageLocked(null, -1, false, false, true, false, false, userId, reason);
- Intent intent = new Intent(Intent.ACTION_USER_STOPPED);
- intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY
- | Intent.FLAG_RECEIVER_FOREGROUND);
- intent.putExtra(Intent.EXTRA_USER_HANDLE, userId);
- broadcastIntentLocked(null, null, intent,
- null, null, 0, null, null, null, AppOpsManager.OP_NONE,
- null, false, false, MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
- }
private final boolean killPackageProcessesLocked(String packageName, int appId,
int userId, int minOomAdj, boolean callerWillRestart, boolean allowRestart,
try {
// Entire package setting changed
enabled = pm.getApplicationEnabledSetting(packageName,
- (userId != UserHandle.USER_ALL) ? userId : UserHandle.USER_OWNER);
+ (userId != UserHandle.USER_ALL) ? userId : UserHandle.USER_SYSTEM);
} catch (Exception e) {
// No such package/component; probably racing with uninstall. In any
// event it means we have nothing further to do here.
try {
enabled = pm.getComponentEnabledSetting(
new ComponentName(packageName, changedClass),
- (userId != UserHandle.USER_ALL) ? userId : UserHandle.USER_OWNER);
+ (userId != UserHandle.USER_ALL) ? userId : UserHandle.USER_SYSTEM);
} catch (Exception e) {
// As above, probably racing with uninstall.
return;
// Clean-up disabled activities.
if (mStackSupervisor.finishDisabledPackageActivitiesLocked(
packageName, disabledClasses, true, false, userId) && mBooted) {
- mStackSupervisor.resumeTopActivitiesLocked();
+ mStackSupervisor.resumeFocusedStackTopActivityLocked();
mStackSupervisor.scheduleIdleLocked();
}
}
- private final boolean forceStopPackageLocked(String packageName, int appId,
+ final boolean clearBroadcastQueueForUserLocked(int userId) {
+ boolean didSomething = false;
+ for (int i = mBroadcastQueues.length - 1; i >= 0; i--) {
+ didSomething |= mBroadcastQueues[i].cleanupDisabledPackageReceiversLocked(
+ null, null, userId, true);
+ }
+ return didSomething;
+ }
+
+ final boolean forceStopPackageLocked(String packageName, int appId,
boolean callerWillRestart, boolean purgeCache, boolean doit,
boolean evenPersistent, boolean uninstalling, int userId, String reason) {
int i;
if (appId < 0 && packageName != null) {
try {
- appId = UserHandle.getAppId(
- AppGlobals.getPackageManager().getPackageUid(packageName, 0));
+ appId = UserHandle.getAppId(AppGlobals.getPackageManager()
+ .getPackageUid(packageName, MATCH_DEBUG_TRIAGED_MISSING, 0));
} catch (RemoteException e) {
}
}
Slog.i(TAG, "Force stopping u" + userId + ": " + reason);
}
- final ArrayMap<String, SparseArray<Long>> pmap = mProcessCrashTimes.getMap();
- for (int ip = pmap.size() - 1; ip >= 0; ip--) {
- SparseArray<Long> ba = pmap.valueAt(ip);
- for (i = ba.size() - 1; i >= 0; i--) {
- boolean remove = false;
- final int entUid = ba.keyAt(i);
- if (packageName != null) {
- if (userId == UserHandle.USER_ALL) {
- if (UserHandle.getAppId(entUid) == appId) {
- remove = true;
- }
- } else {
- if (entUid == UserHandle.getUid(userId, appId)) {
- remove = true;
- }
- }
- } else if (UserHandle.getUserId(entUid) == userId) {
- remove = true;
- }
- if (remove) {
- ba.removeAt(i);
- }
- }
- if (ba.size() == 0) {
- pmap.removeAt(ip);
- }
- }
+ mAppErrors.resetProcessCrashTimeLocked(packageName == null, appId, userId);
}
boolean didSomething = killPackageProcessesLocked(packageName, appId, userId,
- -100, callerWillRestart, true, doit, evenPersistent,
+ ProcessList.INVALID_ADJ, callerWillRestart, true, doit, evenPersistent,
packageName == null ? ("stop user " + userId) : ("stop " + packageName));
+ didSomething |= mActivityStarter.clearPendingActivityLaunchesLocked(packageName);
+
if (mStackSupervisor.finishDisabledPackageActivitiesLocked(
packageName, null, doit, evenPersistent, userId)) {
if (!doit) {
}
didSomething = true;
it.remove();
- pir.canceled = true;
+ makeIntentSenderCanceledLocked(pir);
if (pir.key.activity != null && pir.key.activity.pendingResults != null) {
pir.key.activity.pendingResults.remove(pir.ref);
}
}
}
if (mBooted) {
- mStackSupervisor.resumeTopActivitiesLocked();
+ mStackSupervisor.resumeFocusedStackTopActivityLocked();
mStackSupervisor.scheduleIdleLocked();
}
}
}
private final ProcessRecord removeProcessNameLocked(final String name, final int uid) {
- ProcessRecord old = mProcessNames.remove(name, uid);
- if (old != null) {
+ return removeProcessNameLocked(name, uid, null);
+ }
+
+ private final ProcessRecord removeProcessNameLocked(final String name, final int uid,
+ final ProcessRecord expecting) {
+ ProcessRecord old = mProcessNames.get(name, uid);
+ // Only actually remove when the currently recorded value matches the
+ // record that we expected; if it doesn't match then we raced with a
+ // newly created process and we don't want to destroy the new one.
+ if ((expecting == null) || (old == expecting)) {
+ mProcessNames.remove(name, uid);
+ }
+ if (old != null && old.uidRecord != null) {
old.uidRecord.numProcs--;
if (old.uidRecord.numProcs == 0) {
// No more processes using this uid, tell clients it is gone.
if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
"No more processes in " + old.uidRecord);
- enqueueUidChangeLocked(old.uidRecord, true);
+ enqueueUidChangeLocked(old.uidRecord, -1, UidRecord.CHANGE_GONE);
+ EventLogTags.writeAmUidStopped(uid);
mActiveUids.remove(uid);
+ noteUidProcessState(uid, ActivityManager.PROCESS_STATE_NONEXISTENT);
}
old.uidRecord = null;
}
// This is the first appearance of the uid, report it now!
if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
"Creating new process uid: " + uidRec);
+ if (Arrays.binarySearch(mDeviceIdleTempWhitelist, UserHandle.getAppId(proc.uid)) >= 0
+ || mPendingTempWhitelist.indexOfKey(proc.uid) >= 0) {
+ uidRec.setWhitelist = uidRec.curWhitelist = true;
+ }
+ uidRec.updateHasInternetPermission();
mActiveUids.put(proc.uid, uidRec);
- enqueueUidChangeLocked(uidRec, false);
+ EventLogTags.writeAmUidRunning(uidRec.uid);
+ noteUidProcessState(uidRec.uid, uidRec.curProcState);
}
proc.uidRecord = uidRec;
+
+ // Reset render thread tid if it was already set, so new process can set it again.
+ proc.renderThreadTid = 0;
uidRec.numProcs++;
mProcessNames.put(proc.processName, proc.uid, proc);
if (proc.isolated) {
}
}
- private final boolean removeProcessLocked(ProcessRecord app,
+ boolean removeProcessLocked(ProcessRecord app,
boolean callerWillRestart, boolean allowRestart, String reason) {
final String name = app.processName;
final int uid = app.uid;
if (DEBUG_PROCESSES) Slog.d(TAG_PROCESSES,
"Force removing proc " + app.toShortString() + " (" + name + "/" + uid + ")");
+ ProcessRecord old = mProcessNames.get(name, uid);
+ if (old != app) {
+ // This process is no longer active, so nothing to do.
+ Slog.w(TAG, "Ignoring remove of inactive process: " + app);
+ return false;
+ }
removeProcessNameLocked(name, uid);
if (mHeavyWeightProcess == app) {
mHandler.sendMessage(mHandler.obtainMessage(CANCEL_HEAVY_NOTIFICATION_MSG,
mHandler.removeMessages(PROC_START_TIMEOUT_MSG, app);
}
mBatteryStatsService.noteProcessFinish(app.processName, app.info.uid);
- if (app.isolated) {
- mBatteryStatsService.removeIsolatedUid(app.uid, app.info.uid);
- }
boolean willRestart = false;
if (app.persistent && !app.isolated) {
if (!callerWillRestart) {
}
}
app.kill(reason, true);
+ if (app.isolated) {
+ mBatteryStatsService.removeIsolatedUid(app.uid, app.info.uid);
+ getPackageManagerInternalLocked().removeIsolatedUid(app.uid);
+ }
handleAppDiedLocked(app, willRestart, allowRestart);
if (willRestart) {
removeLruProcessLocked(app);
- addAppLocked(app.info, false, null /* ABI override */);
+ addAppLocked(app.info, null, false, null /* ABI override */);
}
} else {
mRemovedProcesses.add(app);
mHeavyWeightProcess = null;
}
mBatteryStatsService.noteProcessFinish(app.processName, app.info.uid);
- if (app.isolated) {
- mBatteryStatsService.removeIsolatedUid(app.uid, app.info.uid);
- }
// Take care of any launching providers waiting for this process.
cleanupAppInLaunchingProvidersLocked(app, true);
// Take care of any services that are waiting for the process.
mServices.processStartTimedOutLocked(app);
app.kill("start timeout", true);
+ if (app.isolated) {
+ mBatteryStatsService.removeIsolatedUid(app.uid, app.info.uid);
+ }
removeLruProcessLocked(app);
if (mBackupTarget != null && mBackupTarget.app.pid == pid) {
Slog.w(TAG, "Unattached app died before backup, skipping");
- try {
- IBackupManager bm = IBackupManager.Stub.asInterface(
- ServiceManager.getService(Context.BACKUP_SERVICE));
- bm.agentDisconnected(app.info.packageName);
- } catch (RemoteException e) {
- // Can't happen; the backup manager is local
- }
+ mHandler.post(new Runnable() {
+ @Override
+ public void run(){
+ try {
+ IBackupManager bm = IBackupManager.Stub.asInterface(
+ ServiceManager.getService(Context.BACKUP_SERVICE));
+ bm.agentDisconnected(app.info.packageName);
+ } catch (RemoteException e) {
+ // Can't happen; the backup manager is local
+ }
+ }
+ });
}
if (isPendingBroadcastProcessLocked(pid)) {
Slog.w(TAG, "Unattached app died before broadcast acknowledged, skipping");
// the pid if we are running in multiple processes, or just pull the
// next app record if we are emulating process with anonymous threads.
ProcessRecord app;
+ long startTime = SystemClock.uptimeMillis();
if (pid != MY_PID && pid >= 0) {
synchronized (mPidsSelfLocked) {
app = mPidsSelfLocked.get(pid);
+ " (IApplicationThread " + thread + "); dropping process");
EventLog.writeEvent(EventLogTags.AM_DROP_PROCESS, pid);
if (pid > 0 && pid != MY_PID) {
- Process.killProcessQuiet(pid);
+ killProcessQuiet(pid);
//TODO: killProcessGroup(app.info.uid, pid);
} else {
try {
EventLog.writeEvent(EventLogTags.AM_PROC_BOUND, app.userId, app.pid, app.processName);
app.makeActive(thread, mProcessStats);
- app.curAdj = app.setAdj = -100;
- app.curSchedGroup = app.setSchedGroup = Process.THREAD_GROUP_DEFAULT;
- app.forcingToForeground = null;
+ app.curAdj = app.setAdj = app.verifiedAdj = ProcessList.INVALID_ADJ;
+ app.curSchedGroup = app.setSchedGroup = ProcessList.SCHED_GROUP_DEFAULT;
+ app.forcingToImportant = null;
updateProcessForegroundLocked(app, false, false);
app.hasShownUi = false;
app.debugging = false;
app.cached = false;
app.killedByAm = false;
+ app.killed = false;
+
+
+ // We carefully use the same state that PackageManager uses for
+ // filtering, since we use this flag to decide if we need to install
+ // providers when user is unlocked later
+ app.unlocked = StorageManager.isUserKeyUnlocked(app.userId);
mHandler.removeMessages(PROC_START_TIMEOUT_MSG, app);
mHandler.sendMessageDelayed(msg, CONTENT_PROVIDER_PUBLISH_TIMEOUT);
}
+ checkTime(startTime, "attachApplicationLocked: before bindApplication");
+
if (!normalMode) {
Slog.i(TAG, "Launching preboot mode app: " + app);
}
TAG, "New app record " + app
+ " thread=" + thread.asBinder() + " pid=" + pid);
try {
- int testMode = IApplicationThread.DEBUG_OFF;
+ int testMode = ApplicationThreadConstants.DEBUG_OFF;
if (mDebugApp != null && mDebugApp.equals(processName)) {
testMode = mWaitForDebugger
- ? IApplicationThread.DEBUG_WAIT
- : IApplicationThread.DEBUG_ON;
+ ? ApplicationThreadConstants.DEBUG_WAIT
+ : ApplicationThreadConstants.DEBUG_ON;
app.debugging = true;
if (mDebugTransient) {
mDebugApp = mOrigDebugApp;
mWaitForDebugger = mOrigWaitForDebugger;
}
}
- String profileFile = app.instrumentationProfileFile;
- ParcelFileDescriptor profileFd = null;
- int samplingInterval = 0;
- boolean profileAutoStop = false;
+
+ ProfilerInfo profilerInfo = null;
+ String agent = null;
if (mProfileApp != null && mProfileApp.equals(processName)) {
mProfileProc = app;
- profileFile = mProfileFile;
- profileFd = mProfileFd;
- samplingInterval = mSamplingInterval;
- profileAutoStop = mAutoStopProfiler;
+ profilerInfo = (mProfilerInfo != null && mProfilerInfo.profileFile != null) ?
+ new ProfilerInfo(mProfilerInfo) : null;
+ agent = mProfilerInfo != null ? mProfilerInfo.agent : null;
+ } else if (app.instr != null && app.instr.mProfileFile != null) {
+ profilerInfo = new ProfilerInfo(app.instr.mProfileFile, null, 0, false, false,
+ null);
}
- boolean enableOpenGlTrace = false;
- if (mOpenGlTraceApp != null && mOpenGlTraceApp.equals(processName)) {
- enableOpenGlTrace = true;
- mOpenGlTraceApp = null;
+
+ boolean enableTrackAllocation = false;
+ if (mTrackAllocationApp != null && mTrackAllocationApp.equals(processName)) {
+ enableTrackAllocation = true;
+ mTrackAllocationApp = null;
}
// If the app is being launched for restore or full backup, set it up specially
boolean isRestrictedBackupMode = false;
if (mBackupTarget != null && mBackupAppName.equals(processName)) {
- isRestrictedBackupMode = (mBackupTarget.backupMode == BackupRecord.RESTORE)
- || (mBackupTarget.backupMode == BackupRecord.RESTORE_FULL)
- || (mBackupTarget.backupMode == BackupRecord.BACKUP_FULL);
+ isRestrictedBackupMode = mBackupTarget.appInfo.uid >= FIRST_APPLICATION_UID
+ && ((mBackupTarget.backupMode == BackupRecord.RESTORE)
+ || (mBackupTarget.backupMode == BackupRecord.RESTORE_FULL)
+ || (mBackupTarget.backupMode == BackupRecord.BACKUP_FULL));
}
- ensurePackageDexOpt(app.instrumentationInfo != null
- ? app.instrumentationInfo.packageName
- : app.info.packageName);
- if (app.instrumentationClass != null) {
- ensurePackageDexOpt(app.instrumentationClass.getPackageName());
+ if (app.instr != null) {
+ notifyPackageUse(app.instr.mClass.getPackageName(),
+ PackageManager.NOTIFY_PACKAGE_USE_INSTRUMENTATION);
}
if (DEBUG_CONFIGURATION) Slog.v(TAG_CONFIGURATION, "Binding proc "
- + processName + " with config " + mConfiguration);
- ApplicationInfo appInfo = app.instrumentationInfo != null
- ? app.instrumentationInfo : app.info;
+ + processName + " with config " + getGlobalConfiguration());
+ ApplicationInfo appInfo = app.instr != null ? app.instr.mTargetInfo : app.info;
app.compat = compatibilityInfoForPackageLocked(appInfo);
- if (profileFd != null) {
- profileFd = profileFd.dup();
- }
- ProfilerInfo profilerInfo = profileFile == null ? null
- : new ProfilerInfo(profileFile, profileFd, samplingInterval, profileAutoStop);
- thread.bindApplication(processName, appInfo, providers, app.instrumentationClass,
- profilerInfo, app.instrumentationArguments, app.instrumentationWatcher,
- app.instrumentationUiAutomationConnection, testMode, enableOpenGlTrace,
- isRestrictedBackupMode || !normalMode, app.persistent,
- new Configuration(mConfiguration), app.compat,
- getCommonServicesLocked(app.isolated),
- mCoreSettingsObserver.getCoreSettingsLocked());
+
+ if (profilerInfo != null && profilerInfo.profileFd != null) {
+ profilerInfo.profileFd = profilerInfo.profileFd.dup();
+ }
+
+ // We deprecated Build.SERIAL and it is not accessible to
+ // apps that target the v2 security sandbox. Since access to
+ // the serial is now behind a permission we push down the value.
+ String buildSerial = appInfo.targetSandboxVersion < 2
+ ? sTheRealBuildSerial : Build.UNKNOWN;
+
+ // Check if this is a secondary process that should be incorporated into some
+ // currently active instrumentation. (Note we do this AFTER all of the profiling
+ // stuff above because profiling can currently happen only in the primary
+ // instrumentation process.)
+ if (mActiveInstrumentation.size() > 0 && app.instr == null) {
+ for (int i = mActiveInstrumentation.size() - 1; i >= 0 && app.instr == null; i--) {
+ ActiveInstrumentation aInstr = mActiveInstrumentation.get(i);
+ if (!aInstr.mFinished && aInstr.mTargetInfo.uid == app.uid) {
+ if (aInstr.mTargetProcesses.length == 0) {
+ // This is the wildcard mode, where every process brought up for
+ // the target instrumentation should be included.
+ if (aInstr.mTargetInfo.packageName.equals(app.info.packageName)) {
+ app.instr = aInstr;
+ aInstr.mRunningProcesses.add(app);
+ }
+ } else {
+ for (String proc : aInstr.mTargetProcesses) {
+ if (proc.equals(app.processName)) {
+ app.instr = aInstr;
+ aInstr.mRunningProcesses.add(app);
+ break;
+ }
+ }
+ }
+ }
+ }
+ }
+
+ // If we were asked to attach an agent on startup, do so now, before we're binding
+ // application code.
+ if (agent != null) {
+ thread.attachAgent(agent);
+ }
+
+ checkTime(startTime, "attachApplicationLocked: immediately before bindApplication");
+ mStackSupervisor.mActivityMetricsLogger.notifyBindApplication(app);
+ if (app.instr != null) {
+ thread.bindApplication(processName, appInfo, providers,
+ app.instr.mClass,
+ profilerInfo, app.instr.mArguments,
+ app.instr.mWatcher,
+ app.instr.mUiAutomationConnection, testMode,
+ mBinderTransactionTrackingEnabled, enableTrackAllocation,
+ isRestrictedBackupMode || !normalMode, app.persistent,
+ new Configuration(getGlobalConfiguration()), app.compat,
+ getCommonServicesLocked(app.isolated),
+ mCoreSettingsObserver.getCoreSettingsLocked(),
+ buildSerial);
+ } else {
+ thread.bindApplication(processName, appInfo, providers, null, profilerInfo,
+ null, null, null, testMode,
+ mBinderTransactionTrackingEnabled, enableTrackAllocation,
+ isRestrictedBackupMode || !normalMode, app.persistent,
+ new Configuration(getGlobalConfiguration()), app.compat,
+ getCommonServicesLocked(app.isolated),
+ mCoreSettingsObserver.getCoreSettingsLocked(),
+ buildSerial);
+ }
+
+ checkTime(startTime, "attachApplicationLocked: immediately after bindApplication");
updateLruProcessLocked(app, false, null);
+ checkTime(startTime, "attachApplicationLocked: after updateLruProcessLocked");
app.lastRequestedGc = app.lastLowMemory = SystemClock.uptimeMillis();
} catch (Exception e) {
// todo: Yikes! What should we do? For now we will try to
if (!badApp) {
try {
didSomething |= mServices.attachApplicationLocked(app, processName);
+ checkTime(startTime, "attachApplicationLocked: after mServices.attachApplicationLocked");
} catch (Exception e) {
Slog.wtf(TAG, "Exception thrown starting services in " + app, e);
badApp = true;
if (!badApp && isPendingBroadcastProcessLocked(pid)) {
try {
didSomething |= sendPendingBroadcastsLocked(app);
+ checkTime(startTime, "attachApplicationLocked: after sendPendingBroadcastsLocked");
} catch (Exception e) {
// If the app died trying to launch the receiver we declare it 'bad'
Slog.wtf(TAG, "Exception thrown dispatching broadcasts in " + app, e);
}
// Check whether the next backup agent is in this process...
- if (!badApp && mBackupTarget != null && mBackupTarget.appInfo.uid == app.uid) {
+ if (!badApp && mBackupTarget != null && mBackupTarget.app == app) {
if (DEBUG_BACKUP) Slog.v(TAG_BACKUP,
"New app is backup target, launching agent for " + app);
- ensurePackageDexOpt(mBackupTarget.appInfo.packageName);
+ notifyPackageUse(mBackupTarget.appInfo.packageName,
+ PackageManager.NOTIFY_PACKAGE_USE_BACKUP);
try {
thread.scheduleCreateBackupAgent(mBackupTarget.appInfo,
compatibilityInfoForPackageLocked(mBackupTarget.appInfo),
if (!didSomething) {
updateOomAdjLocked();
+ checkTime(startTime, "attachApplicationLocked: after updateOomAdjLocked");
}
return true;
ActivityStack stack = ActivityRecord.getStackLocked(token);
if (stack != null) {
ActivityRecord r =
- mStackSupervisor.activityIdleInternalLocked(token, false, config);
+ mStackSupervisor.activityIdleInternalLocked(token, false /* fromTimeout */,
+ false /* processPausingActivities */, config);
if (stopProfiling) {
- if ((mProfileProc == r.app) && (mProfileFd != null)) {
- try {
- mProfileFd.close();
- } catch (IOException e) {
- }
+ if ((mProfileProc == r.app) && mProfilerInfo != null) {
clearProfilerLocked();
}
}
@Override
public void showBootMessage(final CharSequence msg, final boolean always) {
- if (Binder.getCallingUid() != Process.myUid()) {
- // These days only the core system can call this, so apps can't get in
- // the way of what we show about running them.
+ if (Binder.getCallingUid() != myUid()) {
+ throw new SecurityException();
}
mWindowManager.showBootMessage(msg, always);
}
@Override
- public void keyguardWaitingForActivityDrawn() {
- enforceNotIsolatedCaller("keyguardWaitingForActivityDrawn");
+ public void keyguardGoingAway(int flags) {
+ enforceNotIsolatedCaller("keyguardGoingAway");
final long token = Binder.clearCallingIdentity();
try {
synchronized (this) {
- if (DEBUG_LOCKSCREEN) logLockScreen("");
- mWindowManager.keyguardWaitingForActivityDrawn();
- if (mLockScreenShown == LOCK_SCREEN_SHOWN) {
- mLockScreenShown = LOCK_SCREEN_LEAVING;
- updateSleepIfNeededLocked();
- }
+ mKeyguardController.keyguardGoingAway(flags);
}
} finally {
Binder.restoreCallingIdentity(token);
}
}
- @Override
- public void keyguardGoingAway(boolean disableWindowAnimations,
- boolean keyguardGoingToNotificationShade) {
- enforceNotIsolatedCaller("keyguardGoingAway");
- final long token = Binder.clearCallingIdentity();
- try {
- synchronized (this) {
- if (DEBUG_LOCKSCREEN) logLockScreen("");
- mWindowManager.keyguardGoingAway(disableWindowAnimations,
- keyguardGoingToNotificationShade);
- if (mLockScreenShown == LOCK_SCREEN_SHOWN) {
- mLockScreenShown = LOCK_SCREEN_HIDDEN;
- updateSleepIfNeededLocked();
- }
- }
- } finally {
- Binder.restoreCallingIdentity(token);
- }
+ /**
+ * @return whther the keyguard is currently locked.
+ */
+ boolean isKeyguardLocked() {
+ return mKeyguardController.isKeyguardLocked();
}
final void finishBooting() {
ArraySet<String> completedIsas = new ArraySet<String>();
for (String abi : Build.SUPPORTED_ABIS) {
- Process.establishZygoteConnectionForAbi(abi);
+ zygoteProcess.establishZygoteConnectionForAbi(abi);
final String instructionSet = VMRuntime.getInstructionSet(abi);
if (!completedIsas.contains(instructionSet)) {
- if (mInstaller.markBootComplete(VMRuntime.getInstructionSet(abi)) != 0) {
- Slog.e(TAG, "Unable to mark boot complete for abi: " + abi);
+ try {
+ mInstaller.markBootComplete(VMRuntime.getInstructionSet(abi));
+ } catch (InstallerException e) {
+ Slog.w(TAG, "Unable to mark boot complete for abi: " + abi + " (" +
+ e.getMessage() +")");
}
completedIsas.add(instructionSet);
}
if (mFactoryTest != FactoryTest.FACTORY_TEST_LOW_LEVEL) {
// Start looking for apps that are abusing wake locks.
- Message nmsg = mHandler.obtainMessage(CHECK_EXCESSIVE_WAKE_LOCKS_MSG);
- mHandler.sendMessageDelayed(nmsg, POWER_CHECK_DELAY);
+ Message nmsg = mHandler.obtainMessage(CHECK_EXCESSIVE_POWER_USE_MSG);
+ mHandler.sendMessageDelayed(nmsg, mConstants.POWER_CHECK_INTERVAL);
// Tell anyone interested that we are done booting!
SystemProperties.set("sys.boot_completed", "1");
|| "".equals(SystemProperties.get("vold.encrypt_progress"))) {
SystemProperties.set("dev.bootcomplete", "1");
}
- for (int i=0; i<mStartedUsers.size(); i++) {
- UserState uss = mStartedUsers.valueAt(i);
- if (uss.mState == UserState.STATE_BOOTING) {
- uss.mState = UserState.STATE_RUNNING;
- final int userId = mStartedUsers.keyAt(i);
- Intent intent = new Intent(Intent.ACTION_BOOT_COMPLETED, null);
- intent.putExtra(Intent.EXTRA_USER_HANDLE, userId);
- intent.addFlags(Intent.FLAG_RECEIVER_NO_ABORT);
- broadcastIntentLocked(null, null, intent, null,
- new IIntentReceiver.Stub() {
- @Override
- public void performReceive(Intent intent, int resultCode,
- String data, Bundle extras, boolean ordered,
- boolean sticky, int sendingUser) {
- synchronized (ActivityManagerService.this) {
- requestPssAllProcsLocked(SystemClock.uptimeMillis(),
- true, false);
- }
- }
- },
- 0, null, null,
- new String[] {android.Manifest.permission.RECEIVE_BOOT_COMPLETED},
- AppOpsManager.OP_NONE, null, true, false,
- MY_PID, Process.SYSTEM_UID, userId);
- }
- }
+ mUserController.sendBootCompletedLocked(
+ new IIntentReceiver.Stub() {
+ @Override
+ public void performReceive(Intent intent, int resultCode,
+ String data, Bundle extras, boolean ordered,
+ boolean sticky, int sendingUser) {
+ synchronized (ActivityManagerService.this) {
+ requestPssAllProcsLocked(SystemClock.uptimeMillis(),
+ true, false);
+ }
+ }
+ });
scheduleStartProfilesLocked();
}
}
mBootAnimationComplete = true;
}
if (callFinishBooting) {
+ Trace.traceBegin(Trace.TRACE_TAG_ACTIVITY_MANAGER, "FinishBooting");
finishBooting();
+ Trace.traceEnd(Trace.TRACE_TAG_ACTIVITY_MANAGER);
}
}
}
if (booting) {
+ Trace.traceBegin(Trace.TRACE_TAG_ACTIVITY_MANAGER, "FinishBooting");
finishBooting();
+ Trace.traceEnd(Trace.TRACE_TAG_ACTIVITY_MANAGER);
}
if (enableScreen) {
public final void activityResumed(IBinder token) {
final long origId = Binder.clearCallingIdentity();
synchronized(this) {
- ActivityStack stack = ActivityRecord.getStackLocked(token);
- if (stack != null) {
- ActivityRecord.activityResumedLocked(token);
- }
+ ActivityRecord.activityResumedLocked(token);
+ mWindowManager.notifyAppResumedFinished(token);
}
Binder.restoreCallingIdentity(origId);
}
final long origId = Binder.clearCallingIdentity();
synchronized (this) {
- ActivityRecord r = ActivityRecord.isInStackLocked(token);
+ final ActivityRecord r = ActivityRecord.isInStackLocked(token);
if (r != null) {
- r.task.stack.activityStoppedLocked(r, icicle, persistentState, description);
+ r.activityStoppedLocked(icicle, persistentState, description);
}
}
}
@Override
- public final void backgroundResourcesReleased(IBinder token) {
+ public final void activityRelaunched(IBinder token) {
final long origId = Binder.clearCallingIdentity();
- try {
- synchronized (this) {
- ActivityStack stack = ActivityRecord.getStackLocked(token);
- if (stack != null) {
- stack.backgroundResourcesReleased();
- }
+ synchronized (this) {
+ mStackSupervisor.activityRelaunchedLocked(token);
+ }
+ Binder.restoreCallingIdentity(origId);
+ }
+
+ @Override
+ public void reportSizeConfigurations(IBinder token, int[] horizontalSizeConfiguration,
+ int[] verticalSizeConfigurations, int[] smallestSizeConfigurations) {
+ if (DEBUG_CONFIGURATION) Slog.v(TAG, "Report configuration: " + token + " "
+ + horizontalSizeConfiguration + " " + verticalSizeConfigurations);
+ synchronized (this) {
+ ActivityRecord record = ActivityRecord.isInStackLocked(token);
+ if (record == null) {
+ throw new IllegalArgumentException("reportSizeConfigurations: ActivityRecord not "
+ + "found for: " + token);
}
- } finally {
- Binder.restoreCallingIdentity(origId);
+ record.setSizeConfigurations(horizontalSizeConfiguration,
+ verticalSizeConfigurations, smallestSizeConfigurations);
}
}
public IIntentSender getIntentSender(int type,
String packageName, IBinder token, String resultWho,
int requestCode, Intent[] intents, String[] resolvedTypes,
- int flags, Bundle options, int userId) {
+ int flags, Bundle bOptions, int userId) {
enforceNotIsolatedCaller("getIntentSender");
// Refuse possible leaked file descriptors
if (intents != null) {
"Intent array length does not match resolvedTypes length");
}
}
- if (options != null) {
- if (options.hasFileDescriptors()) {
+ if (bOptions != null) {
+ if (bOptions.hasFileDescriptors()) {
throw new IllegalArgumentException("File descriptors passed in options");
}
}
synchronized(this) {
int callingUid = Binder.getCallingUid();
int origUserId = userId;
- userId = handleIncomingUser(Binder.getCallingPid(), callingUid, userId,
+ userId = mUserController.handleIncomingUser(Binder.getCallingPid(), callingUid, userId,
type == ActivityManager.INTENT_SENDER_BROADCAST,
ALLOW_NON_FULL, "getIntentSender", null);
if (origUserId == UserHandle.USER_CURRENT) {
userId = UserHandle.USER_CURRENT;
}
try {
- if (callingUid != 0 && callingUid != Process.SYSTEM_UID) {
- int uid = AppGlobals.getPackageManager()
- .getPackageUid(packageName, UserHandle.getUserId(callingUid));
+ if (callingUid != 0 && callingUid != SYSTEM_UID) {
+ final int uid = AppGlobals.getPackageManager().getPackageUid(packageName,
+ MATCH_DEBUG_TRIAGED_MISSING, UserHandle.getUserId(callingUid));
if (!UserHandle.isSameApp(callingUid, uid)) {
String msg = "Permission Denial: getIntentSender() from pid="
+ Binder.getCallingPid()
}
return getIntentSenderLocked(type, packageName, callingUid, userId,
- token, resultWho, requestCode, intents, resolvedTypes, flags, options);
+ token, resultWho, requestCode, intents, resolvedTypes, flags, bOptions);
} catch (RemoteException e) {
throw new SecurityException(e);
IIntentSender getIntentSenderLocked(int type, String packageName,
int callingUid, int userId, IBinder token, String resultWho,
int requestCode, Intent[] intents, String[] resolvedTypes, int flags,
- Bundle options) {
+ Bundle bOptions) {
if (DEBUG_MU) Slog.v(TAG_MU, "getIntentSenderLocked(): uid=" + callingUid);
ActivityRecord activity = null;
if (type == ActivityManager.INTENT_SENDER_ACTIVITY_RESULT) {
activity = ActivityRecord.isInStackLocked(token);
if (activity == null) {
+ Slog.w(TAG, "Failed createPendingResult: activity " + token + " not in any stack");
return null;
}
if (activity.finishing) {
+ Slog.w(TAG, "Failed createPendingResult: activity " + activity + " is finishing");
return null;
}
}
+ // We're going to be splicing together extras before sending, so we're
+ // okay poking into any contained extras.
+ if (intents != null) {
+ for (int i = 0; i < intents.length; i++) {
+ intents[i].setDefusable(true);
+ }
+ }
+ Bundle.setDefusable(bOptions, true);
+
final boolean noCreate = (flags&PendingIntent.FLAG_NO_CREATE) != 0;
final boolean cancelCurrent = (flags&PendingIntent.FLAG_CANCEL_CURRENT) != 0;
final boolean updateCurrent = (flags&PendingIntent.FLAG_UPDATE_CURRENT) != 0;
PendingIntentRecord.Key key = new PendingIntentRecord.Key(
type, packageName, activity, resultWho,
- requestCode, intents, resolvedTypes, flags, options, userId);
+ requestCode, intents, resolvedTypes, flags, bOptions, userId);
WeakReference<PendingIntentRecord> ref;
ref = mIntentSenderRecords.get(key);
PendingIntentRecord rec = ref != null ? ref.get() : null;
}
return rec;
}
- rec.canceled = true;
+ makeIntentSenderCanceledLocked(rec);
mIntentSenderRecords.remove(key);
}
if (noCreate) {
}
@Override
+ public int sendIntentSender(IIntentSender target, IBinder whitelistToken, int code,
+ Intent intent, String resolvedType,
+ IIntentReceiver finishedReceiver, String requiredPermission, Bundle options) {
+ if (target instanceof PendingIntentRecord) {
+ return ((PendingIntentRecord)target).sendWithResult(code, intent, resolvedType,
+ whitelistToken, finishedReceiver, requiredPermission, options);
+ } else {
+ if (intent == null) {
+ // Weird case: someone has given us their own custom IIntentSender, and now
+ // they have someone else trying to send to it but of course this isn't
+ // really a PendingIntent, so there is no base Intent, and the caller isn't
+ // supplying an Intent... but we never want to dispatch a null Intent to
+ // a receiver, so um... let's make something up.
+ Slog.wtf(TAG, "Can't use null intent with direct IIntentSender call");
+ intent = new Intent(Intent.ACTION_MAIN);
+ }
+ try {
+ target.send(code, intent, resolvedType, whitelistToken, null,
+ requiredPermission, options);
+ } catch (RemoteException e) {
+ }
+ // Platform code can rely on getting a result back when the send is done, but if
+ // this intent sender is from outside of the system we can't rely on it doing that.
+ // So instead we don't give it the result receiver, and instead just directly
+ // report the finish immediately.
+ if (finishedReceiver != null) {
+ try {
+ finishedReceiver.performReceive(intent, 0,
+ null, null, false, false, UserHandle.getCallingUserId());
+ } catch (RemoteException e) {
+ }
+ }
+ return 0;
+ }
+ }
+
+ @Override
public void cancelIntentSender(IIntentSender sender) {
if (!(sender instanceof PendingIntentRecord)) {
return;
synchronized(this) {
PendingIntentRecord rec = (PendingIntentRecord)sender;
try {
- int uid = AppGlobals.getPackageManager()
- .getPackageUid(rec.key.packageName, UserHandle.getCallingUserId());
+ final int uid = AppGlobals.getPackageManager().getPackageUid(rec.key.packageName,
+ MATCH_DEBUG_TRIAGED_MISSING, UserHandle.getCallingUserId());
if (!UserHandle.isSameApp(uid, Binder.getCallingUid())) {
String msg = "Permission Denial: cancelIntentSender() from pid="
+ Binder.getCallingPid()
+ ", uid=" + Binder.getCallingUid()
- + " is not allowed to cancel packges "
+ + " is not allowed to cancel package "
+ rec.key.packageName;
Slog.w(TAG, msg);
throw new SecurityException(msg);
}
void cancelIntentSenderLocked(PendingIntentRecord rec, boolean cleanActivity) {
- rec.canceled = true;
+ makeIntentSenderCanceledLocked(rec);
mIntentSenderRecords.remove(rec.key);
if (cleanActivity && rec.key.activity != null) {
rec.key.activity.pendingResults.remove(rec.ref);
}
}
+ void makeIntentSenderCanceledLocked(PendingIntentRecord rec) {
+ rec.canceled = true;
+ RemoteCallbackList<IResultReceiver> callbacks = rec.detachCancelListenersLocked();
+ if (callbacks != null) {
+ mHandler.obtainMessage(DISPATCH_PENDING_INTENT_CANCEL_MSG, callbacks).sendToTarget();
+ }
+ }
+
@Override
public String getPackageForIntentSender(IIntentSender pendingResult) {
if (!(pendingResult instanceof PendingIntentRecord)) {
}
@Override
+ public void registerIntentSenderCancelListener(IIntentSender sender, IResultReceiver receiver) {
+ if (!(sender instanceof PendingIntentRecord)) {
+ return;
+ }
+ synchronized(this) {
+ ((PendingIntentRecord)sender).registerCancelListenerLocked(receiver);
+ }
+ }
+
+ @Override
+ public void unregisterIntentSenderCancelListener(IIntentSender sender,
+ IResultReceiver receiver) {
+ if (!(sender instanceof PendingIntentRecord)) {
+ return;
+ }
+ synchronized(this) {
+ ((PendingIntentRecord)sender).unregisterCancelListenerLocked(receiver);
+ }
+ }
+
+ @Override
public int getUidForIntentSender(IIntentSender sender) {
if (sender instanceof PendingIntentRecord) {
try {
@Override
public Intent getIntentForIntentSender(IIntentSender pendingResult) {
+ enforceCallingPermission(Manifest.permission.GET_INTENT_SENDER_INTENT,
+ "getIntentForIntentSender()");
if (!(pendingResult instanceof PendingIntentRecord)) {
return null;
}
enforceCallingPermission(android.Manifest.permission.SET_PROCESS_LIMIT,
"setProcessLimit()");
synchronized (this) {
- mProcessLimit = max < 0 ? ProcessList.MAX_CACHED_APPS : max;
- mProcessLimitOverride = max;
+ mConstants.setOverrideMaxCachedProcesses(max);
}
trimApplications();
}
@Override
public int getProcessLimit() {
synchronized (this) {
- return mProcessLimitOverride;
+ return mConstants.getOverrideMaxCachedProcesses();
}
}
- void foregroundTokenDied(ForegroundToken token) {
+ void importanceTokenDied(ImportanceToken token) {
synchronized (ActivityManagerService.this) {
synchronized (mPidsSelfLocked) {
- ForegroundToken cur
- = mForegroundProcesses.get(token.pid);
+ ImportanceToken cur
+ = mImportantProcesses.get(token.pid);
if (cur != token) {
return;
}
- mForegroundProcesses.remove(token.pid);
+ mImportantProcesses.remove(token.pid);
ProcessRecord pr = mPidsSelfLocked.get(token.pid);
if (pr == null) {
return;
}
- pr.forcingToForeground = null;
+ pr.forcingToImportant = null;
updateProcessForegroundLocked(pr, false, false);
}
updateOomAdjLocked();
}
@Override
- public void setProcessForeground(IBinder token, int pid, boolean isForeground) {
+ public void setProcessImportant(IBinder token, int pid, boolean isForeground, String reason) {
enforceCallingPermission(android.Manifest.permission.SET_PROCESS_LIMIT,
- "setProcessForeground()");
+ "setProcessImportant()");
synchronized(this) {
boolean changed = false;
Slog.w(TAG, "setProcessForeground called on unknown pid: " + pid);
return;
}
- ForegroundToken oldToken = mForegroundProcesses.get(pid);
+ ImportanceToken oldToken = mImportantProcesses.get(pid);
if (oldToken != null) {
oldToken.token.unlinkToDeath(oldToken, 0);
- mForegroundProcesses.remove(pid);
+ mImportantProcesses.remove(pid);
if (pr != null) {
- pr.forcingToForeground = null;
+ pr.forcingToImportant = null;
}
changed = true;
}
if (isForeground && token != null) {
- ForegroundToken newToken = new ForegroundToken() {
+ ImportanceToken newToken = new ImportanceToken(pid, token, reason) {
@Override
public void binderDied() {
- foregroundTokenDied(this);
+ importanceTokenDied(this);
}
};
- newToken.pid = pid;
- newToken.token = token;
try {
token.linkToDeath(newToken, 0);
- mForegroundProcesses.put(pid, newToken);
- pr.forcingToForeground = token;
+ mImportantProcesses.put(pid, newToken);
+ pr.forcingToImportant = newToken;
changed = true;
} catch (RemoteException e) {
// If the process died while doing this, we will later
}
}
- // =========================================================
- // PROCESS INFO
- // =========================================================
-
- static class ProcessInfoService extends IProcessInfoService.Stub {
- final ActivityManagerService mActivityManagerService;
- ProcessInfoService(ActivityManagerService activityManagerService) {
- mActivityManagerService = activityManagerService;
+ @Override
+ public boolean isAppForeground(int uid) throws RemoteException {
+ synchronized (this) {
+ UidRecord uidRec = mActiveUids.get(uid);
+ if (uidRec == null || uidRec.idle) {
+ return false;
+ }
+ return uidRec.curProcState <= ActivityManager.PROCESS_STATE_IMPORTANT_FOREGROUND;
}
+ }
- @Override
- public void getProcessStatesFromPids(/*in*/ int[] pids, /*out*/ int[] states) {
- mActivityManagerService.getProcessStatesForPIDs(/*in*/ pids, /*out*/ states);
+ // NOTE: this is an internal method used by the OnShellCommand implementation only and should
+ // be guarded by permission checking.
+ int getUidState(int uid) {
+ synchronized (this) {
+ return getUidStateLocked(uid);
}
}
- /**
- * For each PID in the given input array, write the current process state
- * for that process into the output array, or -1 to indicate that no
- * process with the given PID exists.
- */
- public void getProcessStatesForPIDs(/*in*/ int[] pids, /*out*/ int[] states) {
- if (pids == null) {
- throw new NullPointerException("pids");
- } else if (states == null) {
- throw new NullPointerException("states");
- } else if (pids.length != states.length) {
- throw new IllegalArgumentException("input and output arrays have different lengths!");
+ int getUidStateLocked(int uid) {
+ UidRecord uidRec = mActiveUids.get(uid);
+ return uidRec == null ? ActivityManager.PROCESS_STATE_NONEXISTENT : uidRec.curProcState;
+ }
+
+ @Override
+ public boolean isInMultiWindowMode(IBinder token) {
+ final long origId = Binder.clearCallingIdentity();
+ try {
+ synchronized(this) {
+ final ActivityRecord r = ActivityRecord.isInStackLocked(token);
+ if (r == null) {
+ return false;
+ }
+ // An activity is consider to be in multi-window mode if its task isn't fullscreen.
+ return !r.getTask().mFullscreen;
+ }
+ } finally {
+ Binder.restoreCallingIdentity(origId);
}
+ }
- synchronized (mPidsSelfLocked) {
- for (int i = 0; i < pids.length; i++) {
- ProcessRecord pr = mPidsSelfLocked.get(pids[i]);
- states[i] = (pr == null) ? ActivityManager.PROCESS_STATE_NONEXISTENT :
- pr.curProcState;
+ @Override
+ public boolean isInPictureInPictureMode(IBinder token) {
+ final long origId = Binder.clearCallingIdentity();
+ try {
+ synchronized(this) {
+ return isInPictureInPictureMode(ActivityRecord.forTokenLocked(token));
}
+ } finally {
+ Binder.restoreCallingIdentity(origId);
}
}
- // =========================================================
- // PERMISSIONS
- // =========================================================
+ private boolean isInPictureInPictureMode(ActivityRecord r) {
+ if (r == null || r.getStack() == null || !r.getStack().isPinnedStack() ||
+ r.getStack().isInStackLocked(r) == null) {
+ return false;
+ }
- static class PermissionController extends IPermissionController.Stub {
- ActivityManagerService mActivityManagerService;
+ // If we are animating to fullscreen then we have already dispatched the PIP mode
+ // changed, so we should reflect that check here as well.
+ final PinnedActivityStack stack = r.getStack();
+ final PinnedStackWindowController windowController = stack.getWindowContainerController();
+ return !windowController.isAnimatingBoundsToFullscreen();
+ }
+
+ @Override
+ public boolean enterPictureInPictureMode(IBinder token, final PictureInPictureParams params) {
+ final long origId = Binder.clearCallingIdentity();
+ try {
+ synchronized(this) {
+ final ActivityRecord r = ensureValidPictureInPictureActivityParamsLocked(
+ "enterPictureInPictureMode", token, params);
+
+ // If the activity is already in picture in picture mode, then just return early
+ if (isInPictureInPictureMode(r)) {
+ return true;
+ }
+
+ // Activity supports picture-in-picture, now check that we can enter PiP at this
+ // point, if it is
+ if (!r.checkEnterPictureInPictureState("enterPictureInPictureMode",
+ false /* beforeStopping */)) {
+ return false;
+ }
+
+ final Runnable enterPipRunnable = () -> {
+ // Only update the saved args from the args that are set
+ r.pictureInPictureArgs.copyOnlySet(params);
+ final float aspectRatio = r.pictureInPictureArgs.getAspectRatio();
+ final List<RemoteAction> actions = r.pictureInPictureArgs.getActions();
+ // Adjust the source bounds by the insets for the transition down
+ final Rect sourceBounds = new Rect(r.pictureInPictureArgs.getSourceRectHint());
+ mStackSupervisor.moveActivityToPinnedStackLocked(r, sourceBounds, aspectRatio,
+ true /* moveHomeStackToFront */, "enterPictureInPictureMode");
+ final PinnedActivityStack stack = mStackSupervisor.getStack(PINNED_STACK_ID);
+ stack.setPictureInPictureAspectRatio(aspectRatio);
+ stack.setPictureInPictureActions(actions);
+
+ MetricsLogger.action(mContext, MetricsEvent.ACTION_PICTURE_IN_PICTURE_ENTERED,
+ r.supportsEnterPipOnTaskSwitch);
+ logPictureInPictureArgs(params);
+ };
+
+ if (isKeyguardLocked()) {
+ // If the keyguard is showing or occluded, then try and dismiss it before
+ // entering picture-in-picture (this will prompt the user to authenticate if the
+ // device is currently locked).
+ try {
+ dismissKeyguard(token, new IKeyguardDismissCallback.Stub() {
+ @Override
+ public void onDismissError() throws RemoteException {
+ // Do nothing
+ }
+
+ @Override
+ public void onDismissSucceeded() throws RemoteException {
+ mHandler.post(enterPipRunnable);
+ }
+
+ @Override
+ public void onDismissCancelled() throws RemoteException {
+ // Do nothing
+ }
+ });
+ } catch (RemoteException e) {
+ // Local call
+ }
+ } else {
+ // Enter picture in picture immediately otherwise
+ enterPipRunnable.run();
+ }
+ return true;
+ }
+ } finally {
+ Binder.restoreCallingIdentity(origId);
+ }
+ }
+
+ @Override
+ public void setPictureInPictureParams(IBinder token, final PictureInPictureParams params) {
+ final long origId = Binder.clearCallingIdentity();
+ try {
+ synchronized(this) {
+ final ActivityRecord r = ensureValidPictureInPictureActivityParamsLocked(
+ "setPictureInPictureParams", token, params);
+
+ // Only update the saved args from the args that are set
+ r.pictureInPictureArgs.copyOnlySet(params);
+ if (r.getStack().getStackId() == PINNED_STACK_ID) {
+ // If the activity is already in picture-in-picture, update the pinned stack now
+ // if it is not already expanding to fullscreen. Otherwise, the arguments will
+ // be used the next time the activity enters PiP
+ final PinnedActivityStack stack = r.getStack();
+ if (!stack.isAnimatingBoundsToFullscreen()) {
+ stack.setPictureInPictureAspectRatio(
+ r.pictureInPictureArgs.getAspectRatio());
+ stack.setPictureInPictureActions(r.pictureInPictureArgs.getActions());
+ }
+ }
+ logPictureInPictureArgs(params);
+ }
+ } finally {
+ Binder.restoreCallingIdentity(origId);
+ }
+ }
+
+ @Override
+ public int getMaxNumPictureInPictureActions(IBinder token) {
+ // Currently, this is a static constant, but later, we may change this to be dependent on
+ // the context of the activity
+ return 3;
+ }
+
+ private void logPictureInPictureArgs(PictureInPictureParams params) {
+ if (params.hasSetActions()) {
+ MetricsLogger.histogram(mContext, "tron_varz_picture_in_picture_actions_count",
+ params.getActions().size());
+ }
+ if (params.hasSetAspectRatio()) {
+ LogMaker lm = new LogMaker(MetricsEvent.ACTION_PICTURE_IN_PICTURE_ASPECT_RATIO_CHANGED);
+ lm.addTaggedData(MetricsEvent.PICTURE_IN_PICTURE_ASPECT_RATIO, params.getAspectRatio());
+ MetricsLogger.action(lm);
+ }
+ }
+
+ /**
+ * Checks the state of the system and the activity associated with the given {@param token} to
+ * verify that picture-in-picture is supported for that activity.
+ *
+ * @return the activity record for the given {@param token} if all the checks pass.
+ */
+ private ActivityRecord ensureValidPictureInPictureActivityParamsLocked(String caller,
+ IBinder token, PictureInPictureParams params) {
+ if (!mSupportsPictureInPicture) {
+ throw new IllegalStateException(caller
+ + ": Device doesn't support picture-in-picture mode.");
+ }
+
+ final ActivityRecord r = ActivityRecord.forTokenLocked(token);
+ if (r == null) {
+ throw new IllegalStateException(caller
+ + ": Can't find activity for token=" + token);
+ }
+
+ if (!r.supportsPictureInPicture()) {
+ throw new IllegalStateException(caller
+ + ": Current activity does not support picture-in-picture.");
+ }
+
+ if (!StackId.isAllowedToEnterPictureInPicture(r.getStack().getStackId())) {
+ throw new IllegalStateException(caller
+ + ": Activities on the home, assistant, or recents stack not supported");
+ }
+
+ if (params.hasSetAspectRatio()
+ && !mWindowManager.isValidPictureInPictureAspectRatio(r.getStack().mDisplayId,
+ params.getAspectRatio())) {
+ final float minAspectRatio = mContext.getResources().getFloat(
+ com.android.internal.R.dimen.config_pictureInPictureMinAspectRatio);
+ final float maxAspectRatio = mContext.getResources().getFloat(
+ com.android.internal.R.dimen.config_pictureInPictureMaxAspectRatio);
+ throw new IllegalArgumentException(String.format(caller
+ + ": Aspect ratio is too extreme (must be between %f and %f).",
+ minAspectRatio, maxAspectRatio));
+ }
+
+ // Truncate the number of actions if necessary
+ params.truncateActions(getMaxNumPictureInPictureActions(token));
+
+ return r;
+ }
+
+ // =========================================================
+ // PROCESS INFO
+ // =========================================================
+
+ static class ProcessInfoService extends IProcessInfoService.Stub {
+ final ActivityManagerService mActivityManagerService;
+ ProcessInfoService(ActivityManagerService activityManagerService) {
+ mActivityManagerService = activityManagerService;
+ }
+
+ @Override
+ public void getProcessStatesFromPids(/*in*/ int[] pids, /*out*/ int[] states) {
+ mActivityManagerService.getProcessStatesAndOomScoresForPIDs(
+ /*in*/ pids, /*out*/ states, null);
+ }
+
+ @Override
+ public void getProcessStatesAndOomScoresFromPids(
+ /*in*/ int[] pids, /*out*/ int[] states, /*out*/ int[] scores) {
+ mActivityManagerService.getProcessStatesAndOomScoresForPIDs(
+ /*in*/ pids, /*out*/ states, /*out*/ scores);
+ }
+ }
+
+ /**
+ * For each PID in the given input array, write the current process state
+ * for that process into the states array, or -1 to indicate that no
+ * process with the given PID exists. If scores array is provided, write
+ * the oom score for the process into the scores array, with INVALID_ADJ
+ * indicating the PID doesn't exist.
+ */
+ public void getProcessStatesAndOomScoresForPIDs(
+ /*in*/ int[] pids, /*out*/ int[] states, /*out*/ int[] scores) {
+ if (scores != null) {
+ enforceCallingPermission(android.Manifest.permission.GET_PROCESS_STATE_AND_OOM_SCORE,
+ "getProcessStatesAndOomScoresForPIDs()");
+ }
+
+ if (pids == null) {
+ throw new NullPointerException("pids");
+ } else if (states == null) {
+ throw new NullPointerException("states");
+ } else if (pids.length != states.length) {
+ throw new IllegalArgumentException("pids and states arrays have different lengths!");
+ } else if (scores != null && pids.length != scores.length) {
+ throw new IllegalArgumentException("pids and scores arrays have different lengths!");
+ }
+
+ synchronized (mPidsSelfLocked) {
+ for (int i = 0; i < pids.length; i++) {
+ ProcessRecord pr = mPidsSelfLocked.get(pids[i]);
+ states[i] = (pr == null) ? ActivityManager.PROCESS_STATE_NONEXISTENT :
+ pr.curProcState;
+ if (scores != null) {
+ scores[i] = (pr == null) ? ProcessList.INVALID_ADJ : pr.curAdj;
+ }
+ }
+ }
+ }
+
+ // =========================================================
+ // PERMISSIONS
+ // =========================================================
+
+ static class PermissionController extends IPermissionController.Stub {
+ ActivityManagerService mActivityManagerService;
PermissionController(ActivityManagerService activityManagerService) {
mActivityManagerService = activityManagerService;
}
try {
PermissionInfo info = mActivityManagerService.mContext.getPackageManager()
.getPermissionInfo(permission, 0);
- return info.protectionLevel == PermissionInfo.PROTECTION_DANGEROUS;
+ return (info.protectionLevel & PermissionInfo.PROTECTION_MASK_BASE)
+ == PermissionInfo.PROTECTION_DANGEROUS;
} catch (NameNotFoundException nnfe) {
Slog.e(TAG, "No such permission: "+ permission, nnfe);
}
return readMet && writeMet;
}
- private ProviderInfo getProviderInfoLocked(String authority, int userHandle) {
+ public boolean isAppStartModeDisabled(int uid, String packageName) {
+ synchronized (this) {
+ return getAppStartModeLocked(uid, packageName, 0, -1, false, true)
+ == ActivityManager.APP_START_MODE_DISABLED;
+ }
+ }
+
+ // Unified app-op and target sdk check
+ int appRestrictedInBackgroundLocked(int uid, String packageName, int packageTargetSdk) {
+ // Apps that target O+ are always subject to background check
+ if (packageTargetSdk >= Build.VERSION_CODES.O) {
+ if (DEBUG_BACKGROUND_CHECK) {
+ Slog.i(TAG, "App " + uid + "/" + packageName + " targets O+, restricted");
+ }
+ return ActivityManager.APP_START_MODE_DELAYED_RIGID;
+ }
+ // ...and legacy apps get an AppOp check
+ int appop = mAppOpsService.noteOperation(AppOpsManager.OP_RUN_IN_BACKGROUND,
+ uid, packageName);
+ if (DEBUG_BACKGROUND_CHECK) {
+ Slog.i(TAG, "Legacy app " + uid + "/" + packageName + " bg appop " + appop);
+ }
+ switch (appop) {
+ case AppOpsManager.MODE_ALLOWED:
+ return ActivityManager.APP_START_MODE_NORMAL;
+ case AppOpsManager.MODE_IGNORED:
+ return ActivityManager.APP_START_MODE_DELAYED;
+ default:
+ return ActivityManager.APP_START_MODE_DELAYED_RIGID;
+ }
+ }
+
+ // Service launch is available to apps with run-in-background exemptions but
+ // some other background operations are not. If we're doing a check
+ // of service-launch policy, allow those callers to proceed unrestricted.
+ int appServicesRestrictedInBackgroundLocked(int uid, String packageName, int packageTargetSdk) {
+ // Persistent app?
+ if (mPackageManagerInt.isPackagePersistent(packageName)) {
+ if (DEBUG_BACKGROUND_CHECK) {
+ Slog.i(TAG, "App " + uid + "/" + packageName
+ + " is persistent; not restricted in background");
+ }
+ return ActivityManager.APP_START_MODE_NORMAL;
+ }
+
+ // Non-persistent but background whitelisted?
+ if (uidOnBackgroundWhitelist(uid)) {
+ if (DEBUG_BACKGROUND_CHECK) {
+ Slog.i(TAG, "App " + uid + "/" + packageName
+ + " on background whitelist; not restricted in background");
+ }
+ return ActivityManager.APP_START_MODE_NORMAL;
+ }
+
+ // Is this app on the battery whitelist?
+ if (isOnDeviceIdleWhitelistLocked(uid)) {
+ if (DEBUG_BACKGROUND_CHECK) {
+ Slog.i(TAG, "App " + uid + "/" + packageName
+ + " on idle whitelist; not restricted in background");
+ }
+ return ActivityManager.APP_START_MODE_NORMAL;
+ }
+
+ // None of the service-policy criteria apply, so we apply the common criteria
+ return appRestrictedInBackgroundLocked(uid, packageName, packageTargetSdk);
+ }
+
+ int getAppStartModeLocked(int uid, String packageName, int packageTargetSdk,
+ int callingPid, boolean alwaysRestrict, boolean disabledOnly) {
+ UidRecord uidRec = mActiveUids.get(uid);
+ if (DEBUG_BACKGROUND_CHECK) Slog.d(TAG, "checkAllowBackground: uid=" + uid + " pkg="
+ + packageName + " rec=" + uidRec + " always=" + alwaysRestrict + " idle="
+ + (uidRec != null ? uidRec.idle : false));
+ if (uidRec == null || alwaysRestrict || uidRec.idle) {
+ boolean ephemeral;
+ if (uidRec == null) {
+ ephemeral = getPackageManagerInternalLocked().isPackageEphemeral(
+ UserHandle.getUserId(uid), packageName);
+ } else {
+ ephemeral = uidRec.ephemeral;
+ }
+
+ if (ephemeral) {
+ // We are hard-core about ephemeral apps not running in the background.
+ return ActivityManager.APP_START_MODE_DISABLED;
+ } else {
+ if (disabledOnly) {
+ // The caller is only interested in whether app starts are completely
+ // disabled for the given package (that is, it is an instant app). So
+ // we don't need to go further, which is all just seeing if we should
+ // apply a "delayed" mode for a regular app.
+ return ActivityManager.APP_START_MODE_NORMAL;
+ }
+ final int startMode = (alwaysRestrict)
+ ? appRestrictedInBackgroundLocked(uid, packageName, packageTargetSdk)
+ : appServicesRestrictedInBackgroundLocked(uid, packageName,
+ packageTargetSdk);
+ if (DEBUG_BACKGROUND_CHECK) Slog.d(TAG, "checkAllowBackground: uid=" + uid
+ + " pkg=" + packageName + " startMode=" + startMode
+ + " onwhitelist=" + isOnDeviceIdleWhitelistLocked(uid));
+ if (startMode == ActivityManager.APP_START_MODE_DELAYED) {
+ // This is an old app that has been forced into a "compatible as possible"
+ // mode of background check. To increase compatibility, we will allow other
+ // foreground apps to cause its services to start.
+ if (callingPid >= 0) {
+ ProcessRecord proc;
+ synchronized (mPidsSelfLocked) {
+ proc = mPidsSelfLocked.get(callingPid);
+ }
+ if (proc != null &&
+ !ActivityManager.isProcStateBackground(proc.curProcState)) {
+ // Whoever is instigating this is in the foreground, so we will allow it
+ // to go through.
+ return ActivityManager.APP_START_MODE_NORMAL;
+ }
+ }
+ }
+ return startMode;
+ }
+ }
+ return ActivityManager.APP_START_MODE_NORMAL;
+ }
+
+ boolean isOnDeviceIdleWhitelistLocked(int uid) {
+ final int appId = UserHandle.getAppId(uid);
+ return Arrays.binarySearch(mDeviceIdleWhitelist, appId) >= 0
+ || Arrays.binarySearch(mDeviceIdleTempWhitelist, appId) >= 0
+ || mPendingTempWhitelist.indexOfKey(uid) >= 0;
+ }
+
+ private ProviderInfo getProviderInfoLocked(String authority, int userHandle, int pmFlags) {
ProviderInfo pi = null;
ContentProviderRecord cpr = mProviderMap.getProviderByName(authority, userHandle);
if (cpr != null) {
} else {
try {
pi = AppGlobals.getPackageManager().resolveContentProvider(
- authority, PackageManager.GET_URI_PERMISSION_PATTERNS, userHandle);
+ authority, PackageManager.GET_URI_PERMISSION_PATTERNS | pmFlags,
+ userHandle);
} catch (RemoteException ex) {
}
}
return pi;
}
+ void grantEphemeralAccessLocked(int userId, Intent intent,
+ int targetAppId, int ephemeralAppId) {
+ getPackageManagerInternalLocked().
+ grantEphemeralAccess(userId, intent, targetAppId, ephemeralAppId);
+ }
+
private UriPermission findUriPermissionLocked(int targetUid, GrantUri grantUri) {
final ArrayMap<GrantUri, UriPermission> targetUris = mGrantedUriPermissions.get(targetUid);
if (targetUris != null) {
return -1;
}
+ // Bail early if system is trying to hand out permissions directly; it
+ // must always grant permissions on behalf of someone explicit.
+ final int callingAppId = UserHandle.getAppId(callingUid);
+ if ((callingAppId == SYSTEM_UID) || (callingAppId == ROOT_UID)) {
+ if ("com.android.settings.files".equals(grantUri.uri.getAuthority())) {
+ // Exempted authority for cropping user photos in Settings app
+ } else {
+ Slog.w(TAG, "For security reasons, the system cannot issue a Uri permission"
+ + " grant to " + grantUri + "; use startActivityAsCaller() instead");
+ return -1;
+ }
+ }
+
final String authority = grantUri.uri.getAuthority();
- final ProviderInfo pi = getProviderInfoLocked(authority, grantUri.sourceUserId);
+ final ProviderInfo pi = getProviderInfoLocked(authority, grantUri.sourceUserId,
+ MATCH_DEBUG_TRIAGED_MISSING);
if (pi == null) {
Slog.w(TAG, "No content provider found for permission check: " +
grantUri.uri.toSafeString());
int targetUid = lastTargetUid;
if (targetUid < 0 && targetPkg != null) {
try {
- targetUid = pm.getPackageUid(targetPkg, UserHandle.getUserId(callingUid));
+ targetUid = pm.getPackageUid(targetPkg, MATCH_DEBUG_TRIAGED_MISSING,
+ UserHandle.getUserId(callingUid));
if (targetUid < 0) {
if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION,
"Can't grant URI permission no uid for: " + targetPkg);
}
}
+ // Figure out the value returned when access is allowed
+ final int allowedResult;
+ if ((modeFlags & Intent.FLAG_GRANT_PERSISTABLE_URI_PERMISSION) != 0) {
+ // If we're extending a persistable grant, then we need to return
+ // "targetUid" so that we always create a grant data structure to
+ // support take/release APIs
+ allowedResult = targetUid;
+ } else {
+ // Otherwise, we can return "-1" to indicate that no grant data
+ // structures need to be created
+ allowedResult = -1;
+ }
+
if (targetUid >= 0) {
// First... does the target actually need this permission?
if (checkHoldingPermissionsLocked(pm, pi, grantUri, targetUid, modeFlags)) {
// No need to grant the target this permission.
if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION,
"Target " + targetPkg + " already has full permission to " + grantUri);
- return -1;
+ return allowedResult;
}
} else {
// First... there is no target package, so can anyone access it?
}
}
if (allowed) {
- return -1;
+ return allowedResult;
}
}
// Third... does the caller itself have permission to access
// this uri?
- final int callingAppId = UserHandle.getAppId(callingUid);
- if ((callingAppId == Process.SYSTEM_UID) || (callingAppId == Process.ROOT_UID)) {
- Slog.w(TAG, "For security reasons, the system cannot issue a Uri permission"
- + " grant to " + grantUri + "; use startActivityAsCaller() instead");
- return -1;
- } else {
- if (!checkHoldingPermissionsLocked(pm, pi, grantUri, callingUid, modeFlags)) {
- // Require they hold a strong enough Uri permission
- if (!checkUriPermissionLocked(grantUri, callingUid, modeFlags)) {
- throw new SecurityException("Uid " + callingUid
- + " does not have permission to uri " + grantUri);
+ if (!checkHoldingPermissionsLocked(pm, pi, grantUri, callingUid, modeFlags)) {
+ // Require they hold a strong enough Uri permission
+ if (!checkUriPermissionLocked(grantUri, callingUid, modeFlags)) {
+ if (android.Manifest.permission.MANAGE_DOCUMENTS.equals(pi.readPermission)) {
+ throw new SecurityException(
+ "UID " + callingUid + " does not have permission to " + grantUri
+ + "; you could obtain access using ACTION_OPEN_DOCUMENT "
+ + "or related APIs");
+ } else {
+ throw new SecurityException(
+ "UID " + callingUid + " does not have permission to " + grantUri);
}
}
}
"Granting " + targetPkg + "/" + targetUid + " permission to " + grantUri);
final String authority = grantUri.uri.getAuthority();
- final ProviderInfo pi = getProviderInfoLocked(authority, grantUri.sourceUserId);
+ final ProviderInfo pi = getProviderInfoLocked(authority, grantUri.sourceUserId,
+ MATCH_DEBUG_TRIAGED_MISSING);
if (pi == null) {
Slog.w(TAG, "No content provider found for grant: " + grantUri.toSafeString());
return;
int targetUid;
final IPackageManager pm = AppGlobals.getPackageManager();
try {
- targetUid = pm.getPackageUid(targetPkg, targetUserId);
+ targetUid = pm.getPackageUid(targetPkg, MATCH_DEBUG_TRIAGED_MISSING, targetUserId);
} catch (RemoteException ex) {
return;
}
targetUid = needed.targetUid;
} else {
try {
- targetUid = pm.getPackageUid(targetPkg, targetUserId);
+ targetUid = pm.getPackageUid(targetPkg, MATCH_DEBUG_TRIAGED_MISSING,
+ targetUserId);
} catch (RemoteException ex) {
return null;
}
}
}
- private void revokeUriPermissionLocked(int callingUid, GrantUri grantUri, final int modeFlags) {
+ private void revokeUriPermissionLocked(String targetPackage, int callingUid, GrantUri grantUri,
+ final int modeFlags) {
if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION,
"Revoking all granted permissions to " + grantUri);
final IPackageManager pm = AppGlobals.getPackageManager();
final String authority = grantUri.uri.getAuthority();
- final ProviderInfo pi = getProviderInfoLocked(authority, grantUri.sourceUserId);
+ final ProviderInfo pi = getProviderInfoLocked(authority, grantUri.sourceUserId,
+ MATCH_DIRECT_BOOT_AWARE | MATCH_DIRECT_BOOT_UNAWARE);
if (pi == null) {
Slog.w(TAG, "No content provider found for permission revoke: "
+ grantUri.toSafeString());
final ArrayMap<GrantUri, UriPermission> perms = mGrantedUriPermissions.get(callingUid);
if (perms != null) {
boolean persistChanged = false;
- for (Iterator<UriPermission> it = perms.values().iterator(); it.hasNext();) {
- final UriPermission perm = it.next();
+ for (int i = perms.size()-1; i >= 0; i--) {
+ final UriPermission perm = perms.valueAt(i);
+ if (targetPackage != null && !targetPackage.equals(perm.targetPkg)) {
+ continue;
+ }
if (perm.uri.sourceUserId == grantUri.sourceUserId
&& perm.uri.uri.isPathPrefixMatch(grantUri.uri)) {
if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION,
persistChanged |= perm.revokeModes(
modeFlags | Intent.FLAG_GRANT_PERSISTABLE_URI_PERMISSION, false);
if (perm.modeFlags == 0) {
- it.remove();
+ perms.removeAt(i);
}
}
}
boolean persistChanged = false;
// Go through all of the permissions and remove any that match.
- int N = mGrantedUriPermissions.size();
- for (int i = 0; i < N; i++) {
+ for (int i = mGrantedUriPermissions.size()-1; i >= 0; i--) {
final int targetUid = mGrantedUriPermissions.keyAt(i);
final ArrayMap<GrantUri, UriPermission> perms = mGrantedUriPermissions.valueAt(i);
- for (Iterator<UriPermission> it = perms.values().iterator(); it.hasNext();) {
- final UriPermission perm = it.next();
+ for (int j = perms.size()-1; j >= 0; j--) {
+ final UriPermission perm = perms.valueAt(j);
+ if (targetPackage != null && !targetPackage.equals(perm.targetPkg)) {
+ continue;
+ }
if (perm.uri.sourceUserId == grantUri.sourceUserId
&& perm.uri.uri.isPathPrefixMatch(grantUri.uri)) {
if (DEBUG_URI_PERMISSION) Slog.v(TAG_URI_PERMISSION,
"Revoking " + perm.targetUid + " permission to " + perm.uri);
persistChanged |= perm.revokeModes(
- modeFlags | Intent.FLAG_GRANT_PERSISTABLE_URI_PERMISSION, true);
+ modeFlags | Intent.FLAG_GRANT_PERSISTABLE_URI_PERMISSION,
+ targetPackage == null);
if (perm.modeFlags == 0) {
- it.remove();
+ perms.removeAt(j);
}
}
}
if (perms.isEmpty()) {
- mGrantedUriPermissions.remove(targetUid);
- N--;
- i--;
+ mGrantedUriPermissions.removeAt(i);
}
}
* @param userId The userId in which the uri is to be resolved.
*/
@Override
- public void revokeUriPermission(IApplicationThread caller, Uri uri, final int modeFlags,
- int userId) {
+ public void revokeUriPermission(IApplicationThread caller, String targetPackage, Uri uri,
+ final int modeFlags, int userId) {
enforceNotIsolatedCaller("revokeUriPermission");
synchronized(this) {
final ProcessRecord r = getRecordForAppLocked(caller);
}
final String authority = uri.getAuthority();
- final ProviderInfo pi = getProviderInfoLocked(authority, userId);
+ final ProviderInfo pi = getProviderInfoLocked(authority, userId,
+ MATCH_DIRECT_BOOT_AWARE | MATCH_DIRECT_BOOT_UNAWARE);
if (pi == null) {
Slog.w(TAG, "No content provider found for permission revoke: "
+ uri.toSafeString());
return;
}
- revokeUriPermissionLocked(r.uid, new GrantUri(userId, uri, false), modeFlags);
+ revokeUriPermissionLocked(targetPackage, r.uid, new GrantUri(userId, uri, false),
+ modeFlags);
}
}
}
}
+ @Override
+ public IBinder getUriPermissionOwnerForActivity(IBinder activityToken) {
+ enforceNotIsolatedCaller("getUriPermissionOwnerForActivity");
+ synchronized(this) {
+ ActivityRecord r = ActivityRecord.isInStackLocked(activityToken);
+ if (r == null) {
+ throw new IllegalArgumentException("Activity does not exist; token="
+ + activityToken);
+ }
+ return r.getUriPermissionsLocked().getExternalTokenLocked();
+ }
+ }
/**
* @param uri This uri must NOT contain an embedded userId.
* @param sourceUserId The userId in which the uri is to be resolved.
@Override
public void grantUriPermissionFromOwner(IBinder token, int fromUid, String targetPkg, Uri uri,
final int modeFlags, int sourceUserId, int targetUserId) {
- targetUserId = handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(),
- targetUserId, false, ALLOW_FULL_ONLY, "grantUriPermissionFromOwner", null);
+ targetUserId = mUserController.handleIncomingUser(Binder.getCallingPid(),
+ Binder.getCallingUid(), targetUserId, false, ALLOW_FULL_ONLY,
+ "grantUriPermissionFromOwner", null);
synchronized(this) {
UriPermissionOwner owner = UriPermissionOwner.fromExternalToken(token);
if (owner == null) {
throw new IllegalArgumentException("Unknown owner: " + token);
}
if (fromUid != Binder.getCallingUid()) {
- if (Binder.getCallingUid() != Process.myUid()) {
+ if (Binder.getCallingUid() != myUid()) {
// Only system code can grant URI permissions on behalf
// of other users.
throw new SecurityException("nice try");
if (uri == null) {
owner.removeUriPermissionsLocked(mode);
} else {
- owner.removeUriPermissionLocked(new GrantUri(userId, uri, false), mode);
+ final boolean prefix = (mode & Intent.FLAG_GRANT_PREFIX_URI_PERMISSION) != 0;
+ owner.removeUriPermissionLocked(new GrantUri(userId, uri, prefix), mode);
}
}
}
final long createdTime = readLongAttribute(in, ATTR_CREATED_TIME, now);
// Sanity check that provider still belongs to source package
+ // Both direct boot aware and unaware packages are fine as we
+ // will do filtering at query time to avoid multiple parsing.
final ProviderInfo pi = getProviderInfoLocked(
- uri.getAuthority(), sourceUserId);
+ uri.getAuthority(), sourceUserId, MATCH_DIRECT_BOOT_AWARE
+ | MATCH_DIRECT_BOOT_UNAWARE);
if (pi != null && sourcePkg.equals(pi.packageName)) {
int targetUid = -1;
try {
- targetUid = AppGlobals.getPackageManager()
- .getPackageUid(targetPkg, targetUserId);
+ targetUid = AppGlobals.getPackageManager().getPackageUid(
+ targetPkg, MATCH_UNINSTALLED_PACKAGES, targetUserId);
} catch (RemoteException e) {
}
if (targetUid != -1) {
Preconditions.checkNotNull(packageName, "packageName");
final int callingUid = Binder.getCallingUid();
+ final int callingUserId = UserHandle.getUserId(callingUid);
final IPackageManager pm = AppGlobals.getPackageManager();
try {
- final int packageUid = pm.getPackageUid(packageName, UserHandle.getUserId(callingUid));
+ final int packageUid = pm.getPackageUid(packageName,
+ MATCH_DIRECT_BOOT_AWARE | MATCH_DIRECT_BOOT_UNAWARE, callingUserId);
if (packageUid != callingUid) {
throw new SecurityException(
"Package " + packageName + " does not belong to calling UID " + callingUid);
}
@Override
+ public ParceledListSlice<android.content.UriPermission> getGrantedUriPermissions(
+ String packageName, int userId) {
+ enforceCallingPermission(android.Manifest.permission.GET_APP_GRANTED_URI_PERMISSIONS,
+ "getGrantedUriPermissions");
+
+ final ArrayList<android.content.UriPermission> result = Lists.newArrayList();
+ synchronized (this) {
+ final int size = mGrantedUriPermissions.size();
+ for (int i = 0; i < size; i++) {
+ final ArrayMap<GrantUri, UriPermission> perms = mGrantedUriPermissions.valueAt(i);
+ for (UriPermission perm : perms.values()) {
+ if (packageName.equals(perm.targetPkg) && perm.targetUserId == userId
+ && perm.persistedModeFlags != 0) {
+ result.add(perm.buildPersistedPublicApiObject());
+ }
+ }
+ }
+ }
+ return new ParceledListSlice<android.content.UriPermission>(result);
+ }
+
+ @Override
+ public void clearGrantedUriPermissions(String packageName, int userId) {
+ enforceCallingPermission(android.Manifest.permission.CLEAR_APP_GRANTED_URI_PERMISSIONS,
+ "clearGrantedUriPermissions");
+ removeUriPermissionsForPackageLocked(packageName, userId, true);
+ }
+
+ @Override
public void showWaitingForDebugger(IApplicationThread who, boolean waiting) {
synchronized (this) {
ProcessRecord app =
if (app == null) return;
Message msg = Message.obtain();
- msg.what = WAIT_FOR_DEBUGGER_MSG;
+ msg.what = WAIT_FOR_DEBUGGER_UI_MSG;
msg.obj = app;
msg.arg1 = waiting ? 1 : 0;
mUiHandler.sendMessage(msg);
public void getMemoryInfo(ActivityManager.MemoryInfo outInfo) {
final long homeAppMem = mProcessList.getMemLevel(ProcessList.HOME_APP_ADJ);
final long cachedAppMem = mProcessList.getMemLevel(ProcessList.CACHED_APP_MIN_ADJ);
- outInfo.availMem = Process.getFreeMemory();
- outInfo.totalMem = Process.getTotalMemory();
+ outInfo.availMem = getFreeMemory();
+ outInfo.totalMem = getTotalMemory();
outInfo.threshold = homeAppMem;
outInfo.lowMemory = outInfo.availMem < (homeAppMem + ((cachedAppMem-homeAppMem)/2));
outInfo.hiddenAppThreshold = cachedAppMem;
// =========================================================
@Override
- public List<IAppTask> getAppTasks(String callingPackage) {
+ public List<IBinder> getAppTasks(String callingPackage) {
int callingUid = Binder.getCallingUid();
long ident = Binder.clearCallingIdentity();
synchronized(this) {
- ArrayList<IAppTask> list = new ArrayList<IAppTask>();
+ ArrayList<IBinder> list = new ArrayList<IBinder>();
try {
if (DEBUG_ALL) Slog.v(TAG, "getAppTasks");
ActivityManager.RecentTaskInfo taskInfo =
createRecentTaskInfoFromTaskRecord(tr);
AppTaskImpl taskImpl = new AppTaskImpl(taskInfo.persistentId, callingUid);
- list.add(taskImpl);
+ list.add(taskImpl.asBinder());
}
} finally {
Binder.restoreCallingIdentity(ident);
rti.persistentId = tr.taskId;
rti.baseIntent = new Intent(tr.getBaseIntent());
rti.origActivity = tr.origActivity;
+ rti.realActivity = tr.realActivity;
rti.description = tr.lastDescription;
- rti.stackId = tr.stack != null ? tr.stack.mStackId : -1;
+ rti.stackId = tr.getStackId();
rti.userId = tr.userId;
rti.taskDescription = new ActivityManager.TaskDescription(tr.lastTaskDescription);
rti.firstActiveTime = tr.firstActiveTime;
rti.affiliatedTaskId = tr.mAffiliatedTaskId;
rti.affiliatedTaskColor = tr.mAffiliatedTaskColor;
rti.numActivities = 0;
+ if (tr.mBounds != null) {
+ rti.bounds = new Rect(tr.mBounds);
+ }
+ rti.supportsSplitScreenMultiWindow = tr.supportsSplitScreen();
+ rti.resizeMode = tr.mResizeMode;
ActivityRecord base = null;
ActivityRecord top = null;
}
@Override
- public List<ActivityManager.RecentTaskInfo> getRecentTasks(int maxNum, int flags, int userId) {
+ public ParceledListSlice<ActivityManager.RecentTaskInfo> getRecentTasks(int maxNum, int flags,
+ int userId) {
final int callingUid = Binder.getCallingUid();
- userId = handleIncomingUser(Binder.getCallingPid(), callingUid, userId,
+ userId = mUserController.handleIncomingUser(Binder.getCallingPid(), callingUid, userId,
false, ALLOW_FULL_ONLY, "getRecentTasks", null);
final boolean includeProfiles = (flags & ActivityManager.RECENT_INCLUDE_PROFILES) != 0;
android.Manifest.permission.GET_DETAILED_TASKS)
== PackageManager.PERMISSION_GRANTED;
+ if (!isUserRunning(userId, ActivityManager.FLAG_AND_UNLOCKED)) {
+ Slog.i(TAG, "user " + userId + " is still locked. Cannot load recents");
+ return ParceledListSlice.emptyList();
+ }
+ mRecentTasks.loadUserRecentsLocked(userId);
+
final int recentsCount = mRecentTasks.size();
ArrayList<ActivityManager.RecentTaskInfo> res =
new ArrayList<>(maxNum < recentsCount ? maxNum : recentsCount);
final Set<Integer> includedUsers;
if (includeProfiles) {
- includedUsers = getProfileIdsLocked(userId);
+ includedUsers = mUserController.getProfileIds(userId);
} else {
includedUsers = new HashSet<>();
}
continue;
}
+ if (tr.realActivitySuspended) {
+ if (DEBUG_RECENTS) Slog.d(TAG_RECENTS, "Skipping, activity suspended: " + tr);
+ continue;
+ }
+
// Return the entry if desired by the caller. We always return
// the first entry, because callers always expect this to be the
// foreground app. We may filter others if the caller has
continue;
}
}
- if ((flags & ActivityManager.RECENT_IGNORE_HOME_STACK_TASKS) != 0) {
- if (tr.stack != null && tr.stack.isHomeStack()) {
+ final ActivityStack stack = tr.getStack();
+ if ((flags & ActivityManager.RECENT_IGNORE_HOME_AND_RECENTS_STACK_TASKS) != 0) {
+ if (stack != null && stack.isHomeOrRecentsStack()) {
+ if (DEBUG_RECENTS) Slog.d(TAG_RECENTS,
+ "Skipping, home or recents stack task: " + tr);
+ continue;
+ }
+ }
+ if ((flags & ActivityManager.RECENT_INGORE_DOCKED_STACK_TOP_TASK) != 0) {
+ if (stack != null && stack.isDockedStack() && stack.topTask() == tr) {
+ if (DEBUG_RECENTS) Slog.d(TAG_RECENTS,
+ "Skipping, top task in docked stack: " + tr);
+ continue;
+ }
+ }
+ if ((flags & ActivityManager.RECENT_INGORE_PINNED_STACK_TASKS) != 0) {
+ if (stack != null && stack.isPinnedStack()) {
if (DEBUG_RECENTS) Slog.d(TAG_RECENTS,
- "Skipping, home stack task: " + tr);
+ "Skipping, pinned stack task: " + tr);
continue;
}
}
continue;
}
+ if (!tr.mUserSetupComplete) {
+ // Don't include task launched while user is not done setting-up.
+ if (DEBUG_RECENTS) Slog.d(TAG_RECENTS,
+ "Skipping, user setup not complete: " + tr);
+ continue;
+ }
+
ActivityManager.RecentTaskInfo rti = createRecentTaskInfoFromTaskRecord(tr);
if (!detailed) {
rti.baseIntent.replaceExtras((Bundle)null);
maxNum--;
}
}
- return res;
+ return new ParceledListSlice<>(res);
}
}
synchronized (this) {
enforceCallingPermission(android.Manifest.permission.READ_FRAME_BUFFER,
"getTaskThumbnail()");
- TaskRecord tr = mStackSupervisor.anyTaskForIdLocked(id, false);
+ final TaskRecord tr = mStackSupervisor.anyTaskForIdLocked(
+ id, MATCH_TASK_IN_STACKS_OR_RECENT_TASKS, INVALID_STACK_ID);
if (tr != null) {
return tr.getTaskThumbnailLocked();
}
}
@Override
+ public ActivityManager.TaskDescription getTaskDescription(int id) {
+ synchronized (this) {
+ enforceCallingPermission(android.Manifest.permission.MANAGE_ACTIVITY_STACKS,
+ "getTaskDescription()");
+ final TaskRecord tr = mStackSupervisor.anyTaskForIdLocked(id,
+ MATCH_TASK_IN_STACKS_OR_RECENT_TASKS, INVALID_STACK_ID);
+ if (tr != null) {
+ return tr.lastTaskDescription;
+ }
+ }
+ return null;
+ }
+
+ @Override
public int addAppTask(IBinder activityToken, Intent intent,
ActivityManager.TaskDescription description, Bitmap thumbnail) throws RemoteException {
final int callingUid = Binder.getCallingUid();
// sense, so turn off auto-remove.
intent.addFlags(Intent.FLAG_ACTIVITY_RETAIN_IN_RECENTS);
}
- } else if ((intent.getFlags()&Intent.FLAG_ACTIVITY_NEW_TASK) != 0) {
- // Must be a new task.
- intent.addFlags(Intent.FLAG_ACTIVITY_NEW_TASK);
}
if (!comp.equals(mLastAddedTaskComponent) || callingUid != mLastAddedTaskUid) {
mLastAddedTaskActivity = null;
}
}
- TaskRecord task = new TaskRecord(this, mStackSupervisor.getNextTaskId(), ainfo,
- intent, description);
+ TaskRecord task = new TaskRecord(this,
+ mStackSupervisor.getNextTaskIdForUserLocked(r.userId),
+ ainfo, intent, description, new TaskThumbnailInfo());
int trimIdx = mRecentTasks.trimForTaskLocked(task, false);
if (trimIdx >= 0) {
task.inRecents = true;
mRecentTasks.add(task);
- r.task.stack.addTask(task, false, false);
+ r.getStack().addTask(task, false, "addAppTask");
- task.setLastThumbnail(thumbnail);
+ task.setLastThumbnailLocked(thumbnail);
task.freeLastThumbnail();
-
return task.taskId;
}
} finally {
ActivityRecord r = ActivityRecord.isInStackLocked(token);
if (r != null) {
r.setTaskDescription(td);
- r.task.updateTaskDescription();
+ final TaskRecord task = r.getTask();
+ task.updateTaskDescription();
+ mTaskChangeNotificationController.notifyTaskDescriptionChanged(task.taskId, td);
}
}
}
@Override
- public void setTaskResizeable(int taskId, boolean resizeable) {
+ public void setTaskResizeable(int taskId, int resizeableMode) {
synchronized (this) {
- TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId, false);
+ final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(
+ taskId, MATCH_TASK_IN_STACKS_OR_RECENT_TASKS, INVALID_STACK_ID);
if (task == null) {
Slog.w(TAG, "setTaskResizeable: taskId=" + taskId + " not found");
return;
}
- if (task.mResizeable != resizeable) {
- task.mResizeable = resizeable;
- mStackSupervisor.ensureActivitiesVisibleLocked(null, 0);
- mStackSupervisor.resumeTopActivitiesLocked();
- }
+ task.setResizeMode(resizeableMode);
}
}
@Override
- public void resizeTask(int taskId, Rect bounds) {
- enforceCallingPermission(android.Manifest.permission.MANAGE_ACTIVITY_STACKS,
- "resizeTask()");
+ public void resizeTask(int taskId, Rect bounds, int resizeMode) {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "resizeTask()");
long ident = Binder.clearCallingIdentity();
try {
synchronized (this) {
Slog.w(TAG, "resizeTask: taskId=" + taskId + " not found");
return;
}
- mStackSupervisor.resizeTaskLocked(task, bounds);
+ // Place the task in the right stack if it isn't there already based on
+ // the requested bounds.
+ // The stack transition logic is:
+ // - a null bounds on a freeform task moves that task to fullscreen
+ // - a non-null bounds on a non-freeform (fullscreen OR docked) task moves
+ // that task to freeform
+ // - otherwise the task is not moved
+ int stackId = task.getStackId();
+ if (!StackId.isTaskResizeAllowed(stackId)) {
+ throw new IllegalArgumentException("resizeTask not allowed on task=" + task);
+ }
+ if (bounds == null && stackId == FREEFORM_WORKSPACE_STACK_ID) {
+ stackId = FULLSCREEN_WORKSPACE_STACK_ID;
+ } else if (bounds != null && stackId != FREEFORM_WORKSPACE_STACK_ID ) {
+ stackId = FREEFORM_WORKSPACE_STACK_ID;
+ }
+
+ // Reparent the task to the right stack if necessary
+ boolean preserveWindow = (resizeMode & RESIZE_MODE_PRESERVE_WINDOW) != 0;
+ if (stackId != task.getStackId()) {
+ // Defer resume until the task is resized below
+ task.reparent(stackId, ON_TOP, REPARENT_KEEP_STACK_AT_FRONT, ANIMATE,
+ DEFER_RESUME, "resizeTask");
+ preserveWindow = false;
+ }
+
+ // After reparenting (which only resizes the task to the stack bounds), resize the
+ // task to the actual bounds provided
+ task.resize(bounds, resizeMode, preserveWindow, !DEFER_RESUME);
}
} finally {
Binder.restoreCallingIdentity(ident);
}
@Override
- public Bitmap getTaskDescriptionIcon(String filename) {
- if (!FileUtils.isValidExtFilename(filename)
- || !filename.contains(ActivityRecord.ACTIVITY_ICON_SUFFIX)) {
- throw new IllegalArgumentException("Bad filename: " + filename);
- }
- return mTaskPersister.getTaskDescriptionIcon(filename);
- }
-
- @Override
- public void startInPlaceAnimationOnFrontMostApplication(ActivityOptions opts)
- throws RemoteException {
- if (opts.getAnimationType() != ActivityOptions.ANIM_CUSTOM_IN_PLACE ||
- opts.getCustomInPlaceResId() == 0) {
- throw new IllegalArgumentException("Expected in-place ActivityOption " +
- "with valid animation");
- }
- mWindowManager.prepareAppTransition(AppTransition.TRANSIT_TASK_IN_PLACE, false);
- mWindowManager.overridePendingAppTransitionInPlace(opts.getPackageName(),
- opts.getCustomInPlaceResId());
- mWindowManager.executeAppTransition();
- }
-
- private void cleanUpRemovedTaskLocked(TaskRecord tr, boolean killProcess) {
- mRecentTasks.remove(tr);
- tr.removedFromRecents();
- ComponentName component = tr.getBaseIntent().getComponent();
- if (component == null) {
- Slog.w(TAG, "No component for base intent of task: " + tr);
- return;
- }
-
- // Find any running services associated with this app and stop if needed.
- mServices.cleanUpRemovedTaskLocked(tr, component, new Intent(tr.getBaseIntent()));
-
- if (!killProcess) {
- return;
- }
-
- // Determine if the process(es) for this task should be killed.
- final String pkg = component.getPackageName();
- ArrayList<ProcessRecord> procsToKill = new ArrayList<>();
- ArrayMap<String, SparseArray<ProcessRecord>> pmap = mProcessNames.getMap();
- for (int i = 0; i < pmap.size(); i++) {
-
- SparseArray<ProcessRecord> uids = pmap.valueAt(i);
- for (int j = 0; j < uids.size(); j++) {
- ProcessRecord proc = uids.valueAt(j);
- if (proc.userId != tr.userId) {
- // Don't kill process for a different user.
- continue;
- }
- if (proc == mHomeProcess) {
- // Don't kill the home process along with tasks from the same package.
- continue;
- }
- if (!proc.pkgList.containsKey(pkg)) {
- // Don't kill process that is not associated with this task.
- continue;
+ public Rect getTaskBounds(int taskId) {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "getTaskBounds()");
+ long ident = Binder.clearCallingIdentity();
+ Rect rect = new Rect();
+ try {
+ synchronized (this) {
+ final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId,
+ MATCH_TASK_IN_STACKS_OR_RECENT_TASKS, INVALID_STACK_ID);
+ if (task == null) {
+ Slog.w(TAG, "getTaskBounds: taskId=" + taskId + " not found");
+ return rect;
}
-
- for (int k = 0; k < proc.activities.size(); k++) {
- TaskRecord otherTask = proc.activities.get(k).task;
- if (tr.taskId != otherTask.taskId && otherTask.inRecents) {
- // Don't kill process(es) that has an activity in a different task that is
- // also in recents.
- return;
+ if (task.getStack() != null) {
+ // Return the bounds from window manager since it will be adjusted for various
+ // things like the presense of a docked stack for tasks that aren't resizeable.
+ task.getWindowContainerBounds(rect);
+ } else {
+ // Task isn't in window manager yet since it isn't associated with a stack.
+ // Return the persist value from activity manager
+ if (task.mBounds != null) {
+ rect.set(task.mBounds);
+ } else if (task.mLastNonFullscreenBounds != null) {
+ rect.set(task.mLastNonFullscreenBounds);
}
}
+ }
+ } finally {
+ Binder.restoreCallingIdentity(ident);
+ }
+ return rect;
+ }
- if (proc.foregroundServices) {
- // Don't kill process(es) with foreground service.
+ @Override
+ public void cancelTaskWindowTransition(int taskId) {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "cancelTaskWindowTransition()");
+ final long ident = Binder.clearCallingIdentity();
+ try {
+ synchronized (this) {
+ final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId,
+ MATCH_TASK_IN_STACKS_ONLY, INVALID_STACK_ID);
+ if (task == null) {
+ Slog.w(TAG, "cancelTaskWindowTransition: taskId=" + taskId + " not found");
return;
}
+ task.cancelWindowTransition();
+ }
+ } finally {
+ Binder.restoreCallingIdentity(ident);
+ }
+ }
- // Add process to kill list.
- procsToKill.add(proc);
+ @Override
+ public void cancelTaskThumbnailTransition(int taskId) {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "cancelTaskThumbnailTransition()");
+ final long ident = Binder.clearCallingIdentity();
+ try {
+ synchronized (this) {
+ final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId,
+ MATCH_TASK_IN_STACKS_ONLY, INVALID_STACK_ID);
+ if (task == null) {
+ Slog.w(TAG, "cancelTaskThumbnailTransition: taskId=" + taskId + " not found");
+ return;
+ }
+ task.cancelThumbnailTransition();
}
+ } finally {
+ Binder.restoreCallingIdentity(ident);
}
+ }
- // Kill the running processes.
- for (int i = 0; i < procsToKill.size(); i++) {
- ProcessRecord pr = procsToKill.get(i);
- if (pr.setSchedGroup == Process.THREAD_GROUP_BG_NONINTERACTIVE
- && pr.curReceiver == null) {
- pr.kill("remove task", true);
- } else {
- // We delay killing processes that are not in the background or running a receiver.
- pr.waitingToKill = "remove task";
+ @Override
+ public TaskSnapshot getTaskSnapshot(int taskId, boolean reducedResolution) {
+ enforceCallingPermission(READ_FRAME_BUFFER, "getTaskSnapshot()");
+ final long ident = Binder.clearCallingIdentity();
+ try {
+ final TaskRecord task;
+ synchronized (this) {
+ task = mStackSupervisor.anyTaskForIdLocked(taskId,
+ MATCH_TASK_IN_STACKS_OR_RECENT_TASKS, INVALID_STACK_ID);
+ if (task == null) {
+ Slog.w(TAG, "getTaskSnapshot: taskId=" + taskId + " not found");
+ return null;
+ }
}
+ // Don't call this while holding the lock as this operation might hit the disk.
+ return task.getSnapshot(reducedResolution);
+ } finally {
+ Binder.restoreCallingIdentity(ident);
+ }
+ }
+
+ @Override
+ public Bitmap getTaskDescriptionIcon(String filePath, int userId) {
+ if (userId != UserHandle.getCallingUserId()) {
+ enforceCallingPermission(android.Manifest.permission.INTERACT_ACROSS_USERS_FULL,
+ "getTaskDescriptionIcon");
}
+ final File passedIconFile = new File(filePath);
+ final File legitIconFile = new File(TaskPersister.getUserImagesDir(userId),
+ passedIconFile.getName());
+ if (!legitIconFile.getPath().equals(filePath)
+ || !filePath.contains(ActivityRecord.ACTIVITY_ICON_SUFFIX)) {
+ throw new IllegalArgumentException("Bad file path: " + filePath
+ + " passed for userId " + userId);
+ }
+ return mRecentTasks.getTaskDescriptionIcon(filePath);
+ }
+
+ @Override
+ public void startInPlaceAnimationOnFrontMostApplication(Bundle opts)
+ throws RemoteException {
+ final ActivityOptions activityOptions = ActivityOptions.fromBundle(opts);
+ if (activityOptions.getAnimationType() != ActivityOptions.ANIM_CUSTOM_IN_PLACE ||
+ activityOptions.getCustomInPlaceResId() == 0) {
+ throw new IllegalArgumentException("Expected in-place ActivityOption " +
+ "with valid animation");
+ }
+ mWindowManager.prepareAppTransition(TRANSIT_TASK_IN_PLACE, false);
+ mWindowManager.overridePendingAppTransitionInPlace(activityOptions.getPackageName(),
+ activityOptions.getCustomInPlaceResId());
+ mWindowManager.executeAppTransition();
}
private void removeTasksByPackageNameLocked(String packageName, int userId) {
ComponentName cn = tr.intent.getComponent();
if (cn != null && cn.getPackageName().equals(packageName)) {
// If the package name matches, remove the task.
- removeTaskByIdLocked(tr.taskId, true);
+ mStackSupervisor.removeTaskByIdLocked(tr.taskId, true, REMOVE_FROM_RECENTS);
}
}
}
final boolean sameComponent = cn != null && cn.getPackageName().equals(packageName)
&& (filterByClasses == null || filterByClasses.contains(cn.getClassName()));
if (sameComponent) {
- removeTaskByIdLocked(tr.taskId, false);
+ mStackSupervisor.removeTaskByIdLocked(tr.taskId, false, REMOVE_FROM_RECENTS);
}
}
}
- /**
- * Removes the task with the specified task id.
- *
- * @param taskId Identifier of the task to be removed.
- * @param killProcess Kill any process associated with the task if possible.
- * @return Returns true if the given task was found and removed.
- */
- private boolean removeTaskByIdLocked(int taskId, boolean killProcess) {
- TaskRecord tr = mStackSupervisor.anyTaskForIdLocked(taskId, false);
- if (tr != null) {
- tr.removeTaskActivitiesLocked();
- cleanUpRemovedTaskLocked(tr, killProcess);
- if (tr.isPersistable) {
- notifyTaskPersisterLocked(null, true);
+ @Override
+ public void removeStack(int stackId) {
+ enforceCallingPermission(Manifest.permission.MANAGE_ACTIVITY_STACKS, "removeStack()");
+ if (StackId.isHomeOrRecentsStack(stackId)) {
+ throw new IllegalArgumentException("Removing home or recents stack is not allowed.");
+ }
+
+ synchronized (this) {
+ final long ident = Binder.clearCallingIdentity();
+ try {
+ mStackSupervisor.removeStackLocked(stackId);
+ } finally {
+ Binder.restoreCallingIdentity(ident);
+ }
+ }
+ }
+
+ @Override
+ public void moveStackToDisplay(int stackId, int displayId) {
+ enforceCallingPermission(INTERNAL_SYSTEM_WINDOW, "moveStackToDisplay()");
+
+ synchronized (this) {
+ final long ident = Binder.clearCallingIdentity();
+ try {
+ if (DEBUG_STACK) Slog.d(TAG_STACK, "moveStackToDisplay: moving stackId=" + stackId
+ + " to displayId=" + displayId);
+ mStackSupervisor.moveStackToDisplayLocked(stackId, displayId, ON_TOP);
+ } finally {
+ Binder.restoreCallingIdentity(ident);
}
- return true;
}
- Slog.w(TAG, "Request to remove task ignored for non-existent task " + taskId);
- return false;
}
@Override
public boolean removeTask(int taskId) {
+ enforceCallingPermission(android.Manifest.permission.REMOVE_TASKS, "removeTask()");
synchronized (this) {
- enforceCallingPermission(android.Manifest.permission.REMOVE_TASKS,
- "removeTask()");
- long ident = Binder.clearCallingIdentity();
+ final long ident = Binder.clearCallingIdentity();
try {
- return removeTaskByIdLocked(taskId, true);
+ return mStackSupervisor.removeTaskByIdLocked(taskId, true, REMOVE_FROM_RECENTS);
} finally {
Binder.restoreCallingIdentity(ident);
}
* TODO: Add mController hook
*/
@Override
- public void moveTaskToFront(int taskId, int flags, Bundle options) {
+ public void moveTaskToFront(int taskId, int flags, Bundle bOptions) {
enforceCallingPermission(android.Manifest.permission.REORDER_TASKS, "moveTaskToFront()");
if (DEBUG_STACK) Slog.d(TAG_STACK, "moveTaskToFront: moving taskId=" + taskId);
synchronized(this) {
- moveTaskToFrontLocked(taskId, flags, options);
+ moveTaskToFrontLocked(taskId, flags, bOptions, false /* fromRecents */);
}
}
- void moveTaskToFrontLocked(int taskId, int flags, Bundle options) {
+ void moveTaskToFrontLocked(int taskId, int flags, Bundle bOptions, boolean fromRecents) {
+ ActivityOptions options = ActivityOptions.fromBundle(bOptions);
+
if (!checkAppSwitchAllowedLocked(Binder.getCallingPid(),
Binder.getCallingUid(), -1, -1, "Task to front")) {
ActivityOptions.abort(options);
return;
}
final ActivityRecord prev = mStackSupervisor.topRunningActivityLocked();
- if (prev != null && prev.isRecentsActivity()) {
- task.setTaskToReturnTo(ActivityRecord.RECENTS_ACTIVITY_TYPE);
+ if (prev != null) {
+ task.setTaskToReturnTo(prev);
+ }
+ mStackSupervisor.findTaskToMoveToFrontLocked(task, flags, options, "moveTaskToFront",
+ false /* forceNonResizable */);
+
+ final ActivityRecord topActivity = task.getTopActivity();
+ if (topActivity != null) {
+
+ // We are reshowing a task, use a starting window to hide the initial draw delay
+ // so the transition can start earlier.
+ topActivity.showStartingWindow(null /* prev */, false /* newTask */,
+ true /* taskSwitch */, fromRecents);
}
- mStackSupervisor.findTaskToMoveToFrontLocked(task, flags, options, "moveTaskToFront");
} finally {
Binder.restoreCallingIdentity(origId);
}
}
/**
- * Moves an activity, and all of the other activities within the same task, to the bottom
- * of the history stack. The activity's order within the task is unchanged.
+ * Attempts to move a task backwards in z-order (the order of activities within the task is
+ * unchanged).
+ *
+ * There are several possible results of this call:
+ * - if the task is locked, then we will show the lock toast
+ * - if there is a task behind the provided task, then that task is made visible and resumed as
+ * this task is moved to the back
+ * - otherwise, if there are no other tasks in the stack:
+ * - if this task is in the pinned stack, then we remove the stack completely, which will
+ * have the effect of moving the task to the top or bottom of the fullscreen stack
+ * (depending on whether it is visible)
+ * - otherwise, we simply return home and hide this task
*
* @param token A reference to the activity we wish to move
* @param nonRoot If false then this only works if the activity is the root
int taskId = ActivityRecord.getTaskForActivityLocked(token, !nonRoot);
final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId);
if (task != null) {
- if (mStackSupervisor.isLockedTask(task)) {
- mStackSupervisor.showLockTaskToast();
- return false;
- }
return ActivityRecord.getStackLocked(token).moveTaskToBackLocked(taskId);
}
} finally {
}
@Override
- public IActivityContainer createVirtualActivityContainer(IBinder parentActivityToken,
- IActivityContainerCallback callback) throws RemoteException {
- enforceCallingPermission(android.Manifest.permission.MANAGE_ACTIVITY_STACKS,
- "createActivityContainer()");
+ public int createStackOnDisplay(int displayId) throws RemoteException {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "createStackOnDisplay()");
synchronized (this) {
- if (parentActivityToken == null) {
- throw new IllegalArgumentException("parent token must not be null");
- }
- ActivityRecord r = ActivityRecord.forTokenLocked(parentActivityToken);
- if (r == null) {
- return null;
- }
- if (callback == null) {
- throw new IllegalArgumentException("callback must not be null");
+ final int stackId = mStackSupervisor.getNextStackId();
+ final ActivityStack stack =
+ mStackSupervisor.createStackOnDisplay(stackId, displayId, true /*onTop*/);
+ if (stack == null) {
+ return INVALID_STACK_ID;
}
- return mStackSupervisor.createVirtualActivityContainer(r, callback);
+ return stack.mStackId;
}
}
@Override
- public void deleteActivityContainer(IActivityContainer container) throws RemoteException {
- enforceCallingPermission(android.Manifest.permission.MANAGE_ACTIVITY_STACKS,
- "deleteActivityContainer()");
+ public int getActivityDisplayId(IBinder activityToken) throws RemoteException {
synchronized (this) {
- mStackSupervisor.deleteActivityContainer(container);
+ final ActivityStack stack = ActivityRecord.getStackLocked(activityToken);
+ if (stack != null && stack.mDisplayId != INVALID_DISPLAY) {
+ return stack.mDisplayId;
+ }
+ return DEFAULT_DISPLAY;
}
}
@Override
- public IActivityContainer createStackOnDisplay(int displayId) throws RemoteException {
- enforceCallingPermission(android.Manifest.permission.MANAGE_ACTIVITY_STACKS,
- "createStackOnDisplay()");
+ public int getActivityStackId(IBinder token) throws RemoteException {
synchronized (this) {
- final int stackId = mStackSupervisor.getNextStackId();
- final ActivityStack stack = mStackSupervisor.createStackOnDisplay(stackId, displayId);
+ ActivityStack stack = ActivityRecord.getStackLocked(token);
if (stack == null) {
- return null;
+ return INVALID_STACK_ID;
}
- return stack.mActivityContainer;
+ return stack.mStackId;
}
}
@Override
- public int getActivityDisplayId(IBinder activityToken) throws RemoteException {
+ public void exitFreeformMode(IBinder token) throws RemoteException {
synchronized (this) {
- ActivityStack stack = ActivityRecord.getStackLocked(activityToken);
- if (stack != null && stack.mActivityContainer.isAttachedLocked()) {
- return stack.mActivityContainer.getDisplayId();
+ long ident = Binder.clearCallingIdentity();
+ try {
+ final ActivityRecord r = ActivityRecord.forTokenLocked(token);
+ if (r == null) {
+ throw new IllegalArgumentException(
+ "exitFreeformMode: No activity record matching token=" + token);
+ }
+
+ final ActivityStack stack = r.getStack();
+ if (stack == null || stack.mStackId != FREEFORM_WORKSPACE_STACK_ID) {
+ throw new IllegalStateException(
+ "exitFreeformMode: You can only go fullscreen from freeform.");
+ }
+
+ if (DEBUG_STACK) Slog.d(TAG_STACK, "exitFreeformMode: " + r);
+ r.getTask().reparent(FULLSCREEN_WORKSPACE_STACK_ID, ON_TOP,
+ REPARENT_KEEP_STACK_AT_FRONT, ANIMATE, !DEFER_RESUME, "exitFreeformMode");
+ } finally {
+ Binder.restoreCallingIdentity(ident);
}
- return Display.DEFAULT_DISPLAY;
}
}
@Override
public void moveTaskToStack(int taskId, int stackId, boolean toTop) {
- enforceCallingPermission(android.Manifest.permission.MANAGE_ACTIVITY_STACKS,
- "moveTaskToStack()");
- if (stackId == HOME_STACK_ID) {
- Slog.e(TAG, "moveTaskToStack: Attempt to move task " + taskId + " to home stack",
- new RuntimeException("here").fillInStackTrace());
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "moveTaskToStack()");
+ if (StackId.isHomeOrRecentsStack(stackId)) {
+ throw new IllegalArgumentException(
+ "moveTaskToStack: Attempt to move task " + taskId + " to stack " + stackId);
}
synchronized (this) {
long ident = Binder.clearCallingIdentity();
try {
+ final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId);
+ if (task == null) {
+ Slog.w(TAG, "moveTaskToStack: No task for id=" + taskId);
+ return;
+ }
+
if (DEBUG_STACK) Slog.d(TAG_STACK, "moveTaskToStack: moving task=" + taskId
+ " to stackId=" + stackId + " toTop=" + toTop);
- mStackSupervisor.moveTaskToStackLocked(taskId, stackId, toTop);
+ if (stackId == DOCKED_STACK_ID) {
+ mWindowManager.setDockedStackCreateState(DOCKED_STACK_CREATE_MODE_TOP_OR_LEFT,
+ null /* initialBounds */);
+ }
+ task.reparent(stackId, toTop,
+ REPARENT_KEEP_STACK_AT_FRONT, ANIMATE, !DEFER_RESUME, "moveTaskToStack");
} finally {
Binder.restoreCallingIdentity(ident);
}
}
@Override
- public void resizeStack(int stackId, Rect bounds) {
- enforceCallingPermission(android.Manifest.permission.MANAGE_ACTIVITY_STACKS,
- "resizeStack()");
+ public void swapDockedAndFullscreenStack() throws RemoteException {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "swapDockedAndFullscreenStack()");
+ synchronized (this) {
+ long ident = Binder.clearCallingIdentity();
+ try {
+ final ActivityStack fullscreenStack = mStackSupervisor.getStack(
+ FULLSCREEN_WORKSPACE_STACK_ID);
+ final TaskRecord topTask = fullscreenStack != null ? fullscreenStack.topTask()
+ : null;
+ final ActivityStack dockedStack = mStackSupervisor.getStack(DOCKED_STACK_ID);
+ final ArrayList<TaskRecord> tasks = dockedStack != null ? dockedStack.getAllTasks()
+ : null;
+ if (topTask == null || tasks == null || tasks.size() == 0) {
+ Slog.w(TAG,
+ "Unable to swap tasks, either docked or fullscreen stack is empty.");
+ return;
+ }
+
+ // TODO: App transition
+ mWindowManager.prepareAppTransition(TRANSIT_ACTIVITY_RELAUNCH, false);
+
+ // Defer the resume until we move all the docked tasks to the fullscreen stack below
+ topTask.reparent(DOCKED_STACK_ID, ON_TOP, REPARENT_KEEP_STACK_AT_FRONT, ANIMATE,
+ DEFER_RESUME, "swapDockedAndFullscreenStack - DOCKED_STACK");
+ final int size = tasks.size();
+ for (int i = 0; i < size; i++) {
+ final int id = tasks.get(i).taskId;
+ if (id == topTask.taskId) {
+ continue;
+ }
+
+ // Defer the resume until after all the tasks have been moved
+ tasks.get(i).reparent(FULLSCREEN_WORKSPACE_STACK_ID, ON_TOP,
+ REPARENT_KEEP_STACK_AT_FRONT, ANIMATE, DEFER_RESUME,
+ "swapDockedAndFullscreenStack - FULLSCREEN_STACK");
+ }
+
+ // Because we deferred the resume to avoid conflicts with stack switches while
+ // resuming, we need to do it after all the tasks are moved.
+ mStackSupervisor.ensureActivitiesVisibleLocked(null, 0, !PRESERVE_WINDOWS);
+ mStackSupervisor.resumeFocusedStackTopActivityLocked();
+
+ mWindowManager.executeAppTransition();
+ } finally {
+ Binder.restoreCallingIdentity(ident);
+ }
+ }
+ }
+
+ /**
+ * Moves the input task to the docked stack.
+ *
+ * @param taskId Id of task to move.
+ * @param createMode The mode the docked stack should be created in if it doesn't exist
+ * already. See
+ * {@link android.app.ActivityManager#DOCKED_STACK_CREATE_MODE_TOP_OR_LEFT}
+ * and
+ * {@link android.app.ActivityManager#DOCKED_STACK_CREATE_MODE_BOTTOM_OR_RIGHT}
+ * @param toTop If the task and stack should be moved to the top.
+ * @param animate Whether we should play an animation for the moving the task
+ * @param initialBounds If the docked stack gets created, it will use these bounds for the
+ * docked stack. Pass {@code null} to use default bounds.
+ */
+ @Override
+ public boolean moveTaskToDockedStack(int taskId, int createMode, boolean toTop, boolean animate,
+ Rect initialBounds) {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "moveTaskToDockedStack()");
+ synchronized (this) {
+ long ident = Binder.clearCallingIdentity();
+ try {
+ final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId);
+ if (task == null) {
+ Slog.w(TAG, "moveTaskToDockedStack: No task for id=" + taskId);
+ return false;
+ }
+
+ if (DEBUG_STACK) Slog.d(TAG_STACK, "moveTaskToDockedStack: moving task=" + taskId
+ + " to createMode=" + createMode + " toTop=" + toTop);
+ mWindowManager.setDockedStackCreateState(createMode, initialBounds);
+
+ // Defer resuming until we move the home stack to the front below
+ final boolean moved = task.reparent(DOCKED_STACK_ID, toTop,
+ REPARENT_KEEP_STACK_AT_FRONT, animate, !DEFER_RESUME,
+ "moveTaskToDockedStack");
+ if (moved) {
+ mStackSupervisor.ensureActivitiesVisibleLocked(null, 0, !PRESERVE_WINDOWS);
+ }
+ return moved;
+ } finally {
+ Binder.restoreCallingIdentity(ident);
+ }
+ }
+ }
+
+ /**
+ * Moves the top activity in the input stackId to the pinned stack.
+ *
+ * @param stackId Id of stack to move the top activity to pinned stack.
+ * @param bounds Bounds to use for pinned stack.
+ *
+ * @return True if the top activity of the input stack was successfully moved to the pinned
+ * stack.
+ */
+ @Override
+ public boolean moveTopActivityToPinnedStack(int stackId, Rect bounds) {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "moveTopActivityToPinnedStack()");
+ synchronized (this) {
+ if (!mSupportsPictureInPicture) {
+ throw new IllegalStateException("moveTopActivityToPinnedStack:"
+ + "Device doesn't support picture-in-picture mode");
+ }
+
+ long ident = Binder.clearCallingIdentity();
+ try {
+ return mStackSupervisor.moveTopStackActivityToPinnedStackLocked(stackId, bounds);
+ } finally {
+ Binder.restoreCallingIdentity(ident);
+ }
+ }
+ }
+
+ @Override
+ public void resizeStack(int stackId, Rect destBounds, boolean allowResizeInDockedMode,
+ boolean preserveWindows, boolean animate, int animationDuration) {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "resizeStack()");
long ident = Binder.clearCallingIdentity();
try {
synchronized (this) {
- mStackSupervisor.resizeStackLocked(stackId, bounds);
+ if (animate) {
+ if (stackId == PINNED_STACK_ID) {
+ final PinnedActivityStack pinnedStack =
+ mStackSupervisor.getStack(PINNED_STACK_ID);
+ if (pinnedStack != null) {
+ pinnedStack.animateResizePinnedStack(null /* sourceHintBounds */,
+ destBounds, animationDuration, false /* fromFullscreen */);
+ }
+ } else {
+ throw new IllegalArgumentException("Stack: " + stackId
+ + " doesn't support animated resize.");
+ }
+ } else {
+ mStackSupervisor.resizeStackLocked(stackId, destBounds, null /* tempTaskBounds */,
+ null /* tempTaskInsetBounds */, preserveWindows,
+ allowResizeInDockedMode, !DEFER_RESUME);
+ }
}
} finally {
Binder.restoreCallingIdentity(ident);
}
@Override
- public List<StackInfo> getAllStackInfos() {
+ public void resizeDockedStack(Rect dockedBounds, Rect tempDockedTaskBounds,
+ Rect tempDockedTaskInsetBounds,
+ Rect tempOtherTaskBounds, Rect tempOtherTaskInsetBounds) {
enforceCallingPermission(android.Manifest.permission.MANAGE_ACTIVITY_STACKS,
- "getAllStackInfos()");
+ "resizeDockedStack()");
long ident = Binder.clearCallingIdentity();
try {
synchronized (this) {
- return mStackSupervisor.getAllStackInfosLocked();
+ mStackSupervisor.resizeDockedStackLocked(dockedBounds, tempDockedTaskBounds,
+ tempDockedTaskInsetBounds, tempOtherTaskBounds, tempOtherTaskInsetBounds,
+ PRESERVE_WINDOWS);
}
} finally {
Binder.restoreCallingIdentity(ident);
}
@Override
- public StackInfo getStackInfo(int stackId) {
+ public void resizePinnedStack(Rect pinnedBounds, Rect tempPinnedTaskBounds) {
enforceCallingPermission(android.Manifest.permission.MANAGE_ACTIVITY_STACKS,
- "getStackInfo()");
+ "resizePinnedStack()");
+ final long ident = Binder.clearCallingIdentity();
+ try {
+ synchronized (this) {
+ mStackSupervisor.resizePinnedStackLocked(pinnedBounds, tempPinnedTaskBounds);
+ }
+ } finally {
+ Binder.restoreCallingIdentity(ident);
+ }
+ }
+
+ /**
+ * Try to place task to provided position. The final position might be different depending on
+ * current user and stacks state. The task will be moved to target stack if it's currently in
+ * different stack.
+ */
+ @Override
+ public void positionTaskInStack(int taskId, int stackId, int position) {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "positionTaskInStack()");
+ if (StackId.isHomeOrRecentsStack(stackId)) {
+ throw new IllegalArgumentException(
+ "positionTaskInStack: Attempt to change the position of task "
+ + taskId + " in/to home/recents stack");
+ }
+ synchronized (this) {
+ long ident = Binder.clearCallingIdentity();
+ try {
+ if (DEBUG_STACK) Slog.d(TAG_STACK, "positionTaskInStack: positioning task="
+ + taskId + " in stackId=" + stackId + " at position=" + position);
+ final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId);
+ if (task == null) {
+ throw new IllegalArgumentException("positionTaskInStack: no task for id="
+ + taskId);
+ }
+
+ final ActivityStack stack = mStackSupervisor.getStack(stackId, CREATE_IF_NEEDED,
+ !ON_TOP);
+
+ // TODO: Have the callers of this API call a separate reparent method if that is
+ // what they intended to do vs. having this method also do reparenting.
+ if (task.getStack() == stack) {
+ // Change position in current stack.
+ stack.positionChildAt(task, position);
+ } else {
+ // Reparent to new stack.
+ task.reparent(stackId, position, REPARENT_LEAVE_STACK_IN_PLACE,
+ !ANIMATE, !DEFER_RESUME, "positionTaskInStack");
+ }
+ } finally {
+ Binder.restoreCallingIdentity(ident);
+ }
+ }
+ }
+
+ @Override
+ public List<StackInfo> getAllStackInfos() {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "getAllStackInfos()");
long ident = Binder.clearCallingIdentity();
try {
synchronized (this) {
- return mStackSupervisor.getStackInfoLocked(stackId);
+ return mStackSupervisor.getAllStackInfosLocked();
}
} finally {
Binder.restoreCallingIdentity(ident);
}
@Override
- public boolean isInHomeStack(int taskId) {
- enforceCallingPermission(android.Manifest.permission.MANAGE_ACTIVITY_STACKS,
- "getStackInfo()");
+ public StackInfo getStackInfo(int stackId) {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "getStackInfo()");
long ident = Binder.clearCallingIdentity();
try {
synchronized (this) {
- TaskRecord tr = mStackSupervisor.anyTaskForIdLocked(taskId, false);
- return tr != null && tr.stack != null && tr.stack.isHomeStack();
+ return mStackSupervisor.getStackInfoLocked(stackId);
}
} finally {
Binder.restoreCallingIdentity(ident);
@Override
public void updateDeviceOwner(String packageName) {
final int callingUid = Binder.getCallingUid();
- if (callingUid != 0 && callingUid != Process.SYSTEM_UID) {
+ if (callingUid != 0 && callingUid != SYSTEM_UID) {
throw new SecurityException("updateDeviceOwner called from non-system process");
}
synchronized (this) {
@Override
public void updateLockTaskPackages(int userId, String[] packages) {
final int callingUid = Binder.getCallingUid();
- if (callingUid != 0 && callingUid != Process.SYSTEM_UID) {
- throw new SecurityException("updateLockTaskPackage called from non-system process");
+ if (callingUid != 0 && callingUid != SYSTEM_UID) {
+ enforceCallingPermission(android.Manifest.permission.UPDATE_LOCK_TASK_PACKAGES,
+ "updateLockTaskPackages()");
}
synchronized (this) {
if (DEBUG_LOCKTASK) Slog.w(TAG_LOCKTASK, "Whitelisting " + userId + ":" +
return;
}
+ // When a task is locked, dismiss the pinned stack if it exists
+ final PinnedActivityStack pinnedStack = mStackSupervisor.getStack(
+ PINNED_STACK_ID);
+ if (pinnedStack != null) {
+ mStackSupervisor.removeStackLocked(PINNED_STACK_ID);
+ }
+
// isSystemInitiated is used to distinguish between locked and pinned mode, as pinned mode
// is initiated by system after the pinning request was shown and locked mode is initiated
// by an authorized app directly
final int callingUid = Binder.getCallingUid();
- boolean isSystemInitiated = callingUid == Process.SYSTEM_UID;
+ boolean isSystemInitiated = callingUid == SYSTEM_UID;
long ident = Binder.clearCallingIdentity();
try {
- final ActivityStack stack = mStackSupervisor.getFocusedStack();
if (!isSystemInitiated) {
task.mLockTaskUid = callingUid;
if (task.mLockTaskAuth == LOCK_TASK_AUTH_PINNABLE) {
StatusBarManagerInternal statusBarManager =
LocalServices.getService(StatusBarManagerInternal.class);
if (statusBarManager != null) {
- statusBarManager.showScreenPinningRequest();
+ statusBarManager.showScreenPinningRequest(task.taskId);
}
return;
}
+ final ActivityStack stack = mStackSupervisor.getFocusedStack();
if (stack == null || task != stack.topTask()) {
throw new IllegalArgumentException("Invalid task, not in foreground");
}
}
@Override
- public void startLockTaskMode(int taskId) {
+ public void startLockTaskModeById(int taskId) {
synchronized (this) {
final TaskRecord task = mStackSupervisor.anyTaskForIdLocked(taskId);
if (task != null) {
}
@Override
- public void startLockTaskMode(IBinder token) {
+ public void startLockTaskModeByToken(IBinder token) {
synchronized (this) {
final ActivityRecord r = ActivityRecord.forTokenLocked(token);
if (r == null) {
return;
}
- final TaskRecord task = r.task;
+ final TaskRecord task = r.getTask();
if (task != null) {
startLockTaskModeLocked(task);
}
}
@Override
- public void startLockTaskModeOnCurrent() throws RemoteException {
- enforceCallingPermission(android.Manifest.permission.MANAGE_ACTIVITY_STACKS,
- "startLockTaskModeOnCurrent");
+ public void startSystemLockTaskMode(int taskId) throws RemoteException {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "startSystemLockTaskMode");
+ // This makes inner call to look as if it was initiated by system.
long ident = Binder.clearCallingIdentity();
try {
synchronized (this) {
- ActivityRecord r = mStackSupervisor.topRunningActivityLocked();
- if (r != null) {
- startLockTaskModeLocked(r.task);
- }
+ startLockTaskModeById(taskId);
}
} finally {
Binder.restoreCallingIdentity(ident);
final int callingUid = Binder.getCallingUid();
final int lockTaskUid = lockTask.mLockTaskUid;
- // Ensure the same caller for startLockTaskMode and stopLockTaskMode.
- // It is possible lockTaskMode was started by the system process because
- // android:lockTaskMode is set to a locking value in the application manifest instead of
- // the app calling startLockTaskMode. In this case {@link TaskRecord.mLockTaskUid} will
- // be 0, so we compare the callingUid to the {@link TaskRecord.effectiveUid} instead.
- if (getLockTaskModeState() == ActivityManager.LOCK_TASK_MODE_LOCKED &&
- callingUid != lockTaskUid
- && (lockTaskUid != 0
- || (lockTaskUid == 0 && callingUid != lockTask.effectiveUid))) {
- throw new SecurityException("Invalid uid, expected " + lockTaskUid
- + " callingUid=" + callingUid + " effectiveUid=" + lockTask.effectiveUid);
+ final int lockTaskModeState = mStackSupervisor.getLockTaskModeState();
+ if (lockTaskModeState == ActivityManager.LOCK_TASK_MODE_NONE) {
+ // Done.
+ return;
+ } else {
+ // Ensure the same caller for startLockTaskMode and stopLockTaskMode.
+ // It is possible lockTaskMode was started by the system process because
+ // android:lockTaskMode is set to a locking value in the application manifest
+ // instead of the app calling startLockTaskMode. In this case
+ // {@link TaskRecord.mLockTaskUid} will be 0, so we compare the callingUid to the
+ // {@link TaskRecord.effectiveUid} instead. Also caller with
+ // {@link MANAGE_ACTIVITY_STACKS} can stop any lock task.
+ if (checkCallingPermission(MANAGE_ACTIVITY_STACKS) != PERMISSION_GRANTED
+ && callingUid != lockTaskUid
+ && (lockTaskUid != 0 || callingUid != lockTask.effectiveUid)) {
+ throw new SecurityException("Invalid uid, expected " + lockTaskUid
+ + " callingUid=" + callingUid + " effectiveUid=" + lockTask.effectiveUid);
+ }
}
-
long ident = Binder.clearCallingIdentity();
try {
Log.d(TAG, "stopLockTaskMode");
}
}
+ /**
+ * This API should be called by SystemUI only when user perform certain action to dismiss
+ * lock task mode. We should only dismiss pinned lock task mode in this case.
+ */
@Override
- public void stopLockTaskModeOnCurrent() throws RemoteException {
- enforceCallingPermission(android.Manifest.permission.MANAGE_ACTIVITY_STACKS,
- "stopLockTaskModeOnCurrent");
- long ident = Binder.clearCallingIdentity();
- try {
+ public void stopSystemLockTaskMode() throws RemoteException {
+ if (mStackSupervisor.getLockTaskModeState() == ActivityManager.LOCK_TASK_MODE_PINNED) {
stopLockTaskMode();
- } finally {
- Binder.restoreCallingIdentity(ident);
+ } else {
+ mStackSupervisor.showLockTaskToast();
}
}
if (r == null) {
return;
}
- mStackSupervisor.showLockTaskEscapeMessageLocked(r.task);
+ mStackSupervisor.showLockTaskEscapeMessageLocked(r.getTask());
+ }
+ }
+
+ @Override
+ public void setDisablePreviewScreenshots(IBinder token, boolean disable)
+ throws RemoteException {
+ synchronized (this) {
+ final ActivityRecord r = ActivityRecord.isInStackLocked(token);
+ if (r == null) {
+ Slog.w(TAG, "setDisablePreviewScreenshots: Unable to find activity for token="
+ + token);
+ return;
+ }
+ final long origId = Binder.clearCallingIdentity();
+ try {
+ r.setDisablePreviewScreenshots(disable);
+ } finally {
+ Binder.restoreCallingIdentity(origId);
+ }
}
}
private final List<ProviderInfo> generateApplicationProvidersLocked(ProcessRecord app) {
List<ProviderInfo> providers = null;
try {
- ParceledListSlice<ProviderInfo> slice = AppGlobals.getPackageManager().
- queryContentProviders(app.processName, app.uid,
- STOCK_PM_FLAGS | PackageManager.GET_URI_PERMISSION_PATTERNS);
- providers = slice != null ? slice.getList() : null;
+ providers = AppGlobals.getPackageManager()
+ .queryContentProviders(app.processName, app.uid,
+ STOCK_PM_FLAGS | PackageManager.GET_URI_PERMISSION_PATTERNS
+ | MATCH_DEBUG_TRIAGED_MISSING, /*metadastaKey=*/ null)
+ .getList();
} catch (RemoteException ex) {
}
if (DEBUG_MU) Slog.v(TAG_MU,
int N = providers.size();
app.pubProviders.ensureCapacity(N + app.pubProviders.size());
for (int i=0; i<N; i++) {
+ // TODO: keep logic in sync with installEncryptionUnawareProviders
ProviderInfo cpi =
(ProviderInfo)providers.get(i);
boolean singleton = isSingleton(cpi.processName, cpi.applicationInfo,
cpi.name, cpi.flags);
- if (singleton && UserHandle.getUserId(app.uid) != UserHandle.USER_OWNER) {
+ if (singleton && UserHandle.getUserId(app.uid) != UserHandle.USER_SYSTEM) {
// This is a singleton provider, but a user besides the
// default user is asking to initialize a process it runs
// in... well, no, it doesn't actually run in this process,
app.addPackage(cpi.applicationInfo.packageName, cpi.applicationInfo.versionCode,
mProcessStats);
}
- ensurePackageDexOpt(cpi.applicationInfo.packageName);
+ notifyPackageUse(cpi.applicationInfo.packageName,
+ PackageManager.NOTIFY_PACKAGE_USE_CONTENT_PROVIDER);
}
}
return providers;
ProviderInfo cpi = null;
try {
cpi = AppGlobals.getPackageManager().resolveContentProvider(authority,
- STOCK_PM_FLAGS | PackageManager.GET_URI_PERMISSION_PATTERNS, userId);
+ STOCK_PM_FLAGS | PackageManager.GET_URI_PERMISSION_PATTERNS
+ | PackageManager.MATCH_DISABLED_COMPONENTS
+ | PackageManager.MATCH_DIRECT_BOOT_AWARE
+ | PackageManager.MATCH_DIRECT_BOOT_UNAWARE,
+ userId);
} catch (RemoteException ignored) {
}
if (cpi == null) {
- // TODO: make this an outright failure in a future platform release;
- // until then anonymous content notifications are unprotected
- //return "Failed to find provider " + authority + " for user " + userId;
- return null;
+ return "Failed to find provider " + authority + " for user " + userId
+ + "; expected to find a valid ContentProvider for this authority";
}
ProcessRecord r = null;
boolean checkedGrants = false;
if (checkUser) {
// Looking for cross-user grants before enforcing the typical cross-users permissions
- int tmpTargetUserId = unsafeConvertIncomingUser(userId);
+ int tmpTargetUserId = mUserController.unsafeConvertIncomingUserLocked(userId);
if (tmpTargetUserId != UserHandle.getUserId(callingUid)) {
if (checkAuthorityGrants(callingUid, cpi, tmpTargetUserId, checkUser)) {
return null;
}
checkedGrants = true;
}
- userId = handleIncomingUser(callingPid, callingUid, userId,
- false, ALLOW_NON_FULL,
- "checkContentProviderPermissionLocked " + cpi.authority, null);
+ userId = mUserController.handleIncomingUser(callingPid, callingUid, userId, false,
+ ALLOW_NON_FULL, "checkContentProviderPermissionLocked " + cpi.authority, null);
if (userId != tmpTargetUserId) {
// When we actually went to determine the final targer user ID, this ended
// up different than our initial check for the authority. This is because
return null;
}
- String msg;
+ final String suffix;
if (!cpi.exported) {
- msg = "Permission Denial: opening provider " + cpi.name
- + " from " + (r != null ? r : "(null)") + " (pid=" + callingPid
- + ", uid=" + callingUid + ") that is not exported from uid "
- + cpi.applicationInfo.uid;
+ suffix = " that is not exported from UID " + cpi.applicationInfo.uid;
+ } else if (android.Manifest.permission.MANAGE_DOCUMENTS.equals(cpi.readPermission)) {
+ suffix = " requires that you obtain access using ACTION_OPEN_DOCUMENT or related APIs";
} else {
- msg = "Permission Denial: opening provider " + cpi.name
- + " from " + (r != null ? r : "(null)") + " (pid=" + callingPid
- + ", uid=" + callingUid + ") requires "
- + cpi.readPermission + " or " + cpi.writePermission;
+ suffix = " requires " + cpi.readPermission + " or " + cpi.writePermission;
}
+ final String msg = "Permission Denial: opening provider " + cpi.name
+ + " from " + (r != null ? r : "(null)") + " (pid=" + callingPid
+ + ", uid=" + callingUid + ")" + suffix;
Slog.w(TAG, msg);
return msg;
}
}
cpr.connections.add(conn);
r.conProviders.add(conn);
- startAssociationLocked(r.uid, r.processName, cpr.uid, cpr.name, cpr.info.processName);
+ startAssociationLocked(r.uid, r.processName, r.curProcState,
+ cpr.uid, cpr.name, cpr.info.processName);
return conn;
}
cpr.addExternalProcessHandleLocked(externalProcessToken);
if (conn.stableCount == 0 && conn.unstableCount == 0) {
cpr.connections.remove(conn);
conn.client.conProviders.remove(conn);
+ if (conn.client.setProcState < ActivityManager.PROCESS_STATE_LAST_ACTIVITY) {
+ // The client is more important than last activity -- note the time this
+ // is happening, so we keep the old provider process around a bit as last
+ // activity to avoid thrashing it.
+ if (cpr.proc != null) {
+ cpr.proc.lastProviderTime = SystemClock.uptimeMillis();
+ }
+ }
stopAssociationLocked(conn.client.uid, conn.client.processName, cpr.uid, cpr.name);
return true;
}
}
private void checkTime(long startTime, String where) {
- long now = SystemClock.elapsedRealtime();
- if ((now-startTime) > 1000) {
- // If we are taking more than a second, log about it.
+ long now = SystemClock.uptimeMillis();
+ if ((now-startTime) > 50) {
+ // If we are taking more than 50ms, log about it.
Slog.w(TAG, "Slow operation: " + (now-startTime) + "ms so far, now at " + where);
}
}
- private final ContentProviderHolder getContentProviderImpl(IApplicationThread caller,
+ private static final int[] PROCESS_STATE_STATS_FORMAT = new int[] {
+ PROC_SPACE_TERM,
+ PROC_SPACE_TERM|PROC_PARENS,
+ PROC_SPACE_TERM|PROC_CHAR|PROC_OUT_LONG, // 3: process state
+ };
+
+ private final long[] mProcessStateStatsLongs = new long[1];
+
+ boolean isProcessAliveLocked(ProcessRecord proc) {
+ if (proc.procStatFile == null) {
+ proc.procStatFile = "/proc/" + proc.pid + "/stat";
+ }
+ mProcessStateStatsLongs[0] = 0;
+ if (!readProcFile(proc.procStatFile, PROCESS_STATE_STATS_FORMAT, null,
+ mProcessStateStatsLongs, null)) {
+ if (DEBUG_OOM_ADJ) Slog.d(TAG, "UNABLE TO RETRIEVE STATE FOR " + proc.procStatFile);
+ return false;
+ }
+ final long state = mProcessStateStatsLongs[0];
+ if (DEBUG_OOM_ADJ) Slog.d(TAG, "RETRIEVED STATE FOR " + proc.procStatFile + ": "
+ + (char)state);
+ return state != 'Z' && state != 'X' && state != 'x' && state != 'K';
+ }
+
+ private ContentProviderHolder getContentProviderImpl(IApplicationThread caller,
String name, IBinder token, boolean stable, int userId) {
ContentProviderRecord cpr;
ContentProviderConnection conn = null;
ProviderInfo cpi = null;
synchronized(this) {
- long startTime = SystemClock.elapsedRealtime();
+ long startTime = SystemClock.uptimeMillis();
ProcessRecord r = null;
if (caller != null) {
cpr = mProviderMap.getProviderByName(name, userId);
// If that didn't work, check if it exists for user 0 and then
// verify that it's a singleton provider before using it.
- if (cpr == null && userId != UserHandle.USER_OWNER) {
- cpr = mProviderMap.getProviderByName(name, UserHandle.USER_OWNER);
+ if (cpr == null && userId != UserHandle.USER_SYSTEM) {
+ cpr = mProviderMap.getProviderByName(name, UserHandle.USER_SYSTEM);
if (cpr != null) {
cpi = cpr.info;
if (isSingleton(cpi.processName, cpi.applicationInfo,
cpi.name, cpi.flags)
&& isValidSingletonCall(r.uid, cpi.applicationInfo.uid)) {
- userId = UserHandle.USER_OWNER;
+ userId = UserHandle.USER_SYSTEM;
checkCrossUser = false;
} else {
cpr = null;
}
}
- boolean providerRunning = cpr != null;
+ boolean providerRunning = cpr != null && cpr.proc != null && !cpr.proc.killed;
if (providerRunning) {
cpi = cpr.info;
String msg;
holder.provider = null;
return holder;
}
+ // Don't expose providers between normal apps and instant apps
+ try {
+ if (AppGlobals.getPackageManager()
+ .resolveContentProvider(name, 0 /*flags*/, userId) == null) {
+ return null;
+ }
+ } catch (RemoteException e) {
+ }
final long origId = Binder.clearCallingIdentity();
}
}
- if (cpr.proc != null) {
- if (false) {
- if (cpr.name.flattenToShortString().equals(
- "com.android.providers.calendar/.CalendarProvider2")) {
- Slog.v(TAG, "****************** KILLING "
- + cpr.name.flattenToShortString());
- Process.killProcess(cpr.proc.pid);
- }
- }
- checkTime(startTime, "getContentProviderImpl: before updateOomAdj");
- boolean success = updateOomAdjLocked(cpr.proc);
- maybeUpdateProviderUsageStatsLocked(r, cpr.info.packageName, name);
- checkTime(startTime, "getContentProviderImpl: after updateOomAdj");
- if (DEBUG_PROVIDER) Slog.i(TAG_PROVIDER, "Adjust success: " + success);
- // NOTE: there is still a race here where a signal could be
- // pending on the process even though we managed to update its
- // adj level. Not sure what to do about this, but at least
- // the race is now smaller.
- if (!success) {
- // Uh oh... it looks like the provider's process
- // has been killed on us. We need to wait for a new
- // process to be started, and make sure its death
- // doesn't kill our process.
- Slog.i(TAG, "Existing provider " + cpr.name.flattenToShortString()
- + " is crashing; detaching " + r);
- boolean lastRef = decProviderCountLocked(conn, cpr, token, stable);
- checkTime(startTime, "getContentProviderImpl: before appDied");
- appDiedLocked(cpr.proc);
- checkTime(startTime, "getContentProviderImpl: after appDied");
- if (!lastRef) {
- // This wasn't the last ref our process had on
- // the provider... we have now been killed, bail.
- return null;
- }
- providerRunning = false;
- conn = null;
+ checkTime(startTime, "getContentProviderImpl: before updateOomAdj");
+ final int verifiedAdj = cpr.proc.verifiedAdj;
+ boolean success = updateOomAdjLocked(cpr.proc, true);
+ // XXX things have changed so updateOomAdjLocked doesn't actually tell us
+ // if the process has been successfully adjusted. So to reduce races with
+ // it, we will check whether the process still exists. Note that this doesn't
+ // completely get rid of races with LMK killing the process, but should make
+ // them much smaller.
+ if (success && verifiedAdj != cpr.proc.setAdj && !isProcessAliveLocked(cpr.proc)) {
+ success = false;
+ }
+ maybeUpdateProviderUsageStatsLocked(r, cpr.info.packageName, name);
+ checkTime(startTime, "getContentProviderImpl: after updateOomAdj");
+ if (DEBUG_PROVIDER) Slog.i(TAG_PROVIDER, "Adjust success: " + success);
+ // NOTE: there is still a race here where a signal could be
+ // pending on the process even though we managed to update its
+ // adj level. Not sure what to do about this, but at least
+ // the race is now smaller.
+ if (!success) {
+ // Uh oh... it looks like the provider's process
+ // has been killed on us. We need to wait for a new
+ // process to be started, and make sure its death
+ // doesn't kill our process.
+ Slog.i(TAG, "Existing provider " + cpr.name.flattenToShortString()
+ + " is crashing; detaching " + r);
+ boolean lastRef = decProviderCountLocked(conn, cpr, token, stable);
+ checkTime(startTime, "getContentProviderImpl: before appDied");
+ appDiedLocked(cpr.proc);
+ checkTime(startTime, "getContentProviderImpl: after appDied");
+ if (!lastRef) {
+ // This wasn't the last ref our process had on
+ // the provider... we have now been killed, bail.
+ return null;
}
+ providerRunning = false;
+ conn = null;
+ } else {
+ cpr.proc.verifiedAdj = cpr.proc.setAdj;
}
Binder.restoreCallingIdentity(origId);
}
- boolean singleton;
if (!providerRunning) {
try {
checkTime(startTime, "getContentProviderImpl: before resolveContentProvider");
// (it's a call within the same user || the provider is a
// privileged app)
// Then allow connecting to the singleton provider
- singleton = isSingleton(cpi.processName, cpi.applicationInfo,
+ boolean singleton = isSingleton(cpi.processName, cpi.applicationInfo,
cpi.name, cpi.flags)
&& isValidSingletonCall(r.uid, cpi.applicationInfo.uid);
if (singleton) {
- userId = UserHandle.USER_OWNER;
+ userId = UserHandle.USER_SYSTEM;
}
cpi.applicationInfo = getAppInfoForUser(cpi.applicationInfo, userId);
checkTime(startTime, "getContentProviderImpl: got app info for user");
}
checkTime(startTime, "getContentProviderImpl: after checkContentProviderPermission");
- if (!mProcessesReady && !mDidUpdate && !mWaitingUpdate
+ if (!mProcessesReady
&& !cpi.processName.equals("system")) {
// If this content provider does not run in the system
// process, and the system is not yet ready to run other
// Make sure that the user who owns this provider is running. If not,
// we don't want to allow it to run.
- if (!isUserRunningLocked(userId, false)) {
+ if (!mUserController.isUserRunningLocked(userId, 0)) {
Slog.w(TAG, "Unable to launch app "
+ cpi.applicationInfo.packageName + "/"
+ cpi.applicationInfo.uid + " for provider "
final boolean firstClass = cpr == null;
if (firstClass) {
final long ident = Binder.clearCallingIdentity();
+
+ // If permissions need a review before any of the app components can run,
+ // we return no provider and launch a review activity if the calling app
+ // is in the foreground.
+ if (mPermissionReviewRequired) {
+ if (!requestTargetProviderPermissionsReviewIfNeededLocked(cpi, r, userId)) {
+ return null;
+ }
+ }
+
try {
checkTime(startTime, "getContentProviderImpl: before getApplicationInfo");
ApplicationInfo ai =
checkTime(startTime, "getContentProviderImpl: looking for process record");
ProcessRecord proc = getProcessRecordLocked(
cpi.processName, cpr.appInfo.uid, false);
- if (proc != null && proc.thread != null) {
+ if (proc != null && proc.thread != null && !proc.killed) {
if (DEBUG_PROVIDER) Slog.d(TAG_PROVIDER,
"Installing in existing process " + proc);
if (!proc.pubProviders.containsKey(cpi.name)) {
}
}
checkTime(startTime, "getContentProviderImpl: done!");
+
+ grantEphemeralAccessLocked(userId, null /*intent*/,
+ cpi.applicationInfo.uid, UserHandle.getAppId(Binder.getCallingUid()));
}
// Wait for the provider to be published...
return cpr != null ? cpr.newHolder(conn) : null;
}
+ private boolean requestTargetProviderPermissionsReviewIfNeededLocked(ProviderInfo cpi,
+ ProcessRecord r, final int userId) {
+ if (getPackageManagerInternalLocked().isPermissionsReviewRequired(
+ cpi.packageName, userId)) {
+
+ final boolean callerForeground = r == null || r.setSchedGroup
+ != ProcessList.SCHED_GROUP_BACKGROUND;
+
+ // Show a permission review UI only for starting from a foreground app
+ if (!callerForeground) {
+ Slog.w(TAG, "u" + userId + " Instantiating a provider in package"
+ + cpi.packageName + " requires a permissions review");
+ return false;
+ }
+
+ final Intent intent = new Intent(Intent.ACTION_REVIEW_PERMISSIONS);
+ intent.addFlags(Intent.FLAG_ACTIVITY_NEW_TASK
+ | Intent.FLAG_ACTIVITY_EXCLUDE_FROM_RECENTS);
+ intent.putExtra(Intent.EXTRA_PACKAGE_NAME, cpi.packageName);
+
+ if (DEBUG_PERMISSIONS_REVIEW) {
+ Slog.i(TAG, "u" + userId + " Launching permission review "
+ + "for package " + cpi.packageName);
+ }
+
+ final UserHandle userHandle = new UserHandle(userId);
+ mHandler.post(new Runnable() {
+ @Override
+ public void run() {
+ mContext.startActivityAsUser(intent, userHandle);
+ }
+ });
+
+ return false;
+ }
+
+ return true;
+ }
+
+ PackageManagerInternal getPackageManagerInternalLocked() {
+ if (mPackageManagerInt == null) {
+ mPackageManagerInt = LocalServices.getService(PackageManagerInternal.class);
+ }
+ return mPackageManagerInt;
+ }
+
@Override
public final ContentProviderHolder getContentProvider(
IApplicationThread caller, String name, int userId, boolean stable) {
String name, int userId, IBinder token) {
enforceCallingPermission(android.Manifest.permission.ACCESS_CONTENT_PROVIDERS_EXTERNALLY,
"Do not have permission in call getContentProviderExternal()");
- userId = handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(), userId,
- false, ALLOW_FULL_ONLY, "getContentProvider", null);
+ userId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(),
+ userId, false, ALLOW_FULL_ONLY, "getContentProvider", null);
return getContentProviderExternalUnchecked(name, token, userId);
}
dst.proc = r;
dst.notifyAll();
}
- updateOomAdjLocked(r);
+ updateOomAdjLocked(r, true);
maybeUpdateProviderUsageStatsLocked(r, src.info.packageName,
src.info.authority);
}
return;
}
- final long token = Binder.clearCallingIdentity();
- try {
- appNotResponding(host, null, null, false, "ContentProvider not responding");
- } finally {
- Binder.restoreCallingIdentity(token);
- }
+ mHandler.post(new Runnable() {
+ @Override
+ public void run() {
+ mAppErrors.appNotResponding(host, null, null, false,
+ "ContentProvider not responding");
+ }
+ });
}
public final void installSystemProviders() {
List<ProviderInfo> providers;
synchronized (this) {
- ProcessRecord app = mProcessNames.get("system", Process.SYSTEM_UID);
+ ProcessRecord app = mProcessNames.get("system", SYSTEM_UID);
providers = generateApplicationProvidersLocked(app);
if (providers != null) {
for (int i=providers.size()-1; i>=0; i--) {
mSystemThread.installSystemProviders(providers);
}
+ mConstants.start(mContext.getContentResolver());
mCoreSettingsObserver = new CoreSettingsObserver(this);
+ mFontScaleSettingObserver = new FontScaleSettingObserver();
+
+ // Now that the settings provider is published we can consider sending
+ // in a rescue party.
+ RescueParty.onSettingsProviderPublished(mContext);
//mUsageStatsService.monitorPackages();
}
+ private void startPersistentApps(int matchFlags) {
+ if (mFactoryTest == FactoryTest.FACTORY_TEST_LOW_LEVEL) return;
+
+ synchronized (this) {
+ try {
+ final List<ApplicationInfo> apps = AppGlobals.getPackageManager()
+ .getPersistentApplications(STOCK_PM_FLAGS | matchFlags).getList();
+ for (ApplicationInfo app : apps) {
+ if (!"android".equals(app.packageName)) {
+ addAppLocked(app, null, false, null /* ABI override */);
+ }
+ }
+ } catch (RemoteException ex) {
+ }
+ }
+ }
+
+ /**
+ * When a user is unlocked, we need to install encryption-unaware providers
+ * belonging to any running apps.
+ */
+ private void installEncryptionUnawareProviders(int userId) {
+ // We're only interested in providers that are encryption unaware, and
+ // we don't care about uninstalled apps, since there's no way they're
+ // running at this point.
+ final int matchFlags = GET_PROVIDERS | MATCH_DIRECT_BOOT_UNAWARE;
+
+ synchronized (this) {
+ final int NP = mProcessNames.getMap().size();
+ for (int ip = 0; ip < NP; ip++) {
+ final SparseArray<ProcessRecord> apps = mProcessNames.getMap().valueAt(ip);
+ final int NA = apps.size();
+ for (int ia = 0; ia < NA; ia++) {
+ final ProcessRecord app = apps.valueAt(ia);
+ if (app.userId != userId || app.thread == null || app.unlocked) continue;
+
+ final int NG = app.pkgList.size();
+ for (int ig = 0; ig < NG; ig++) {
+ try {
+ final String pkgName = app.pkgList.keyAt(ig);
+ final PackageInfo pkgInfo = AppGlobals.getPackageManager()
+ .getPackageInfo(pkgName, matchFlags, userId);
+ if (pkgInfo != null && !ArrayUtils.isEmpty(pkgInfo.providers)) {
+ for (ProviderInfo pi : pkgInfo.providers) {
+ // TODO: keep in sync with generateApplicationProvidersLocked
+ final boolean processMatch = Objects.equals(pi.processName,
+ app.processName) || pi.multiprocess;
+ final boolean userMatch = isSingleton(pi.processName,
+ pi.applicationInfo, pi.name, pi.flags)
+ ? (app.userId == UserHandle.USER_SYSTEM) : true;
+ if (processMatch && userMatch) {
+ Log.v(TAG, "Installing " + pi);
+ app.thread.scheduleInstallProvider(pi);
+ } else {
+ Log.v(TAG, "Skipping " + pi);
+ }
+ }
+ }
+ } catch (RemoteException ignored) {
+ }
+ }
+ }
+ }
+ }
+ }
+
/**
* Allows apps to retrieve the MIME type of a URI.
* If an app is in the same user as the ContentProvider, or if it is allowed to interact across
int callingPid = Binder.getCallingPid();
long ident = 0;
boolean clearedIdentity = false;
- userId = unsafeConvertIncomingUser(userId);
+ synchronized (this) {
+ userId = mUserController.unsafeConvertIncomingUserLocked(userId);
+ }
if (canClearIdentity(callingPid, callingUid, userId)) {
clearedIdentity = true;
ident = Binder.clearCallingIdentity();
} catch (RemoteException e) {
Log.w(TAG, "Content provider dead retrieving " + uri, e);
return null;
+ } catch (Exception e) {
+ Log.w(TAG, "Exception while determining type of " + uri, e);
+ return null;
} finally {
// We need to clear the identity to call removeContentProviderExternalUnchecked
if (!clearedIdentity) {
int uid = info.uid;
if (isolated) {
if (isolatedUid == 0) {
- int stepsLeft = Process.LAST_ISOLATED_UID - Process.FIRST_ISOLATED_UID + 1;
+ int stepsLeft = LAST_ISOLATED_UID - FIRST_ISOLATED_UID + 1;
while (true) {
- if (mNextIsolatedProcessUid < Process.FIRST_ISOLATED_UID
- || mNextIsolatedProcessUid > Process.LAST_ISOLATED_UID) {
- mNextIsolatedProcessUid = Process.FIRST_ISOLATED_UID;
+ if (mNextIsolatedProcessUid < FIRST_ISOLATED_UID
+ || mNextIsolatedProcessUid > LAST_ISOLATED_UID) {
+ mNextIsolatedProcessUid = FIRST_ISOLATED_UID;
}
uid = UserHandle.getUid(userId, mNextIsolatedProcessUid);
mNextIsolatedProcessUid++;
// the uid of the isolated process is specified by the caller.
uid = isolatedUid;
}
+ getPackageManagerInternalLocked().addIsolatedUid(uid, info.uid);
+
+ // Register the isolated UID with this application so BatteryStats knows to
+ // attribute resource usage to the application.
+ //
+ // NOTE: This is done here before addProcessNameLocked, which will tell BatteryStats
+ // about the process state of the isolated UID *before* it is registered with the
+ // owning application.
+ mBatteryStatsService.addIsolatedUid(uid, info.uid);
}
final ProcessRecord r = new ProcessRecord(stats, info, proc, uid);
if (!mBooted && !mBooting
- && userId == UserHandle.USER_OWNER
+ && userId == UserHandle.USER_SYSTEM
&& (info.flags & PERSISTENT_MASK) == PERSISTENT_MASK) {
r.persistent = true;
+ r.maxAdj = ProcessList.PERSISTENT_PROC_ADJ;
}
addProcessNameLocked(r);
return r;
}
- final ProcessRecord addAppLocked(ApplicationInfo info, boolean isolated,
+ private boolean uidOnBackgroundWhitelist(final int uid) {
+ final int appId = UserHandle.getAppId(uid);
+ final int[] whitelist = mBackgroundAppIdWhitelist;
+ final int N = whitelist.length;
+ for (int i = 0; i < N; i++) {
+ if (appId == whitelist[i]) {
+ return true;
+ }
+ }
+ return false;
+ }
+
+ @Override
+ public void backgroundWhitelistUid(final int uid) {
+ if (Binder.getCallingUid() != Process.SYSTEM_UID) {
+ throw new SecurityException("Only the OS may call backgroundWhitelistUid()");
+ }
+
+ if (DEBUG_BACKGROUND_CHECK) {
+ Slog.i(TAG, "Adding uid " + uid + " to bg uid whitelist");
+ }
+ synchronized (this) {
+ final int N = mBackgroundAppIdWhitelist.length;
+ int[] newList = new int[N+1];
+ System.arraycopy(mBackgroundAppIdWhitelist, 0, newList, 0, N);
+ newList[N] = UserHandle.getAppId(uid);
+ mBackgroundAppIdWhitelist = newList;
+ }
+ }
+
+ final ProcessRecord addAppLocked(ApplicationInfo info, String customProcess, boolean isolated,
String abiOverride) {
ProcessRecord app;
if (!isolated) {
- app = getProcessRecordLocked(info.processName, info.uid, true);
+ app = getProcessRecordLocked(customProcess != null ? customProcess : info.processName,
+ info.uid, true);
} else {
app = null;
}
if (app == null) {
- app = newProcessRecordLocked(info, null, isolated, 0);
+ app = newProcessRecordLocked(info, customProcess, isolated, 0);
updateLruProcessLocked(app, false, null);
updateOomAdjLocked();
}
}
if (app.thread == null && mPersistentStartingProcesses.indexOf(app) < 0) {
mPersistentStartingProcesses.add(app);
- startProcessLocked(app, "added application", app.processName, abiOverride,
+ startProcessLocked(app, "added application",
+ customProcess != null ? customProcess : app.processName, abiOverride,
null /* entryPoint */, null /* entryPointArgs */);
}
}
}
- public ParcelFileDescriptor openContentUri(Uri uri) throws RemoteException {
+ public ParcelFileDescriptor openContentUri(String uriString) throws RemoteException {
enforceNotIsolatedCaller("openContentUri");
final int userId = UserHandle.getCallingUserId();
+ final Uri uri = Uri.parse(uriString);
String name = uri.getAuthority();
ContentProviderHolder cph = getContentProviderExternalUnchecked(name, null, userId);
ParcelFileDescriptor pfd = null;
// Actually is sleeping or shutting down or whatever else in the future
// is an inactive state.
- public boolean isSleepingOrShuttingDown() {
- return isSleeping() || mShuttingDown;
+ boolean isSleepingOrShuttingDownLocked() {
+ return isSleepingLocked() || mShuttingDown;
+ }
+
+ boolean isShuttingDownLocked() {
+ return mShuttingDown;
}
- public boolean isSleeping() {
+ boolean isSleepingLocked() {
return mSleeping;
}
void onWakefulnessChanged(int wakefulness) {
synchronized(this) {
+ boolean wasAwake = mWakefulness == PowerManagerInternal.WAKEFULNESS_AWAKE;
+ boolean isAwake = wakefulness == PowerManagerInternal.WAKEFULNESS_AWAKE;
mWakefulness = wakefulness;
- updateSleepIfNeededLocked();
+
+ if (wasAwake != isAwake) {
+ // Also update state in a special way for running foreground services UI.
+ mServices.updateScreenStateLocked(isAwake);
+ sendNotifyVrManagerOfSleepState(!isAwake);
+ }
}
}
}
void startTimeTrackingFocusedActivityLocked() {
- if (!mSleeping && mCurAppTimeTracker != null && mFocusedActivity != null) {
- mCurAppTimeTracker.start(mFocusedActivity.packageName);
+ final ActivityRecord resumedActivity = mStackSupervisor.getResumedActivityLocked();
+ if (!mSleeping && mCurAppTimeTracker != null && resumedActivity != null) {
+ mCurAppTimeTracker.start(resumedActivity.packageName);
}
}
void updateSleepIfNeededLocked() {
- if (mSleeping && !shouldSleepLocked()) {
- mSleeping = false;
- startTimeTrackingFocusedActivityLocked();
- mTopProcessState = ActivityManager.PROCESS_STATE_TOP;
- mStackSupervisor.comeOutOfSleepIfNeededLocked();
- updateOomAdjLocked();
- } else if (!mSleeping && shouldSleepLocked()) {
+ final boolean shouldSleep = !mStackSupervisor.hasAwakeDisplay();
+ final boolean wasSleeping = mSleeping;
+
+ if (!shouldSleep) {
+ // If wasSleeping is true, we need to wake up activity manager state from when
+ // we started sleeping. In either case, we need to apply the sleep tokens, which
+ // will wake up stacks or put them to sleep as appropriate.
+ if (wasSleeping) {
+ mSleeping = false;
+ startTimeTrackingFocusedActivityLocked();
+ mTopProcessState = ActivityManager.PROCESS_STATE_TOP;
+ mStackSupervisor.comeOutOfSleepIfNeededLocked();
+ }
+ mStackSupervisor.applySleepTokensLocked(true /* applyToStacks */);
+ if (wasSleeping) {
+ updateOomAdjLocked();
+ }
+ } else if (!mSleeping && shouldSleep) {
mSleeping = true;
if (mCurAppTimeTracker != null) {
mCurAppTimeTracker.stop();
mTopProcessState = ActivityManager.PROCESS_STATE_TOP_SLEEPING;
mStackSupervisor.goingToSleepLocked();
updateOomAdjLocked();
-
- // Initialize the wake times of all processes.
- checkExcessivePowerUsageLocked(false);
- mHandler.removeMessages(CHECK_EXCESSIVE_WAKE_LOCKS_MSG);
- Message nmsg = mHandler.obtainMessage(CHECK_EXCESSIVE_WAKE_LOCKS_MSG);
- mHandler.sendMessageDelayed(nmsg, POWER_CHECK_DELAY);
- }
- }
-
- private boolean shouldSleepLocked() {
- // Resume applications while running a voice interactor.
- if (mRunningVoice != null) {
- return false;
- }
-
- // TODO: Transform the lock screen state into a sleep token instead.
- switch (mWakefulness) {
- case PowerManagerInternal.WAKEFULNESS_AWAKE:
- case PowerManagerInternal.WAKEFULNESS_DREAMING:
- case PowerManagerInternal.WAKEFULNESS_DOZING:
- // Pause applications whenever the lock screen is shown or any sleep
- // tokens have been acquired.
- return (mLockScreenShown != LOCK_SCREEN_HIDDEN || !mSleepTokens.isEmpty());
- case PowerManagerInternal.WAKEFULNESS_ASLEEP:
- default:
- // If we're asleep then pause applications unconditionally.
- return true;
}
}
/** Pokes the task persister. */
void notifyTaskPersisterLocked(TaskRecord task, boolean flush) {
- if (task != null && task.stack != null && task.stack.isHomeStack()) {
- // Never persist the home stack.
- return;
- }
- mTaskPersister.wakeup(task, flush);
+ mRecentTasks.notifyTaskPersisterLocked(task, flush);
+ }
+
+ /**
+ * Notifies all listeners when the pinned stack animation starts.
+ */
+ @Override
+ public void notifyPinnedStackAnimationStarted() {
+ mTaskChangeNotificationController.notifyPinnedStackAnimationStarted();
}
- /** Notifies all listeners when the task stack has changed. */
- void notifyTaskStackChangedLocked() {
- mHandler.removeMessages(NOTIFY_TASK_STACK_CHANGE_LISTENERS_MSG);
- Message nmsg = mHandler.obtainMessage(NOTIFY_TASK_STACK_CHANGE_LISTENERS_MSG);
- mHandler.sendMessageDelayed(nmsg, NOTIFY_TASK_STACK_CHANGE_LISTENERS_DELAY);
+ /**
+ * Notifies all listeners when the pinned stack animation ends.
+ */
+ @Override
+ public void notifyPinnedStackAnimationEnded() {
+ mTaskChangeNotificationController.notifyPinnedStackAnimationEnded();
}
@Override
synchronized(this) {
mShuttingDown = true;
+ mStackSupervisor.prepareForShutdownLocked();
updateEventDispatchingLocked();
timedout = mStackSupervisor.shutdownLocked(timeout);
}
Binder.restoreCallingIdentity(origId);
}
- private String lockScreenShownToString() {
- switch (mLockScreenShown) {
- case LOCK_SCREEN_HIDDEN: return "LOCK_SCREEN_HIDDEN";
- case LOCK_SCREEN_LEAVING: return "LOCK_SCREEN_LEAVING";
- case LOCK_SCREEN_SHOWN: return "LOCK_SCREEN_SHOWN";
- default: return "Unknown=" + mLockScreenShown;
- }
- }
-
- void logLockScreen(String msg) {
- if (DEBUG_LOCKSCREEN) Slog.d(TAG_LOCKSCREEN, Debug.getCallers(2) + ":" + msg
- + " mLockScreenShown=" + lockScreenShownToString() + " mWakefulness="
- + PowerManagerInternal.wakefulnessToString(mWakefulness)
- + " mSleeping=" + mSleeping);
- }
-
void startRunningVoiceLocked(IVoiceInteractionSession session, int targetUid) {
+ Slog.d(TAG, "<<< startRunningVoiceLocked()");
mVoiceWakeLock.setWorkSource(new WorkSource(targetUid));
if (mRunningVoice == null || mRunningVoice.asBinder() != session.asBinder()) {
boolean wasRunningVoice = mRunningVoice != null;
mWindowManager.setEventDispatching(mBooted && !mShuttingDown);
}
- public void setLockScreenShown(boolean shown) {
+ @Override
+ public void setLockScreenShown(boolean showing, int secondaryDisplayShowing) {
if (checkCallingPermission(android.Manifest.permission.DEVICE_POWER)
!= PackageManager.PERMISSION_GRANTED) {
throw new SecurityException("Requires permission "
synchronized(this) {
long ident = Binder.clearCallingIdentity();
try {
- if (DEBUG_LOCKSCREEN) logLockScreen(" shown=" + shown);
- mLockScreenShown = shown ? LOCK_SCREEN_SHOWN : LOCK_SCREEN_HIDDEN;
- updateSleepIfNeededLocked();
+ mKeyguardController.setKeyguardShown(showing, secondaryDisplayShowing);
+ } finally {
+ Binder.restoreCallingIdentity(ident);
+ }
+ }
+ sendNotifyVrManagerOfKeyguardState(showing);
+ }
+
+ @Override
+ public void notifyLockedProfile(@UserIdInt int userId) {
+ try {
+ if (!AppGlobals.getPackageManager().isUidPrivileged(Binder.getCallingUid())) {
+ throw new SecurityException("Only privileged app can call notifyLockedProfile");
+ }
+ } catch (RemoteException ex) {
+ throw new SecurityException("Fail to check is caller a privileged app", ex);
+ }
+
+ synchronized (this) {
+ final long ident = Binder.clearCallingIdentity();
+ try {
+ if (mUserController.shouldConfirmCredentials(userId)) {
+ if (mKeyguardController.isKeyguardLocked()) {
+ // Showing launcher to avoid user entering credential twice.
+ final int currentUserId = mUserController.getCurrentUserIdLocked();
+ startHomeActivityLocked(currentUserId, "notifyLockedProfile");
+ }
+ mStackSupervisor.lockAllProfileTasks(userId);
+ }
+ } finally {
+ Binder.restoreCallingIdentity(ident);
+ }
+ }
+ }
+
+ @Override
+ public void startConfirmDeviceCredentialIntent(Intent intent, Bundle options) {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "startConfirmDeviceCredentialIntent");
+ synchronized (this) {
+ final long ident = Binder.clearCallingIdentity();
+ try {
+ mActivityStarter.startConfirmCredentialIntent(intent, options);
} finally {
Binder.restoreCallingIdentity(ident);
}
public void stopAppSwitches() {
if (checkCallingPermission(android.Manifest.permission.STOP_APP_SWITCHES)
!= PackageManager.PERMISSION_GRANTED) {
- throw new SecurityException("Requires permission "
+ throw new SecurityException("viewquires permission "
+ android.Manifest.permission.STOP_APP_SWITCHES);
}
}
}
- void setOpenGlTraceApp(ApplicationInfo app, String processName) {
+ void setTrackAllocationApp(ApplicationInfo app, String processName) {
synchronized (this) {
boolean isDebuggable = "1".equals(SystemProperties.get(SYSTEM_DEBUGGABLE, "0"));
if (!isDebuggable) {
- if ((app.flags&ApplicationInfo.FLAG_DEBUGGABLE) == 0) {
+ if ((app.flags & ApplicationInfo.FLAG_DEBUGGABLE) == 0) {
throw new SecurityException("Process not debuggable: " + app.packageName);
}
}
- mOpenGlTraceApp = processName;
+ mTrackAllocationApp = processName;
}
}
synchronized (this) {
boolean isDebuggable = "1".equals(SystemProperties.get(SYSTEM_DEBUGGABLE, "0"));
if (!isDebuggable) {
- if ((app.flags&ApplicationInfo.FLAG_DEBUGGABLE) == 0) {
+ if ((app.flags & ApplicationInfo.FLAG_DEBUGGABLE) == 0) {
throw new SecurityException("Process not debuggable: " + app.packageName);
}
}
mProfileApp = processName;
- mProfileFile = profilerInfo.profileFile;
- if (mProfileFd != null) {
- try {
- mProfileFd.close();
- } catch (IOException e) {
+
+ if (mProfilerInfo != null) {
+ if (mProfilerInfo.profileFd != null) {
+ try {
+ mProfilerInfo.profileFd.close();
+ } catch (IOException e) {
+ }
}
- mProfileFd = null;
}
- mProfileFd = profilerInfo.profileFd;
- mSamplingInterval = profilerInfo.samplingInterval;
- mAutoStopProfiler = profilerInfo.autoStopProfiler;
+ mProfilerInfo = new ProfilerInfo(profilerInfo);
mProfileType = 0;
}
}
+ void setNativeDebuggingAppLocked(ApplicationInfo app, String processName) {
+ boolean isDebuggable = "1".equals(SystemProperties.get(SYSTEM_DEBUGGABLE, "0"));
+ if (!isDebuggable) {
+ if ((app.flags & ApplicationInfo.FLAG_DEBUGGABLE) == 0) {
+ throw new SecurityException("Process not debuggable: " + app.packageName);
+ }
+ }
+ mNativeDebuggingApp = processName;
+ }
+
@Override
public void setAlwaysFinish(boolean enabled) {
enforceCallingPermission(android.Manifest.permission.SET_ALWAYS_FINISH,
"setAlwaysFinish()");
- Settings.Global.putInt(
- mContext.getContentResolver(),
- Settings.Global.ALWAYS_FINISH_ACTIVITIES, enabled ? 1 : 0);
+ long ident = Binder.clearCallingIdentity();
+ try {
+ Settings.Global.putInt(
+ mContext.getContentResolver(),
+ Settings.Global.ALWAYS_FINISH_ACTIVITIES, enabled ? 1 : 0);
- synchronized (this) {
- mAlwaysFinishActivities = enabled;
+ synchronized (this) {
+ mAlwaysFinishActivities = enabled;
+ }
+ } finally {
+ Binder.restoreCallingIdentity(ident);
}
}
@Override
- public void setActivityController(IActivityController controller) {
+ public void setActivityController(IActivityController controller, boolean imAMonkey) {
enforceCallingPermission(android.Manifest.permission.SET_ACTIVITY_WATCHER,
"setActivityController()");
synchronized (this) {
mController = controller;
+ mControllerIsAMonkey = imAMonkey;
Watchdog.getInstance().setActivityController(controller);
}
}
synchronized (this) {
synchronized (mPidsSelfLocked) {
final int callingPid = Binder.getCallingPid();
- ProcessRecord precessRecord = mPidsSelfLocked.get(callingPid);
- if (precessRecord == null) {
+ ProcessRecord proc = mPidsSelfLocked.get(callingPid);
+ if (proc == null) {
throw new SecurityException("Unknown process: " + callingPid);
}
- if (precessRecord.instrumentationUiAutomationConnection == null) {
+ if (proc.instr == null || proc.instr.mUiAutomationConnection == null) {
throw new SecurityException("Only an instrumentation process "
+ "with a UiAutomation can call setUserIsMonkey");
}
public boolean isUserAMonkey() {
synchronized (this) {
// If there is a controller also implies the user is a monkey.
- return (mUserIsMonkey || mController != null);
+ return (mUserIsMonkey || (mController != null && mControllerIsAMonkey));
}
}
- public void requestBugReport() {
+ /**
+ * @deprecated This method is only used by a few internal components and it will soon be
+ * replaced by a proper bug report API (which will be restricted to a few, pre-defined apps).
+ * No new code should be calling it.
+ */
+ @Deprecated
+ @Override
+ public void requestBugReport(int bugreportType) {
+ String extraOptions = null;
+ switch (bugreportType) {
+ case ActivityManager.BUGREPORT_OPTION_FULL:
+ // Default options.
+ break;
+ case ActivityManager.BUGREPORT_OPTION_INTERACTIVE:
+ extraOptions = "bugreportplus";
+ break;
+ case ActivityManager.BUGREPORT_OPTION_REMOTE:
+ extraOptions = "bugreportremote";
+ break;
+ case ActivityManager.BUGREPORT_OPTION_WEAR:
+ extraOptions = "bugreportwear";
+ break;
+ case ActivityManager.BUGREPORT_OPTION_TELEPHONY:
+ extraOptions = "bugreporttelephony";
+ break;
+ default:
+ throw new IllegalArgumentException("Provided bugreport type is not correct, value: "
+ + bugreportType);
+ }
+ // Always log caller, even if it does not have permission to dump.
+ String type = extraOptions == null ? "bugreport" : extraOptions;
+ Slog.i(TAG, type + " requested by UID " + Binder.getCallingUid());
+
enforceCallingPermission(android.Manifest.permission.DUMP, "requestBugReport");
+ if (extraOptions != null) {
+ SystemProperties.set("dumpstate.options", extraOptions);
+ }
SystemProperties.set("ctl.start", "bugreport");
}
+ /**
+ * @deprecated This method is only used by a few internal components and it will soon be
+ * replaced by a proper bug report API (which will be restricted to a few, pre-defined apps).
+ * No new code should be calling it.
+ */
+ @Deprecated
+ @Override
+ public void requestTelephonyBugReport(String shareTitle, String shareDescription) {
+
+ if (!TextUtils.isEmpty(shareTitle)) {
+ if (shareTitle.length() > MAX_BUGREPORT_TITLE_SIZE) {
+ String errorStr = "shareTitle should be less than " +
+ MAX_BUGREPORT_TITLE_SIZE + " characters";
+ throw new IllegalArgumentException(errorStr);
+ } else {
+ if (!TextUtils.isEmpty(shareDescription)) {
+ int length;
+ try {
+ length = shareDescription.getBytes("UTF-8").length;
+ } catch (UnsupportedEncodingException e) {
+ String errorStr = "shareDescription: UnsupportedEncodingException";
+ throw new IllegalArgumentException(errorStr);
+ }
+ if (length > SystemProperties.PROP_VALUE_MAX) {
+ String errorStr = "shareTitle should be less than " +
+ SystemProperties.PROP_VALUE_MAX + " bytes";
+ throw new IllegalArgumentException(errorStr);
+ } else {
+ SystemProperties.set("dumpstate.options.description", shareDescription);
+ }
+ }
+ SystemProperties.set("dumpstate.options.title", shareTitle);
+ }
+ }
+
+ Slog.d(TAG, "Bugreport notification title " + shareTitle
+ + " description " + shareDescription);
+ requestBugReport(ActivityManager.BUGREPORT_OPTION_TELEPHONY);
+ }
+
public static long getInputDispatchingTimeoutLocked(ActivityRecord r) {
return r != null ? getInputDispatchingTimeoutLocked(r.app) : KEY_DISPATCHING_TIMEOUT;
}
public static long getInputDispatchingTimeoutLocked(ProcessRecord r) {
- if (r != null && (r.instrumentationClass != null || r.usingWrapper)) {
+ if (r != null && (r.instr != null || r.usingWrapper)) {
return INSTRUMENTATION_KEY_DISPATCHING_TIMEOUT;
}
return KEY_DISPATCHING_TIMEOUT;
timeout = getInputDispatchingTimeoutLocked(proc);
}
- if (!inputDispatchingTimedOut(proc, null, null, aboveSystem, reason)) {
+ if (inputDispatchingTimedOut(proc, null, null, aboveSystem, reason)) {
return -1;
}
return false;
}
- if (mDidDexOpt) {
- // Give more time since we were dexopting.
- mDidDexOpt = false;
- return false;
- }
-
- if (proc.instrumentationClass != null) {
+ if (proc.instr != null) {
Bundle info = new Bundle();
info.putString("shortMsg", "keyDispatchingTimedOut");
info.putString("longMsg", annotation);
mHandler.post(new Runnable() {
@Override
public void run() {
- appNotResponding(proc, activity, parent, aboveSystem, annotation);
+ mAppErrors.appNotResponding(proc, activity, parent, aboveSystem, annotation);
}
});
}
@Override
public Bundle getAssistContextExtras(int requestType) {
PendingAssistExtras pae = enqueueAssistContext(requestType, null, null, null,
- null, UserHandle.getCallingUserId(), null, PENDING_ASSIST_EXTRAS_TIMEOUT);
+ null, null, true /* focused */, true /* newSessionId */,
+ UserHandle.getCallingUserId(), null, PENDING_ASSIST_EXTRAS_TIMEOUT, 0);
if (pae == null) {
return null;
}
@Override
public boolean isAssistDataAllowedOnCurrentActivity() {
- int userId = mCurrentUserId;
+ int userId;
synchronized (this) {
- ActivityRecord activity = getFocusedStack().topActivity();
+ final ActivityStack focusedStack = getFocusedStack();
+ if (focusedStack == null || focusedStack.isAssistantStack()) {
+ return false;
+ }
+
+ final ActivityRecord activity = focusedStack.topActivity();
if (activity == null) {
return false;
}
return false;
}
}
- AssistUtils utils = new AssistUtils(mContext);
- return utils.showSessionForActiveService(args,
- VoiceInteractionSession.SHOW_SOURCE_APPLICATION, null, token);
+ return mAssistUtils.showSessionForActiveService(args, SHOW_SOURCE_APPLICATION, null,
+ token);
} finally {
Binder.restoreCallingIdentity(ident);
}
@Override
public boolean requestAssistContextExtras(int requestType, IResultReceiver receiver,
- IBinder activityToken) {
- return enqueueAssistContext(requestType, null, null, receiver, activityToken,
- UserHandle.getCallingUserId(), null, PENDING_ASSIST_EXTRAS_LONG_TIMEOUT) != null;
+ Bundle receiverExtras, IBinder activityToken, boolean focused, boolean newSessionId) {
+ return enqueueAssistContext(requestType, null, null, receiver, receiverExtras,
+ activityToken, focused, newSessionId, UserHandle.getCallingUserId(), null,
+ PENDING_ASSIST_EXTRAS_LONG_TIMEOUT, 0) != null;
+ }
+
+ @Override
+ public boolean requestAutofillData(IResultReceiver receiver, Bundle receiverExtras,
+ IBinder activityToken, int flags) {
+ return enqueueAssistContext(ActivityManager.ASSIST_CONTEXT_AUTOFILL, null, null,
+ receiver, receiverExtras, activityToken, true, true, UserHandle.getCallingUserId(),
+ null, PENDING_AUTOFILL_ASSIST_STRUCTURE_TIMEOUT, flags) != null;
}
private PendingAssistExtras enqueueAssistContext(int requestType, Intent intent, String hint,
- IResultReceiver receiver, IBinder activityToken, int userHandle, Bundle args,
- long timeout) {
+ IResultReceiver receiver, Bundle receiverExtras, IBinder activityToken,
+ boolean focused, boolean newSessionId, int userHandle, Bundle args, long timeout,
+ int flags) {
enforceCallingPermission(android.Manifest.permission.GET_TOP_ACTIVITY_INFO,
"enqueueAssistContext()");
+
synchronized (this) {
ActivityRecord activity = getFocusedStack().topActivity();
if (activity == null) {
Slog.w(TAG, "getAssistContextExtras failed: no process for " + activity);
return null;
}
- if (activityToken != null) {
- ActivityRecord caller = ActivityRecord.forTokenLocked(activityToken);
- if (activity != caller) {
- Slog.w(TAG, "enqueueAssistContext failed: caller " + caller
- + " is not current top " + activity);
- return null;
+ if (focused) {
+ if (activityToken != null) {
+ ActivityRecord caller = ActivityRecord.forTokenLocked(activityToken);
+ if (activity != caller) {
+ Slog.w(TAG, "enqueueAssistContext failed: caller " + caller
+ + " is not current top " + activity);
+ return null;
+ }
+ }
+ } else {
+ activity = ActivityRecord.forTokenLocked(activityToken);
+ if (activity == null) {
+ Slog.w(TAG, "enqueueAssistContext failed: activity for token=" + activityToken
+ + " couldn't be found");
+ return null;
+ }
+ if (activity.app == null || activity.app.thread == null) {
+ Slog.w(TAG, "enqueueAssistContext failed: no process for " + activity);
+ return null;
}
}
+
PendingAssistExtras pae;
Bundle extras = new Bundle();
if (args != null) {
}
extras.putString(Intent.EXTRA_ASSIST_PACKAGE, activity.packageName);
extras.putInt(Intent.EXTRA_ASSIST_UID, activity.app.uid);
- pae = new PendingAssistExtras(activity, extras, intent, hint, receiver, userHandle);
+
+ pae = new PendingAssistExtras(activity, extras, intent, hint, receiver, receiverExtras,
+ userHandle);
+ pae.isHome = activity.isHomeActivity();
+
+ // Increment the sessionId if necessary
+ if (newSessionId) {
+ mViSessionId++;
+ }
try {
- activity.app.thread.requestAssistContextExtras(activity.appToken, pae,
- requestType);
+ activity.app.thread.requestAssistContextExtras(activity.appToken, pae, requestType,
+ mViSessionId, flags);
mPendingAssistExtras.add(pae);
mUiHandler.postDelayed(pae, timeout);
} catch (RemoteException e) {
}
if (receiver != null) {
// Caller wants result sent back to them.
+ Bundle sendBundle = new Bundle();
+ // At least return the receiver extras
+ sendBundle.putBundle(VoiceInteractionSession.KEY_RECEIVER_EXTRAS,
+ pae.receiverExtras);
try {
- pae.receiver.send(0, null);
+ pae.receiver.send(0, sendBundle);
} catch (RemoteException e) {
}
}
}
}
+ /** Called from an app when assist data is ready. */
+ @Override
public void reportAssistContextExtras(IBinder token, Bundle extras, AssistStructure structure,
AssistContent content, Uri referrer) {
PendingAssistExtras pae = (PendingAssistExtras)token;
if (referrer != null) {
pae.extras.putParcelable(Intent.EXTRA_REFERRER, referrer);
}
+ if (structure != null) {
+ structure.setHomeActivity(pae.isHome);
+ }
pae.haveResult = true;
pae.notifyAll();
if (pae.intent == null && pae.receiver == null) {
return;
}
}
-
// We are now ready to launch the assist activity.
IResultReceiver sendReceiver = null;
Bundle sendBundle = null;
if ((sendReceiver=pae.receiver) != null) {
// Caller wants result sent back to them.
sendBundle = new Bundle();
- sendBundle.putBundle("data", pae.extras);
- sendBundle.putParcelable("structure", pae.structure);
- sendBundle.putParcelable("content", pae.content);
+ sendBundle.putBundle(VoiceInteractionSession.KEY_DATA, pae.extras);
+ sendBundle.putParcelable(VoiceInteractionSession.KEY_STRUCTURE, pae.structure);
+ sendBundle.putParcelable(VoiceInteractionSession.KEY_CONTENT, pae.content);
+ sendBundle.putBundle(VoiceInteractionSession.KEY_RECEIVER_EXTRAS,
+ pae.receiverExtras);
}
}
if (sendReceiver != null) {
return;
}
- long ident = Binder.clearCallingIdentity();
+ final long ident = Binder.clearCallingIdentity();
try {
- pae.intent.replaceExtras(pae.extras);
- pae.intent.setFlags(Intent.FLAG_ACTIVITY_NEW_TASK
- | Intent.FLAG_ACTIVITY_SINGLE_TOP
- | Intent.FLAG_ACTIVITY_CLEAR_TOP);
- closeSystemDialogs("assist");
- try {
- mContext.startActivityAsUser(pae.intent, new UserHandle(pae.userHandle));
- } catch (ActivityNotFoundException e) {
- Slog.w(TAG, "No activity to handle assist action.", e);
+ if (TextUtils.equals(pae.intent.getAction(),
+ android.service.voice.VoiceInteractionService.SERVICE_INTERFACE)) {
+ pae.intent.putExtras(pae.extras);
+ mContext.startServiceAsUser(pae.intent, new UserHandle(pae.userHandle));
+ } else {
+ pae.intent.replaceExtras(pae.extras);
+ pae.intent.setFlags(Intent.FLAG_ACTIVITY_NEW_TASK
+ | Intent.FLAG_ACTIVITY_SINGLE_TOP
+ | Intent.FLAG_ACTIVITY_CLEAR_TOP);
+ closeSystemDialogs("assist");
+
+ try {
+ mContext.startActivityAsUser(pae.intent, new UserHandle(pae.userHandle));
+ } catch (ActivityNotFoundException e) {
+ Slog.w(TAG, "No activity to handle assist action.", e);
+ }
}
} finally {
Binder.restoreCallingIdentity(ident);
public boolean launchAssistIntent(Intent intent, int requestType, String hint, int userHandle,
Bundle args) {
- return enqueueAssistContext(requestType, intent, hint, null, null, userHandle, args,
- PENDING_ASSIST_EXTRAS_TIMEOUT) != null;
+ return enqueueAssistContext(requestType, intent, hint, null, null, null,
+ true /* focused */, true /* newSessionId */, userHandle, args,
+ PENDING_ASSIST_EXTRAS_TIMEOUT, 0) != null;
}
public void registerProcessObserver(IProcessObserver observer) {
}
}
- public void registerUidObserver(IUidObserver observer) {
- enforceCallingPermission(android.Manifest.permission.SET_ACTIVITY_WATCHER,
- "registerUidObserver()");
+ @Override
+ public int getUidProcessState(int uid, String callingPackage) {
+ if (!hasUsageStatsPermission(callingPackage)) {
+ enforceCallingPermission(android.Manifest.permission.PACKAGE_USAGE_STATS,
+ "getUidProcessState");
+ }
+
synchronized (this) {
- mUidObservers.register(observer);
+ UidRecord uidRec = mActiveUids.get(uid);
+ return uidRec != null ? uidRec.curProcState : ActivityManager.PROCESS_STATE_NONEXISTENT;
+ }
+ }
+
+ @Override
+ public void registerUidObserver(IUidObserver observer, int which, int cutpoint,
+ String callingPackage) {
+ if (!hasUsageStatsPermission(callingPackage)) {
+ enforceCallingPermission(android.Manifest.permission.PACKAGE_USAGE_STATS,
+ "registerUidObserver");
+ }
+ synchronized (this) {
+ mUidObservers.register(observer, new UidObserverRegistration(Binder.getCallingUid(),
+ callingPackage, which, cutpoint));
}
}
}
final boolean translucentChanged = r.changeWindowTranslucency(true);
if (translucentChanged) {
- r.task.stack.releaseBackgroundResources(r);
- mStackSupervisor.ensureActivitiesVisibleLocked(null, 0);
+ mStackSupervisor.ensureActivitiesVisibleLocked(null, 0, !PRESERVE_WINDOWS);
}
mWindowManager.setAppFullscreen(token, true);
return translucentChanged;
}
@Override
- public boolean convertToTranslucent(IBinder token, ActivityOptions options) {
+ public boolean convertToTranslucent(IBinder token, Bundle options) {
final long origId = Binder.clearCallingIdentity();
try {
synchronized (this) {
if (r == null) {
return false;
}
- int index = r.task.mActivities.lastIndexOf(r);
+ final TaskRecord task = r.getTask();
+ int index = task.mActivities.lastIndexOf(r);
if (index > 0) {
- ActivityRecord under = r.task.mActivities.get(index - 1);
- under.returningOptions = options;
+ ActivityRecord under = task.mActivities.get(index - 1);
+ under.returningOptions = ActivityOptions.fromBundle(options);
}
final boolean translucentChanged = r.changeWindowTranslucency(false);
if (translucentChanged) {
- r.task.stack.convertActivityToTranslucent(r);
+ r.getStack().convertActivityToTranslucent(r);
}
- mStackSupervisor.ensureActivitiesVisibleLocked(null, 0);
+ mStackSupervisor.ensureActivitiesVisibleLocked(null, 0, !PRESERVE_WINDOWS);
mWindowManager.setAppFullscreen(token, false);
return translucentChanged;
}
}
@Override
- public boolean requestVisibleBehind(IBinder token, boolean visible) {
- final long origId = Binder.clearCallingIdentity();
- try {
- synchronized (this) {
- final ActivityRecord r = ActivityRecord.isInStackLocked(token);
- if (r != null) {
- return mStackSupervisor.requestVisibleBehindLocked(r, visible);
- }
- }
- return false;
- } finally {
- Binder.restoreCallingIdentity(origId);
- }
- }
-
- @Override
- public boolean isBackgroundVisibleBehind(IBinder token) {
- final long origId = Binder.clearCallingIdentity();
- try {
- synchronized (this) {
- final ActivityStack stack = ActivityRecord.getStackLocked(token);
- final boolean visible = stack == null ? false : stack.hasVisibleBehindActivity();
- if (DEBUG_VISIBLE_BEHIND) Slog.d(TAG_VISIBLE_BEHIND,
- "isBackgroundVisibleBehind: stack=" + stack + " visible=" + visible);
- return visible;
- }
- } finally {
- Binder.restoreCallingIdentity(origId);
- }
- }
-
- @Override
- public ActivityOptions getActivityOptions(IBinder token) {
+ public Bundle getActivityOptions(IBinder token) {
final long origId = Binder.clearCallingIdentity();
try {
synchronized (this) {
final ActivityRecord r = ActivityRecord.isInStackLocked(token);
if (r != null) {
- final ActivityOptions activityOptions = r.pendingOptions;
- r.pendingOptions = null;
- return activityOptions;
+ final ActivityOptions activityOptions = r.takeOptionsLocked();
+ return activityOptions == null ? null : activityOptions.toBundle();
}
return null;
}
r.immersive = immersive;
// update associated state if we're frontmost
- if (r == mFocusedActivity) {
+ if (r == mStackSupervisor.getResumedActivityLocked()) {
if (DEBUG_IMMERSIVE) Slog.d(TAG_IMMERSIVE, "Frontmost changed immersion: "+ r);
applyUpdateLockStateLocked(r);
}
}
}
+ @Override
+ public void setVrThread(int tid) {
+ enforceSystemHasVrFeature();
+ synchronized (this) {
+ synchronized (mPidsSelfLocked) {
+ final int pid = Binder.getCallingPid();
+ final ProcessRecord proc = mPidsSelfLocked.get(pid);
+ mVrController.setVrThreadLocked(tid, pid, proc);
+ }
+ }
+ }
+
+ @Override
+ public void setPersistentVrThread(int tid) {
+ if (checkCallingPermission(permission.RESTRICTED_VR_ACCESS) != PERMISSION_GRANTED) {
+ final String msg = "Permission Denial: setPersistentVrThread() from pid="
+ + Binder.getCallingPid()
+ + ", uid=" + Binder.getCallingUid()
+ + " requires " + permission.RESTRICTED_VR_ACCESS;
+ Slog.w(TAG, msg);
+ throw new SecurityException(msg);
+ }
+ enforceSystemHasVrFeature();
+ synchronized (this) {
+ synchronized (mPidsSelfLocked) {
+ final int pid = Binder.getCallingPid();
+ final ProcessRecord proc = mPidsSelfLocked.get(pid);
+ mVrController.setPersistentVrThreadLocked(tid, pid, proc);
+ }
+ }
+ }
+
+ /**
+ * Schedule the given thread a normal scheduling priority.
+ *
+ * @param tid the tid of the thread to adjust the scheduling of.
+ * @param suppressLogs {@code true} if any error logging should be disabled.
+ *
+ * @return {@code true} if this succeeded.
+ */
+ static boolean scheduleAsRegularPriority(int tid, boolean suppressLogs) {
+ try {
+ Process.setThreadScheduler(tid, Process.SCHED_OTHER, 0);
+ return true;
+ } catch (IllegalArgumentException e) {
+ if (!suppressLogs) {
+ Slog.w(TAG, "Failed to set scheduling policy, thread does not exist:\n" + e);
+ }
+ } catch (SecurityException e) {
+ if (!suppressLogs) {
+ Slog.w(TAG, "Failed to set scheduling policy, not allowed:\n" + e);
+ }
+ }
+ return false;
+ }
+
+ /**
+ * Schedule the given thread an FIFO scheduling priority.
+ *
+ * @param tid the tid of the thread to adjust the scheduling of.
+ * @param suppressLogs {@code true} if any error logging should be disabled.
+ *
+ * @return {@code true} if this succeeded.
+ */
+ static boolean scheduleAsFifoPriority(int tid, boolean suppressLogs) {
+ try {
+ Process.setThreadScheduler(tid, Process.SCHED_FIFO | Process.SCHED_RESET_ON_FORK, 1);
+ return true;
+ } catch (IllegalArgumentException e) {
+ if (!suppressLogs) {
+ Slog.w(TAG, "Failed to set scheduling policy, thread does not exist:\n" + e);
+ }
+ } catch (SecurityException e) {
+ if (!suppressLogs) {
+ Slog.w(TAG, "Failed to set scheduling policy, not allowed:\n" + e);
+ }
+ }
+ return false;
+ }
+
+ /**
+ * Check that we have the features required for VR-related API calls, and throw an exception if
+ * not.
+ */
+ private void enforceSystemHasVrFeature() {
+ if (!mContext.getPackageManager().hasSystemFeature(PackageManager.FEATURE_VR_MODE)) {
+ throw new UnsupportedOperationException("VR mode not supported on this device!");
+ }
+ }
+
+ @Override
+ public void setRenderThread(int tid) {
+ synchronized (this) {
+ ProcessRecord proc;
+ int pid = Binder.getCallingPid();
+ if (pid == Process.myPid()) {
+ demoteSystemServerRenderThread(tid);
+ return;
+ }
+ synchronized (mPidsSelfLocked) {
+ proc = mPidsSelfLocked.get(pid);
+ if (proc != null && proc.renderThreadTid == 0 && tid > 0) {
+ // ensure the tid belongs to the process
+ if (!isThreadInProcess(pid, tid)) {
+ throw new IllegalArgumentException(
+ "Render thread does not belong to process");
+ }
+ proc.renderThreadTid = tid;
+ if (DEBUG_OOM_ADJ) {
+ Slog.d("UI_FIFO", "Set RenderThread tid " + tid + " for pid " + pid);
+ }
+ // promote to FIFO now
+ if (proc.curSchedGroup == ProcessList.SCHED_GROUP_TOP_APP) {
+ if (DEBUG_OOM_ADJ) Slog.d("UI_FIFO", "Promoting " + tid + "out of band");
+ if (mUseFifoUiScheduling) {
+ setThreadScheduler(proc.renderThreadTid,
+ SCHED_FIFO | SCHED_RESET_ON_FORK, 1);
+ } else {
+ setThreadPriority(proc.renderThreadTid, TOP_APP_PRIORITY_BOOST);
+ }
+ }
+ } else {
+ if (DEBUG_OOM_ADJ) {
+ Slog.d("UI_FIFO", "Didn't set thread from setRenderThread? " +
+ "PID: " + pid + ", TID: " + tid + " FIFO: " +
+ mUseFifoUiScheduling);
+ }
+ }
+ }
+ }
+ }
+
+ /**
+ * We only use RenderThread in system_server to store task snapshots to the disk, which should
+ * happen in the background. Thus, demote render thread from system_server to a lower priority.
+ *
+ * @param tid the tid of the RenderThread
+ */
+ private void demoteSystemServerRenderThread(int tid) {
+ setThreadPriority(tid, Process.THREAD_PRIORITY_BACKGROUND);
+ }
+
+ @Override
+ public int setVrMode(IBinder token, boolean enabled, ComponentName packageName) {
+ if (!mContext.getPackageManager().hasSystemFeature(PackageManager.FEATURE_VR_MODE)) {
+ throw new UnsupportedOperationException("VR mode not supported on this device!");
+ }
+
+ final VrManagerInternal vrService = LocalServices.getService(VrManagerInternal.class);
+
+ ActivityRecord r;
+ synchronized (this) {
+ r = ActivityRecord.isInStackLocked(token);
+ }
+
+ if (r == null) {
+ throw new IllegalArgumentException();
+ }
+
+ int err;
+ if ((err = vrService.hasVrPackage(packageName, r.userId)) !=
+ VrManagerInternal.NO_ERROR) {
+ return err;
+ }
+
+ synchronized(this) {
+ r.requestedVrComponent = (enabled) ? packageName : null;
+
+ // Update associated state if this activity is currently focused
+ if (r == mStackSupervisor.getResumedActivityLocked()) {
+ applyUpdateVrModeLocked(r);
+ }
+ return 0;
+ }
+ }
+
+ @Override
+ public boolean isVrModePackageEnabled(ComponentName packageName) {
+ if (!mContext.getPackageManager().hasSystemFeature(PackageManager.FEATURE_VR_MODE)) {
+ throw new UnsupportedOperationException("VR mode not supported on this device!");
+ }
+
+ final VrManagerInternal vrService = LocalServices.getService(VrManagerInternal.class);
+
+ return vrService.hasVrPackage(packageName, UserHandle.getCallingUserId()) ==
+ VrManagerInternal.NO_ERROR;
+ }
+
public boolean isTopActivityImmersive() {
enforceNotIsolatedCaller("startActivity");
synchronized (this) {
- ActivityRecord r = getFocusedStack().topRunningActivityLocked(null);
+ ActivityRecord r = getFocusedStack().topRunningActivityLocked();
return (r != null) ? r.immersive : false;
}
}
+ /**
+ * @return whether the system should disable UI modes incompatible with VR mode.
+ */
+ boolean shouldDisableNonVrUiLocked() {
+ return mVrController.shouldDisableNonVrUiLocked();
+ }
+
@Override
public boolean isTopOfTask(IBinder token) {
synchronized (this) {
if (r == null) {
throw new IllegalArgumentException();
}
- return r.task.getTopActivity() == r;
+ return r.getTask().getTopActivity() == r;
+ }
+ }
+
+ @Override
+ public void setHasTopUi(boolean hasTopUi) throws RemoteException {
+ if (checkCallingPermission(permission.INTERNAL_SYSTEM_WINDOW) != PERMISSION_GRANTED) {
+ String msg = "Permission Denial: setHasTopUi() from pid="
+ + Binder.getCallingPid()
+ + ", uid=" + Binder.getCallingUid()
+ + " requires " + permission.INTERNAL_SYSTEM_WINDOW;
+ Slog.w(TAG, msg);
+ throw new SecurityException(msg);
+ }
+ final int pid = Binder.getCallingPid();
+ final long origId = Binder.clearCallingIdentity();
+ try {
+ synchronized (this) {
+ boolean changed = false;
+ ProcessRecord pr;
+ synchronized (mPidsSelfLocked) {
+ pr = mPidsSelfLocked.get(pid);
+ if (pr == null) {
+ Slog.w(TAG, "setHasTopUi called on unknown pid: " + pid);
+ return;
+ }
+ if (pr.hasTopUi != hasTopUi) {
+ if (DEBUG_OOM_ADJ) {
+ Slog.d(TAG, "Setting hasTopUi=" + hasTopUi + " for pid=" + pid);
+ }
+ pr.hasTopUi = hasTopUi;
+ changed = true;
+ }
+ }
+ if (changed) {
+ updateOomAdjLocked(pr, true);
+ }
+ }
+ } finally {
+ Binder.restoreCallingIdentity(origId);
}
}
}
public void noteWakeupAlarm(IIntentSender sender, int sourceUid, String sourcePkg, String tag) {
- if (!(sender instanceof PendingIntentRecord)) {
+ if (sender != null && !(sender instanceof PendingIntentRecord)) {
return;
}
final PendingIntentRecord rec = (PendingIntentRecord)sender;
if (mBatteryStatsService.isOnBattery()) {
mBatteryStatsService.enforceCallingPermission();
int MY_UID = Binder.getCallingUid();
- int uid = rec.uid == MY_UID ? Process.SYSTEM_UID : rec.uid;
+ final int uid;
+ if (sender == null) {
+ uid = sourceUid;
+ } else {
+ uid = rec.uid == MY_UID ? SYSTEM_UID : rec.uid;
+ }
BatteryStatsImpl.Uid.Pkg pkg =
stats.getPackageStatsLocked(sourceUid >= 0 ? sourceUid : uid,
sourcePkg != null ? sourcePkg : rec.key.packageName);
}
public void noteAlarmStart(IIntentSender sender, int sourceUid, String tag) {
- if (!(sender instanceof PendingIntentRecord)) {
+ if (sender != null && !(sender instanceof PendingIntentRecord)) {
return;
}
final PendingIntentRecord rec = (PendingIntentRecord)sender;
synchronized (stats) {
mBatteryStatsService.enforceCallingPermission();
int MY_UID = Binder.getCallingUid();
- int uid = rec.uid == MY_UID ? Process.SYSTEM_UID : rec.uid;
+ final int uid;
+ if (sender == null) {
+ uid = sourceUid;
+ } else {
+ uid = rec.uid == MY_UID ? SYSTEM_UID : rec.uid;
+ }
mBatteryStatsService.noteAlarmStart(tag, sourceUid >= 0 ? sourceUid : uid);
}
}
public void noteAlarmFinish(IIntentSender sender, int sourceUid, String tag) {
- if (!(sender instanceof PendingIntentRecord)) {
+ if (sender != null && !(sender instanceof PendingIntentRecord)) {
return;
}
final PendingIntentRecord rec = (PendingIntentRecord)sender;
synchronized (stats) {
mBatteryStatsService.enforceCallingPermission();
int MY_UID = Binder.getCallingUid();
- int uid = rec.uid == MY_UID ? Process.SYSTEM_UID : rec.uid;
+ final int uid;
+ if (sender == null) {
+ uid = sourceUid;
+ } else {
+ uid = rec.uid == MY_UID ? SYSTEM_UID : rec.uid;
+ }
mBatteryStatsService.noteAlarmFinish(tag, sourceUid >= 0 ? sourceUid : uid);
}
}
public boolean killPids(int[] pids, String pReason, boolean secure) {
- if (Binder.getCallingUid() != Process.SYSTEM_UID) {
+ if (Binder.getCallingUid() != SYSTEM_UID) {
throw new SecurityException("killPids only available to the system");
}
String reason = (pReason == null) ? "Unknown" : pReason;
boolean killed = false;
synchronized (mPidsSelfLocked) {
- int[] types = new int[pids.length];
int worstType = 0;
for (int i=0; i<pids.length; i++) {
ProcessRecord proc = mPidsSelfLocked.get(pids[i]);
if (proc != null) {
int type = proc.setAdj;
- types[i] = type;
if (type > worstType) {
worstType = type;
}
@Override
public boolean killProcessesBelowForeground(String reason) {
- if (Binder.getCallingUid() != Process.SYSTEM_UID) {
+ if (Binder.getCallingUid() != SYSTEM_UID) {
throw new SecurityException("killProcessesBelowForeground() only available to system");
}
}
private boolean killProcessesBelowAdj(int belowAdj, String reason) {
- if (Binder.getCallingUid() != Process.SYSTEM_UID) {
+ if (Binder.getCallingUid() != SYSTEM_UID) {
throw new SecurityException("killProcessesBelowAdj() only available to system");
}
Log.i(TAG, "Shutting down activity manager...");
shutdown(10000);
Log.i(TAG, "Shutdown complete, restarting!");
- Process.killProcess(Process.myPid());
+ killProcess(myPid());
System.exit(10);
}
};
sb.append(proc.processName);
sb.append(" in idle maint: pss=");
sb.append(proc.lastPss);
+ sb.append(", swapPss=");
+ sb.append(proc.lastSwapPss);
sb.append(", initialPss=");
sb.append(proc.initialIdlePss);
sb.append(", period=");
+ " from " + proc.initialIdlePss + ")", true);
}
}
- } else if (proc.setProcState < ActivityManager.PROCESS_STATE_HOME) {
+ } else if (proc.setProcState < ActivityManager.PROCESS_STATE_HOME
+ && proc.setProcState >= ActivityManager.PROCESS_STATE_PERSISTENT) {
proc.notCachedSinceIdle = true;
proc.initialIdlePss = 0;
- proc.nextPssTime = ProcessList.computeNextPssTime(proc.curProcState, true,
- mTestPssMode, isSleeping(), now);
+ proc.nextPssTime = ProcessList.computeNextPssTime(proc.setProcState, true,
+ mTestPssMode, isSleepingLocked(), now);
}
}
}
}
+ @Override
+ public void sendIdleJobTrigger() {
+ if (checkCallingPermission(android.Manifest.permission.SET_ACTIVITY_WATCHER)
+ != PackageManager.PERMISSION_GRANTED) {
+ throw new SecurityException("Requires permission "
+ + android.Manifest.permission.SET_ACTIVITY_WATCHER);
+ }
+
+ final long ident = Binder.clearCallingIdentity();
+ try {
+ Intent intent = new Intent(ACTION_TRIGGER_IDLE)
+ .setPackage("android")
+ .addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY);
+ broadcastIntent(null, intent, null, null, 0, null, null, null,
+ android.app.AppOpsManager.OP_NONE, null, true, false, UserHandle.USER_ALL);
+ } finally {
+ Binder.restoreCallingIdentity(ident);
+ }
+ }
+
private void retrieveSettings() {
final ContentResolver resolver = mContext.getContentResolver();
- String debugApp = Settings.Global.getString(
- resolver, Settings.Global.DEBUG_APP);
- boolean waitForDebugger = Settings.Global.getInt(
- resolver, Settings.Global.WAIT_FOR_DEBUGGER, 0) != 0;
- boolean alwaysFinishActivities = Settings.Global.getInt(
- resolver, Settings.Global.ALWAYS_FINISH_ACTIVITIES, 0) != 0;
- boolean forceRtl = Settings.Global.getInt(
- resolver, Settings.Global.DEVELOPMENT_FORCE_RTL, 0) != 0;
+ final boolean freeformWindowManagement =
+ mContext.getPackageManager().hasSystemFeature(FEATURE_FREEFORM_WINDOW_MANAGEMENT)
+ || Settings.Global.getInt(
+ resolver, DEVELOPMENT_ENABLE_FREEFORM_WINDOWS_SUPPORT, 0) != 0;
+
+ final boolean supportsMultiWindow = ActivityManager.supportsMultiWindow(mContext);
+ final boolean supportsPictureInPicture = supportsMultiWindow &&
+ mContext.getPackageManager().hasSystemFeature(FEATURE_PICTURE_IN_PICTURE);
+ final boolean supportsSplitScreenMultiWindow =
+ ActivityManager.supportsSplitScreenMultiWindow(mContext);
+ final boolean supportsMultiDisplay = mContext.getPackageManager()
+ .hasSystemFeature(FEATURE_ACTIVITIES_ON_SECONDARY_DISPLAYS);
+ final String debugApp = Settings.Global.getString(resolver, DEBUG_APP);
+ final boolean waitForDebugger = Settings.Global.getInt(resolver, WAIT_FOR_DEBUGGER, 0) != 0;
+ final boolean alwaysFinishActivities =
+ Settings.Global.getInt(resolver, ALWAYS_FINISH_ACTIVITIES, 0) != 0;
+ final boolean forceRtl = Settings.Global.getInt(resolver, DEVELOPMENT_FORCE_RTL, 0) != 0;
+ final boolean forceResizable = Settings.Global.getInt(
+ resolver, DEVELOPMENT_FORCE_RESIZABLE_ACTIVITIES, 0) != 0;
+ final long waitForNetworkTimeoutMs = Settings.Global.getLong(resolver,
+ NETWORK_ACCESS_TIMEOUT_MS, NETWORK_ACCESS_TIMEOUT_DEFAULT_MS);
+ final boolean supportsLeanbackOnly =
+ mContext.getPackageManager().hasSystemFeature(FEATURE_LEANBACK_ONLY);
+
// Transfer any global setting for forcing RTL layout, into a System Property
- SystemProperties.set(Settings.Global.DEVELOPMENT_FORCE_RTL, forceRtl ? "1":"0");
+ SystemProperties.set(DEVELOPMENT_FORCE_RTL, forceRtl ? "1":"0");
- Configuration configuration = new Configuration();
+ final Configuration configuration = new Configuration();
Settings.System.getConfiguration(resolver, configuration);
if (forceRtl) {
// This will take care of setting the correct layout direction flags
mDebugApp = mOrigDebugApp = debugApp;
mWaitForDebugger = mOrigWaitForDebugger = waitForDebugger;
mAlwaysFinishActivities = alwaysFinishActivities;
- // This happens before any activities are started, so we can
- // change mConfiguration in-place.
- updateConfigurationLocked(configuration, null, false, true);
- if (DEBUG_CONFIGURATION) Slog.v(TAG_CONFIGURATION,
- "Initial config: " + mConfiguration);
+ mSupportsLeanbackOnly = supportsLeanbackOnly;
+ mForceResizableActivities = forceResizable;
+ final boolean multiWindowFormEnabled = freeformWindowManagement
+ || supportsSplitScreenMultiWindow
+ || supportsPictureInPicture
+ || supportsMultiDisplay;
+ if ((supportsMultiWindow || forceResizable) && multiWindowFormEnabled) {
+ mSupportsMultiWindow = true;
+ mSupportsFreeformWindowManagement = freeformWindowManagement;
+ mSupportsSplitScreenMultiWindow = supportsSplitScreenMultiWindow;
+ mSupportsPictureInPicture = supportsPictureInPicture;
+ mSupportsMultiDisplay = supportsMultiDisplay;
+ } else {
+ mSupportsMultiWindow = false;
+ mSupportsFreeformWindowManagement = false;
+ mSupportsSplitScreenMultiWindow = false;
+ mSupportsPictureInPicture = false;
+ mSupportsMultiDisplay = false;
+ }
+ mWindowManager.setForceResizableTasks(mForceResizableActivities);
+ mWindowManager.setSupportsPictureInPicture(mSupportsPictureInPicture);
+ // This happens before any activities are started, so we can change global configuration
+ // in-place.
+ updateConfigurationLocked(configuration, null, true);
+ final Configuration globalConfig = getGlobalConfiguration();
+ if (DEBUG_CONFIGURATION) Slog.v(TAG_CONFIGURATION, "Initial config: " + globalConfig);
+
+ // Load resources only after the current configuration has been set.
+ final Resources res = mContext.getResources();
+ mHasRecents = res.getBoolean(com.android.internal.R.bool.config_hasRecents);
+ mThumbnailWidth = res.getDimensionPixelSize(
+ com.android.internal.R.dimen.thumbnail_width);
+ mThumbnailHeight = res.getDimensionPixelSize(
+ com.android.internal.R.dimen.thumbnail_height);
+ mAppErrors.loadAppsNotReportingCrashesFromConfigLocked(res.getString(
+ com.android.internal.R.string.config_appsNotReportingCrashes));
+ mUserController.mUserSwitchUiEnabled = !res.getBoolean(
+ com.android.internal.R.bool.config_customUserSwitchUi);
+ if ((globalConfig.uiMode & UI_MODE_TYPE_TELEVISION) == UI_MODE_TYPE_TELEVISION) {
+ mFullscreenThumbnailScale = (float) res
+ .getInteger(com.android.internal.R.integer.thumbnail_width_tv) /
+ (float) globalConfig.screenWidthDp;
+ } else {
+ mFullscreenThumbnailScale = res.getFraction(
+ com.android.internal.R.fraction.thumbnail_fullscreen_scale, 1, 1);
+ }
+ mWaitForNetworkTimeoutMs = waitForNetworkTimeoutMs;
}
}
- /** Loads resources after the current configuration has been set. */
- private void loadResourcesOnSystemReady() {
- final Resources res = mContext.getResources();
- mHasRecents = res.getBoolean(com.android.internal.R.bool.config_hasRecents);
- mThumbnailWidth = res.getDimensionPixelSize(com.android.internal.R.dimen.thumbnail_width);
- mThumbnailHeight = res.getDimensionPixelSize(com.android.internal.R.dimen.thumbnail_height);
- }
-
- public boolean testIsSystemReady() {
- // no need to synchronize(this) just to read & return the value
- return mSystemReady;
- }
+ public void systemReady(final Runnable goingCallback, TimingsTraceLog traceLog) {
+ traceLog.traceBegin("PhaseActivityManagerReady");
+ synchronized(this) {
+ if (mSystemReady) {
+ // If we're done calling all the receivers, run the next "boot phase" passed in
+ // by the SystemServer
+ if (goingCallback != null) {
+ goingCallback.run();
+ }
+ return;
+ }
- private static File getCalledPreBootReceiversFile() {
- File dataDir = Environment.getDataDirectory();
- File systemDir = new File(dataDir, "system");
- File fname = new File(systemDir, CALLED_PRE_BOOTS_FILENAME);
- return fname;
- }
+ mLocalDeviceIdleController
+ = LocalServices.getService(DeviceIdleController.LocalService.class);
+ mAssistUtils = new AssistUtils(mContext);
+ mVrController.onSystemReady();
+ // Make sure we have the current profile info, since it is needed for security checks.
+ mUserController.onSystemReady();
+ mRecentTasks.onSystemReadyLocked();
+ mAppOpsService.systemReady();
+ mSystemReady = true;
+ }
- private static ArrayList<ComponentName> readLastDonePreBootReceivers() {
- ArrayList<ComponentName> lastDoneReceivers = new ArrayList<ComponentName>();
- File file = getCalledPreBootReceiversFile();
- FileInputStream fis = null;
try {
- fis = new FileInputStream(file);
- DataInputStream dis = new DataInputStream(new BufferedInputStream(fis, 2048));
- int fvers = dis.readInt();
- if (fvers == LAST_PREBOOT_DELIVERED_FILE_VERSION) {
- String vers = dis.readUTF();
- String codename = dis.readUTF();
- String build = dis.readUTF();
- if (android.os.Build.VERSION.RELEASE.equals(vers)
- && android.os.Build.VERSION.CODENAME.equals(codename)
- && android.os.Build.VERSION.INCREMENTAL.equals(build)) {
- int num = dis.readInt();
- while (num > 0) {
- num--;
- String pkg = dis.readUTF();
- String cls = dis.readUTF();
- lastDoneReceivers.add(new ComponentName(pkg, cls));
+ sTheRealBuildSerial = IDeviceIdentifiersPolicyService.Stub.asInterface(
+ ServiceManager.getService(Context.DEVICE_IDENTIFIERS_SERVICE))
+ .getSerial();
+ } catch (RemoteException e) {}
+
+ ArrayList<ProcessRecord> procsToKill = null;
+ synchronized(mPidsSelfLocked) {
+ for (int i=mPidsSelfLocked.size()-1; i>=0; i--) {
+ ProcessRecord proc = mPidsSelfLocked.valueAt(i);
+ if (!isAllowedWhileBooting(proc.info)){
+ if (procsToKill == null) {
+ procsToKill = new ArrayList<ProcessRecord>();
}
- }
- }
- } catch (FileNotFoundException e) {
- } catch (IOException e) {
- Slog.w(TAG, "Failure reading last done pre-boot receivers", e);
- } finally {
- if (fis != null) {
- try {
- fis.close();
- } catch (IOException e) {
- }
- }
- }
- return lastDoneReceivers;
- }
-
- private static void writeLastDonePreBootReceivers(ArrayList<ComponentName> list) {
- File file = getCalledPreBootReceiversFile();
- FileOutputStream fos = null;
- DataOutputStream dos = null;
- try {
- fos = new FileOutputStream(file);
- dos = new DataOutputStream(new BufferedOutputStream(fos, 2048));
- dos.writeInt(LAST_PREBOOT_DELIVERED_FILE_VERSION);
- dos.writeUTF(android.os.Build.VERSION.RELEASE);
- dos.writeUTF(android.os.Build.VERSION.CODENAME);
- dos.writeUTF(android.os.Build.VERSION.INCREMENTAL);
- dos.writeInt(list.size());
- for (int i=0; i<list.size(); i++) {
- dos.writeUTF(list.get(i).getPackageName());
- dos.writeUTF(list.get(i).getClassName());
- }
- } catch (IOException e) {
- Slog.w(TAG, "Failure writing last done pre-boot receivers", e);
- file.delete();
- } finally {
- FileUtils.sync(fos);
- if (dos != null) {
- try {
- dos.close();
- } catch (IOException e) {
- // TODO Auto-generated catch block
- e.printStackTrace();
- }
- }
- }
- }
-
- final class PreBootContinuation extends IIntentReceiver.Stub {
- final Intent intent;
- final Runnable onFinishCallback;
- final ArrayList<ComponentName> doneReceivers;
- final List<ResolveInfo> ris;
- final int[] users;
- int lastRi = -1;
- int curRi = 0;
- int curUser = 0;
-
- PreBootContinuation(Intent _intent, Runnable _onFinishCallback,
- ArrayList<ComponentName> _doneReceivers, List<ResolveInfo> _ris, int[] _users) {
- intent = _intent;
- onFinishCallback = _onFinishCallback;
- doneReceivers = _doneReceivers;
- ris = _ris;
- users = _users;
- }
-
- void go() {
- if (lastRi != curRi) {
- ActivityInfo ai = ris.get(curRi).activityInfo;
- ComponentName comp = new ComponentName(ai.packageName, ai.name);
- intent.setComponent(comp);
- doneReceivers.add(comp);
- lastRi = curRi;
- CharSequence label = ai.loadLabel(mContext.getPackageManager());
- showBootMessage(mContext.getString(R.string.android_preparing_apk, label), false);
- }
- Slog.i(TAG, "Pre-boot of " + intent.getComponent().toShortString()
- + " for user " + users[curUser]);
- EventLogTags.writeAmPreBoot(users[curUser], intent.getComponent().getPackageName());
- broadcastIntentLocked(null, null, intent, null, this,
- 0, null, null, null, AppOpsManager.OP_NONE,
- null, true, false, MY_PID, Process.SYSTEM_UID, users[curUser]);
- }
-
- public void performReceive(Intent intent, int resultCode,
- String data, Bundle extras, boolean ordered,
- boolean sticky, int sendingUser) {
- curUser++;
- if (curUser >= users.length) {
- curUser = 0;
- curRi++;
- if (curRi >= ris.size()) {
- // All done sending broadcasts!
- if (onFinishCallback != null) {
- // The raw IIntentReceiver interface is called
- // with the AM lock held, so redispatch to
- // execute our code without the lock.
- mHandler.post(onFinishCallback);
- }
- return;
- }
- }
- go();
- }
- }
-
- private boolean deliverPreBootCompleted(final Runnable onFinishCallback,
- ArrayList<ComponentName> doneReceivers, int userId) {
- Intent intent = new Intent(Intent.ACTION_PRE_BOOT_COMPLETED);
- List<ResolveInfo> ris = null;
- try {
- ris = AppGlobals.getPackageManager().queryIntentReceivers(
- intent, null, 0, userId);
- } catch (RemoteException e) {
- }
- if (ris == null) {
- return false;
- }
- for (int i=ris.size()-1; i>=0; i--) {
- if ((ris.get(i).activityInfo.applicationInfo.flags
- &ApplicationInfo.FLAG_SYSTEM) == 0) {
- ris.remove(i);
- }
- }
- intent.addFlags(Intent.FLAG_RECEIVER_BOOT_UPGRADE);
-
- // For User 0, load the version number. When delivering to a new user, deliver
- // to all receivers.
- if (userId == UserHandle.USER_OWNER) {
- ArrayList<ComponentName> lastDoneReceivers = readLastDonePreBootReceivers();
- for (int i=0; i<ris.size(); i++) {
- ActivityInfo ai = ris.get(i).activityInfo;
- ComponentName comp = new ComponentName(ai.packageName, ai.name);
- if (lastDoneReceivers.contains(comp)) {
- // We already did the pre boot receiver for this app with the current
- // platform version, so don't do it again...
- ris.remove(i);
- i--;
- // ...however, do keep it as one that has been done, so we don't
- // forget about it when rewriting the file of last done receivers.
- doneReceivers.add(comp);
- }
- }
- }
-
- if (ris.size() <= 0) {
- return false;
- }
-
- // If primary user, send broadcast to all available users, else just to userId
- final int[] users = userId == UserHandle.USER_OWNER ? getUsersLocked()
- : new int[] { userId };
- if (users.length <= 0) {
- return false;
- }
-
- PreBootContinuation cont = new PreBootContinuation(intent, onFinishCallback, doneReceivers,
- ris, users);
- cont.go();
- return true;
- }
-
- public void systemReady(final Runnable goingCallback) {
- synchronized(this) {
- if (mSystemReady) {
- // If we're done calling all the receivers, run the next "boot phase" passed in
- // by the SystemServer
- if (goingCallback != null) {
- goingCallback.run();
- }
- return;
- }
-
- mLocalDeviceIdleController
- = LocalServices.getService(DeviceIdleController.LocalService.class);
-
- // Make sure we have the current profile info, since it is needed for
- // security checks.
- updateCurrentProfileIdsLocked();
-
- mRecentTasks.clear();
- mRecentTasks.addAll(mTaskPersister.restoreTasksLocked());
- mRecentTasks.cleanupLocked(UserHandle.USER_ALL);
- mTaskPersister.startPersisting();
-
- // Check to see if there are any update receivers to run.
- if (!mDidUpdate) {
- if (mWaitingUpdate) {
- return;
- }
- final ArrayList<ComponentName> doneReceivers = new ArrayList<ComponentName>();
- mWaitingUpdate = deliverPreBootCompleted(new Runnable() {
- public void run() {
- synchronized (ActivityManagerService.this) {
- mDidUpdate = true;
- }
- showBootMessage(mContext.getText(
- R.string.android_upgrading_complete),
- false);
- writeLastDonePreBootReceivers(doneReceivers);
- systemReady(goingCallback);
- }
- }, doneReceivers, UserHandle.USER_OWNER);
-
- if (mWaitingUpdate) {
- return;
- }
- mDidUpdate = true;
- }
-
- mAppOpsService.systemReady();
- mSystemReady = true;
- }
-
- ArrayList<ProcessRecord> procsToKill = null;
- synchronized(mPidsSelfLocked) {
- for (int i=mPidsSelfLocked.size()-1; i>=0; i--) {
- ProcessRecord proc = mPidsSelfLocked.valueAt(i);
- if (!isAllowedWhileBooting(proc.info)){
- if (procsToKill == null) {
- procsToKill = new ArrayList<ProcessRecord>();
- }
- procsToKill.add(proc);
+ procsToKill.add(proc);
}
}
}
mTopData = null;
mTopComponent = null;
Message msg = Message.obtain();
- msg.what = SHOW_FACTORY_ERROR_MSG;
+ msg.what = SHOW_FACTORY_ERROR_UI_MSG;
msg.getData().putCharSequence("msg", errorMsg);
mUiHandler.sendMessage(msg);
}
}
retrieveSettings();
- loadResourcesOnSystemReady();
-
+ final int currentUserId;
synchronized (this) {
+ currentUserId = mUserController.getCurrentUserIdLocked();
readGrantedUriPermissionsLocked();
}
if (goingCallback != null) goingCallback.run();
-
+ traceLog.traceBegin("ActivityManagerStartApps");
mBatteryStatsService.noteEvent(BatteryStats.HistoryItem.EVENT_USER_RUNNING_START,
- Integer.toString(mCurrentUserId), mCurrentUserId);
+ Integer.toString(currentUserId), currentUserId);
mBatteryStatsService.noteEvent(BatteryStats.HistoryItem.EVENT_USER_FOREGROUND_START,
- Integer.toString(mCurrentUserId), mCurrentUserId);
- mSystemServiceManager.startUser(mCurrentUserId);
+ Integer.toString(currentUserId), currentUserId);
+ mSystemServiceManager.startUser(currentUserId);
synchronized (this) {
- if (mFactoryTest != FactoryTest.FACTORY_TEST_LOW_LEVEL) {
- try {
- List apps = AppGlobals.getPackageManager().
- getPersistentApplications(STOCK_PM_FLAGS);
- if (apps != null) {
- int N = apps.size();
- int i;
- for (i=0; i<N; i++) {
- ApplicationInfo info
- = (ApplicationInfo)apps.get(i);
- if (info != null &&
- !info.packageName.equals("android")) {
- addAppLocked(info, false, null /* ABI override */);
- }
- }
- }
- } catch (RemoteException ex) {
- // pm is in same process, this will never happen.
- }
- }
+ // Only start up encryption-aware persistent apps; once user is
+ // unlocked we'll come back around and start unaware apps
+ startPersistentApps(PackageManager.MATCH_DIRECT_BOOT_AWARE);
// Start up initial activity.
mBooting = true;
- startHomeActivityLocked(mCurrentUserId, "systemReady");
+ // Enable home activity for system user, so that the system can always boot. We don't
+ // do this when the system user is not setup since the setup wizard should be the one
+ // to handle home activity in this case.
+ if (UserManager.isSplitSystemUser() &&
+ Settings.Secure.getInt(mContext.getContentResolver(),
+ Settings.Secure.USER_SETUP_COMPLETE, 0) != 0) {
+ ComponentName cName = new ComponentName(mContext, SystemUserHomeActivity.class);
+ try {
+ AppGlobals.getPackageManager().setComponentEnabledSetting(cName,
+ PackageManager.COMPONENT_ENABLED_STATE_ENABLED, 0,
+ UserHandle.USER_SYSTEM);
+ } catch (RemoteException e) {
+ throw e.rethrowAsRuntimeException();
+ }
+ }
+ startHomeActivityLocked(currentUserId, "systemReady");
try {
if (AppGlobals.getPackageManager().hasSystemUidErrors()) {
Slog.e(TAG, "UIDs on the system are inconsistent, you need to wipe your"
+ " data partition or your device will be unstable.");
- mUiHandler.obtainMessage(SHOW_UID_ERROR_MSG).sendToTarget();
+ mUiHandler.obtainMessage(SHOW_UID_ERROR_UI_MSG).sendToTarget();
}
} catch (RemoteException e) {
}
if (!Build.isBuildConsistent()) {
Slog.e(TAG, "Build fingerprint is not consistent, warning user");
- mUiHandler.obtainMessage(SHOW_FINGERPRINT_ERROR_MSG).sendToTarget();
+ mUiHandler.obtainMessage(SHOW_FINGERPRINT_ERROR_UI_MSG).sendToTarget();
}
long ident = Binder.clearCallingIdentity();
Intent intent = new Intent(Intent.ACTION_USER_STARTED);
intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY
| Intent.FLAG_RECEIVER_FOREGROUND);
- intent.putExtra(Intent.EXTRA_USER_HANDLE, mCurrentUserId);
+ intent.putExtra(Intent.EXTRA_USER_HANDLE, currentUserId);
broadcastIntentLocked(null, null, intent,
null, null, 0, null, null, null, AppOpsManager.OP_NONE,
- null, false, false, MY_PID, Process.SYSTEM_UID, mCurrentUserId);
+ null, false, false, MY_PID, SYSTEM_UID,
+ currentUserId);
intent = new Intent(Intent.ACTION_USER_STARTING);
intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY);
- intent.putExtra(Intent.EXTRA_USER_HANDLE, mCurrentUserId);
+ intent.putExtra(Intent.EXTRA_USER_HANDLE, currentUserId);
broadcastIntentLocked(null, null, intent,
null, new IIntentReceiver.Stub() {
@Override
}
}, 0, null, null,
new String[] {INTERACT_ACROSS_USERS}, AppOpsManager.OP_NONE,
- null, true, false, MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
+ null, true, false, MY_PID, SYSTEM_UID, UserHandle.USER_ALL);
} catch (Throwable t) {
Slog.wtf(TAG, "Failed sending first user broadcasts", t);
} finally {
Binder.restoreCallingIdentity(ident);
}
- mStackSupervisor.resumeTopActivitiesLocked();
- sendUserSwitchBroadcastsLocked(-1, mCurrentUserId);
+ mStackSupervisor.resumeFocusedStackTopActivityLocked();
+ mUserController.sendUserSwitchBroadcastsLocked(-1, currentUserId);
+ traceLog.traceEnd(); // ActivityManagerStartApps
+ traceLog.traceEnd(); // PhaseActivityManagerReady
}
}
- private boolean makeAppCrashingLocked(ProcessRecord app,
- String shortMsg, String longMsg, String stackTrace) {
- app.crashing = true;
- app.crashingReport = generateProcessError(app,
- ActivityManager.ProcessErrorStateInfo.CRASHED, null, shortMsg, longMsg, stackTrace);
- startAppProblemLocked(app);
- app.stopFreezingAllLocked();
- return handleAppCrashLocked(app, "force-crash" /*reason*/, shortMsg, longMsg, stackTrace);
- }
-
- private void makeAppNotRespondingLocked(ProcessRecord app,
- String activity, String shortMsg, String longMsg) {
- app.notResponding = true;
- app.notRespondingReport = generateProcessError(app,
- ActivityManager.ProcessErrorStateInfo.NOT_RESPONDING,
- activity, shortMsg, longMsg, null);
- startAppProblemLocked(app);
- app.stopFreezingAllLocked();
- }
-
- /**
- * Generate a process error record, suitable for attachment to a ProcessRecord.
- *
- * @param app The ProcessRecord in which the error occurred.
- * @param condition Crashing, Application Not Responding, etc. Values are defined in
- * ActivityManager.AppErrorStateInfo
- * @param activity The activity associated with the crash, if known.
- * @param shortMsg Short message describing the crash.
- * @param longMsg Long message describing the crash.
- * @param stackTrace Full crash stack trace, may be null.
- *
- * @return Returns a fully-formed AppErrorStateInfo record.
- */
- private ActivityManager.ProcessErrorStateInfo generateProcessError(ProcessRecord app,
- int condition, String activity, String shortMsg, String longMsg, String stackTrace) {
- ActivityManager.ProcessErrorStateInfo report = new ActivityManager.ProcessErrorStateInfo();
-
- report.condition = condition;
- report.processName = app.processName;
- report.pid = app.pid;
- report.uid = app.info.uid;
- report.tag = activity;
- report.shortMsg = shortMsg;
- report.longMsg = longMsg;
- report.stackTrace = stackTrace;
-
- return report;
- }
-
void killAppAtUsersRequest(ProcessRecord app, Dialog fromDialog) {
synchronized (this) {
- app.crashing = false;
- app.crashingReport = null;
- app.notResponding = false;
- app.notRespondingReport = null;
- if (app.anrDialog == fromDialog) {
- app.anrDialog = null;
- }
- if (app.waitDialog == fromDialog) {
- app.waitDialog = null;
- }
- if (app.pid > 0 && app.pid != MY_PID) {
- handleAppCrashLocked(app, "user-terminated" /*reason*/,
- null /*shortMsg*/, null /*longMsg*/, null /*stackTrace*/);
- app.kill("user request after error", true);
- }
- }
- }
-
- private boolean handleAppCrashLocked(ProcessRecord app, String reason,
- String shortMsg, String longMsg, String stackTrace) {
- long now = SystemClock.uptimeMillis();
-
- Long crashTime;
- if (!app.isolated) {
- crashTime = mProcessCrashTimes.get(app.info.processName, app.uid);
- } else {
- crashTime = null;
- }
- if (crashTime != null && now < crashTime+ProcessList.MIN_CRASH_INTERVAL) {
- // This process loses!
- Slog.w(TAG, "Process " + app.info.processName
- + " has crashed too many times: killing!");
- EventLog.writeEvent(EventLogTags.AM_PROCESS_CRASHED_TOO_MUCH,
- app.userId, app.info.processName, app.uid);
- mStackSupervisor.handleAppCrashLocked(app);
- if (!app.persistent) {
- // We don't want to start this process again until the user
- // explicitly does so... but for persistent process, we really
- // need to keep it running. If a persistent process is actually
- // repeatedly crashing, then badness for everyone.
- EventLog.writeEvent(EventLogTags.AM_PROC_BAD, app.userId, app.uid,
- app.info.processName);
- if (!app.isolated) {
- // XXX We don't have a way to mark isolated processes
- // as bad, since they don't have a peristent identity.
- mBadProcesses.put(app.info.processName, app.uid,
- new BadProcessInfo(now, shortMsg, longMsg, stackTrace));
- mProcessCrashTimes.remove(app.info.processName, app.uid);
- }
- app.bad = true;
- app.removed = true;
- // Don't let services in this process be restarted and potentially
- // annoy the user repeatedly. Unless it is persistent, since those
- // processes run critical code.
- removeProcessLocked(app, false, false, "crash");
- mStackSupervisor.resumeTopActivitiesLocked();
- return false;
- }
- mStackSupervisor.resumeTopActivitiesLocked();
- } else {
- mStackSupervisor.finishTopRunningActivityLocked(app, reason);
- }
-
- // Bump up the crash count of any services currently running in the proc.
- for (int i=app.services.size()-1; i>=0; i--) {
- // Any services running in the application need to be placed
- // back in the pending list.
- ServiceRecord sr = app.services.valueAt(i);
- sr.crashCount++;
- }
-
- // If the crashing process is what we consider to be the "home process" and it has been
- // replaced by a third-party app, clear the package preferred activities from packages
- // with a home activity running in the process to prevent a repeatedly crashing app
- // from blocking the user to manually clear the list.
- final ArrayList<ActivityRecord> activities = app.activities;
- if (app == mHomeProcess && activities.size() > 0
- && (mHomeProcess.info.flags & ApplicationInfo.FLAG_SYSTEM) == 0) {
- for (int activityNdx = activities.size() - 1; activityNdx >= 0; --activityNdx) {
- final ActivityRecord r = activities.get(activityNdx);
- if (r.isHomeActivity()) {
- Log.i(TAG, "Clearing package preferred activities from " + r.packageName);
- try {
- ActivityThread.getPackageManager()
- .clearPackagePreferredActivities(r.packageName);
- } catch (RemoteException c) {
- // pm is in same process, this will never happen.
- }
- }
- }
- }
-
- if (!app.isolated) {
- // XXX Can't keep track of crash times for isolated processes,
- // because they don't have a perisistent identity.
- mProcessCrashTimes.put(app.info.processName, app.uid, now);
- }
-
- if (app.crashHandler != null) mHandler.post(app.crashHandler);
- return true;
- }
-
- void startAppProblemLocked(ProcessRecord app) {
- // If this app is not running under the current user, then we
- // can't give it a report button because that would require
- // launching the report UI under a different user.
- app.errorReportReceiver = null;
-
- for (int userId : mCurrentProfileIds) {
- if (app.userId == userId) {
- app.errorReportReceiver = ApplicationErrorReport.getErrorReportReceiver(
- mContext, app.info.packageName, app.info.flags);
- }
+ mAppErrors.killAppAtUserRequestLocked(app, fromDialog);
}
- skipCurrentReceiverLocked(app);
}
void skipCurrentReceiverLocked(ProcessRecord app) {
* @param app object of the crashing app, null for the system server
* @param crashInfo describing the exception
*/
- public void handleApplicationCrash(IBinder app, ApplicationErrorReport.CrashInfo crashInfo) {
+ public void handleApplicationCrash(IBinder app,
+ ApplicationErrorReport.ParcelableCrashInfo crashInfo) {
ProcessRecord r = findAppProcess(app, "Crash");
final String processName = app == null ? "system_server"
: (r == null ? "unknown" : r.processName);
addErrorToDropBox(eventType, r, processName, null, null, null, null, null, crashInfo);
- crashApplication(r, crashInfo);
+ mAppErrors.crashApplication(r, crashInfo);
}
public void handleApplicationStrictModeViolation(
final long origId = Binder.clearCallingIdentity();
Message msg = Message.obtain();
- msg.what = SHOW_STRICT_MODE_VIOLATION_MSG;
+ msg.what = SHOW_STRICT_MODE_VIOLATION_UI_MSG;
HashMap<String, Object> data = new HashMap<String, Object>();
data.put("result", result);
data.put("app", r);
* @return true if the process should exit immediately (WTF is fatal)
*/
public boolean handleApplicationWtf(final IBinder app, final String tag, boolean system,
- final ApplicationErrorReport.CrashInfo crashInfo) {
+ final ApplicationErrorReport.ParcelableCrashInfo crashInfo) {
final int callingUid = Binder.getCallingUid();
final int callingPid = Binder.getCallingPid();
final ProcessRecord r = handleApplicationWtfInner(callingUid, callingPid, app, tag,
crashInfo);
- if (r != null && r.pid != Process.myPid() &&
- Settings.Global.getInt(mContext.getContentResolver(),
- Settings.Global.WTF_IS_FATAL, 0) != 0) {
- crashApplication(r, crashInfo);
+ final boolean isFatal = Build.IS_ENG || Settings.Global
+ .getInt(mContext.getContentResolver(), Settings.Global.WTF_IS_FATAL, 0) != 0;
+ final boolean isSystem = (r == null) || r.persistent;
+
+ if (isFatal && !isSystem) {
+ mAppErrors.crashApplication(r, crashInfo);
return true;
} else {
return false;
// concurrently during execution of this method)
synchronized (this) {
sb.append("Process: ").append(processName).append("\n");
+ sb.append("PID: ").append(process.pid).append("\n");
int flags = process.info.flags;
IPackageManager pm = AppGlobals.getPackageManager();
- sb.append("Flags: 0x").append(Integer.toString(flags, 16)).append("\n");
+ sb.append("Flags: 0x").append(Integer.toHexString(flags)).append("\n");
for (int ip=0; ip<process.pkgList.size(); ip++) {
String pkg = process.pkgList.keyAt(ip);
sb.append("Package: ").append(pkg);
}
sb.append("\n");
}
+ if (process.info.isInstantApp()) {
+ sb.append("Instant-App: true\n");
+ }
}
}
}
}
+ private volatile long mWtfClusterStart;
+ private volatile int mWtfClusterCount;
+
/**
* Write a description of an error (crash, WTF, ANR) to the drop box.
* @param eventType to include in the drop box tag ("crash", "wtf", etc.)
* @param parent activity related to the error, null if unknown
* @param subject line related to the error, null if absent
* @param report in long form describing the error, null if absent
- * @param logFile to include in the report, null if none
+ * @param dataFile text file to include in the report, null if none
* @param crashInfo giving an application stack trace, null if absent
*/
public void addErrorToDropBox(String eventType,
ProcessRecord process, String processName, ActivityRecord activity,
ActivityRecord parent, String subject,
- final String report, final File logFile,
+ final String report, final File dataFile,
final ApplicationErrorReport.CrashInfo crashInfo) {
// NOTE -- this must never acquire the ActivityManagerService lock,
// otherwise the watchdog may be prevented from resetting the system.
- final String dropboxTag = processClass(process) + "_" + eventType;
- final DropBoxManager dbox = (DropBoxManager)
- mContext.getSystemService(Context.DROPBOX_SERVICE);
+ // Bail early if not published yet
+ if (ServiceManager.getService(Context.DROPBOX_SERVICE) == null) return;
+ final DropBoxManager dbox = mContext.getSystemService(DropBoxManager.class);
// Exit early if the dropbox isn't configured to accept this report type.
+ final String dropboxTag = processClass(process) + "_" + eventType;
if (dbox == null || !dbox.isTagEnabled(dropboxTag)) return;
+ // Rate-limit how often we're willing to do the heavy lifting below to
+ // collect and record logs; currently 5 logs per 10 second period.
+ final long now = SystemClock.elapsedRealtime();
+ if (now - mWtfClusterStart > 10 * DateUtils.SECOND_IN_MILLIS) {
+ mWtfClusterStart = now;
+ mWtfClusterCount = 1;
+ } else {
+ if (mWtfClusterCount++ >= 5) return;
+ }
+
final StringBuilder sb = new StringBuilder(1024);
appendDropBoxProcessHeaders(process, processName, sb);
+ if (process != null) {
+ sb.append("Foreground: ")
+ .append(process.isInterestingToUserLocked() ? "Yes" : "No")
+ .append("\n");
+ }
if (activity != null) {
sb.append("Activity: ").append(activity.shortComponentName).append("\n");
}
if (report != null) {
sb.append(report);
}
- if (logFile != null) {
+
+ String setting = Settings.Global.ERROR_LOGCAT_PREFIX + dropboxTag;
+ int lines = Settings.Global.getInt(mContext.getContentResolver(), setting, 0);
+ int maxDataFileSize = DROPBOX_MAX_SIZE - sb.length()
+ - lines * RESERVED_BYTES_PER_LOGCAT_LINE;
+
+ if (dataFile != null && maxDataFileSize > 0) {
try {
- sb.append(FileUtils.readTextFile(logFile, DROPBOX_MAX_SIZE,
+ sb.append(FileUtils.readTextFile(dataFile, maxDataFileSize,
"\n\n[[TRUNCATED]]"));
} catch (IOException e) {
- Slog.e(TAG, "Error reading " + logFile, e);
+ Slog.e(TAG, "Error reading " + dataFile, e);
}
}
if (crashInfo != null && crashInfo.stackTrace != null) {
sb.append(crashInfo.stackTrace);
}
- String setting = Settings.Global.ERROR_LOGCAT_PREFIX + dropboxTag;
- int lines = Settings.Global.getInt(mContext.getContentResolver(), setting, 0);
if (lines > 0) {
sb.append("\n");
// Merge several logcat streams, and take the last N lines
InputStreamReader input = null;
try {
- java.lang.Process logcat = new ProcessBuilder("/system/bin/logcat",
- "-v", "time", "-b", "events", "-b", "system", "-b", "main",
- "-b", "crash",
- "-t", String.valueOf(lines)).redirectErrorStream(true).start();
+ java.lang.Process logcat = new ProcessBuilder(
+ "/system/bin/timeout", "-k", "15s", "10s",
+ "/system/bin/logcat", "-v", "threadtime", "-b", "events", "-b", "system",
+ "-b", "main", "-b", "crash", "-t", String.valueOf(lines))
+ .redirectErrorStream(true).start();
try { logcat.getOutputStream().close(); } catch (IOException e) {}
try { logcat.getErrorStream().close(); } catch (IOException e) {}
}
}
- /**
- * Bring up the "unexpected error" dialog box for a crashing app.
- * Deal with edge cases (intercepts from instrumented applications,
- * ActivityController, error intent receivers, that sort of thing).
- * @param r the application crashing
- * @param crashInfo describing the failure
- */
- private void crashApplication(ProcessRecord r, ApplicationErrorReport.CrashInfo crashInfo) {
- long timeMillis = System.currentTimeMillis();
- String shortMsg = crashInfo.exceptionClassName;
- String longMsg = crashInfo.exceptionMessage;
- String stackTrace = crashInfo.stackTrace;
- if (shortMsg != null && longMsg != null) {
- longMsg = shortMsg + ": " + longMsg;
- } else if (shortMsg != null) {
- longMsg = shortMsg;
- }
-
- AppErrorResult result = new AppErrorResult();
- synchronized (this) {
- if (mController != null) {
- try {
- String name = r != null ? r.processName : null;
- int pid = r != null ? r.pid : Binder.getCallingPid();
- int uid = r != null ? r.info.uid : Binder.getCallingUid();
- if (!mController.appCrashed(name, pid,
- shortMsg, longMsg, timeMillis, crashInfo.stackTrace)) {
- if ("1".equals(SystemProperties.get(SYSTEM_DEBUGGABLE, "0"))
- && "Native crash".equals(crashInfo.exceptionClassName)) {
- Slog.w(TAG, "Skip killing native crashed app " + name
- + "(" + pid + ") during testing");
- } else {
- Slog.w(TAG, "Force-killing crashed app " + name
- + " at watcher's request");
- if (r != null) {
- r.kill("crash", true);
- } else {
- // Huh.
- Process.killProcess(pid);
- killProcessGroup(uid, pid);
- }
- }
- return;
- }
- } catch (RemoteException e) {
- mController = null;
- Watchdog.getInstance().setActivityController(null);
- }
- }
-
- final long origId = Binder.clearCallingIdentity();
-
- // If this process is running instrumentation, finish it.
- if (r != null && r.instrumentationClass != null) {
- Slog.w(TAG, "Error in app " + r.processName
- + " running instrumentation " + r.instrumentationClass + ":");
- if (shortMsg != null) Slog.w(TAG, " " + shortMsg);
- if (longMsg != null) Slog.w(TAG, " " + longMsg);
- Bundle info = new Bundle();
- info.putString("shortMsg", shortMsg);
- info.putString("longMsg", longMsg);
- finishInstrumentationLocked(r, Activity.RESULT_CANCELED, info);
- Binder.restoreCallingIdentity(origId);
- return;
- }
-
- // Log crash in battery stats.
- if (r != null) {
- mBatteryStatsService.noteProcessCrash(r.processName, r.uid);
- }
-
- // If we can't identify the process or it's already exceeded its crash quota,
- // quit right away without showing a crash dialog.
- if (r == null || !makeAppCrashingLocked(r, shortMsg, longMsg, stackTrace)) {
- Binder.restoreCallingIdentity(origId);
- return;
- }
-
- Message msg = Message.obtain();
- msg.what = SHOW_ERROR_MSG;
- HashMap data = new HashMap();
- data.put("result", result);
- data.put("app", r);
- msg.obj = data;
- mUiHandler.sendMessage(msg);
-
- Binder.restoreCallingIdentity(origId);
- }
-
- int res = result.get();
-
- Intent appErrorIntent = null;
- synchronized (this) {
- if (r != null && !r.isolated) {
- // XXX Can't keep track of crash time for isolated processes,
- // since they don't have a persistent identity.
- mProcessCrashTimes.put(r.info.processName, r.uid,
- SystemClock.uptimeMillis());
- }
- if (res == AppErrorDialog.FORCE_QUIT_AND_REPORT) {
- appErrorIntent = createAppErrorIntentLocked(r, timeMillis, crashInfo);
- }
- }
-
- if (appErrorIntent != null) {
- try {
- mContext.startActivityAsUser(appErrorIntent, new UserHandle(r.userId));
- } catch (ActivityNotFoundException e) {
- Slog.w(TAG, "bug report receiver dissappeared", e);
- }
- }
- }
-
- Intent createAppErrorIntentLocked(ProcessRecord r,
- long timeMillis, ApplicationErrorReport.CrashInfo crashInfo) {
- ApplicationErrorReport report = createAppErrorReportLocked(r, timeMillis, crashInfo);
- if (report == null) {
- return null;
- }
- Intent result = new Intent(Intent.ACTION_APP_ERROR);
- result.setComponent(r.errorReportReceiver);
- result.putExtra(Intent.EXTRA_BUG_REPORT, report);
- result.addFlags(Intent.FLAG_ACTIVITY_NEW_TASK);
- return result;
- }
-
- private ApplicationErrorReport createAppErrorReportLocked(ProcessRecord r,
- long timeMillis, ApplicationErrorReport.CrashInfo crashInfo) {
- if (r.errorReportReceiver == null) {
- return null;
- }
-
- if (!r.crashing && !r.notResponding && !r.forceCrashReport) {
- return null;
- }
-
- ApplicationErrorReport report = new ApplicationErrorReport();
- report.packageName = r.info.packageName;
- report.installerPackageName = r.errorReportReceiver.getPackageName();
- report.processName = r.processName;
- report.time = timeMillis;
- report.systemApp = (r.info.flags & ApplicationInfo.FLAG_SYSTEM) != 0;
-
- if (r.crashing || r.forceCrashReport) {
- report.type = ApplicationErrorReport.TYPE_CRASH;
- report.crashInfo = crashInfo;
- } else if (r.notResponding) {
- report.type = ApplicationErrorReport.TYPE_ANR;
- report.anrInfo = new ApplicationErrorReport.AnrInfo();
-
- report.anrInfo.activity = r.notRespondingReport.tag;
- report.anrInfo.cause = r.notRespondingReport.shortMsg;
- report.anrInfo.info = r.notRespondingReport.longMsg;
- }
-
- return report;
- }
-
+ @Override
public List<ActivityManager.ProcessErrorStateInfo> getProcessesInErrorState() {
enforceNotIsolatedCaller("getProcessesInErrorState");
// assume our apps are happy - lazy create the list
}
static int procStateToImportance(int procState, int memAdj,
- ActivityManager.RunningAppProcessInfo currApp) {
- int imp = ActivityManager.RunningAppProcessInfo.procStateToImportance(procState);
+ ActivityManager.RunningAppProcessInfo currApp,
+ int clientTargetSdk) {
+ int imp = ActivityManager.RunningAppProcessInfo.procStateToImportanceForTargetSdk(
+ procState, clientTargetSdk);
if (imp == ActivityManager.RunningAppProcessInfo.IMPORTANCE_BACKGROUND) {
currApp.lru = memAdj;
} else {
}
private void fillInProcMemInfo(ProcessRecord app,
- ActivityManager.RunningAppProcessInfo outInfo) {
+ ActivityManager.RunningAppProcessInfo outInfo,
+ int clientTargetSdk) {
outInfo.pid = app.pid;
outInfo.uid = app.info.uid;
if (mHeavyWeightProcess == app) {
outInfo.lastTrimLevel = app.trimMemoryLevel;
int adj = app.curAdj;
int procState = app.curProcState;
- outInfo.importance = procStateToImportance(procState, adj, outInfo);
+ outInfo.importance = procStateToImportance(procState, adj, outInfo, clientTargetSdk);
outInfo.importanceReasonCode = app.adjTypeCode;
outInfo.processState = app.curProcState;
}
+ @Override
public List<ActivityManager.RunningAppProcessInfo> getRunningAppProcesses() {
enforceNotIsolatedCaller("getRunningAppProcesses");
final int callingUid = Binder.getCallingUid();
+ final int clientTargetSdk = mPackageManagerInt.getUidTargetSdkVersion(callingUid);
// Lazy instantiation of list
List<ActivityManager.RunningAppProcessInfo> runList = null;
ActivityManager.RunningAppProcessInfo currApp =
new ActivityManager.RunningAppProcessInfo(app.processName,
app.pid, app.getPackageList());
- fillInProcMemInfo(app, currApp);
+ fillInProcMemInfo(app, currApp, clientTargetSdk);
if (app.adjSource instanceof ProcessRecord) {
currApp.importanceReasonPid = ((ProcessRecord)app.adjSource).pid;
currApp.importanceReasonImportance =
return runList;
}
+ @Override
public List<ApplicationInfo> getRunningExternalApplications() {
enforceNotIsolatedCaller("getRunningExternalApplications");
List<ActivityManager.RunningAppProcessInfo> runningApps = getRunningAppProcesses();
@Override
public void getMyMemoryState(ActivityManager.RunningAppProcessInfo outInfo) {
enforceNotIsolatedCaller("getMyMemoryState");
+
+ final int callingUid = Binder.getCallingUid();
+ final int clientTargetSdk = mPackageManagerInt.getUidTargetSdkVersion(callingUid);
+
synchronized (this) {
ProcessRecord proc;
synchronized (mPidsSelfLocked) {
proc = mPidsSelfLocked.get(Binder.getCallingPid());
}
- fillInProcMemInfo(proc, outInfo);
+ fillInProcMemInfo(proc, outInfo, clientTargetSdk);
}
}
@Override
- protected void dump(FileDescriptor fd, PrintWriter pw, String[] args) {
- if (checkCallingPermission(android.Manifest.permission.DUMP)
- != PackageManager.PERMISSION_GRANTED) {
- pw.println("Permission Denial: can't dump ActivityManager from from pid="
- + Binder.getCallingPid()
- + ", uid=" + Binder.getCallingUid()
- + " without permission "
- + android.Manifest.permission.DUMP);
- return;
+ public int getMemoryTrimLevel() {
+ enforceNotIsolatedCaller("getMyMemoryState");
+ synchronized (this) {
+ return mLastMemoryLevel;
+ }
+ }
+
+ @Override
+ public void onShellCommand(FileDescriptor in, FileDescriptor out,
+ FileDescriptor err, String[] args, ShellCallback callback,
+ ResultReceiver resultReceiver) {
+ (new ActivityManagerShellCommand(this, false)).exec(
+ this, in, out, err, args, callback, resultReceiver);
+ }
+
+ SleepToken acquireSleepToken(String tag, int displayId) {
+ synchronized (this) {
+ final SleepToken token = mStackSupervisor.createSleepTokenLocked(tag, displayId);
+ updateSleepIfNeededLocked();
+ return token;
}
+ }
+
+ @Override
+ protected void dump(FileDescriptor fd, PrintWriter pw, String[] args) {
+ if (!DumpUtils.checkDumpAndUsageStatsPermission(mContext, TAG, pw)) return;
boolean dumpAll = false;
boolean dumpClient = false;
+ boolean dumpCheckin = false;
+ boolean dumpCheckinFormat = false;
+ boolean dumpVisibleStacksOnly = false;
+ boolean dumpFocusedStackOnly = false;
String dumpPackage = null;
int opti = 0;
dumpAll = true;
} else if ("-c".equals(opt)) {
dumpClient = true;
+ } else if ("-v".equals(opt)) {
+ dumpVisibleStacksOnly = true;
+ } else if ("-f".equals(opt)) {
+ dumpFocusedStackOnly = true;
} else if ("-p".equals(opt)) {
if (opti < args.length) {
dumpPackage = args[opti];
return;
}
dumpClient = true;
+ } else if ("--checkin".equals(opt)) {
+ dumpCheckin = dumpCheckinFormat = true;
+ } else if ("-C".equals(opt)) {
+ dumpCheckinFormat = true;
} else if ("-h".equals(opt)) {
- pw.println("Activity manager dump options:");
- pw.println(" [-a] [-c] [-p package] [-h] [cmd] ...");
- pw.println(" cmd may be one of:");
- pw.println(" a[ctivities]: activity stack state");
- pw.println(" r[recents]: recent activities state");
- pw.println(" b[roadcasts] [PACKAGE_NAME] [history [-s]]: broadcast state");
- pw.println(" i[ntents] [PACKAGE_NAME]: pending intent state");
- pw.println(" p[rocesses] [PACKAGE_NAME]: process state");
- pw.println(" o[om]: out of memory management");
- pw.println(" perm[issions]: URI permission grant state");
- pw.println(" prov[iders] [COMP_SPEC ...]: content provider state");
- pw.println(" provider [COMP_SPEC]: provider client-side state");
- pw.println(" s[ervices] [COMP_SPEC ...]: service state");
- pw.println(" as[sociations]: tracked app associations");
- pw.println(" service [COMP_SPEC]: service client-side state");
- pw.println(" package [PACKAGE_NAME]: all state related to given package");
- pw.println(" all: dump all activities");
- pw.println(" top: dump the top activity");
- pw.println(" write: write all pending state to storage");
- pw.println(" track-associations: enable association tracking");
- pw.println(" untrack-associations: disable and clear association tracking");
- pw.println(" cmd may also be a COMP_SPEC to dump activities.");
- pw.println(" COMP_SPEC may be a component name (com.foo/.myApp),");
- pw.println(" a partial substring in a component name, a");
- pw.println(" hex object identifier.");
- pw.println(" -a: include all available server state.");
- pw.println(" -c: include client state.");
- pw.println(" -p: limit output to given package.");
+ ActivityManagerShellCommand.dumpHelp(pw, true);
return;
} else {
pw.println("Unknown argument: " + opt + "; use -h for help");
synchronized (this) {
dumpActivitiesLocked(fd, pw, args, opti, true, dumpClient, dumpPackage);
}
+ } else if ("lastanr".equals(cmd)) {
+ synchronized (this) {
+ dumpLastANRLocked(pw);
+ }
+ } else if ("starter".equals(cmd)) {
+ synchronized (this) {
+ dumpActivityStarterLocked(pw, dumpPackage);
+ }
} else if ("recents".equals(cmd) || "r".equals(cmd)) {
synchronized (this) {
dumpRecentsLocked(fd, pw, args, opti, true, dumpPackage);
synchronized (this) {
dumpBroadcastsLocked(fd, pw, args, opti, true, dumpPackage);
}
- } else if ("intents".equals(cmd) || "i".equals(cmd)) {
+ } else if ("broadcast-stats".equals(cmd)) {
String[] newArgs;
String name;
if (opti >= args.length) {
args.length - opti);
}
synchronized (this) {
- dumpPendingIntentsLocked(fd, pw, args, opti, true, dumpPackage);
+ if (dumpCheckinFormat) {
+ dumpBroadcastStatsCheckinLocked(fd, pw, args, opti, dumpCheckin,
+ dumpPackage);
+ } else {
+ dumpBroadcastStatsLocked(fd, pw, args, opti, true, dumpPackage);
+ }
}
- } else if ("processes".equals(cmd) || "p".equals(cmd)) {
+ } else if ("intents".equals(cmd) || "i".equals(cmd)) {
String[] newArgs;
String name;
if (opti >= args.length) {
args.length - opti);
}
synchronized (this) {
- dumpProcessesLocked(fd, pw, args, opti, true, dumpPackage);
- }
- } else if ("oom".equals(cmd) || "o".equals(cmd)) {
- synchronized (this) {
- dumpOomLocked(fd, pw, args, opti, true);
+ dumpPendingIntentsLocked(fd, pw, args, opti, true, dumpPackage);
}
- } else if ("permissions".equals(cmd) || "perm".equals(cmd)) {
+ } else if ("processes".equals(cmd) || "p".equals(cmd)) {
+ String[] newArgs;
+ String name;
+ if (opti >= args.length) {
+ name = null;
+ newArgs = EMPTY_STRING_ARRAY;
+ } else {
+ dumpPackage = args[opti];
+ opti++;
+ newArgs = new String[args.length - opti];
+ if (args.length > 2) System.arraycopy(args, opti, newArgs, 0,
+ args.length - opti);
+ }
+ synchronized (this) {
+ dumpProcessesLocked(fd, pw, args, opti, true, dumpPackage);
+ }
+ } else if ("oom".equals(cmd) || "o".equals(cmd)) {
+ synchronized (this) {
+ dumpOomLocked(fd, pw, args, opti, true);
+ }
+ } else if ("permissions".equals(cmd) || "perm".equals(cmd)) {
synchronized (this) {
dumpPermissionsLocked(fd, pw, args, opti, true, null);
}
synchronized (this) {
dumpAssociationsLocked(fd, pw, args, opti, true, dumpClient, dumpPackage);
}
- } else if ("services".equals(cmd) || "s".equals(cmd)) {
+ } else if ("settings".equals(cmd)) {
synchronized (this) {
- mServices.dumpServicesLocked(fd, pw, args, opti, true, dumpClient, dumpPackage);
+ mConstants.dump(pw);
}
- } else if ("write".equals(cmd)) {
- mTaskPersister.flush();
- pw.println("All tasks persisted.");
- return;
- } else if ("track-associations".equals(cmd)) {
- synchronized (this) {
- if (!mTrackingAssociations) {
- mTrackingAssociations = true;
- pw.println("Association tracking started.");
- } else {
- pw.println("Association tracking already enabled.");
+ } else if ("services".equals(cmd) || "s".equals(cmd)) {
+ if (dumpClient) {
+ ActiveServices.ServiceDumper dumper;
+ synchronized (this) {
+ dumper = mServices.newServiceDumperLocked(fd, pw, args, opti, true,
+ dumpPackage);
}
- }
- return;
- } else if ("untrack-associations".equals(cmd)) {
- synchronized (this) {
- if (mTrackingAssociations) {
- mTrackingAssociations = false;
- mAssociations.clear();
- pw.println("Association tracking stopped.");
- } else {
- pw.println("Association tracking not running.");
+ dumper.dumpWithClient();
+ } else {
+ synchronized (this) {
+ mServices.newServiceDumperLocked(fd, pw, args, opti, true,
+ dumpPackage).dumpLocked();
}
}
- return;
+ } else if ("locks".equals(cmd)) {
+ LockGuard.dump(fd, pw, args);
} else {
// Dumping a single activity?
- if (!dumpActivity(fd, pw, cmd, args, opti, dumpAll)) {
- pw.println("Bad activity command, or no activities match: " + cmd);
- pw.println("Use -h for help.");
+ if (!dumpActivity(fd, pw, cmd, args, opti, dumpAll, dumpVisibleStacksOnly,
+ dumpFocusedStackOnly)) {
+ ActivityManagerShellCommand shell = new ActivityManagerShellCommand(this, true);
+ int res = shell.exec(this, null, fd, null, args, null,
+ new ResultReceiver(null));
+ if (res < 0) {
+ pw.println("Bad activity command, or no activities match: " + cmd);
+ pw.println("Use -h for help.");
+ }
}
}
if (!more) {
}
// No piece of data specified, dump everything.
- synchronized (this) {
- dumpPendingIntentsLocked(fd, pw, args, opti, dumpAll, dumpPackage);
- pw.println();
- if (dumpAll) {
- pw.println("-------------------------------------------------------------------------------");
- }
- dumpBroadcastsLocked(fd, pw, args, opti, dumpAll, dumpPackage);
- pw.println();
- if (dumpAll) {
- pw.println("-------------------------------------------------------------------------------");
- }
- dumpProvidersLocked(fd, pw, args, opti, dumpAll, dumpPackage);
- pw.println();
- if (dumpAll) {
- pw.println("-------------------------------------------------------------------------------");
- }
- dumpPermissionsLocked(fd, pw, args, opti, dumpAll, dumpPackage);
- pw.println();
- if (dumpAll) {
- pw.println("-------------------------------------------------------------------------------");
- }
- mServices.dumpServicesLocked(fd, pw, args, opti, dumpAll, dumpClient, dumpPackage);
- pw.println();
- if (dumpAll) {
- pw.println("-------------------------------------------------------------------------------");
+ if (dumpCheckinFormat) {
+ dumpBroadcastStatsCheckinLocked(fd, pw, args, opti, dumpCheckin, dumpPackage);
+ } else if (dumpClient) {
+ ActiveServices.ServiceDumper sdumper;
+ synchronized (this) {
+ mConstants.dump(pw);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ dumpPendingIntentsLocked(fd, pw, args, opti, dumpAll, dumpPackage);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ dumpBroadcastsLocked(fd, pw, args, opti, dumpAll, dumpPackage);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ if (dumpAll || dumpPackage != null) {
+ dumpBroadcastStatsLocked(fd, pw, args, opti, dumpAll, dumpPackage);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ }
+ dumpProvidersLocked(fd, pw, args, opti, dumpAll, dumpPackage);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ dumpPermissionsLocked(fd, pw, args, opti, dumpAll, dumpPackage);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ sdumper = mServices.newServiceDumperLocked(fd, pw, args, opti, dumpAll,
+ dumpPackage);
}
- dumpRecentsLocked(fd, pw, args, opti, dumpAll, dumpPackage);
+ sdumper.dumpWithClient();
pw.println();
- if (dumpAll) {
- pw.println("-------------------------------------------------------------------------------");
- }
- dumpActivitiesLocked(fd, pw, args, opti, dumpAll, dumpClient, dumpPackage);
- if (mAssociations.size() > 0) {
+ synchronized (this) {
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ dumpRecentsLocked(fd, pw, args, opti, dumpAll, dumpPackage);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ dumpLastANRLocked(pw);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ dumpActivityStarterLocked(pw, dumpPackage);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ dumpActivitiesLocked(fd, pw, args, opti, dumpAll, dumpClient, dumpPackage);
+ if (mAssociations.size() > 0) {
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ dumpAssociationsLocked(fd, pw, args, opti, dumpAll, dumpClient, dumpPackage);
+ }
pw.println();
if (dumpAll) {
pw.println("-------------------------------------------------------------------------------");
}
- dumpAssociationsLocked(fd, pw, args, opti, dumpAll, dumpClient, dumpPackage);
+ dumpProcessesLocked(fd, pw, args, opti, dumpAll, dumpPackage);
}
- pw.println();
- if (dumpAll) {
- pw.println("-------------------------------------------------------------------------------");
+
+ } else {
+ synchronized (this) {
+ mConstants.dump(pw);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ dumpPendingIntentsLocked(fd, pw, args, opti, dumpAll, dumpPackage);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ dumpBroadcastsLocked(fd, pw, args, opti, dumpAll, dumpPackage);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ if (dumpAll || dumpPackage != null) {
+ dumpBroadcastStatsLocked(fd, pw, args, opti, dumpAll, dumpPackage);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ }
+ dumpProvidersLocked(fd, pw, args, opti, dumpAll, dumpPackage);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ dumpPermissionsLocked(fd, pw, args, opti, dumpAll, dumpPackage);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ mServices.newServiceDumperLocked(fd, pw, args, opti, dumpAll, dumpPackage)
+ .dumpLocked();
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ dumpRecentsLocked(fd, pw, args, opti, dumpAll, dumpPackage);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ dumpLastANRLocked(pw);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ dumpActivityStarterLocked(pw, dumpPackage);
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ dumpActivitiesLocked(fd, pw, args, opti, dumpAll, dumpClient, dumpPackage);
+ if (mAssociations.size() > 0) {
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ dumpAssociationsLocked(fd, pw, args, opti, dumpAll, dumpClient, dumpPackage);
+ }
+ pw.println();
+ if (dumpAll) {
+ pw.println("-------------------------------------------------------------------------------");
+ }
+ dumpProcessesLocked(fd, pw, args, opti, dumpAll, dumpPackage);
}
- dumpProcessesLocked(fd, pw, args, opti, dumpAll, dumpPackage);
}
Binder.restoreCallingIdentity(origId);
}
+ private void dumpLastANRLocked(PrintWriter pw) {
+ pw.println("ACTIVITY MANAGER LAST ANR (dumpsys activity lastanr)");
+ if (mLastANRState == null) {
+ pw.println(" <no ANR has occurred since boot>");
+ } else {
+ pw.println(mLastANRState);
+ }
+ }
+
+ private void dumpActivityStarterLocked(PrintWriter pw, String dumpPackage) {
+ pw.println("ACTIVITY MANAGER STARTER (dumpsys activity starter)");
+ mActivityStarter.dump(pw, "", dumpPackage);
+ }
+
void dumpActivitiesLocked(FileDescriptor fd, PrintWriter pw, String[] args,
int opti, boolean dumpAll, boolean dumpClient, String dumpPackage) {
- pw.println("ACTIVITY MANAGER ACTIVITIES (dumpsys activity activities)");
+ dumpActivitiesLocked(fd, pw, args, opti, dumpAll, dumpClient, dumpPackage,
+ "ACTIVITY MANAGER ACTIVITIES (dumpsys activity activities)");
+ }
+
+ void dumpActivitiesLocked(FileDescriptor fd, PrintWriter pw, String[] args,
+ int opti, boolean dumpAll, boolean dumpClient, String dumpPackage, String header) {
+ pw.println(header);
boolean printedAnything = mStackSupervisor.dumpActivitiesLocked(fd, pw, dumpAll, dumpClient,
dumpPackage);
boolean needSep = printedAnything;
- boolean printed = ActivityStackSupervisor.printThisActivity(pw, mFocusedActivity,
- dumpPackage, needSep, " mFocusedActivity: ");
+ boolean printed = ActivityStackSupervisor.printThisActivity(pw,
+ mStackSupervisor.getResumedActivityLocked(),
+ dumpPackage, needSep, " ResumedActivity: ");
if (printed) {
printedAnything = true;
needSep = false;
if (needSep) {
pw.println();
}
- needSep = true;
printedAnything = true;
mStackSupervisor.dump(pw, " ");
}
TaskRecord tr = mRecentTasks.get(i);
if (dumpPackage != null) {
if (tr.realActivity == null ||
- !dumpPackage.equals(tr.realActivity)) {
+ !dumpPackage.equals(tr.realActivity.getPackageName())) {
continue;
}
}
if (dumpPackage != null) {
IPackageManager pm = AppGlobals.getPackageManager();
try {
- dumpUid = pm.getPackageUid(dumpPackage, 0);
+ dumpUid = pm.getPackageUid(dumpPackage, MATCH_ANY_USER, 0);
} catch (RemoteException e) {
}
}
TimeUtils.formatDuration(dur, pw);
pw.print(" (");
pw.print(ass.mCount);
- pw.println(" times)");
+ pw.print(" times)");
+ pw.print(" ");
+ for (int i=0; i<ass.mStateTimes.length; i++) {
+ long amt = ass.mStateTimes[i];
+ if ((ass.mLastState-ActivityManager.MIN_PROCESS_STATE) == i) {
+ amt += now - ass.mLastStateUptime;
+ }
+ if (amt != 0) {
+ pw.print(" ");
+ pw.print(ProcessList.makeProcStateString(
+ i + ActivityManager.MIN_PROCESS_STATE));
+ pw.print("=");
+ TimeUtils.formatDuration(amt, pw);
+ if ((ass.mLastState-ActivityManager.MIN_PROCESS_STATE) == i) {
+ pw.print("*");
+ }
+ }
+ }
+ pw.println();
if (ass.mNesting > 0) {
- pw.print(" ");
- pw.print(" Currently active: ");
+ pw.print(" Currently active: ");
TimeUtils.formatDuration(now - ass.mStartTime, pw);
pw.println();
}
}
}
+ boolean dumpUids(PrintWriter pw, String dumpPackage, SparseArray<UidRecord> uids,
+ String header, boolean needSep) {
+ boolean printed = false;
+ int whichAppId = -1;
+ if (dumpPackage != null) {
+ try {
+ ApplicationInfo info = mContext.getPackageManager().getApplicationInfo(
+ dumpPackage, 0);
+ whichAppId = UserHandle.getAppId(info.uid);
+ } catch (NameNotFoundException e) {
+ e.printStackTrace();
+ }
+ }
+ for (int i=0; i<uids.size(); i++) {
+ UidRecord uidRec = uids.valueAt(i);
+ if (dumpPackage != null && UserHandle.getAppId(uidRec.uid) != whichAppId) {
+ continue;
+ }
+ if (!printed) {
+ printed = true;
+ if (needSep) {
+ pw.println();
+ }
+ pw.print(" ");
+ pw.println(header);
+ needSep = true;
+ }
+ pw.print(" UID "); UserHandle.formatUid(pw, uidRec.uid);
+ pw.print(": "); pw.println(uidRec);
+ }
+ return printed;
+ }
+
void dumpProcessesLocked(FileDescriptor fd, PrintWriter pw, String[] args,
int opti, boolean dumpAll, String dumpPackage) {
boolean needSep = false;
printed = true;
needSep = true;
}
- pw.println(String.format("%sIsolated #%2d: %s",
- " ", i, r.toString()));
+ pw.print(" Isolated #"); pw.print(i); pw.print(": ");
+ pw.println(r);
+ }
+ }
+
+ if (mActiveInstrumentation.size() > 0) {
+ boolean printed = false;
+ for (int i=0; i<mActiveInstrumentation.size(); i++) {
+ ActiveInstrumentation ai = mActiveInstrumentation.get(i);
+ if (dumpPackage != null && !ai.mClass.getPackageName().equals(dumpPackage)
+ && !ai.mTargetInfo.packageName.equals(dumpPackage)) {
+ continue;
+ }
+ if (!printed) {
+ if (needSep) {
+ pw.println();
+ }
+ pw.println(" Active instrumentation:");
+ printedAnything = true;
+ printed = true;
+ needSep = true;
+ }
+ pw.print(" Instrumentation #"); pw.print(i); pw.print(": ");
+ pw.println(ai);
+ ai.dump(pw, " ");
}
}
if (mActiveUids.size() > 0) {
- if (needSep) {
- pw.println();
+ if (dumpUids(pw, dumpPackage, mActiveUids, "UID states:", needSep)) {
+ printedAnything = needSep = true;
}
- pw.println(" UID states:");
- for (int i=0; i<mActiveUids.size(); i++) {
- UidRecord uidRec = mActiveUids.valueAt(i);
- pw.print(" UID "); UserHandle.formatUid(pw, uidRec.uid);
- pw.print(": "); pw.println(uidRec);
+ }
+ if (dumpAll) {
+ if (mValidateUids.size() > 0) {
+ if (dumpUids(pw, dumpPackage, mValidateUids, "UID validation:", needSep)) {
+ printedAnything = needSep = true;
+ }
}
- needSep = true;
- printedAnything = true;
}
if (mLruProcesses.size() > 0) {
}
}
- if (mForegroundProcesses.size() > 0) {
+ if (mImportantProcesses.size() > 0) {
synchronized (mPidsSelfLocked) {
boolean printed = false;
- for (int i=0; i<mForegroundProcesses.size(); i++) {
+ for (int i = 0; i< mImportantProcesses.size(); i++) {
ProcessRecord r = mPidsSelfLocked.get(
- mForegroundProcesses.valueAt(i).pid);
+ mImportantProcesses.valueAt(i).pid);
if (dumpPackage != null && (r == null
|| !r.pkgList.containsKey(dumpPackage))) {
continue;
printed = true;
printedAnything = true;
}
- pw.print(" PID #"); pw.print(mForegroundProcesses.keyAt(i));
- pw.print(": "); pw.println(mForegroundProcesses.valueAt(i));
+ pw.print(" PID #"); pw.print(mImportantProcesses.keyAt(i));
+ pw.print(": "); pw.println(mImportantProcesses.valueAt(i));
}
}
}
needSep = dumpProcessesToGc(fd, pw, args, opti, needSep, dumpAll, dumpPackage);
- if (mProcessCrashTimes.getMap().size() > 0) {
- boolean printed = false;
- long now = SystemClock.uptimeMillis();
- final ArrayMap<String, SparseArray<Long>> pmap = mProcessCrashTimes.getMap();
- final int NP = pmap.size();
- for (int ip=0; ip<NP; ip++) {
- String pname = pmap.keyAt(ip);
- SparseArray<Long> uids = pmap.valueAt(ip);
- final int N = uids.size();
- for (int i=0; i<N; i++) {
- int puid = uids.keyAt(i);
- ProcessRecord r = mProcessNames.get(pname, puid);
- if (dumpPackage != null && (r == null
- || !r.pkgList.containsKey(dumpPackage))) {
- continue;
- }
- if (!printed) {
- if (needSep) pw.println();
- needSep = true;
- pw.println(" Time since processes crashed:");
- printed = true;
- printedAnything = true;
- }
- pw.print(" Process "); pw.print(pname);
- pw.print(" uid "); pw.print(puid);
- pw.print(": last crashed ");
- TimeUtils.formatDuration(now-uids.valueAt(i), pw);
- pw.println(" ago");
- }
- }
- }
-
- if (mBadProcesses.getMap().size() > 0) {
- boolean printed = false;
- final ArrayMap<String, SparseArray<BadProcessInfo>> pmap = mBadProcesses.getMap();
- final int NP = pmap.size();
- for (int ip=0; ip<NP; ip++) {
- String pname = pmap.keyAt(ip);
- SparseArray<BadProcessInfo> uids = pmap.valueAt(ip);
- final int N = uids.size();
- for (int i=0; i<N; i++) {
- int puid = uids.keyAt(i);
- ProcessRecord r = mProcessNames.get(pname, puid);
- if (dumpPackage != null && (r == null
- || !r.pkgList.containsKey(dumpPackage))) {
- continue;
- }
- if (!printed) {
- if (needSep) pw.println();
- needSep = true;
- pw.println(" Bad processes:");
- printedAnything = true;
- }
- BadProcessInfo info = uids.valueAt(i);
- pw.print(" Bad process "); pw.print(pname);
- pw.print(" uid "); pw.print(puid);
- pw.print(": crashed at time "); pw.println(info.time);
- if (info.shortMsg != null) {
- pw.print(" Short msg: "); pw.println(info.shortMsg);
- }
- if (info.longMsg != null) {
- pw.print(" Long msg: "); pw.println(info.longMsg);
- }
- if (info.stack != null) {
- pw.println(" Stack:");
- int lastPos = 0;
- for (int pos=0; pos<info.stack.length(); pos++) {
- if (info.stack.charAt(pos) == '\n') {
- pw.print(" ");
- pw.write(info.stack, lastPos, pos-lastPos);
- pw.println();
- lastPos = pos+1;
- }
- }
- if (lastPos < info.stack.length()) {
- pw.print(" ");
- pw.write(info.stack, lastPos, info.stack.length()-lastPos);
- pw.println();
- }
- }
- }
- }
+ needSep = mAppErrors.dumpLocked(fd, pw, needSep, dumpPackage);
+ if (needSep) {
+ printedAnything = true;
}
if (dumpPackage == null) {
pw.println();
needSep = false;
- pw.println(" mStartedUsers:");
- for (int i=0; i<mStartedUsers.size(); i++) {
- UserState uss = mStartedUsers.valueAt(i);
- pw.print(" User #"); pw.print(uss.mHandle.getIdentifier());
- pw.print(": "); uss.dump("", pw);
- }
- pw.print(" mStartedUserArray: [");
- for (int i=0; i<mStartedUserArray.length; i++) {
- if (i > 0) pw.print(", ");
- pw.print(mStartedUserArray[i]);
- }
- pw.println("]");
- pw.print(" mUserLru: [");
- for (int i=0; i<mUserLru.size(); i++) {
- if (i > 0) pw.print(", ");
- pw.print(mUserLru.get(i));
- }
- pw.println("]");
- if (dumpAll) {
- pw.print(" mStartedUserArray: "); pw.println(Arrays.toString(mStartedUserArray));
- }
- synchronized (mUserProfileGroupIdsSelfLocked) {
- if (mUserProfileGroupIdsSelfLocked.size() > 0) {
- pw.println(" mUserProfileGroupIds:");
- for (int i=0; i<mUserProfileGroupIdsSelfLocked.size(); i++) {
- pw.print(" User #");
- pw.print(mUserProfileGroupIdsSelfLocked.keyAt(i));
- pw.print(" -> profile #");
- pw.println(mUserProfileGroupIdsSelfLocked.valueAt(i));
- }
- }
- }
+ mUserController.dump(pw, dumpAll);
}
if (mHomeProcess != null && (dumpPackage == null
|| mHomeProcess.pkgList.containsKey(dumpPackage))) {
pw.println(" mHeavyWeightProcess: " + mHeavyWeightProcess);
}
if (dumpPackage == null) {
- pw.println(" mConfiguration: " + mConfiguration);
+ pw.println(" mGlobalConfiguration: " + getGlobalConfiguration());
+ mStackSupervisor.dumpDisplayConfigs(pw, " ");
}
if (dumpAll) {
pw.println(" mConfigWillChange: " + getFocusedStack().mConfigWillChange);
pw.print(mode); pw.println();
}
}
- }
- if (dumpPackage == null) {
- pw.println(" mWakefulness="
- + PowerManagerInternal.wakefulnessToString(mWakefulness));
- pw.println(" mSleepTokens=" + mSleepTokens);
- pw.println(" mSleeping=" + mSleeping + " mLockScreenShown="
- + lockScreenShownToString());
+ final int NI = mUidObservers.getRegisteredCallbackCount();
+ boolean printed = false;
+ for (int i=0; i<NI; i++) {
+ final UidObserverRegistration reg = (UidObserverRegistration)
+ mUidObservers.getRegisteredCallbackCookie(i);
+ if (dumpPackage == null || dumpPackage.equals(reg.pkg)) {
+ if (!printed) {
+ pw.println(" mUidObservers:");
+ printed = true;
+ }
+ pw.print(" "); UserHandle.formatUid(pw, reg.uid);
+ pw.print(" "); pw.print(reg.pkg); pw.print(":");
+ if ((reg.which&ActivityManager.UID_OBSERVER_IDLE) != 0) {
+ pw.print(" IDLE");
+ }
+ if ((reg.which&ActivityManager.UID_OBSERVER_ACTIVE) != 0) {
+ pw.print(" ACT" );
+ }
+ if ((reg.which&ActivityManager.UID_OBSERVER_GONE) != 0) {
+ pw.print(" GONE");
+ }
+ if ((reg.which&ActivityManager.UID_OBSERVER_PROCSTATE) != 0) {
+ pw.print(" STATE");
+ pw.print(" (cut="); pw.print(reg.cutpoint);
+ pw.print(")");
+ }
+ pw.println();
+ if (reg.lastProcStates != null) {
+ final int NJ = reg.lastProcStates.size();
+ for (int j=0; j<NJ; j++) {
+ pw.print(" Last ");
+ UserHandle.formatUid(pw, reg.lastProcStates.keyAt(j));
+ pw.print(": "); pw.println(reg.lastProcStates.valueAt(j));
+ }
+ }
+ }
+ }
+ pw.println(" mDeviceIdleWhitelist=" + Arrays.toString(mDeviceIdleWhitelist));
+ pw.println(" mDeviceIdleTempWhitelist=" + Arrays.toString(mDeviceIdleTempWhitelist));
+ if (mPendingTempWhitelist.size() > 0) {
+ pw.println(" mPendingTempWhitelist:");
+ for (int i = 0; i < mPendingTempWhitelist.size(); i++) {
+ PendingTempWhitelist ptw = mPendingTempWhitelist.valueAt(i);
+ pw.print(" ");
+ UserHandle.formatUid(pw, ptw.targetUid);
+ pw.print(": ");
+ TimeUtils.formatDuration(ptw.duration, pw);
+ pw.print(" ");
+ pw.println(ptw.tag);
+ }
+ }
+ }
+ if (dumpPackage == null) {
+ pw.println(" mWakefulness="
+ + PowerManagerInternal.wakefulnessToString(mWakefulness));
+ pw.println(" mSleepTokens=" + mStackSupervisor.mSleepTokens);
+ pw.println(" mSleeping=" + mSleeping);
pw.println(" mShuttingDown=" + mShuttingDown + " mTestPssMode=" + mTestPssMode);
if (mRunningVoice != null) {
pw.println(" mRunningVoice=" + mRunningVoice);
pw.println(" mVoiceWakeLock" + mVoiceWakeLock);
}
}
+ pw.println(" mVrController=" + mVrController);
if (mDebugApp != null || mOrigDebugApp != null || mDebugTransient
|| mOrigWaitForDebugger) {
if (dumpPackage == null || dumpPackage.equals(mDebugApp)
pw.print(" mMemWatchDumpPid="); pw.print(mMemWatchDumpPid);
pw.print(" mMemWatchDumpUid="); pw.println(mMemWatchDumpUid);
}
- if (mOpenGlTraceApp != null) {
- if (dumpPackage == null || dumpPackage.equals(mOpenGlTraceApp)) {
+ if (mTrackAllocationApp != null) {
+ if (dumpPackage == null || dumpPackage.equals(mTrackAllocationApp)) {
if (needSep) {
pw.println();
needSep = false;
}
- pw.println(" mOpenGlTraceApp=" + mOpenGlTraceApp);
+ pw.println(" mTrackAllocationApp=" + mTrackAllocationApp);
}
}
- if (mProfileApp != null || mProfileProc != null || mProfileFile != null
- || mProfileFd != null) {
+ if (mProfileApp != null || mProfileProc != null || (mProfilerInfo != null &&
+ (mProfilerInfo.profileFile != null || mProfilerInfo.profileFd != null))) {
if (dumpPackage == null || dumpPackage.equals(mProfileApp)) {
if (needSep) {
pw.println();
needSep = false;
}
pw.println(" mProfileApp=" + mProfileApp + " mProfileProc=" + mProfileProc);
- pw.println(" mProfileFile=" + mProfileFile + " mProfileFd=" + mProfileFd);
- pw.println(" mSamplingInterval=" + mSamplingInterval + " mAutoStopProfiler="
- + mAutoStopProfiler);
- pw.println(" mProfileType=" + mProfileType);
+ if (mProfilerInfo != null) {
+ pw.println(" mProfileFile=" + mProfilerInfo.profileFile + " mProfileFd=" +
+ mProfilerInfo.profileFd);
+ pw.println(" mSamplingInterval=" + mProfilerInfo.samplingInterval +
+ " mAutoStopProfiler=" + mProfilerInfo.autoStopProfiler +
+ " mStreamingOutput=" + mProfilerInfo.streamingOutput);
+ pw.println(" mProfileType=" + mProfileType);
+ }
+ }
+ }
+ if (mNativeDebuggingApp != null) {
+ if (dumpPackage == null || dumpPackage.equals(mNativeDebuggingApp)) {
+ if (needSep) {
+ pw.println();
+ needSep = false;
+ }
+ pw.println(" mNativeDebuggingApp=" + mNativeDebuggingApp);
}
}
if (dumpPackage == null) {
- if (mAlwaysFinishActivities || mController != null) {
- pw.println(" mAlwaysFinishActivities=" + mAlwaysFinishActivities
- + " mController=" + mController);
+ if (mAlwaysFinishActivities) {
+ pw.println(" mAlwaysFinishActivities=" + mAlwaysFinishActivities);
+ }
+ if (mController != null) {
+ pw.println(" mController=" + mController
+ + " mControllerIsAMonkey=" + mControllerIsAMonkey);
}
if (dumpAll) {
pw.println(" Total persistent processes: " + numPers);
pw.println(" mBooting=" + mBooting
+ " mCallFinishBooting=" + mCallFinishBooting
+ " mBootAnimationComplete=" + mBootAnimationComplete);
- pw.print(" mLastPowerCheckRealtime=");
- TimeUtils.formatDuration(mLastPowerCheckRealtime, pw);
- pw.println("");
pw.print(" mLastPowerCheckUptime=");
TimeUtils.formatDuration(mLastPowerCheckUptime, pw);
pw.println("");
+ " mNumServiceProcs=" + mNumServiceProcs
+ " mNewNumServiceProcs=" + mNewNumServiceProcs);
pw.println(" mAllowLowerMemLevel=" + mAllowLowerMemLevel
- + " mLastMemoryLevel" + mLastMemoryLevel
- + " mLastNumProcesses" + mLastNumProcesses);
+ + " mLastMemoryLevel=" + mLastMemoryLevel
+ + " mLastNumProcesses=" + mLastNumProcesses);
long now = SystemClock.uptimeMillis();
pw.print(" mLastIdleTime=");
TimeUtils.formatDuration(now, mLastIdleTime, pw);
pw.print(": ");
pw.print(name);
pw.print(" (");
- pw.print(mProcessList.getMemLevel(adj)/1024);
- pw.println(" kB)");
+ pw.print(stringifySize(mProcessList.getMemLevel(adj), 1024));
+ pw.println(")");
}
boolean dumpOomLocked(FileDescriptor fd, PrintWriter pw, String[] args,
* - the cmd arg isn't the flattened component name of an existing activity:
* dump all activity whose component contains the cmd as a substring
* - A hex number of the ActivityRecord object instance.
+ *
+ * @param dumpVisibleStacksOnly dump activity with {@param name} only if in a visible stack
+ * @param dumpFocusedStackOnly dump activity with {@param name} only if in the focused stack
*/
protected boolean dumpActivity(FileDescriptor fd, PrintWriter pw, String name, String[] args,
- int opti, boolean dumpAll) {
+ int opti, boolean dumpAll, boolean dumpVisibleStacksOnly, boolean dumpFocusedStackOnly) {
ArrayList<ActivityRecord> activities;
synchronized (this) {
- activities = mStackSupervisor.getDumpActivitiesLocked(name);
+ activities = mStackSupervisor.getDumpActivitiesLocked(name, dumpVisibleStacksOnly,
+ dumpFocusedStackOnly);
}
if (activities.size() <= 0) {
}
needSep = true;
synchronized (this) {
- if (lastTask != r.task) {
- lastTask = r.task;
+ final TaskRecord task = r.getTask();
+ if (lastTask != task) {
+ lastTask = task;
pw.print("TASK "); pw.print(lastTask.affinity);
- pw.print(" id="); pw.println(lastTask.taskId);
+ pw.print(" id="); pw.print(lastTask.taskId);
+ pw.print(" userId="); pw.println(lastTask.userId);
if (dumpAll) {
lastTask.dump(pw, " ");
}
try {
TransferPipe tp = new TransferPipe();
try {
- r.app.thread.dumpActivity(tp.getWriteFd().getFileDescriptor(),
+ r.app.thread.dumpActivity(tp.getWriteFd(),
r.appToken, innerPrefix, args);
tp.go(fd);
} finally {
}
}
+ void dumpBroadcastStatsLocked(FileDescriptor fd, PrintWriter pw, String[] args,
+ int opti, boolean dumpAll, String dumpPackage) {
+ if (mCurBroadcastStats == null) {
+ return;
+ }
+
+ pw.println("ACTIVITY MANAGER BROADCAST STATS STATE (dumpsys activity broadcast-stats)");
+ final long now = SystemClock.elapsedRealtime();
+ if (mLastBroadcastStats != null) {
+ pw.print(" Last stats (from ");
+ TimeUtils.formatDuration(mLastBroadcastStats.mStartRealtime, now, pw);
+ pw.print(" to ");
+ TimeUtils.formatDuration(mLastBroadcastStats.mEndRealtime, now, pw);
+ pw.print(", ");
+ TimeUtils.formatDuration(mLastBroadcastStats.mEndUptime
+ - mLastBroadcastStats.mStartUptime, pw);
+ pw.println(" uptime):");
+ if (!mLastBroadcastStats.dumpStats(pw, " ", dumpPackage)) {
+ pw.println(" (nothing)");
+ }
+ pw.println();
+ }
+ pw.print(" Current stats (from ");
+ TimeUtils.formatDuration(mCurBroadcastStats.mStartRealtime, now, pw);
+ pw.print(" to now, ");
+ TimeUtils.formatDuration(SystemClock.uptimeMillis()
+ - mCurBroadcastStats.mStartUptime, pw);
+ pw.println(" uptime):");
+ if (!mCurBroadcastStats.dumpStats(pw, " ", dumpPackage)) {
+ pw.println(" (nothing)");
+ }
+ }
+
+ void dumpBroadcastStatsCheckinLocked(FileDescriptor fd, PrintWriter pw, String[] args,
+ int opti, boolean fullCheckin, String dumpPackage) {
+ if (mCurBroadcastStats == null) {
+ return;
+ }
+
+ if (mLastBroadcastStats != null) {
+ mLastBroadcastStats.dumpCheckinStats(pw, dumpPackage);
+ if (fullCheckin) {
+ mLastBroadcastStats = null;
+ return;
+ }
+ }
+ mCurBroadcastStats.dumpCheckinStats(pw, dumpPackage);
+ if (fullCheckin) {
+ mCurBroadcastStats = null;
+ }
+ }
+
void dumpProvidersLocked(FileDescriptor fd, PrintWriter pw, String[] args,
int opti, boolean dumpAll, String dumpPackage) {
boolean needSep;
int dumpUid = -2;
if (dumpPackage != null) {
try {
- dumpUid = mContext.getPackageManager().getPackageUid(dumpPackage, 0);
+ dumpUid = mContext.getPackageManager().getPackageUidAsUser(dumpPackage,
+ MATCH_ANY_USER, 0);
} catch (NameNotFoundException e) {
dumpUid = -1;
}
pw.println("ACTIVITY MANAGER PENDING INTENTS (dumpsys activity intents)");
if (mIntentSenderRecords.size() > 0) {
- Iterator<WeakReference<PendingIntentRecord>> it
+ // Organize these by package name, so they are easier to read.
+ final ArrayMap<String, ArrayList<PendingIntentRecord>> byPackage = new ArrayMap<>();
+ final ArrayList<WeakReference<PendingIntentRecord>> weakRefs = new ArrayList<>();
+ final Iterator<WeakReference<PendingIntentRecord>> it
= mIntentSenderRecords.values().iterator();
while (it.hasNext()) {
WeakReference<PendingIntentRecord> ref = it.next();
- PendingIntentRecord rec = ref != null ? ref.get(): null;
- if (dumpPackage != null && (rec == null
- || !dumpPackage.equals(rec.key.packageName))) {
+ PendingIntentRecord rec = ref != null ? ref.get() : null;
+ if (rec == null) {
+ weakRefs.add(ref);
+ continue;
+ }
+ if (dumpPackage != null && !dumpPackage.equals(rec.key.packageName)) {
continue;
}
+ ArrayList<PendingIntentRecord> list = byPackage.get(rec.key.packageName);
+ if (list == null) {
+ list = new ArrayList<>();
+ byPackage.put(rec.key.packageName, list);
+ }
+ list.add(rec);
+ }
+ for (int i = 0; i < byPackage.size(); i++) {
+ ArrayList<PendingIntentRecord> intents = byPackage.valueAt(i);
printed = true;
- if (rec != null) {
- pw.print(" * "); pw.println(rec);
+ pw.print(" * "); pw.print(byPackage.keyAt(i));
+ pw.print(": "); pw.print(intents.size()); pw.println(" items");
+ for (int j = 0; j < intents.size(); j++) {
+ pw.print(" #"); pw.print(j); pw.print(": "); pw.println(intents.get(j));
if (dumpAll) {
- rec.dump(pw, " ");
+ intents.get(j).dump(pw, " ");
}
- } else {
- pw.print(" * "); pw.println(ref);
+ }
+ }
+ if (weakRefs.size() > 0) {
+ printed = true;
+ pw.println(" * WEAK REFS:");
+ for (int i = 0; i < weakRefs.size(); i++) {
+ pw.print(" #"); pw.print(i); pw.print(": "); pw.println(weakRefs.get(i));
}
}
}
if (object1.first.setAdj != object2.first.setAdj) {
return object1.first.setAdj > object2.first.setAdj ? -1 : 1;
}
+ if (object1.first.setProcState != object2.first.setProcState) {
+ return object1.first.setProcState > object2.first.setProcState ? -1 : 1;
+ }
if (object1.second.intValue() != object2.second.intValue()) {
return object1.second.intValue() > object2.second.intValue() ? -1 : 1;
}
Collections.sort(list, comparator);
- final long curRealtime = SystemClock.elapsedRealtime();
- final long realtimeSince = curRealtime - service.mLastPowerCheckRealtime;
final long curUptime = SystemClock.uptimeMillis();
final long uptimeSince = curUptime - service.mLastPowerCheckUptime;
String oomAdj = ProcessList.makeOomAdjString(r.setAdj);
char schedGroup;
switch (r.setSchedGroup) {
- case Process.THREAD_GROUP_BG_NONINTERACTIVE:
+ case ProcessList.SCHED_GROUP_BACKGROUND:
schedGroup = 'B';
break;
- case Process.THREAD_GROUP_DEFAULT:
+ case ProcessList.SCHED_GROUP_DEFAULT:
schedGroup = 'F';
break;
+ case ProcessList.SCHED_GROUP_TOP_APP:
+ schedGroup = 'T';
+ break;
default:
schedGroup = '?';
break;
pw.print("state: cur="); pw.print(ProcessList.makeProcStateString(r.curProcState));
pw.print(" set="); pw.print(ProcessList.makeProcStateString(r.setProcState));
pw.print(" lastPss="); DebugUtils.printSizeValue(pw, r.lastPss*1024);
+ pw.print(" lastSwapPss="); DebugUtils.printSizeValue(pw, r.lastSwapPss*1024);
pw.print(" lastCachedPss="); DebugUtils.printSizeValue(pw, r.lastCachedPss*1024);
pw.println();
pw.print(prefix);
pw.print(" hasAboveClient="); pw.println(r.hasAboveClient);
if (r.setProcState >= ActivityManager.PROCESS_STATE_SERVICE) {
- if (r.lastWakeTime != 0) {
- long wtime;
- BatteryStatsImpl stats = service.mBatteryStatsService.getActiveStatistics();
- synchronized (stats) {
- wtime = stats.getProcessWakeTime(r.info.uid,
- r.pid, curRealtime);
- }
- long timeUsed = wtime - r.lastWakeTime;
- pw.print(prefix);
- pw.print(" ");
- pw.print("keep awake over ");
- TimeUtils.formatDuration(realtimeSince, pw);
- pw.print(" used ");
- TimeUtils.formatDuration(timeUsed, pw);
- pw.print(" (");
- pw.print((timeUsed*100)/realtimeSince);
- pw.println("%)");
- }
if (r.lastCpuTime != 0) {
long timeUsed = r.curCpuTime - r.lastCpuTime;
pw.print(prefix);
try {
TransferPipe tp = new TransferPipe();
try {
- r.thread.dumpGfxInfo(tp.getWriteFd().getFileDescriptor(), args);
+ r.thread.dumpGfxInfo(tp.getWriteFd(), args);
tp.go(fd);
} finally {
tp.kill();
try {
TransferPipe tp = new TransferPipe();
try {
- r.thread.dumpDbInfo(tp.getWriteFd().getFileDescriptor(), args);
+ r.thread.dumpDbInfo(tp.getWriteFd(), args);
tp.go(fd);
} finally {
tp.kill();
final String label;
final String shortLabel;
final long pss;
+ final long swapPss;
final int id;
final boolean hasActivities;
ArrayList<MemItem> subitems;
- public MemItem(String _label, String _shortLabel, long _pss, int _id,
+ public MemItem(String _label, String _shortLabel, long _pss, long _swapPss, int _id,
boolean _hasActivities) {
isProc = true;
label = _label;
shortLabel = _shortLabel;
pss = _pss;
+ swapPss = _swapPss;
id = _id;
hasActivities = _hasActivities;
}
- public MemItem(String _label, String _shortLabel, long _pss, int _id) {
+ public MemItem(String _label, String _shortLabel, long _pss, long _swapPss, int _id) {
isProc = false;
label = _label;
shortLabel = _shortLabel;
pss = _pss;
+ swapPss = _swapPss;
id = _id;
hasActivities = false;
}
}
static final void dumpMemItems(PrintWriter pw, String prefix, String tag,
- ArrayList<MemItem> items, boolean sort, boolean isCompact) {
+ ArrayList<MemItem> items, boolean sort, boolean isCompact, boolean dumpSwapPss) {
if (sort && !isCompact) {
Collections.sort(items, new Comparator<MemItem>() {
@Override
for (int i=0; i<items.size(); i++) {
MemItem mi = items.get(i);
if (!isCompact) {
- pw.print(prefix); pw.printf("%7d kB: ", mi.pss); pw.println(mi.label);
+ if (dumpSwapPss) {
+ pw.printf("%s%s: %-60s (%s in swap)\n", prefix, stringifyKBSize(mi.pss),
+ mi.label, stringifyKBSize(mi.swapPss));
+ } else {
+ pw.printf("%s%s: %s\n", prefix, stringifyKBSize(mi.pss), mi.label);
+ }
} else if (mi.isProc) {
pw.print("proc,"); pw.print(tag); pw.print(","); pw.print(mi.shortLabel);
- pw.print(","); pw.print(mi.id); pw.print(","); pw.print(mi.pss);
+ pw.print(","); pw.print(mi.id); pw.print(","); pw.print(mi.pss); pw.print(",");
+ pw.print(dumpSwapPss ? mi.swapPss : "N/A");
pw.println(mi.hasActivities ? ",a" : ",e");
} else {
pw.print(tag); pw.print(","); pw.print(mi.shortLabel); pw.print(",");
- pw.println(mi.pss);
+ pw.print(mi.pss); pw.print(","); pw.println(dumpSwapPss ? mi.swapPss : "N/A");
}
if (mi.subitems != null) {
- dumpMemItems(pw, prefix + " ", mi.shortLabel, mi.subitems,
- true, isCompact);
+ dumpMemItems(pw, prefix + " ", mi.shortLabel, mi.subitems,
+ true, isCompact, dumpSwapPss);
}
}
}
ProcessList.VISIBLE_APP_ADJ, ProcessList.PERCEPTIBLE_APP_ADJ,
ProcessList.BACKUP_APP_ADJ, ProcessList.HEAVY_WEIGHT_APP_ADJ,
ProcessList.SERVICE_ADJ, ProcessList.HOME_APP_ADJ,
- ProcessList.PREVIOUS_APP_ADJ, ProcessList.SERVICE_B_ADJ, ProcessList.CACHED_APP_MAX_ADJ
+ ProcessList.PREVIOUS_APP_ADJ, ProcessList.SERVICE_B_ADJ, ProcessList.CACHED_APP_MIN_ADJ
};
static final String[] DUMP_MEM_OOM_LABEL = new String[] {
"Native",
private final void dumpApplicationMemoryUsageHeader(PrintWriter pw, long uptime,
long realtime, boolean isCheckinRequest, boolean isCompact) {
+ if (isCompact) {
+ pw.print("version,"); pw.println(MEMINFO_COMPACT_VERSION);
+ }
if (isCheckinRequest || isCompact) {
// short checkin version
pw.print("time,"); pw.print(uptime); pw.print(","); pw.println(realtime);
} else {
- pw.println("Applications Memory Usage (kB):");
+ pw.println("Applications Memory Usage (in Kilobytes):");
pw.println("Uptime: " + uptime + " Realtime: " + realtime);
}
}
private final long[] getKsmInfo() {
long[] longOut = new long[4];
final int[] SINGLE_LONG_FORMAT = new int[] {
- Process.PROC_SPACE_TERM|Process.PROC_OUT_LONG
+ PROC_SPACE_TERM| PROC_OUT_LONG
};
long[] longTmp = new long[1];
- Process.readProcFile("/sys/kernel/mm/ksm/pages_shared",
+ readProcFile("/sys/kernel/mm/ksm/pages_shared",
SINGLE_LONG_FORMAT, null, longTmp, null);
longOut[KSM_SHARED] = longTmp[0] * ProcessList.PAGE_SIZE / 1024;
longTmp[0] = 0;
- Process.readProcFile("/sys/kernel/mm/ksm/pages_sharing",
+ readProcFile("/sys/kernel/mm/ksm/pages_sharing",
SINGLE_LONG_FORMAT, null, longTmp, null);
longOut[KSM_SHARING] = longTmp[0] * ProcessList.PAGE_SIZE / 1024;
longTmp[0] = 0;
- Process.readProcFile("/sys/kernel/mm/ksm/pages_unshared",
+ readProcFile("/sys/kernel/mm/ksm/pages_unshared",
SINGLE_LONG_FORMAT, null, longTmp, null);
longOut[KSM_UNSHARED] = longTmp[0] * ProcessList.PAGE_SIZE / 1024;
longTmp[0] = 0;
- Process.readProcFile("/sys/kernel/mm/ksm/pages_volatile",
+ readProcFile("/sys/kernel/mm/ksm/pages_volatile",
SINGLE_LONG_FORMAT, null, longTmp, null);
longOut[KSM_VOLATILE] = longTmp[0] * ProcessList.PAGE_SIZE / 1024;
return longOut;
}
+ private static String stringifySize(long size, int order) {
+ Locale locale = Locale.US;
+ switch (order) {
+ case 1:
+ return String.format(locale, "%,13d", size);
+ case 1024:
+ return String.format(locale, "%,9dK", size / 1024);
+ case 1024 * 1024:
+ return String.format(locale, "%,5dM", size / 1024 / 1024);
+ case 1024 * 1024 * 1024:
+ return String.format(locale, "%,1dG", size / 1024 / 1024 / 1024);
+ default:
+ throw new IllegalArgumentException("Invalid size order");
+ }
+ }
+
+ private static String stringifyKBSize(long size) {
+ return stringifySize(size * 1024, 1024);
+ }
+
+ // Update this version number in case you change the 'compact' format
+ private static final int MEMINFO_COMPACT_VERSION = 1;
+
final void dumpApplicationMemoryUsage(FileDescriptor fd,
PrintWriter pw, String prefix, String[] args, boolean brief, PrintWriter categoryPw) {
boolean dumpDetails = false;
boolean dumpFullDetails = false;
boolean dumpDalvik = false;
boolean dumpSummaryOnly = false;
+ boolean dumpUnreachable = false;
boolean oomOnly = false;
boolean isCompact = false;
boolean localOnly = false;
boolean packages = false;
+ boolean isCheckinRequest = false;
+ boolean dumpSwapPss = false;
int opti = 0;
while (opti < args.length) {
dumpDetails = true;
dumpFullDetails = true;
dumpDalvik = true;
+ dumpSwapPss = true;
} else if ("-d".equals(opt)) {
dumpDalvik = true;
} else if ("-c".equals(opt)) {
} else if ("-s".equals(opt)) {
dumpDetails = true;
dumpSummaryOnly = true;
+ } else if ("-S".equals(opt)) {
+ dumpSwapPss = true;
+ } else if ("--unreachable".equals(opt)) {
+ dumpUnreachable = true;
} else if ("--oom".equals(opt)) {
oomOnly = true;
} else if ("--local".equals(opt)) {
localOnly = true;
} else if ("--package".equals(opt)) {
packages = true;
+ } else if ("--checkin".equals(opt)) {
+ isCheckinRequest = true;
+
} else if ("-h".equals(opt)) {
pw.println("meminfo dump options: [-a] [-d] [-c] [-s] [--oom] [process]");
pw.println(" -a: include all available information for each process.");
pw.println(" -d: include dalvik details.");
pw.println(" -c: dump in a compact machine-parseable representation.");
pw.println(" -s: dump only summary of application memory usage.");
+ pw.println(" -S: dump also SwapPss.");
pw.println(" --oom: only show processes organized by oom adj.");
pw.println(" --local: only collect details locally, don't call process.");
pw.println(" --package: interpret process arg as package, dumping all");
pw.println(" processes that have loaded that package.");
+ pw.println(" --checkin: dump data for a checkin");
pw.println("If [process] is specified it can be the name or ");
pw.println("pid of a specific process to dump.");
return;
}
}
- final boolean isCheckinRequest = scanArgs(args, "--checkin");
long uptime = SystemClock.uptimeMillis();
long realtime = SystemClock.elapsedRealtime();
final long[] tmpLong = new long[1];
ArrayList<MemItem> procMems = new ArrayList<MemItem>();
final SparseArray<MemItem> procMemsMap = new SparseArray<MemItem>();
long nativePss = 0;
+ long nativeSwapPss = 0;
long dalvikPss = 0;
+ long dalvikSwapPss = 0;
long[] dalvikSubitemPss = dumpDalvik ? new long[Debug.MemoryInfo.NUM_DVK_STATS] :
EmptyArray.LONG;
+ long[] dalvikSubitemSwapPss = dumpDalvik ? new long[Debug.MemoryInfo.NUM_DVK_STATS] :
+ EmptyArray.LONG;
long otherPss = 0;
+ long otherSwapPss = 0;
long[] miscPss = new long[Debug.MemoryInfo.NUM_OTHER_STATS];
+ long[] miscSwapPss = new long[Debug.MemoryInfo.NUM_OTHER_STATS];
long oomPss[] = new long[DUMP_MEM_OOM_LABEL.length];
+ long oomSwapPss[] = new long[DUMP_MEM_OOM_LABEL.length];
ArrayList<MemItem>[] oomProcs = (ArrayList<MemItem>[])
new ArrayList[DUMP_MEM_OOM_LABEL.length];
long totalPss = 0;
+ long totalSwapPss = 0;
long cachedPss = 0;
+ long cachedSwapPss = 0;
+ boolean hasSwapPss = false;
Debug.MemoryInfo mi = null;
for (int i = procs.size() - 1 ; i >= 0 ; i--) {
}
if (dumpDetails || (!brief && !oomOnly)) {
Debug.getMemoryInfo(pid, mi);
+ hasSwapPss = mi.hasSwappedOutPss;
} else {
mi.dalvikPss = (int)Debug.getPss(pid, tmpLong, null);
mi.dalvikPrivateDirty = (int)tmpLong[0];
pw.println();
}
} else {
+ pw.flush();
try {
- pw.flush();
- thread.dumpMemInfo(fd, mi, isCheckinRequest, dumpFullDetails,
- dumpDalvik, dumpSummaryOnly, innerArgs);
+ TransferPipe tp = new TransferPipe();
+ try {
+ thread.dumpMemInfo(tp.getWriteFd(),
+ mi, isCheckinRequest, dumpFullDetails,
+ dumpDalvik, dumpSummaryOnly, dumpUnreachable, innerArgs);
+ tp.go(fd);
+ } finally {
+ tp.kill();
+ }
+ } catch (IOException e) {
+ if (!isCheckinRequest) {
+ pw.println("Got IoException! " + e);
+ pw.flush();
+ }
} catch (RemoteException e) {
if (!isCheckinRequest) {
- pw.println("Got RemoteException!");
+ pw.println("Got RemoteException! " + e);
pw.flush();
}
}
final long myTotalPss = mi.getTotalPss();
final long myTotalUss = mi.getTotalUss();
+ final long myTotalSwapPss = mi.getTotalSwappedOutPss();
synchronized (this) {
if (r.thread != null && oomAdj == r.getSetAdjWithServices()) {
if (!isCheckinRequest && mi != null) {
totalPss += myTotalPss;
+ totalSwapPss += myTotalSwapPss;
MemItem pssItem = new MemItem(r.processName + " (pid " + pid +
- (hasActivities ? " / activities)" : ")"),
- r.processName, myTotalPss, pid, hasActivities);
+ (hasActivities ? " / activities)" : ")"), r.processName, myTotalPss,
+ myTotalSwapPss, pid, hasActivities);
procMems.add(pssItem);
procMemsMap.put(pid, pssItem);
nativePss += mi.nativePss;
+ nativeSwapPss += mi.nativeSwappedOutPss;
dalvikPss += mi.dalvikPss;
+ dalvikSwapPss += mi.dalvikSwappedOutPss;
for (int j=0; j<dalvikSubitemPss.length; j++) {
dalvikSubitemPss[j] += mi.getOtherPss(Debug.MemoryInfo.NUM_OTHER_STATS + j);
+ dalvikSubitemSwapPss[j] +=
+ mi.getOtherSwappedOutPss(Debug.MemoryInfo.NUM_OTHER_STATS + j);
}
otherPss += mi.otherPss;
+ otherSwapPss += mi.otherSwappedOutPss;
for (int j=0; j<Debug.MemoryInfo.NUM_OTHER_STATS; j++) {
long mem = mi.getOtherPss(j);
miscPss[j] += mem;
otherPss -= mem;
+ mem = mi.getOtherSwappedOutPss(j);
+ miscSwapPss[j] += mem;
+ otherSwapPss -= mem;
}
if (oomAdj >= ProcessList.CACHED_APP_MIN_ADJ) {
cachedPss += myTotalPss;
+ cachedSwapPss += myTotalSwapPss;
}
for (int oomIndex=0; oomIndex<oomPss.length; oomIndex++) {
- if (oomAdj <= DUMP_MEM_OOM_ADJ[oomIndex]
- || oomIndex == (oomPss.length-1)) {
+ if (oomIndex == (oomPss.length - 1)
+ || (oomAdj >= DUMP_MEM_OOM_ADJ[oomIndex]
+ && oomAdj < DUMP_MEM_OOM_ADJ[oomIndex + 1])) {
oomPss[oomIndex] += myTotalPss;
+ oomSwapPss[oomIndex] += myTotalSwapPss;
if (oomProcs[oomIndex] == null) {
oomProcs[oomIndex] = new ArrayList<MemItem>();
}
}
final long myTotalPss = mi.getTotalPss();
+ final long myTotalSwapPss = mi.getTotalSwappedOutPss();
totalPss += myTotalPss;
nativeProcTotalPss += myTotalPss;
MemItem pssItem = new MemItem(st.name + " (pid " + st.pid + ")",
- st.name, myTotalPss, st.pid, false);
+ st.name, myTotalPss, mi.getSummaryTotalSwapPss(), st.pid, false);
procMems.add(pssItem);
nativePss += mi.nativePss;
+ nativeSwapPss += mi.nativeSwappedOutPss;
dalvikPss += mi.dalvikPss;
+ dalvikSwapPss += mi.dalvikSwappedOutPss;
for (int j=0; j<dalvikSubitemPss.length; j++) {
- dalvikSubitemPss[j] += mi.getOtherPss(
- Debug.MemoryInfo.NUM_OTHER_STATS + j);
+ dalvikSubitemPss[j] += mi.getOtherPss(Debug.MemoryInfo.NUM_OTHER_STATS + j);
+ dalvikSubitemSwapPss[j] +=
+ mi.getOtherSwappedOutPss(Debug.MemoryInfo.NUM_OTHER_STATS + j);
}
otherPss += mi.otherPss;
+ otherSwapPss += mi.otherSwappedOutPss;
for (int j=0; j<Debug.MemoryInfo.NUM_OTHER_STATS; j++) {
long mem = mi.getOtherPss(j);
miscPss[j] += mem;
otherPss -= mem;
+ mem = mi.getOtherSwappedOutPss(j);
+ miscSwapPss[j] += mem;
+ otherSwapPss -= mem;
}
oomPss[0] += myTotalPss;
+ oomSwapPss[0] += myTotalSwapPss;
if (oomProcs[0] == null) {
oomProcs[0] = new ArrayList<MemItem>();
}
ArrayList<MemItem> catMems = new ArrayList<MemItem>();
- catMems.add(new MemItem("Native", "Native", nativePss, -1));
- final MemItem dalvikItem = new MemItem("Dalvik", "Dalvik", dalvikPss, -2);
- if (dalvikSubitemPss.length > 0) {
- dalvikItem.subitems = new ArrayList<MemItem>();
- for (int j=0; j<dalvikSubitemPss.length; j++) {
- final String name = Debug.MemoryInfo.getOtherLabel(
- Debug.MemoryInfo.NUM_OTHER_STATS + j);
- dalvikItem.subitems.add(new MemItem(name, name, dalvikSubitemPss[j], j));
- }
- }
- catMems.add(dalvikItem);
- catMems.add(new MemItem("Unknown", "Unknown", otherPss, -3));
+ catMems.add(new MemItem("Native", "Native", nativePss, nativeSwapPss, -1));
+ final int dalvikId = -2;
+ catMems.add(new MemItem("Dalvik", "Dalvik", dalvikPss, dalvikSwapPss, dalvikId));
+ catMems.add(new MemItem("Unknown", "Unknown", otherPss, otherSwapPss, -3));
for (int j=0; j<Debug.MemoryInfo.NUM_OTHER_STATS; j++) {
String label = Debug.MemoryInfo.getOtherLabel(j);
- catMems.add(new MemItem(label, label, miscPss[j], j));
+ catMems.add(new MemItem(label, label, miscPss[j], miscSwapPss[j], j));
+ }
+ if (dalvikSubitemPss.length > 0) {
+ // Add dalvik subitems.
+ for (MemItem memItem : catMems) {
+ int memItemStart = 0, memItemEnd = 0;
+ if (memItem.id == dalvikId) {
+ memItemStart = Debug.MemoryInfo.OTHER_DVK_STAT_DALVIK_START;
+ memItemEnd = Debug.MemoryInfo.OTHER_DVK_STAT_DALVIK_END;
+ } else if (memItem.id == Debug.MemoryInfo.OTHER_DALVIK_OTHER) {
+ memItemStart = Debug.MemoryInfo.OTHER_DVK_STAT_DALVIK_OTHER_START;
+ memItemEnd = Debug.MemoryInfo.OTHER_DVK_STAT_DALVIK_OTHER_END;
+ } else if (memItem.id == Debug.MemoryInfo.OTHER_DEX) {
+ memItemStart = Debug.MemoryInfo.OTHER_DVK_STAT_DEX_START;
+ memItemEnd = Debug.MemoryInfo.OTHER_DVK_STAT_DEX_END;
+ } else if (memItem.id == Debug.MemoryInfo.OTHER_ART) {
+ memItemStart = Debug.MemoryInfo.OTHER_DVK_STAT_ART_START;
+ memItemEnd = Debug.MemoryInfo.OTHER_DVK_STAT_ART_END;
+ } else {
+ continue; // No subitems, continue.
+ }
+ memItem.subitems = new ArrayList<MemItem>();
+ for (int j=memItemStart; j<=memItemEnd; j++) {
+ final String name = Debug.MemoryInfo.getOtherLabel(
+ Debug.MemoryInfo.NUM_OTHER_STATS + j);
+ memItem.subitems.add(new MemItem(name, name, dalvikSubitemPss[j],
+ dalvikSubitemSwapPss[j], j));
+ }
+ }
}
ArrayList<MemItem> oomMems = new ArrayList<MemItem>();
if (oomPss[j] != 0) {
String label = isCompact ? DUMP_MEM_OOM_COMPACT_LABEL[j]
: DUMP_MEM_OOM_LABEL[j];
- MemItem item = new MemItem(label, label, oomPss[j],
+ MemItem item = new MemItem(label, label, oomPss[j], oomSwapPss[j],
DUMP_MEM_OOM_ADJ[j]);
item.subitems = oomProcs[j];
oomMems.add(item);
}
}
+ dumpSwapPss = dumpSwapPss && hasSwapPss && totalSwapPss != 0;
if (!brief && !oomOnly && !isCompact) {
pw.println();
pw.println("Total PSS by process:");
- dumpMemItems(pw, " ", "proc", procMems, true, isCompact);
+ dumpMemItems(pw, " ", "proc", procMems, true, isCompact, dumpSwapPss);
pw.println();
}
if (!isCompact) {
pw.println("Total PSS by OOM adjustment:");
}
- dumpMemItems(pw, " ", "oom", oomMems, false, isCompact);
+ dumpMemItems(pw, " ", "oom", oomMems, false, isCompact, dumpSwapPss);
if (!brief && !oomOnly) {
PrintWriter out = categoryPw != null ? categoryPw : pw;
if (!isCompact) {
out.println();
out.println("Total PSS by category:");
}
- dumpMemItems(out, " ", "cat", catMems, true, isCompact);
+ dumpMemItems(out, " ", "cat", catMems, true, isCompact, dumpSwapPss);
}
if (!isCompact) {
pw.println();
}
if (!brief) {
if (!isCompact) {
- pw.print("Total RAM: "); pw.print(memInfo.getTotalSizeKb());
- pw.print(" kB (status ");
+ pw.print("Total RAM: "); pw.print(stringifyKBSize(memInfo.getTotalSizeKb()));
+ pw.print(" (status ");
switch (mLastMemoryLevel) {
case ProcessStats.ADJ_MEM_FACTOR_NORMAL:
pw.println("normal)");
pw.println(")");
break;
}
- pw.print(" Free RAM: "); pw.print(cachedPss + memInfo.getCachedSizeKb()
- + memInfo.getFreeSizeKb()); pw.print(" kB (");
- pw.print(cachedPss); pw.print(" cached pss + ");
- pw.print(memInfo.getCachedSizeKb()); pw.print(" cached kernel + ");
- pw.print(memInfo.getFreeSizeKb()); pw.println(" free)");
+ pw.print(" Free RAM: ");
+ pw.print(stringifyKBSize(cachedPss + memInfo.getCachedSizeKb()
+ + memInfo.getFreeSizeKb()));
+ pw.print(" (");
+ pw.print(stringifyKBSize(cachedPss));
+ pw.print(" cached pss + ");
+ pw.print(stringifyKBSize(memInfo.getCachedSizeKb()));
+ pw.print(" cached kernel + ");
+ pw.print(stringifyKBSize(memInfo.getFreeSizeKb()));
+ pw.println(" free)");
} else {
pw.print("ram,"); pw.print(memInfo.getTotalSizeKb()); pw.print(",");
pw.print(cachedPss + memInfo.getCachedSizeKb()
pw.println(totalPss - cachedPss);
}
}
+ long lostRAM = memInfo.getTotalSizeKb() - (totalPss - totalSwapPss)
+ - memInfo.getFreeSizeKb() - memInfo.getCachedSizeKb()
+ - memInfo.getKernelUsedSizeKb() - memInfo.getZramTotalSizeKb();
if (!isCompact) {
- pw.print(" Used RAM: "); pw.print(totalPss - cachedPss
- + memInfo.getKernelUsedSizeKb()); pw.print(" kB (");
- pw.print(totalPss - cachedPss); pw.print(" used pss + ");
- pw.print(memInfo.getKernelUsedSizeKb()); pw.print(" kernel)\n");
- pw.print(" Lost RAM: "); pw.print(memInfo.getTotalSizeKb()
- - totalPss - memInfo.getFreeSizeKb() - memInfo.getCachedSizeKb()
- - memInfo.getKernelUsedSizeKb()); pw.println(" kB");
+ pw.print(" Used RAM: "); pw.print(stringifyKBSize(totalPss - cachedPss
+ + memInfo.getKernelUsedSizeKb())); pw.print(" (");
+ pw.print(stringifyKBSize(totalPss - cachedPss)); pw.print(" used pss + ");
+ pw.print(stringifyKBSize(memInfo.getKernelUsedSizeKb())); pw.print(" kernel)\n");
+ pw.print(" Lost RAM: "); pw.println(stringifyKBSize(lostRAM));
+ } else {
+ pw.print("lostram,"); pw.println(lostRAM);
}
if (!brief) {
if (memInfo.getZramTotalSizeKb() != 0) {
if (!isCompact) {
- pw.print(" ZRAM: "); pw.print(memInfo.getZramTotalSizeKb());
- pw.print(" kB physical used for ");
- pw.print(memInfo.getSwapTotalSizeKb()
- - memInfo.getSwapFreeSizeKb());
- pw.print(" kB in swap (");
- pw.print(memInfo.getSwapTotalSizeKb());
- pw.println(" kB total swap)");
+ pw.print(" ZRAM: ");
+ pw.print(stringifyKBSize(memInfo.getZramTotalSizeKb()));
+ pw.print(" physical used for ");
+ pw.print(stringifyKBSize(memInfo.getSwapTotalSizeKb()
+ - memInfo.getSwapFreeSizeKb()));
+ pw.print(" in swap (");
+ pw.print(stringifyKBSize(memInfo.getSwapTotalSizeKb()));
+ pw.println(" total swap)");
} else {
pw.print("zram,"); pw.print(memInfo.getZramTotalSizeKb()); pw.print(",");
pw.print(memInfo.getSwapTotalSizeKb()); pw.print(",");
if (!isCompact) {
if (ksm[KSM_SHARING] != 0 || ksm[KSM_SHARED] != 0 || ksm[KSM_UNSHARED] != 0
|| ksm[KSM_VOLATILE] != 0) {
- pw.print(" KSM: "); pw.print(ksm[KSM_SHARING]);
- pw.print(" kB saved from shared ");
- pw.print(ksm[KSM_SHARED]); pw.println(" kB");
- pw.print(" "); pw.print(ksm[KSM_UNSHARED]);
- pw.print(" kB unshared; ");
- pw.print(ksm[KSM_VOLATILE]); pw.println(" kB volatile");
+ pw.print(" KSM: "); pw.print(stringifyKBSize(ksm[KSM_SHARING]));
+ pw.print(" saved from shared ");
+ pw.print(stringifyKBSize(ksm[KSM_SHARED]));
+ pw.print(" "); pw.print(stringifyKBSize(ksm[KSM_UNSHARED]));
+ pw.print(" unshared; ");
+ pw.print(stringifyKBSize(
+ ksm[KSM_VOLATILE])); pw.println(" volatile");
}
pw.print(" Tuning: ");
pw.print(ActivityManager.staticGetMemoryClass());
pw.print(" (large ");
pw.print(ActivityManager.staticGetLargeMemoryClass());
pw.print("), oom ");
- pw.print(mProcessList.getMemLevel(ProcessList.CACHED_APP_MAX_ADJ)/1024);
- pw.print(" kB");
+ pw.print(stringifySize(
+ mProcessList.getMemLevel(ProcessList.CACHED_APP_MAX_ADJ), 1024));
pw.print(", restore limit ");
- pw.print(mProcessList.getCachedRestoreThresholdKb());
- pw.print(" kB");
+ pw.print(stringifyKBSize(mProcessList.getCachedRestoreThresholdKb()));
if (ActivityManager.isLowRamDeviceStatic()) {
pw.print(" (low-ram)");
}
sb.append(ProcessList.makeProcStateString(procState));
sb.append(' ');
ProcessList.appendRamKb(sb, pss);
- sb.append(" kB: ");
+ sb.append(": ");
sb.append(name);
if (memtrack > 0) {
sb.append(" (");
- sb.append(memtrack);
- sb.append(" kB memtrack)");
+ sb.append(stringifyKBSize(memtrack));
+ sb.append(" memtrack)");
}
}
}
updateCpuStatsNow();
long[] memtrackTmp = new long[1];
+ final List<ProcessCpuTracker.Stats> stats;
+ // Get a list of Stats that have vsize > 0
synchronized (mProcessCpuTracker) {
- final int N = mProcessCpuTracker.countStats();
- for (int i=0; i<N; i++) {
- ProcessCpuTracker.Stats st = mProcessCpuTracker.getStats(i);
- if (st.vsize > 0) {
- long pss = Debug.getPss(st.pid, null, memtrackTmp);
- if (pss > 0) {
- if (infoMap.indexOfKey(st.pid) < 0) {
- ProcessMemInfo mi = new ProcessMemInfo(st.name, st.pid,
- ProcessList.NATIVE_ADJ, -1, "native", null);
- mi.pss = pss;
- mi.memtrack = memtrackTmp[0];
- memInfos.add(mi);
- }
- }
+ stats = mProcessCpuTracker.getStats((st) -> {
+ return st.vsize > 0;
+ });
+ }
+ final int statsCount = stats.size();
+ for (int i = 0; i < statsCount; i++) {
+ ProcessCpuTracker.Stats st = stats.get(i);
+ long pss = Debug.getPss(st.pid, null, memtrackTmp);
+ if (pss > 0) {
+ if (infoMap.indexOfKey(st.pid) < 0) {
+ ProcessMemInfo mi = new ProcessMemInfo(st.name, st.pid,
+ ProcessList.NATIVE_ADJ, -1, "native", null);
+ mi.pss = pss;
+ mi.memtrack = memtrackTmp[0];
+ memInfos.add(mi);
}
}
}
fullJavaBuilder.append(" ");
ProcessList.appendRamKb(fullJavaBuilder, totalPss);
- fullJavaBuilder.append(" kB: TOTAL");
+ fullJavaBuilder.append(": TOTAL");
if (totalMemtrack > 0) {
fullJavaBuilder.append(" (");
- fullJavaBuilder.append(totalMemtrack);
- fullJavaBuilder.append(" kB memtrack)");
+ fullJavaBuilder.append(stringifyKBSize(totalMemtrack));
+ fullJavaBuilder.append(" memtrack)");
} else {
}
fullJavaBuilder.append("\n");
StringBuilder memInfoBuilder = new StringBuilder(1024);
Debug.getMemInfo(infos);
memInfoBuilder.append(" MemInfo: ");
- memInfoBuilder.append(infos[Debug.MEMINFO_SLAB]).append(" kB slab, ");
- memInfoBuilder.append(infos[Debug.MEMINFO_SHMEM]).append(" kB shmem, ");
- memInfoBuilder.append(infos[Debug.MEMINFO_VM_ALLOC_USED]).append(" kB vm alloc, ");
- memInfoBuilder.append(infos[Debug.MEMINFO_PAGE_TABLES]).append(" kB page tables ");
- memInfoBuilder.append(infos[Debug.MEMINFO_KERNEL_STACK]).append(" kB kernel stack\n");
+ memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_SLAB])).append(" slab, ");
+ memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_SHMEM])).append(" shmem, ");
+ memInfoBuilder.append(stringifyKBSize(
+ infos[Debug.MEMINFO_VM_ALLOC_USED])).append(" vm alloc, ");
+ memInfoBuilder.append(stringifyKBSize(
+ infos[Debug.MEMINFO_PAGE_TABLES])).append(" page tables ");
+ memInfoBuilder.append(stringifyKBSize(
+ infos[Debug.MEMINFO_KERNEL_STACK])).append(" kernel stack\n");
memInfoBuilder.append(" ");
- memInfoBuilder.append(infos[Debug.MEMINFO_BUFFERS]).append(" kB buffers, ");
- memInfoBuilder.append(infos[Debug.MEMINFO_CACHED]).append(" kB cached, ");
- memInfoBuilder.append(infos[Debug.MEMINFO_MAPPED]).append(" kB mapped, ");
- memInfoBuilder.append(infos[Debug.MEMINFO_FREE]).append(" kB free\n");
+ memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_BUFFERS])).append(" buffers, ");
+ memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_CACHED])).append(" cached, ");
+ memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_MAPPED])).append(" mapped, ");
+ memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_FREE])).append(" free\n");
if (infos[Debug.MEMINFO_ZRAM_TOTAL] != 0) {
memInfoBuilder.append(" ZRAM: ");
- memInfoBuilder.append(infos[Debug.MEMINFO_ZRAM_TOTAL]);
- memInfoBuilder.append(" kB RAM, ");
- memInfoBuilder.append(infos[Debug.MEMINFO_SWAP_TOTAL]);
- memInfoBuilder.append(" kB swap total, ");
- memInfoBuilder.append(infos[Debug.MEMINFO_SWAP_FREE]);
- memInfoBuilder.append(" kB swap free\n");
+ memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_ZRAM_TOTAL]));
+ memInfoBuilder.append(" RAM, ");
+ memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_SWAP_TOTAL]));
+ memInfoBuilder.append(" swap total, ");
+ memInfoBuilder.append(stringifyKBSize(infos[Debug.MEMINFO_SWAP_FREE]));
+ memInfoBuilder.append(" swap free\n");
}
final long[] ksm = getKsmInfo();
if (ksm[KSM_SHARING] != 0 || ksm[KSM_SHARED] != 0 || ksm[KSM_UNSHARED] != 0
|| ksm[KSM_VOLATILE] != 0) {
- memInfoBuilder.append(" KSM: "); memInfoBuilder.append(ksm[KSM_SHARING]);
- memInfoBuilder.append(" kB saved from shared ");
- memInfoBuilder.append(ksm[KSM_SHARED]); memInfoBuilder.append(" kB\n");
- memInfoBuilder.append(" "); memInfoBuilder.append(ksm[KSM_UNSHARED]);
- memInfoBuilder.append(" kB unshared; ");
- memInfoBuilder.append(ksm[KSM_VOLATILE]); memInfoBuilder.append(" kB volatile\n");
+ memInfoBuilder.append(" KSM: ");
+ memInfoBuilder.append(stringifyKBSize(ksm[KSM_SHARING]));
+ memInfoBuilder.append(" saved from shared ");
+ memInfoBuilder.append(stringifyKBSize(ksm[KSM_SHARED]));
+ memInfoBuilder.append("\n ");
+ memInfoBuilder.append(stringifyKBSize(ksm[KSM_UNSHARED]));
+ memInfoBuilder.append(" unshared; ");
+ memInfoBuilder.append(stringifyKBSize(ksm[KSM_VOLATILE]));
+ memInfoBuilder.append(" volatile\n");
}
memInfoBuilder.append(" Free RAM: ");
- memInfoBuilder.append(cachedPss + memInfo.getCachedSizeKb()
- + memInfo.getFreeSizeKb());
- memInfoBuilder.append(" kB\n");
+ memInfoBuilder.append(stringifyKBSize(cachedPss + memInfo.getCachedSizeKb()
+ + memInfo.getFreeSizeKb()));
+ memInfoBuilder.append("\n");
memInfoBuilder.append(" Used RAM: ");
- memInfoBuilder.append(totalPss - cachedPss + memInfo.getKernelUsedSizeKb());
- memInfoBuilder.append(" kB\n");
+ memInfoBuilder.append(stringifyKBSize(
+ totalPss - cachedPss + memInfo.getKernelUsedSizeKb()));
+ memInfoBuilder.append("\n");
memInfoBuilder.append(" Lost RAM: ");
- memInfoBuilder.append(memInfo.getTotalSizeKb()
+ memInfoBuilder.append(stringifyKBSize(memInfo.getTotalSizeKb()
- totalPss - memInfo.getFreeSizeKb() - memInfo.getCachedSizeKb()
- - memInfo.getKernelUsedSizeKb());
- memInfoBuilder.append(" kB\n");
+ - memInfo.getKernelUsedSizeKb() - memInfo.getZramTotalSizeKb()));
+ memInfoBuilder.append("\n");
Slog.i(TAG, "Low on memory:");
Slog.i(TAG, shortNativeBuilder.toString());
Slog.i(TAG, fullJavaBuilder.toString());
catPw.println();
dumpProcessesLocked(null, catPw, emptyArgs, 0, false, null);
catPw.println();
- mServices.dumpServicesLocked(null, catPw, emptyArgs, 0,
- false, false, null);
+ mServices.newServiceDumperLocked(null, catPw, emptyArgs, 0,
+ false, null).dumpLocked();
catPw.println();
dumpActivitiesLocked(null, catPw, emptyArgs, 0, false, false, null);
catPw.flush();
&& capp.pid != MY_PID) {
capp.kill("depends on provider "
+ cpr.name.flattenToShortString()
- + " in dying proc " + (proc != null ? proc.processName : "??"), true);
+ + " in dying proc " + (proc != null ? proc.processName : "??")
+ + " (adj " + (proc != null ? proc.setAdj : "??") + ")", true);
}
} else if (capp.thread != null && conn.provider.provider != null) {
try {
*/
private final boolean cleanUpApplicationRecordLocked(ProcessRecord app,
boolean restarting, boolean allowRestart, int index, boolean replacingPid) {
- Slog.d(TAG, "cleanUpApplicationRecord -- " + app.pid);
if (index >= 0) {
removeLruProcessLocked(app);
ProcessList.remove(app.pid);
app.unlinkDeathRecipient();
app.makeInactive(mProcessStats);
app.waitingToKill = null;
- app.forcingToForeground = null;
+ app.forcingToImportant = null;
updateProcessForegroundLocked(app, false, false);
app.foregroundActivities = false;
app.hasShownUi = false;
if (mBackupTarget != null && app.pid == mBackupTarget.app.pid) {
if (DEBUG_BACKUP || DEBUG_CLEANUP) Slog.d(TAG_CLEANUP, "App "
+ mBackupTarget.appInfo + " died during backup");
- try {
- IBackupManager bm = IBackupManager.Stub.asInterface(
- ServiceManager.getService(Context.BACKUP_SERVICE));
- bm.agentDisconnected(app.info.packageName);
- } catch (RemoteException e) {
- // can't happen; backup manager is local
- }
+ mHandler.post(new Runnable() {
+ @Override
+ public void run(){
+ try {
+ IBackupManager bm = IBackupManager.Stub.asInterface(
+ ServiceManager.getService(Context.BACKUP_SERVICE));
+ bm.agentDisconnected(app.info.packageName);
+ } catch (RemoteException e) {
+ // can't happen; backup manager is local
+ }
+ }
+ });
}
for (int i = mPendingProcessChanges.size() - 1; i >= 0; i--) {
mAvailProcessChanges.add(item);
}
}
- mUiHandler.obtainMessage(DISPATCH_PROCESS_DIED, app.pid, app.info.uid, null).sendToTarget();
+ mUiHandler.obtainMessage(DISPATCH_PROCESS_DIED_UI_MSG, app.pid, app.info.uid,
+ null).sendToTarget();
// If the caller is restarting this app, then leave it in its
// current lists and let the caller take care of it.
if (DEBUG_PROCESSES || DEBUG_CLEANUP) Slog.v(TAG_CLEANUP,
"Removing non-persistent process during cleanup: " + app);
if (!replacingPid) {
- removeProcessNameLocked(app.processName, app.uid);
+ removeProcessNameLocked(app.processName, app.uid, app);
}
if (mHeavyWeightProcess == app) {
mHandler.sendMessage(mHandler.obtainMessage(CANCEL_HEAVY_NOTIFICATION_MSG,
public List<ActivityManager.RunningServiceInfo> getServices(int maxNum,
int flags) {
enforceNotIsolatedCaller("getServices");
+
+ final int callingUid = Binder.getCallingUid();
+ final boolean canInteractAcrossUsers = (ActivityManager.checkUidPermission(
+ INTERACT_ACROSS_USERS_FULL, callingUid) == PERMISSION_GRANTED);
+ final boolean allowed = isGetTasksAllowed("getServices", Binder.getCallingPid(),
+ callingUid);
synchronized (this) {
- return mServices.getRunningServiceInfoLocked(maxNum, flags);
+ return mServices.getRunningServiceInfoLocked(maxNum, flags, callingUid,
+ allowed, canInteractAcrossUsers);
}
}
@Override
public ComponentName startService(IApplicationThread caller, Intent service,
- String resolvedType, String callingPackage, int userId)
+ String resolvedType, boolean requireForeground, String callingPackage, int userId)
throws TransactionTooLargeException {
enforceNotIsolatedCaller("startService");
// Refuse possible leaked file descriptors
}
if (DEBUG_SERVICE) Slog.v(TAG_SERVICE,
- "startService: " + service + " type=" + resolvedType);
+ "*** startService: " + service + " type=" + resolvedType + " fg=" + requireForeground);
synchronized(this) {
final int callingPid = Binder.getCallingPid();
final int callingUid = Binder.getCallingUid();
final long origId = Binder.clearCallingIdentity();
- ComponentName res = mServices.startServiceLocked(caller, service,
- resolvedType, callingPid, callingUid, callingPackage, userId);
- Binder.restoreCallingIdentity(origId);
+ ComponentName res;
+ try {
+ res = mServices.startServiceLocked(caller, service,
+ resolvedType, callingPid, callingUid,
+ requireForeground, callingPackage, userId);
+ } finally {
+ Binder.restoreCallingIdentity(origId);
+ }
return res;
}
}
ComponentName startServiceInPackage(int uid, Intent service, String resolvedType,
- String callingPackage, int userId)
+ boolean fgRequired, String callingPackage, int userId)
throws TransactionTooLargeException {
synchronized(this) {
if (DEBUG_SERVICE) Slog.v(TAG_SERVICE,
"startServiceInPackage: " + service + " type=" + resolvedType);
final long origId = Binder.clearCallingIdentity();
- ComponentName res = mServices.startServiceLocked(null, service,
- resolvedType, -1, uid, callingPackage, userId);
- Binder.restoreCallingIdentity(origId);
+ ComponentName res;
+ try {
+ res = mServices.startServiceLocked(null, service,
+ resolvedType, -1, uid, fgRequired, callingPackage, userId);
+ } finally {
+ Binder.restoreCallingIdentity(origId);
+ }
return res;
}
}
@Override
public void setServiceForeground(ComponentName className, IBinder token,
- int id, Notification notification, boolean removeNotification) {
+ int id, Notification notification, int flags) {
synchronized(this) {
- mServices.setServiceForegroundLocked(className, token, id, notification,
- removeNotification);
+ mServices.setServiceForegroundLocked(className, token, id, notification, flags);
}
}
@Override
public int handleIncomingUser(int callingPid, int callingUid, int userId, boolean allowAll,
boolean requireFull, String name, String callerPackage) {
- return handleIncomingUser(callingPid, callingUid, userId, allowAll,
+ return mUserController.handleIncomingUser(callingPid, callingUid, userId, allowAll,
requireFull ? ALLOW_FULL_ONLY : ALLOW_NON_FULL, name, callerPackage);
}
- int unsafeConvertIncomingUser(int userId) {
- return (userId == UserHandle.USER_CURRENT || userId == UserHandle.USER_CURRENT_OR_SELF)
- ? mCurrentUserId : userId;
- }
-
- int handleIncomingUser(int callingPid, int callingUid, int userId, boolean allowAll,
- int allowMode, String name, String callerPackage) {
- final int callingUserId = UserHandle.getUserId(callingUid);
- if (callingUserId == userId) {
- return userId;
- }
-
- // Note that we may be accessing mCurrentUserId outside of a lock...
- // shouldn't be a big deal, if this is being called outside
- // of a locked context there is intrinsically a race with
- // the value the caller will receive and someone else changing it.
- // We assume that USER_CURRENT_OR_SELF will use the current user; later
- // we will switch to the calling user if access to the current user fails.
- int targetUserId = unsafeConvertIncomingUser(userId);
-
- if (callingUid != 0 && callingUid != Process.SYSTEM_UID) {
- final boolean allow;
- if (checkComponentPermission(INTERACT_ACROSS_USERS_FULL, callingPid,
- callingUid, -1, true) == PackageManager.PERMISSION_GRANTED) {
- // If the caller has this permission, they always pass go. And collect $200.
- allow = true;
- } else if (allowMode == ALLOW_FULL_ONLY) {
- // We require full access, sucks to be you.
- allow = false;
- } else if (checkComponentPermission(INTERACT_ACROSS_USERS, callingPid,
- callingUid, -1, true) != PackageManager.PERMISSION_GRANTED) {
- // If the caller does not have either permission, they are always doomed.
- allow = false;
- } else if (allowMode == ALLOW_NON_FULL) {
- // We are blanket allowing non-full access, you lucky caller!
- allow = true;
- } else if (allowMode == ALLOW_NON_FULL_IN_PROFILE) {
- // We may or may not allow this depending on whether the two users are
- // in the same profile.
- synchronized (mUserProfileGroupIdsSelfLocked) {
- int callingProfile = mUserProfileGroupIdsSelfLocked.get(callingUserId,
- UserInfo.NO_PROFILE_GROUP_ID);
- int targetProfile = mUserProfileGroupIdsSelfLocked.get(targetUserId,
- UserInfo.NO_PROFILE_GROUP_ID);
- allow = callingProfile != UserInfo.NO_PROFILE_GROUP_ID
- && callingProfile == targetProfile;
- }
- } else {
- throw new IllegalArgumentException("Unknown mode: " + allowMode);
- }
- if (!allow) {
- if (userId == UserHandle.USER_CURRENT_OR_SELF) {
- // In this case, they would like to just execute as their
- // owner user instead of failing.
- targetUserId = callingUserId;
- } else {
- StringBuilder builder = new StringBuilder(128);
- builder.append("Permission Denial: ");
- builder.append(name);
- if (callerPackage != null) {
- builder.append(" from ");
- builder.append(callerPackage);
- }
- builder.append(" asks to run as user ");
- builder.append(userId);
- builder.append(" but is calling from user ");
- builder.append(UserHandle.getUserId(callingUid));
- builder.append("; this requires ");
- builder.append(INTERACT_ACROSS_USERS_FULL);
- if (allowMode != ALLOW_FULL_ONLY) {
- builder.append(" or ");
- builder.append(INTERACT_ACROSS_USERS);
- }
- String msg = builder.toString();
- Slog.w(TAG, msg);
- throw new SecurityException(msg);
- }
- }
- }
- if (!allowAll && targetUserId < 0) {
- throw new IllegalArgumentException(
- "Call does not support special user #" + targetUserId);
- }
- // Check shell permission
- if (callingUid == Process.SHELL_UID && targetUserId >= UserHandle.USER_OWNER) {
- if (mUserManager.hasUserRestriction(UserManager.DISALLOW_DEBUGGING_FEATURES,
- targetUserId)) {
- throw new SecurityException("Shell does not have permission to access user "
- + targetUserId + "\n " + Debug.getCallers(3));
- }
- }
- return targetUserId;
- }
-
boolean isSingleton(String componentProcessName, ApplicationInfo aInfo,
String className, int flags) {
boolean result = false;
// For apps that don't have pre-defined UIDs, check for permission
- if (UserHandle.getAppId(aInfo.uid) >= Process.FIRST_APPLICATION_UID) {
+ if (UserHandle.getAppId(aInfo.uid) >= FIRST_APPLICATION_UID) {
if ((flags & ServiceInfo.FLAG_SINGLE_USER) != 0) {
if (ActivityManager.checkUidPermission(
INTERACT_ACROSS_USERS,
result = true;
} else if ((flags & ServiceInfo.FLAG_SINGLE_USER) != 0) {
// Phone app and persistent apps are allowed to export singleuser providers.
- result = UserHandle.isSameApp(aInfo.uid, Process.PHONE_UID)
+ result = UserHandle.isSameApp(aInfo.uid, PHONE_UID)
|| (aInfo.flags & ApplicationInfo.FLAG_PERSISTENT) != 0;
}
if (DEBUG_MU) Slog.v(TAG_MU,
boolean isValidSingletonCall(int callingUid, int componentUid) {
int componentAppId = UserHandle.getAppId(componentUid);
return UserHandle.isSameApp(callingUid, componentUid)
- || componentAppId == Process.SYSTEM_UID
- || componentAppId == Process.PHONE_UID
+ || componentAppId == SYSTEM_UID
+ || componentAppId == PHONE_UID
|| ActivityManager.checkUidPermission(INTERACT_ACROSS_USERS_FULL, componentUid)
== PackageManager.PERMISSION_GRANTED;
}
return false;
}
+ int oldBackupUid;
+ int newBackupUid;
+
synchronized(this) {
// !!! TODO: currently no check here that we're already bound
BatteryStatsImpl.Uid.Pkg.Serv ss = null;
}
BackupRecord r = new BackupRecord(ss, app, backupMode);
- ComponentName hostingName = (backupMode == IApplicationThread.BACKUP_MODE_INCREMENTAL)
- ? new ComponentName(app.packageName, app.backupAgentName)
- : new ComponentName("android", "FullBackupAgent");
+ ComponentName hostingName =
+ (backupMode == ApplicationThreadConstants.BACKUP_MODE_INCREMENTAL)
+ ? new ComponentName(app.packageName, app.backupAgentName)
+ : new ComponentName("android", "FullBackupAgent");
// startProcessLocked() returns existing proc's record if it's already running
ProcessRecord proc = startProcessLocked(app.processName, app,
false, 0, "backup", hostingName, false, false, false);
return false;
}
+ // If the app is a regular app (uid >= 10000) and not the system server or phone
+ // process, etc, then mark it as being in full backup so that certain calls to the
+ // process can be blocked. This is not reset to false anywhere because we kill the
+ // process after the full backup is done and the ProcessRecord will vaporize anyway.
+ if (UserHandle.isApp(app.uid) &&
+ backupMode == ApplicationThreadConstants.BACKUP_MODE_FULL) {
+ proc.inFullBackup = true;
+ }
r.app = proc;
+ oldBackupUid = mBackupTarget != null ? mBackupTarget.appInfo.uid : -1;
+ newBackupUid = proc.inFullBackup ? r.appInfo.uid : -1;
mBackupTarget = r;
mBackupAppName = app.packageName;
// Try not to kill the process during backup
- updateOomAdjLocked(proc);
+ updateOomAdjLocked(proc, true);
// If the process is already attached, schedule the creation of the backup agent now.
// If it is not yet live, this will be done when it attaches to the framework.
// know that it's scheduled for a backup-agent operation.
}
+ JobSchedulerInternal js = LocalServices.getService(JobSchedulerInternal.class);
+ if (oldBackupUid != -1) {
+ js.removeBackingUpUid(oldBackupUid);
+ }
+ if (newBackupUid != -1) {
+ js.addBackingUpUid(newBackupUid);
+ }
+
return true;
}
mBackupTarget = null;
mBackupAppName = null;
}
+
+ JobSchedulerInternal js = LocalServices.getService(JobSchedulerInternal.class);
+ js.clearAllBackingUpUids();
}
// A backup agent has just come up
return;
}
+ int oldBackupUid;
+
synchronized(this) {
try {
if (mBackupAppName == null) {
// Not backing this app up any more; reset its OOM adjustment
final ProcessRecord proc = mBackupTarget.app;
- updateOomAdjLocked(proc);
+ updateOomAdjLocked(proc, true);
+ proc.inFullBackup = false;
+
+ oldBackupUid = mBackupTarget != null ? mBackupTarget.appInfo.uid : -1;
// If the app crashed during backup, 'thread' will be null here
if (proc.thread != null) {
mBackupAppName = null;
}
}
+
+ if (oldBackupUid != -1) {
+ JobSchedulerInternal js = LocalServices.getService(JobSchedulerInternal.class);
+ js.removeBackingUpUid(oldBackupUid);
+ }
}
+
// =========================================================
// BROADCASTS
// =========================================================
+ private boolean isInstantApp(ProcessRecord record, String callerPackage, int uid) {
+ if (UserHandle.getAppId(uid) < FIRST_APPLICATION_UID) {
+ return false;
+ }
+ // Easy case -- we have the app's ProcessRecord.
+ if (record != null) {
+ return record.info.isInstantApp();
+ }
+ // Otherwise check with PackageManager.
+ if (callerPackage == null) {
+ Slog.e(TAG, "isInstantApp with an application's uid, no record, and no package name");
+ throw new IllegalArgumentException("Calling application did not provide package name");
+ }
+ mAppOpsService.checkPackage(uid, callerPackage);
+ try {
+ IPackageManager pm = AppGlobals.getPackageManager();
+ return pm.isInstantApp(callerPackage, UserHandle.getUserId(uid));
+ } catch (RemoteException e) {
+ Slog.e(TAG, "Error looking up if " + callerPackage + " is an instant app.", e);
+ return true;
+ }
+ }
+
boolean isPendingBroadcastProcessLocked(int pid) {
return mFgBroadcastQueue.isPendingBroadcastProcessLocked(pid)
|| mBgBroadcastQueue.isPendingBroadcastProcessLocked(pid);
}
public Intent registerReceiver(IApplicationThread caller, String callerPackage,
- IIntentReceiver receiver, IntentFilter filter, String permission, int userId) {
+ IIntentReceiver receiver, IntentFilter filter, String permission, int userId,
+ int flags) {
enforceNotIsolatedCaller("registerReceiver");
ArrayList<Intent> stickyIntents = null;
ProcessRecord callerApp = null;
+ final boolean visibleToInstantApps
+ = (flags & Context.RECEIVER_VISIBLE_TO_INSTANT_APPS) != 0;
int callingUid;
int callingPid;
+ boolean instantApp;
synchronized(this) {
if (caller != null) {
callerApp = getRecordForAppLocked(caller);
+ " (pid=" + Binder.getCallingPid()
+ ") when registering receiver " + receiver);
}
- if (callerApp.info.uid != Process.SYSTEM_UID &&
+ if (callerApp.info.uid != SYSTEM_UID &&
!callerApp.pkgList.containsKey(callerPackage) &&
!"android".equals(callerPackage)) {
throw new SecurityException("Given caller package " + callerPackage
callingPid = Binder.getCallingPid();
}
- userId = handleIncomingUser(callingPid, callingUid, userId,
- true, ALLOW_FULL_ONLY, "registerReceiver", callerPackage);
+ instantApp = isInstantApp(callerApp, callerPackage, callingUid);
+ userId = mUserController.handleIncomingUser(callingPid, callingUid, userId, true,
+ ALLOW_FULL_ONLY, "registerReceiver", callerPackage);
Iterator<String> actions = filter.actionsIterator();
if (actions == null) {
// Look for any matching sticky broadcasts...
for (int i = 0, N = stickyIntents.size(); i < N; i++) {
Intent intent = stickyIntents.get(i);
+ // Don't provided intents that aren't available to instant apps.
+ if (instantApp &&
+ (intent.getFlags() & Intent.FLAG_RECEIVER_VISIBLE_TO_INSTANT_APPS) == 0) {
+ continue;
+ }
// If intent has scheme "content", it will need to acccess
// provider that needs to lock mProviderMap in ActivityThread
// and also it may need to wait application response, so we
} else if (rl.uid != callingUid) {
throw new IllegalArgumentException(
"Receiver requested to register for uid " + callingUid
- + " was previously registered for uid " + rl.uid);
+ + " was previously registered for uid " + rl.uid
+ + " callerPackage is " + callerPackage);
} else if (rl.pid != callingPid) {
throw new IllegalArgumentException(
"Receiver requested to register for pid " + callingPid
- + " was previously registered for pid " + rl.pid);
+ + " was previously registered for pid " + rl.pid
+ + " callerPackage is " + callerPackage);
} else if (rl.userId != userId) {
throw new IllegalArgumentException(
"Receiver requested to register for user " + userId
- + " was previously registered for user " + rl.userId);
+ + " was previously registered for user " + rl.userId
+ + " callerPackage is " + callerPackage);
}
BroadcastFilter bf = new BroadcastFilter(filter, rl, callerPackage,
- permission, callingUid, userId);
+ permission, callingUid, userId, instantApp, visibleToInstantApps);
rl.add(bf);
if (!bf.debugCheck()) {
Slog.w(TAG, "==> For Dynamic broadcast");
Intent intent = allSticky.get(i);
BroadcastQueue queue = broadcastQueueForIntent(intent);
BroadcastRecord r = new BroadcastRecord(queue, intent, null,
- null, -1, -1, null, null, AppOpsManager.OP_NONE, null, receivers,
+ null, -1, -1, false, null, null, AppOpsManager.OP_NONE, null, receivers,
null, 0, null, null, false, true, true, -1);
queue.enqueueParallelBroadcastLocked(r);
queue.scheduleBroadcastsLocked();
private List<ResolveInfo> collectReceiverComponents(Intent intent, String resolvedType,
int callingUid, int[] users) {
+ // TODO: come back and remove this assumption to triage all broadcasts
+ int pmFlags = STOCK_PM_FLAGS | MATCH_DEBUG_TRIAGED_MISSING;
+
List<ResolveInfo> receivers = null;
try {
HashSet<ComponentName> singleUserReceivers = null;
boolean scannedFirstReceivers = false;
for (int user : users) {
- // Skip users that have Shell restrictions
- if (callingUid == Process.SHELL_UID
- && getUserManagerLocked().hasUserRestriction(
- UserManager.DISALLOW_DEBUGGING_FEATURES, user)) {
+ // Skip users that have Shell restrictions, with exception of always permitted
+ // Shell broadcasts
+ if (callingUid == SHELL_UID
+ && mUserController.hasUserRestriction(
+ UserManager.DISALLOW_DEBUGGING_FEATURES, user)
+ && !isPermittedShellBroadcast(intent)) {
continue;
}
List<ResolveInfo> newReceivers = AppGlobals.getPackageManager()
- .queryIntentReceivers(intent, resolvedType, STOCK_PM_FLAGS, user);
- if (user != UserHandle.USER_OWNER && newReceivers != null) {
- // If this is not the primary user, we need to check for
+ .queryIntentReceivers(intent, resolvedType, pmFlags, user).getList();
+ if (user != UserHandle.USER_SYSTEM && newReceivers != null) {
+ // If this is not the system user, we need to check for
// any receivers that should be filtered out.
for (int i=0; i<newReceivers.size(); i++) {
ResolveInfo ri = newReceivers.get(i);
- if ((ri.activityInfo.flags&ActivityInfo.FLAG_PRIMARY_USER_ONLY) != 0) {
+ if ((ri.activityInfo.flags&ActivityInfo.FLAG_SYSTEM_USER_ONLY) != 0) {
newReceivers.remove(i);
i--;
}
return receivers;
}
- private final int broadcastIntentLocked(ProcessRecord callerApp,
+ private boolean isPermittedShellBroadcast(Intent intent) {
+ // remote bugreport should always be allowed to be taken
+ return INTENT_REMOTE_BUGREPORT_FINISHED.equals(intent.getAction());
+ }
+
+ private void checkBroadcastFromSystem(Intent intent, ProcessRecord callerApp,
+ String callerPackage, int callingUid, boolean isProtectedBroadcast, List receivers) {
+ if ((intent.getFlags() & Intent.FLAG_RECEIVER_FROM_SHELL) != 0) {
+ // Don't yell about broadcasts sent via shell
+ return;
+ }
+
+ final String action = intent.getAction();
+ if (isProtectedBroadcast
+ || Intent.ACTION_CLOSE_SYSTEM_DIALOGS.equals(action)
+ || Intent.ACTION_DISMISS_KEYBOARD_SHORTCUTS.equals(action)
+ || Intent.ACTION_MEDIA_BUTTON.equals(action)
+ || Intent.ACTION_MEDIA_SCANNER_SCAN_FILE.equals(action)
+ || Intent.ACTION_SHOW_KEYBOARD_SHORTCUTS.equals(action)
+ || Intent.ACTION_MASTER_CLEAR.equals(action)
+ || Intent.ACTION_FACTORY_RESET.equals(action)
+ || AppWidgetManager.ACTION_APPWIDGET_CONFIGURE.equals(action)
+ || AppWidgetManager.ACTION_APPWIDGET_UPDATE.equals(action)
+ || LocationManager.HIGH_POWER_REQUEST_CHANGE_ACTION.equals(action)
+ || TelephonyIntents.ACTION_REQUEST_OMADM_CONFIGURATION_UPDATE.equals(action)
+ || SuggestionSpan.ACTION_SUGGESTION_PICKED.equals(action)
+ || AudioEffect.ACTION_OPEN_AUDIO_EFFECT_CONTROL_SESSION.equals(action)
+ || AudioEffect.ACTION_CLOSE_AUDIO_EFFECT_CONTROL_SESSION.equals(action)) {
+ // Broadcast is either protected, or it's a public action that
+ // we've relaxed, so it's fine for system internals to send.
+ return;
+ }
+
+ // This broadcast may be a problem... but there are often system components that
+ // want to send an internal broadcast to themselves, which is annoying to have to
+ // explicitly list each action as a protected broadcast, so we will check for that
+ // one safe case and allow it: an explicit broadcast, only being received by something
+ // that has protected itself.
+ if (receivers != null && receivers.size() > 0
+ && (intent.getPackage() != null || intent.getComponent() != null)) {
+ boolean allProtected = true;
+ for (int i = receivers.size()-1; i >= 0; i--) {
+ Object target = receivers.get(i);
+ if (target instanceof ResolveInfo) {
+ ResolveInfo ri = (ResolveInfo)target;
+ if (ri.activityInfo.exported && ri.activityInfo.permission == null) {
+ allProtected = false;
+ break;
+ }
+ } else {
+ BroadcastFilter bf = (BroadcastFilter)target;
+ if (bf.requiredPermission == null) {
+ allProtected = false;
+ break;
+ }
+ }
+ }
+ if (allProtected) {
+ // All safe!
+ return;
+ }
+ }
+
+ // The vast majority of broadcasts sent from system internals
+ // should be protected to avoid security holes, so yell loudly
+ // to ensure we examine these cases.
+ if (callerApp != null) {
+ Log.wtf(TAG, "Sending non-protected broadcast " + action
+ + " from system " + callerApp.toShortString() + " pkg " + callerPackage,
+ new Throwable());
+ } else {
+ Log.wtf(TAG, "Sending non-protected broadcast " + action
+ + " from system uid " + UserHandle.formatUid(callingUid)
+ + " pkg " + callerPackage,
+ new Throwable());
+ }
+ }
+
+ final int broadcastIntentLocked(ProcessRecord callerApp,
String callerPackage, Intent intent, String resolvedType,
IIntentReceiver resultTo, int resultCode, String resultData,
- Bundle resultExtras, String[] requiredPermissions, int appOp, Bundle options,
+ Bundle resultExtras, String[] requiredPermissions, int appOp, Bundle bOptions,
boolean ordered, boolean sticky, int callingPid, int callingUid, int userId) {
intent = new Intent(intent);
+ final boolean callerInstantApp = isInstantApp(callerApp, callerPackage, callingUid);
+ // Instant Apps cannot use FLAG_RECEIVER_VISIBLE_TO_INSTANT_APPS
+ if (callerInstantApp) {
+ intent.setFlags(intent.getFlags() & ~Intent.FLAG_RECEIVER_VISIBLE_TO_INSTANT_APPS);
+ }
+
// By default broadcasts do not go to stopped apps.
intent.addFlags(Intent.FLAG_EXCLUDE_STOPPED_PACKAGES);
Slog.w(TAG, "Broadcast " + intent + " not ordered but result callback requested!");
}
- userId = handleIncomingUser(callingPid, callingUid, userId,
- true, ALLOW_NON_FULL, "broadcast", callerPackage);
+ userId = mUserController.handleIncomingUser(callingPid, callingUid, userId, true,
+ ALLOW_NON_FULL, "broadcast", callerPackage);
// Make sure that the user who is receiving this broadcast is running.
// If not, we will just skip it. Make an exception for shutdown broadcasts
// and upgrade steps.
- if (userId != UserHandle.USER_ALL && !isUserRunningLocked(userId, false)) {
- if ((callingUid != Process.SYSTEM_UID
+ if (userId != UserHandle.USER_ALL && !mUserController.isUserRunningLocked(userId, 0)) {
+ if ((callingUid != SYSTEM_UID
|| (intent.getFlags() & Intent.FLAG_RECEIVER_BOOT_UPGRADE) == 0)
&& !Intent.ACTION_SHUTDOWN.equals(intent.getAction())) {
Slog.w(TAG, "Skipping broadcast of " + intent
}
BroadcastOptions brOptions = null;
- if (options != null) {
- brOptions = new BroadcastOptions(options);
+ if (bOptions != null) {
+ brOptions = new BroadcastOptions(bOptions);
if (brOptions.getTemporaryAppWhitelistDuration() > 0) {
// See if the caller is allowed to do this. Note we are checking against
// the actual real caller (not whoever provided the operation as say a
}
}
- /*
- * Prevent non-system code (defined here to be non-persistent
- * processes) from sending protected broadcasts.
- */
- int callingAppId = UserHandle.getAppId(callingUid);
- if (callingAppId == Process.SYSTEM_UID || callingAppId == Process.PHONE_UID
- || callingAppId == Process.SHELL_UID || callingAppId == Process.BLUETOOTH_UID
- || callingAppId == Process.NFC_UID || callingUid == 0) {
- // Always okay.
- } else if (callerApp == null || !callerApp.persistent) {
- try {
- if (AppGlobals.getPackageManager().isProtectedBroadcast(
- intent.getAction())) {
+ // Verify that protected broadcasts are only being sent by system code,
+ // and that system code is only sending protected broadcasts.
+ final String action = intent.getAction();
+ final boolean isProtectedBroadcast;
+ try {
+ isProtectedBroadcast = AppGlobals.getPackageManager().isProtectedBroadcast(action);
+ } catch (RemoteException e) {
+ Slog.w(TAG, "Remote exception", e);
+ return ActivityManager.BROADCAST_SUCCESS;
+ }
+
+ final boolean isCallerSystem;
+ switch (UserHandle.getAppId(callingUid)) {
+ case ROOT_UID:
+ case SYSTEM_UID:
+ case PHONE_UID:
+ case BLUETOOTH_UID:
+ case NFC_UID:
+ isCallerSystem = true;
+ break;
+ default:
+ isCallerSystem = (callerApp != null) && callerApp.persistent;
+ break;
+ }
+
+ // First line security check before anything else: stop non-system apps from
+ // sending protected broadcasts.
+ if (!isCallerSystem) {
+ if (isProtectedBroadcast) {
+ String msg = "Permission Denial: not allowed to send broadcast "
+ + action + " from pid="
+ + callingPid + ", uid=" + callingUid;
+ Slog.w(TAG, msg);
+ throw new SecurityException(msg);
+
+ } else if (AppWidgetManager.ACTION_APPWIDGET_CONFIGURE.equals(action)
+ || AppWidgetManager.ACTION_APPWIDGET_UPDATE.equals(action)) {
+ // Special case for compatibility: we don't want apps to send this,
+ // but historically it has not been protected and apps may be using it
+ // to poke their own app widget. So, instead of making it protected,
+ // just limit it to the caller.
+ if (callerPackage == null) {
String msg = "Permission Denial: not allowed to send broadcast "
- + intent.getAction() + " from pid="
- + callingPid + ", uid=" + callingUid;
+ + action + " from unknown caller.";
Slog.w(TAG, msg);
throw new SecurityException(msg);
- } else if (AppWidgetManager.ACTION_APPWIDGET_CONFIGURE.equals(intent.getAction())) {
- // Special case for compatibility: we don't want apps to send this,
- // but historically it has not been protected and apps may be using it
- // to poke their own app widget. So, instead of making it protected,
- // just limit it to the caller.
- if (callerApp == null) {
+ } else if (intent.getComponent() != null) {
+ // They are good enough to send to an explicit component... verify
+ // it is being sent to the calling app.
+ if (!intent.getComponent().getPackageName().equals(
+ callerPackage)) {
String msg = "Permission Denial: not allowed to send broadcast "
- + intent.getAction() + " from unknown caller.";
+ + action + " to "
+ + intent.getComponent().getPackageName() + " from "
+ + callerPackage;
Slog.w(TAG, msg);
throw new SecurityException(msg);
- } else if (intent.getComponent() != null) {
- // They are good enough to send to an explicit component... verify
- // it is being sent to the calling app.
- if (!intent.getComponent().getPackageName().equals(
- callerApp.info.packageName)) {
- String msg = "Permission Denial: not allowed to send broadcast "
- + intent.getAction() + " to "
- + intent.getComponent().getPackageName() + " from "
- + callerApp.info.packageName;
- Slog.w(TAG, msg);
- throw new SecurityException(msg);
- }
- } else {
- // Limit broadcast to their own package.
- intent.setPackage(callerApp.info.packageName);
}
+ } else {
+ // Limit broadcast to their own package.
+ intent.setPackage(callerPackage);
}
- } catch (RemoteException e) {
- Slog.w(TAG, "Remote exception", e);
- return ActivityManager.BROADCAST_SUCCESS;
}
}
- final String action = intent.getAction();
if (action != null) {
+ if (getBackgroundLaunchBroadcasts().contains(action)) {
+ if (DEBUG_BACKGROUND_CHECK) {
+ Slog.i(TAG, "Broadcast action " + action + " forcing include-background");
+ }
+ intent.addFlags(Intent.FLAG_RECEIVER_INCLUDE_BACKGROUND);
+ }
+
switch (action) {
case Intent.ACTION_UID_REMOVED:
case Intent.ACTION_PACKAGE_REMOVED:
case Intent.ACTION_PACKAGE_CHANGED:
case Intent.ACTION_EXTERNAL_APPLICATIONS_UNAVAILABLE:
case Intent.ACTION_EXTERNAL_APPLICATIONS_AVAILABLE:
+ case Intent.ACTION_PACKAGES_SUSPENDED:
+ case Intent.ACTION_PACKAGES_UNSUSPENDED:
// Handle special intents: if this broadcast is from the package
// manager about a package being removed, we need to remove all of
// its activities from the history stack.
}
switch (action) {
case Intent.ACTION_UID_REMOVED:
- final Bundle intentExtras = intent.getExtras();
- final int uid = intentExtras != null
- ? intentExtras.getInt(Intent.EXTRA_UID) : -1;
+ final int uid = getUidFromIntent(intent);
if (uid >= 0) {
mBatteryStatsService.removeUid(uid);
mAppOpsService.uidRemoved(uid);
}
mRecentTasks.cleanupLocked(UserHandle.USER_ALL);
sendPackageBroadcastLocked(
- IApplicationThread.EXTERNAL_STORAGE_UNAVAILABLE, list,
- userId);
+ ApplicationThreadConstants.EXTERNAL_STORAGE_UNAVAILABLE,
+ list, userId);
}
break;
case Intent.ACTION_EXTERNAL_APPLICATIONS_AVAILABLE:
String ssp;
if (data != null && (ssp=data.getSchemeSpecificPart()) != null) {
boolean removed = Intent.ACTION_PACKAGE_REMOVED.equals(action);
- boolean fullUninstall = removed &&
- !intent.getBooleanExtra(Intent.EXTRA_REPLACING, false);
+ final boolean replacing =
+ intent.getBooleanExtra(Intent.EXTRA_REPLACING, false);
final boolean killProcess =
!intent.getBooleanExtra(Intent.EXTRA_DONT_KILL_APP, false);
- if (killProcess) {
- forceStopPackageLocked(ssp, UserHandle.getAppId(
- intent.getIntExtra(Intent.EXTRA_UID, -1)),
- false, true, true, false, fullUninstall, userId,
- removed ? "pkg removed" : "pkg changed");
- }
+ final boolean fullUninstall = removed && !replacing;
if (removed) {
- sendPackageBroadcastLocked(IApplicationThread.PACKAGE_REMOVED,
+ if (killProcess) {
+ forceStopPackageLocked(ssp, UserHandle.getAppId(
+ intent.getIntExtra(Intent.EXTRA_UID, -1)),
+ false, true, true, false, fullUninstall, userId,
+ removed ? "pkg removed" : "pkg changed");
+ }
+ final int cmd = killProcess
+ ? ApplicationThreadConstants.PACKAGE_REMOVED
+ : ApplicationThreadConstants.PACKAGE_REMOVED_DONT_KILL;
+ sendPackageBroadcastLocked(cmd,
new String[] {ssp}, userId);
if (fullUninstall) {
mAppOpsService.packageRemoved(
removeUriPermissionsForPackageLocked(ssp, userId, true);
removeTasksByPackageNameLocked(ssp, userId);
+
+ mServices.forceStopPackageLocked(ssp, userId);
+
+ // Hide the "unsupported display" dialog if necessary.
+ if (mUnsupportedDisplaySizeDialog != null && ssp.equals(
+ mUnsupportedDisplaySizeDialog.getPackageName())) {
+ mUnsupportedDisplaySizeDialog.dismiss();
+ mUnsupportedDisplaySizeDialog = null;
+ }
+ mCompatModePackages.handlePackageUninstalledLocked(ssp);
mBatteryStatsService.notePackageUninstalled(ssp);
}
} else {
+ if (killProcess) {
+ killPackageProcessesLocked(ssp, UserHandle.getAppId(
+ intent.getIntExtra(Intent.EXTRA_UID, -1)),
+ userId, ProcessList.INVALID_ADJ,
+ false, true, true, false, "change " + ssp);
+ }
cleanupDisabledPackageComponentsLocked(ssp, userId, killProcess,
intent.getStringArrayExtra(
Intent.EXTRA_CHANGED_COMPONENT_NAME_LIST));
}
}
break;
+ case Intent.ACTION_PACKAGES_SUSPENDED:
+ case Intent.ACTION_PACKAGES_UNSUSPENDED:
+ final boolean suspended = Intent.ACTION_PACKAGES_SUSPENDED.equals(
+ intent.getAction());
+ final String[] packageNames = intent.getStringArrayExtra(
+ Intent.EXTRA_CHANGED_PACKAGE_LIST);
+ final int userHandle = intent.getIntExtra(
+ Intent.EXTRA_USER_HANDLE, UserHandle.USER_NULL);
+
+ synchronized(ActivityManagerService.this) {
+ mRecentTasks.onPackagesSuspendedChanged(
+ packageNames, suspended, userHandle);
+ }
+ break;
+ }
+ break;
+ case Intent.ACTION_PACKAGE_REPLACED:
+ {
+ final Uri data = intent.getData();
+ final String ssp;
+ if (data != null && (ssp = data.getSchemeSpecificPart()) != null) {
+ ApplicationInfo aInfo = null;
+ try {
+ aInfo = AppGlobals.getPackageManager()
+ .getApplicationInfo(ssp, 0 /*flags*/, userId);
+ } catch (RemoteException ignore) {}
+ if (aInfo == null) {
+ Slog.w(TAG, "Dropping ACTION_PACKAGE_REPLACED for non-existent pkg:"
+ + " ssp=" + ssp + " data=" + data);
+ return ActivityManager.BROADCAST_SUCCESS;
+ }
+ mStackSupervisor.updateActivityApplicationInfoLocked(aInfo);
+ sendPackageBroadcastLocked(ApplicationThreadConstants.PACKAGE_REPLACED,
+ new String[] {ssp}, userId);
}
break;
+ }
case Intent.ACTION_PACKAGE_ADDED:
+ {
// Special case for adding a package: by default turn on compatibility mode.
Uri data = intent.getData();
String ssp;
}
}
break;
+ }
+ case Intent.ACTION_PACKAGE_DATA_CLEARED:
+ {
+ Uri data = intent.getData();
+ String ssp;
+ if (data != null && (ssp = data.getSchemeSpecificPart()) != null) {
+ // Hide the "unsupported display" dialog if necessary.
+ if (mUnsupportedDisplaySizeDialog != null && ssp.equals(
+ mUnsupportedDisplaySizeDialog.getPackageName())) {
+ mUnsupportedDisplaySizeDialog.dismiss();
+ mUnsupportedDisplaySizeDialog = null;
+ }
+ mCompatModePackages.handlePackageDataClearedLocked(ssp);
+ }
+ break;
+ }
case Intent.ACTION_TIMEZONE_CHANGED:
// If this is the time zone changed action, queue up a message that will reset
// the timezone of all currently running processes. This message will get
mHandler.sendEmptyMessage(UPDATE_TIME_ZONE);
break;
case Intent.ACTION_TIME_CHANGED:
- // If the user set the time, let all running processes know.
- final int is24Hour =
- intent.getBooleanExtra(Intent.EXTRA_TIME_PREF_24_HOUR_FORMAT, false) ? 1
- : 0;
- mHandler.sendMessage(mHandler.obtainMessage(UPDATE_TIME, is24Hour, 0));
+ // EXTRA_TIME_PREF_24_HOUR_FORMAT is optional so we must distinguish between
+ // the tri-state value it may contain and "unknown".
+ // For convenience we re-use the Intent extra values.
+ final int NO_EXTRA_VALUE_FOUND = -1;
+ final int timeFormatPreferenceMsgValue = intent.getIntExtra(
+ Intent.EXTRA_TIME_PREF_24_HOUR_FORMAT,
+ NO_EXTRA_VALUE_FOUND /* defaultValue */);
+ // Only send a message if the time preference is available.
+ if (timeFormatPreferenceMsgValue != NO_EXTRA_VALUE_FOUND) {
+ Message updateTimePreferenceMsg =
+ mHandler.obtainMessage(UPDATE_TIME_PREFERENCE_MSG,
+ timeFormatPreferenceMsgValue, 0);
+ mHandler.sendMessage(updateTimePreferenceMsg);
+ }
BatteryStatsImpl stats = mBatteryStatsService.getActiveStatistics();
synchronized (stats) {
stats.noteCurrentTimeChangedLocked();
ProxyInfo proxy = intent.getParcelableExtra(Proxy.EXTRA_PROXY_INFO);
mHandler.sendMessage(mHandler.obtainMessage(UPDATE_HTTP_PROXY_MSG, proxy));
break;
+ case android.hardware.Camera.ACTION_NEW_PICTURE:
+ case android.hardware.Camera.ACTION_NEW_VIDEO:
+ // In N we just turned these off; in O we are turing them back on partly,
+ // only for registered receivers. This will still address the main problem
+ // (a spam of apps waking up when a picture is taken putting significant
+ // memory pressure on the system at a bad point), while still allowing apps
+ // that are already actively running to know about this happening.
+ intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY);
+ break;
+ case android.security.KeyChain.ACTION_TRUST_STORE_CHANGED:
+ mHandler.sendEmptyMessage(HANDLE_TRUST_STORAGE_UPDATE_MSG);
+ break;
+ case "com.android.launcher.action.INSTALL_SHORTCUT":
+ // As of O, we no longer support this broadcasts, even for pre-O apps.
+ // Apps should now be using ShortcutManager.pinRequestShortcut().
+ Log.w(TAG, "Broadcast " + action
+ + " no longer supported. It will not be delivered.");
+ return ActivityManager.BROADCAST_SUCCESS;
+ }
+
+ if (Intent.ACTION_PACKAGE_ADDED.equals(action) ||
+ Intent.ACTION_PACKAGE_REMOVED.equals(action) ||
+ Intent.ACTION_PACKAGE_REPLACED.equals(action)) {
+ final int uid = getUidFromIntent(intent);
+ if (uid != -1) {
+ final UidRecord uidRec = mActiveUids.get(uid);
+ if (uidRec != null) {
+ uidRec.updateHasInternetPermission();
+ }
+ }
}
}
int[] users;
if (userId == UserHandle.USER_ALL) {
// Caller wants broadcast to go to all started users.
- users = mStartedUserArray;
+ users = mUserController.getStartedUserArrayLocked();
} else {
// Caller wants broadcast to go to one specific user.
users = new int[] {userId};
receivers = collectReceiverComponents(intent, resolvedType, callingUid, users);
}
if (intent.getComponent() == null) {
- if (userId == UserHandle.USER_ALL && callingUid == Process.SHELL_UID) {
+ if (userId == UserHandle.USER_ALL && callingUid == SHELL_UID) {
// Query one target user at a time, excluding shell-restricted users
- UserManagerService ums = getUserManagerLocked();
for (int i = 0; i < users.length; i++) {
- if (ums.hasUserRestriction(
+ if (mUserController.hasUserRestriction(
UserManager.DISALLOW_DEBUGGING_FEATURES, users[i])) {
continue;
}
List<BroadcastFilter> registeredReceiversForUser =
mReceiverResolver.queryIntent(intent,
- resolvedType, false, users[i]);
+ resolvedType, false /*defaultOnly*/, users[i]);
if (registeredReceivers == null) {
registeredReceivers = registeredReceiversForUser;
} else if (registeredReceiversForUser != null) {
}
} else {
registeredReceivers = mReceiverResolver.queryIntent(intent,
- resolvedType, false, userId);
+ resolvedType, false /*defaultOnly*/, userId);
}
}
final boolean replacePending =
(intent.getFlags()&Intent.FLAG_RECEIVER_REPLACE_PENDING) != 0;
- if (DEBUG_BROADCAST) Slog.v(TAG_BROADCAST, "Enqueing broadcast: " + intent.getAction()
+ if (DEBUG_BROADCAST) Slog.v(TAG_BROADCAST, "Enqueueing broadcast: " + intent.getAction()
+ " replacePending=" + replacePending);
int NR = registeredReceivers != null ? registeredReceivers.size() : 0;
// If we are not serializing this broadcast, then send the
// registered receivers separately so they don't wait for the
// components to be launched.
+ if (isCallerSystem) {
+ checkBroadcastFromSystem(intent, callerApp, callerPackage, callingUid,
+ isProtectedBroadcast, registeredReceivers);
+ }
final BroadcastQueue queue = broadcastQueueForIntent(intent);
BroadcastRecord r = new BroadcastRecord(queue, intent, callerApp,
- callerPackage, callingPid, callingUid, resolvedType, requiredPermissions,
- appOp, brOptions, registeredReceivers, resultTo, resultCode, resultData,
- resultExtras, ordered, sticky, false, userId);
+ callerPackage, callingPid, callingUid, callerInstantApp, resolvedType,
+ requiredPermissions, appOp, brOptions, registeredReceivers, resultTo,
+ resultCode, resultData, resultExtras, ordered, sticky, false, userId);
if (DEBUG_BROADCAST) Slog.v(TAG_BROADCAST, "Enqueueing parallel broadcast " + r);
- final boolean replaced = replacePending && queue.replaceParallelBroadcastLocked(r);
+ final boolean replaced = replacePending
+ && (queue.replaceParallelBroadcastLocked(r) != null);
+ // Note: We assume resultTo is null for non-ordered broadcasts.
if (!replaced) {
queue.enqueueParallelBroadcastLocked(r);
queue.scheduleBroadcastsLocked();
ir++;
}
+ if (isCallerSystem) {
+ checkBroadcastFromSystem(intent, callerApp, callerPackage, callingUid,
+ isProtectedBroadcast, receivers);
+ }
+
if ((receivers != null && receivers.size() > 0)
|| resultTo != null) {
BroadcastQueue queue = broadcastQueueForIntent(intent);
BroadcastRecord r = new BroadcastRecord(queue, intent, callerApp,
- callerPackage, callingPid, callingUid, resolvedType,
+ callerPackage, callingPid, callingUid, callerInstantApp, resolvedType,
requiredPermissions, appOp, brOptions, receivers, resultTo, resultCode,
resultData, resultExtras, ordered, sticky, false, userId);
if (DEBUG_BROADCAST) Slog.i(TAG_BROADCAST,
"Enqueueing broadcast " + r.intent.getAction());
- boolean replaced = replacePending && queue.replaceOrderedBroadcastLocked(r);
- if (!replaced) {
- queue.enqueueOrderedBroadcastLocked(r);
- queue.scheduleBroadcastsLocked();
- }
+ final BroadcastRecord oldRecord =
+ replacePending ? queue.replaceOrderedBroadcastLocked(r) : null;
+ if (oldRecord != null) {
+ // Replaced, fire the result-to receiver.
+ if (oldRecord.resultTo != null) {
+ final BroadcastQueue oldQueue = broadcastQueueForIntent(oldRecord.intent);
+ try {
+ oldQueue.performReceiveLocked(oldRecord.callerApp, oldRecord.resultTo,
+ oldRecord.intent,
+ Activity.RESULT_CANCELED, null, null,
+ false, false, oldRecord.userId);
+ } catch (RemoteException e) {
+ Slog.w(TAG, "Failure ["
+ + queue.mQueueName + "] sending broadcast result of "
+ + intent, e);
+
+ }
+ }
+ } else {
+ queue.enqueueOrderedBroadcastLocked(r);
+ queue.scheduleBroadcastsLocked();
+ }
+ } else {
+ // There was nobody interested in the broadcast, but we still want to record
+ // that it happened.
+ if (intent.getComponent() == null && intent.getPackage() == null
+ && (intent.getFlags()&Intent.FLAG_RECEIVER_REGISTERED_ONLY) == 0) {
+ // This was an implicit broadcast... let's record it for posterity.
+ addBroadcastStatLocked(intent.getAction(), callerPackage, 0, 0, 0);
+ }
}
return ActivityManager.BROADCAST_SUCCESS;
}
+ /**
+ * @return uid from the extra field {@link Intent#EXTRA_UID} if present, Otherwise -1
+ */
+ private int getUidFromIntent(Intent intent) {
+ if (intent == null) {
+ return -1;
+ }
+ final Bundle intentExtras = intent.getExtras();
+ return intent.hasExtra(Intent.EXTRA_UID)
+ ? intentExtras.getInt(Intent.EXTRA_UID) : -1;
+ }
+
+ final void rotateBroadcastStatsIfNeededLocked() {
+ final long now = SystemClock.elapsedRealtime();
+ if (mCurBroadcastStats == null ||
+ (mCurBroadcastStats.mStartRealtime +(24*60*60*1000) < now)) {
+ mLastBroadcastStats = mCurBroadcastStats;
+ if (mLastBroadcastStats != null) {
+ mLastBroadcastStats.mEndRealtime = SystemClock.elapsedRealtime();
+ mLastBroadcastStats.mEndUptime = SystemClock.uptimeMillis();
+ }
+ mCurBroadcastStats = new BroadcastStats();
+ }
+ }
+
+ final void addBroadcastStatLocked(String action, String srcPackage, int receiveCount,
+ int skipCount, long dispatchTime) {
+ rotateBroadcastStatsIfNeededLocked();
+ mCurBroadcastStats.addBroadcast(action, srcPackage, receiveCount, skipCount, dispatchTime);
+ }
+
+ final void addBackgroundCheckViolationLocked(String action, String targetPackage) {
+ rotateBroadcastStatsIfNeededLocked();
+ mCurBroadcastStats.addBackgroundCheckViolation(action, targetPackage);
+ }
+
final Intent verifyBroadcastLocked(Intent intent) {
// Refuse possible leaked file descriptors
if (intent != null && intent.hasFileDescriptors() == true) {
"Can't use FLAG_RECEIVER_BOOT_UPGRADE here");
}
+ if ((flags & Intent.FLAG_RECEIVER_FROM_SHELL) != 0) {
+ switch (Binder.getCallingUid()) {
+ case ROOT_UID:
+ case SHELL_UID:
+ break;
+ default:
+ Slog.w(TAG, "Removing FLAG_RECEIVER_FROM_SHELL because caller is UID "
+ + Binder.getCallingUid());
+ intent.removeFlags(Intent.FLAG_RECEIVER_FROM_SHELL);
+ break;
+ }
+ }
+
return intent;
}
public final int broadcastIntent(IApplicationThread caller,
Intent intent, String resolvedType, IIntentReceiver resultTo,
int resultCode, String resultData, Bundle resultExtras,
- String[] requiredPermissions, int appOp, Bundle options,
+ String[] requiredPermissions, int appOp, Bundle bOptions,
boolean serialized, boolean sticky, int userId) {
enforceNotIsolatedCaller("broadcastIntent");
synchronized(this) {
int res = broadcastIntentLocked(callerApp,
callerApp != null ? callerApp.info.packageName : null,
intent, resolvedType, resultTo, resultCode, resultData, resultExtras,
- requiredPermissions, appOp, null, serialized, sticky,
+ requiredPermissions, appOp, bOptions, serialized, sticky,
callingPid, callingUid, userId);
Binder.restoreCallingIdentity(origId);
return res;
int broadcastIntentInPackage(String packageName, int uid,
Intent intent, String resolvedType, IIntentReceiver resultTo,
int resultCode, String resultData, Bundle resultExtras,
- String requiredPermission, Bundle options, boolean serialized, boolean sticky,
+ String requiredPermission, Bundle bOptions, boolean serialized, boolean sticky,
int userId) {
synchronized(this) {
intent = verifyBroadcastLocked(intent);
: new String[] {requiredPermission};
int res = broadcastIntentLocked(null, packageName, intent, resolvedType,
resultTo, resultCode, resultData, resultExtras,
- requiredPermissions, AppOpsManager.OP_NONE, options, serialized,
+ requiredPermissions, AppOpsManager.OP_NONE, bOptions, serialized,
sticky, -1, uid, userId);
Binder.restoreCallingIdentity(origId);
return res;
throw new IllegalArgumentException("File descriptors passed in Intent");
}
- userId = handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(),
+ userId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(),
userId, true, ALLOW_NON_FULL, "removeStickyBroadcast", null);
synchronized(this) {
IInstrumentationWatcher watcher, IUiAutomationConnection uiAutomationConnection,
int userId, String abiOverride) {
enforceNotIsolatedCaller("startInstrumentation");
- userId = handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(),
+ userId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(),
userId, false, ALLOW_FULL_ONLY, "startInstrumentation", null);
// Refuse possible leaked file descriptors
if (arguments != null && arguments.hasFileDescriptors()) {
} catch (RemoteException e) {
}
if (ii == null) {
- reportStartInstrumentationFailure(watcher, className,
+ reportStartInstrumentationFailureLocked(watcher, className,
"Unable to find instrumentation info for: " + className);
return false;
}
if (ai == null) {
- reportStartInstrumentationFailure(watcher, className,
+ reportStartInstrumentationFailureLocked(watcher, className,
"Unable to find instrumentation target package: " + ii.targetPackage);
return false;
}
+ if (!ai.hasCode()) {
+ reportStartInstrumentationFailureLocked(watcher, className,
+ "Instrumentation target has no code: " + ii.targetPackage);
+ return false;
+ }
int match = mContext.getPackageManager().checkSignatures(
ii.targetPackage, ii.packageName);
+ " not allowed because package " + ii.packageName
+ " does not have a signature matching the target "
+ ii.targetPackage;
- reportStartInstrumentationFailure(watcher, className, msg);
+ reportStartInstrumentationFailureLocked(watcher, className, msg);
throw new SecurityException(msg);
}
+ ActiveInstrumentation activeInstr = new ActiveInstrumentation(this);
+ activeInstr.mClass = className;
+ String defProcess = ai.processName;;
+ if (ii.targetProcesses == null) {
+ activeInstr.mTargetProcesses = new String[]{ai.processName};
+ } else if (ii.targetProcesses.equals("*")) {
+ activeInstr.mTargetProcesses = new String[0];
+ } else {
+ activeInstr.mTargetProcesses = ii.targetProcesses.split(",");
+ defProcess = activeInstr.mTargetProcesses[0];
+ }
+ activeInstr.mTargetInfo = ai;
+ activeInstr.mProfileFile = profileFile;
+ activeInstr.mArguments = arguments;
+ activeInstr.mWatcher = watcher;
+ activeInstr.mUiAutomationConnection = uiAutomationConnection;
+ activeInstr.mResultClass = className;
+
final long origId = Binder.clearCallingIdentity();
// Instrumentation can kill and relaunch even persistent processes
forceStopPackageLocked(ii.targetPackage, -1, true, false, true, true, false, userId,
"start instr");
- ProcessRecord app = addAppLocked(ai, false, abiOverride);
- app.instrumentationClass = className;
- app.instrumentationInfo = ai;
- app.instrumentationProfileFile = profileFile;
- app.instrumentationArguments = arguments;
- app.instrumentationWatcher = watcher;
- app.instrumentationUiAutomationConnection = uiAutomationConnection;
- app.instrumentationResultClass = className;
+ ProcessRecord app = addAppLocked(ai, defProcess, false, abiOverride);
+ app.instr = activeInstr;
+ activeInstr.mFinished = false;
+ activeInstr.mRunningProcesses.add(app);
+ if (!mActiveInstrumentation.contains(activeInstr)) {
+ mActiveInstrumentation.add(activeInstr);
+ }
Binder.restoreCallingIdentity(origId);
}
* @param cn The component name of the instrumentation.
* @param report The error report.
*/
- private void reportStartInstrumentationFailure(IInstrumentationWatcher watcher,
+ private void reportStartInstrumentationFailureLocked(IInstrumentationWatcher watcher,
ComponentName cn, String report) {
Slog.w(TAG, report);
- try {
- if (watcher != null) {
- Bundle results = new Bundle();
- results.putString(Instrumentation.REPORT_KEY_IDENTIFIER, "ActivityManagerService");
- results.putString("Error", report);
- watcher.instrumentationStatus(cn, -1, results);
+ if (watcher != null) {
+ Bundle results = new Bundle();
+ results.putString(Instrumentation.REPORT_KEY_IDENTIFIER, "ActivityManagerService");
+ results.putString("Error", report);
+ mInstrumentationReporter.reportStatus(watcher, cn, -1, results);
+ }
+ }
+
+ void addInstrumentationResultsLocked(ProcessRecord app, Bundle results) {
+ if (app.instr == null) {
+ Slog.w(TAG, "finishInstrumentation called on non-instrumented: " + app);
+ return;
+ }
+
+ if (!app.instr.mFinished && results != null) {
+ if (app.instr.mCurResults == null) {
+ app.instr.mCurResults = new Bundle(results);
+ } else {
+ app.instr.mCurResults.putAll(results);
}
- } catch (RemoteException e) {
- Slog.w(TAG, e);
}
}
- void finishInstrumentationLocked(ProcessRecord app, int resultCode, Bundle results) {
- if (app.instrumentationWatcher != null) {
- try {
- // NOTE: IInstrumentationWatcher *must* be oneway here
- app.instrumentationWatcher.instrumentationFinished(
- app.instrumentationClass,
- resultCode,
- results);
- } catch (RemoteException e) {
+ public void addInstrumentationResults(IApplicationThread target, Bundle results) {
+ int userId = UserHandle.getCallingUserId();
+ // Refuse possible leaked file descriptors
+ if (results != null && results.hasFileDescriptors()) {
+ throw new IllegalArgumentException("File descriptors passed in Intent");
+ }
+
+ synchronized(this) {
+ ProcessRecord app = getRecordForAppLocked(target);
+ if (app == null) {
+ Slog.w(TAG, "addInstrumentationResults: no app for " + target);
+ return;
}
+ final long origId = Binder.clearCallingIdentity();
+ addInstrumentationResultsLocked(app, results);
+ Binder.restoreCallingIdentity(origId);
+ }
+ }
+
+ void finishInstrumentationLocked(ProcessRecord app, int resultCode, Bundle results) {
+ if (app.instr == null) {
+ Slog.w(TAG, "finishInstrumentation called on non-instrumented: " + app);
+ return;
}
- // Can't call out of the system process with a lock held, so post a message.
- if (app.instrumentationUiAutomationConnection != null) {
- mHandler.obtainMessage(SHUTDOWN_UI_AUTOMATION_CONNECTION_MSG,
- app.instrumentationUiAutomationConnection).sendToTarget();
+ if (!app.instr.mFinished) {
+ if (app.instr.mWatcher != null) {
+ Bundle finalResults = app.instr.mCurResults;
+ if (finalResults != null) {
+ if (app.instr.mCurResults != null && results != null) {
+ finalResults.putAll(results);
+ }
+ } else {
+ finalResults = results;
+ }
+ mInstrumentationReporter.reportFinished(app.instr.mWatcher,
+ app.instr.mClass, resultCode, finalResults);
+ }
+
+ // Can't call out of the system process with a lock held, so post a message.
+ if (app.instr.mUiAutomationConnection != null) {
+ mHandler.obtainMessage(SHUTDOWN_UI_AUTOMATION_CONNECTION_MSG,
+ app.instr.mUiAutomationConnection).sendToTarget();
+ }
+ app.instr.mFinished = true;
}
- app.instrumentationWatcher = null;
- app.instrumentationUiAutomationConnection = null;
- app.instrumentationClass = null;
- app.instrumentationInfo = null;
- app.instrumentationProfileFile = null;
- app.instrumentationArguments = null;
+ app.instr.removeProcess(app);
+ app.instr = null;
forceStopPackageLocked(app.info.packageName, -1, false, false, true, true, false, app.userId,
"finished inst");
public ConfigurationInfo getDeviceConfigurationInfo() {
ConfigurationInfo config = new ConfigurationInfo();
synchronized (this) {
- config.reqTouchScreen = mConfiguration.touchscreen;
- config.reqKeyboardType = mConfiguration.keyboard;
- config.reqNavigation = mConfiguration.navigation;
- if (mConfiguration.navigation == Configuration.NAVIGATION_DPAD
- || mConfiguration.navigation == Configuration.NAVIGATION_TRACKBALL) {
+ final Configuration globalConfig = getGlobalConfiguration();
+ config.reqTouchScreen = globalConfig.touchscreen;
+ config.reqKeyboardType = globalConfig.keyboard;
+ config.reqNavigation = globalConfig.navigation;
+ if (globalConfig.navigation == Configuration.NAVIGATION_DPAD
+ || globalConfig.navigation == Configuration.NAVIGATION_TRACKBALL) {
config.reqInputFeatures |= ConfigurationInfo.INPUT_FEATURE_FIVE_WAY_NAV;
}
- if (mConfiguration.keyboard != Configuration.KEYBOARD_UNDEFINED
- && mConfiguration.keyboard != Configuration.KEYBOARD_NOKEYS) {
+ if (globalConfig.keyboard != Configuration.KEYBOARD_UNDEFINED
+ && globalConfig.keyboard != Configuration.KEYBOARD_NOKEYS) {
config.reqInputFeatures |= ConfigurationInfo.INPUT_FEATURE_HARD_KEYBOARD;
}
config.reqGlEsVersion = GL_ES_VERSION;
public Configuration getConfiguration() {
Configuration ci;
synchronized(this) {
- ci = new Configuration(mConfiguration);
+ ci = new Configuration(getGlobalConfiguration());
ci.userSetLocale = false;
}
return ci;
}
+ @Override
+ public void suppressResizeConfigChanges(boolean suppress) throws RemoteException {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "suppressResizeConfigChanges()");
+ synchronized (this) {
+ mSuppressResizeConfigChanges = suppress;
+ }
+ }
+
+ /**
+ * NOTE: For the pinned stack, this method is usually called after the bounds animation has
+ * animated the stack to the fullscreen, but can also be called if we are relaunching an
+ * activity and clearing the task at the same time.
+ */
+ @Override
+ public void moveTasksToFullscreenStack(int fromStackId, boolean onTop) {
+ enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "moveTasksToFullscreenStack()");
+ if (StackId.isHomeOrRecentsStack(fromStackId)) {
+ throw new IllegalArgumentException("You can't move tasks from the home/recents stack.");
+ }
+ synchronized (this) {
+ final long origId = Binder.clearCallingIdentity();
+ try {
+ mStackSupervisor.moveTasksToFullscreenStackLocked(fromStackId, onTop);
+ } finally {
+ Binder.restoreCallingIdentity(origId);
+ }
+ }
+ }
+
+ @Override
public void updatePersistentConfiguration(Configuration values) {
- enforceCallingPermission(android.Manifest.permission.CHANGE_CONFIGURATION,
- "updateConfiguration()");
- enforceWriteSettingsPermission("updateConfiguration()");
+ enforceCallingPermission(CHANGE_CONFIGURATION, "updatePersistentConfiguration()");
+ enforceWriteSettingsPermission("updatePersistentConfiguration()");
if (values == null) {
throw new NullPointerException("Configuration must not be null");
}
+ int userId = UserHandle.getCallingUserId();
+
synchronized(this) {
- final long origId = Binder.clearCallingIdentity();
- updateConfigurationLocked(values, null, true, false);
+ updatePersistentConfigurationLocked(values, userId);
+ }
+ }
+
+ private void updatePersistentConfigurationLocked(Configuration values, @UserIdInt int userId) {
+ final long origId = Binder.clearCallingIdentity();
+ try {
+ updateConfigurationLocked(values, null, false, true, userId, false /* deferResume */);
+ } finally {
Binder.restoreCallingIdentity(origId);
}
}
+ private void updateFontScaleIfNeeded(@UserIdInt int userId) {
+ final float scaleFactor = Settings.System.getFloatForUser(mContext.getContentResolver(),
+ FONT_SCALE, 1.0f, userId);
+
+ synchronized (this) {
+ if (getGlobalConfiguration().fontScale == scaleFactor) {
+ return;
+ }
+
+ final Configuration configuration
+ = mWindowManager.computeNewConfiguration(DEFAULT_DISPLAY);
+ configuration.fontScale = scaleFactor;
+ updatePersistentConfigurationLocked(configuration, userId);
+ }
+ }
+
private void enforceWriteSettingsPermission(String func) {
int uid = Binder.getCallingUid();
- if (uid == Process.ROOT_UID) {
+ if (uid == ROOT_UID) {
return;
}
throw new SecurityException(msg);
}
- public void updateConfiguration(Configuration values) {
- enforceCallingPermission(android.Manifest.permission.CHANGE_CONFIGURATION,
- "updateConfiguration()");
+ @Override
+ public boolean updateConfiguration(Configuration values) {
+ enforceCallingPermission(CHANGE_CONFIGURATION, "updateConfiguration()");
synchronized(this) {
if (values == null && mWindowManager != null) {
// sentinel: fetch the current configuration from the window manager
- values = mWindowManager.computeNewConfiguration();
+ values = mWindowManager.computeNewConfiguration(DEFAULT_DISPLAY);
}
if (mWindowManager != null) {
+ // Update OOM levels based on display size.
mProcessList.applyDisplaySize(mWindowManager);
}
final long origId = Binder.clearCallingIdentity();
- if (values != null) {
- Settings.System.clearConfiguration(values);
+ try {
+ if (values != null) {
+ Settings.System.clearConfiguration(values);
+ }
+ updateConfigurationLocked(values, null, false, false /* persistent */,
+ UserHandle.USER_NULL, false /* deferResume */,
+ mTmpUpdateConfigurationResult);
+ return mTmpUpdateConfigurationResult.changes != 0;
+ } finally {
+ Binder.restoreCallingIdentity(origId);
}
- updateConfigurationLocked(values, null, false, false);
- Binder.restoreCallingIdentity(origId);
}
}
+ void updateUserConfigurationLocked() {
+ final Configuration configuration = new Configuration(getGlobalConfiguration());
+ final int currentUserId = mUserController.getCurrentUserIdLocked();
+ Settings.System.adjustConfigurationForUser(mContext.getContentResolver(), configuration,
+ currentUserId, Settings.System.canWrite(mContext));
+ updateConfigurationLocked(configuration, null /* starting */, false /* initLocale */,
+ false /* persistent */, currentUserId, false /* deferResume */);
+ }
+
+ boolean updateConfigurationLocked(Configuration values, ActivityRecord starting,
+ boolean initLocale) {
+ return updateConfigurationLocked(values, starting, initLocale, false /* deferResume */);
+ }
+
+ boolean updateConfigurationLocked(Configuration values, ActivityRecord starting,
+ boolean initLocale, boolean deferResume) {
+ // pass UserHandle.USER_NULL as userId because we don't persist configuration for any user
+ return updateConfigurationLocked(values, starting, initLocale, false /* persistent */,
+ UserHandle.USER_NULL, deferResume);
+ }
+
+ // To cache the list of supported system locales
+ private String[] mSupportedSystemLocales = null;
+
+ private boolean updateConfigurationLocked(Configuration values, ActivityRecord starting,
+ boolean initLocale, boolean persistent, int userId, boolean deferResume) {
+ return updateConfigurationLocked(values, starting, initLocale, persistent, userId,
+ deferResume, null /* result */);
+ }
+
/**
* Do either or both things: (1) change the current configuration, and (2)
* make sure the given activity is running with the (now) current
* configuration. Returns true if the activity has been left running, or
* false if <var>starting</var> is being destroyed to match the new
* configuration.
- * @param persistent TODO
+ *
+ * @param userId is only used when persistent parameter is set to true to persist configuration
+ * for that particular user
*/
- boolean updateConfigurationLocked(Configuration values,
- ActivityRecord starting, boolean persistent, boolean initLocale) {
+ private boolean updateConfigurationLocked(Configuration values, ActivityRecord starting,
+ boolean initLocale, boolean persistent, int userId, boolean deferResume,
+ UpdateConfigurationResult result) {
int changes = 0;
+ boolean kept = true;
+
+ if (mWindowManager != null) {
+ mWindowManager.deferSurfaceLayout();
+ }
+ try {
+ if (values != null) {
+ changes = updateGlobalConfiguration(values, initLocale, persistent, userId,
+ deferResume);
+ }
+
+ kept = ensureConfigAndVisibilityAfterUpdate(starting, changes);
+ } finally {
+ if (mWindowManager != null) {
+ mWindowManager.continueSurfaceLayout();
+ }
+ }
+
+ if (result != null) {
+ result.changes = changes;
+ result.activityRelaunched = !kept;
+ }
+ return kept;
+ }
- if (values != null) {
- Configuration newConfig = new Configuration(mConfiguration);
- changes = newConfig.updateFrom(values);
- if (changes != 0) {
- if (DEBUG_SWITCH || DEBUG_CONFIGURATION) Slog.i(TAG_CONFIGURATION,
- "Updating configuration to: " + values);
+ /** Update default (global) configuration and notify listeners about changes. */
+ private int updateGlobalConfiguration(@NonNull Configuration values, boolean initLocale,
+ boolean persistent, int userId, boolean deferResume) {
+ mTempConfig.setTo(getGlobalConfiguration());
+ final int changes = mTempConfig.updateFrom(values);
+ if (changes == 0) {
+ // Since calling to Activity.setRequestedOrientation leads to freezing the window with
+ // setting WindowManagerService.mWaitingForConfig to true, it is important that we call
+ // performDisplayOverrideConfigUpdate in order to send the new display configuration
+ // (even if there are no actual changes) to unfreeze the window.
+ performDisplayOverrideConfigUpdate(values, deferResume, DEFAULT_DISPLAY);
+ return 0;
+ }
+
+ if (DEBUG_SWITCH || DEBUG_CONFIGURATION) Slog.i(TAG_CONFIGURATION,
+ "Updating global configuration to: " + values);
- EventLog.writeEvent(EventLogTags.CONFIGURATION_CHANGED, changes);
+ EventLog.writeEvent(EventLogTags.CONFIGURATION_CHANGED, changes);
- if (!initLocale && values.locale != null && values.userSetLocale) {
- final String languageTag = values.locale.toLanguageTag();
- SystemProperties.set("persist.sys.locale", languageTag);
- mHandler.sendMessage(mHandler.obtainMessage(SEND_LOCALE_TO_MOUNT_DAEMON_MSG,
- values.locale));
+ if (!initLocale && !values.getLocales().isEmpty() && values.userSetLocale) {
+ final LocaleList locales = values.getLocales();
+ int bestLocaleIndex = 0;
+ if (locales.size() > 1) {
+ if (mSupportedSystemLocales == null) {
+ mSupportedSystemLocales = Resources.getSystem().getAssets().getLocales();
}
+ bestLocaleIndex = Math.max(0, locales.getFirstMatchIndex(mSupportedSystemLocales));
+ }
+ SystemProperties.set("persist.sys.locale",
+ locales.get(bestLocaleIndex).toLanguageTag());
+ LocaleList.setDefault(locales, bestLocaleIndex);
+ mHandler.sendMessage(mHandler.obtainMessage(SEND_LOCALE_TO_MOUNT_DAEMON_MSG,
+ locales.get(bestLocaleIndex)));
+ }
+
+ mConfigurationSeq = Math.max(++mConfigurationSeq, 1);
+ mTempConfig.seq = mConfigurationSeq;
+
+ // Update stored global config and notify everyone about the change.
+ mStackSupervisor.onConfigurationChanged(mTempConfig);
+
+ Slog.i(TAG, "Config changes=" + Integer.toHexString(changes) + " " + mTempConfig);
+ // TODO(multi-display): Update UsageEvents#Event to include displayId.
+ mUsageStatsService.reportConfigurationChange(mTempConfig,
+ mUserController.getCurrentUserIdLocked());
+
+ // TODO: If our config changes, should we auto dismiss any currently showing dialogs?
+ mShowDialogs = shouldShowDialogs(mTempConfig);
- mConfigurationSeq++;
- if (mConfigurationSeq <= 0) {
- mConfigurationSeq = 1;
+ AttributeCache ac = AttributeCache.instance();
+ if (ac != null) {
+ ac.updateConfiguration(mTempConfig);
+ }
+
+ // Make sure all resources in our process are updated right now, so that anyone who is going
+ // to retrieve resource values after we return will be sure to get the new ones. This is
+ // especially important during boot, where the first config change needs to guarantee all
+ // resources have that config before following boot code is executed.
+ mSystemThread.applyConfigurationToResources(mTempConfig);
+
+ // We need another copy of global config because we're scheduling some calls instead of
+ // running them in place. We need to be sure that object we send will be handled unchanged.
+ final Configuration configCopy = new Configuration(mTempConfig);
+ if (persistent && Settings.System.hasInterestingConfigurationChanges(changes)) {
+ Message msg = mHandler.obtainMessage(UPDATE_CONFIGURATION_MSG);
+ msg.obj = configCopy;
+ msg.arg1 = userId;
+ mHandler.sendMessage(msg);
+ }
+
+ for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
+ ProcessRecord app = mLruProcesses.get(i);
+ try {
+ if (app.thread != null) {
+ if (DEBUG_CONFIGURATION) Slog.v(TAG_CONFIGURATION, "Sending to proc "
+ + app.processName + " new config " + configCopy);
+ app.thread.scheduleConfigurationChanged(configCopy);
}
- newConfig.seq = mConfigurationSeq;
- mConfiguration = newConfig;
- Slog.i(TAG, "Config changes=" + Integer.toHexString(changes) + " " + newConfig);
- mUsageStatsService.reportConfigurationChange(newConfig, mCurrentUserId);
- //mUsageStatsService.noteStartConfig(newConfig);
+ } catch (Exception e) {
+ }
+ }
+
+ Intent intent = new Intent(Intent.ACTION_CONFIGURATION_CHANGED);
+ intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY | Intent.FLAG_RECEIVER_REPLACE_PENDING
+ | Intent.FLAG_RECEIVER_FOREGROUND
+ | Intent.FLAG_RECEIVER_VISIBLE_TO_INSTANT_APPS);
+ broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null,
+ AppOpsManager.OP_NONE, null, false, false, MY_PID, SYSTEM_UID,
+ UserHandle.USER_ALL);
+ if ((changes & ActivityInfo.CONFIG_LOCALE) != 0) {
+ intent = new Intent(Intent.ACTION_LOCALE_CHANGED);
+ intent.addFlags(Intent.FLAG_RECEIVER_FOREGROUND
+ | Intent.FLAG_RECEIVER_INCLUDE_BACKGROUND
+ | Intent.FLAG_RECEIVER_VISIBLE_TO_INSTANT_APPS);
+ if (initLocale || !mProcessesReady) {
+ intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY);
+ }
+ broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null,
+ AppOpsManager.OP_NONE, null, false, false, MY_PID, SYSTEM_UID,
+ UserHandle.USER_ALL);
+ }
- final Configuration configCopy = new Configuration(mConfiguration);
+ // Override configuration of the default display duplicates global config, so we need to
+ // update it also. This will also notify WindowManager about changes.
+ performDisplayOverrideConfigUpdate(mStackSupervisor.getConfiguration(), deferResume,
+ DEFAULT_DISPLAY);
- // TODO: If our config changes, should we auto dismiss any currently
- // showing dialogs?
- mShowDialogs = shouldShowDialogs(newConfig);
+ return changes;
+ }
- AttributeCache ac = AttributeCache.instance();
- if (ac != null) {
- ac.updateConfiguration(configCopy);
+ @Override
+ public boolean updateDisplayOverrideConfiguration(Configuration values, int displayId) {
+ enforceCallingPermission(CHANGE_CONFIGURATION, "updateDisplayOverrideConfiguration()");
+
+ synchronized (this) {
+ // Check if display is initialized in AM.
+ if (!mStackSupervisor.isDisplayAdded(displayId)) {
+ // Call might come when display is not yet added or has already been removed.
+ if (DEBUG_CONFIGURATION) {
+ Slog.w(TAG, "Trying to update display configuration for non-existing displayId="
+ + displayId);
}
+ return false;
+ }
+
+ if (values == null && mWindowManager != null) {
+ // sentinel: fetch the current configuration from the window manager
+ values = mWindowManager.computeNewConfiguration(displayId);
+ }
- // Make sure all resources in our process are updated
- // right now, so that anyone who is going to retrieve
- // resource values after we return will be sure to get
- // the new ones. This is especially important during
- // boot, where the first config change needs to guarantee
- // all resources have that config before following boot
- // code is executed.
- mSystemThread.applyConfigurationToResources(configCopy);
+ if (mWindowManager != null) {
+ // Update OOM levels based on display size.
+ mProcessList.applyDisplaySize(mWindowManager);
+ }
- if (persistent && Settings.System.hasInterestingConfigurationChanges(changes)) {
- Message msg = mHandler.obtainMessage(UPDATE_CONFIGURATION_MSG);
- msg.obj = new Configuration(configCopy);
- mHandler.sendMessage(msg);
+ final long origId = Binder.clearCallingIdentity();
+ try {
+ if (values != null) {
+ Settings.System.clearConfiguration(values);
}
+ updateDisplayOverrideConfigurationLocked(values, null /* starting */,
+ false /* deferResume */, displayId, mTmpUpdateConfigurationResult);
+ return mTmpUpdateConfigurationResult.changes != 0;
+ } finally {
+ Binder.restoreCallingIdentity(origId);
+ }
+ }
+ }
- for (int i=mLruProcesses.size()-1; i>=0; i--) {
- ProcessRecord app = mLruProcesses.get(i);
- try {
- if (app.thread != null) {
- if (DEBUG_CONFIGURATION) Slog.v(TAG_CONFIGURATION, "Sending to proc "
- + app.processName + " new config " + mConfiguration);
- app.thread.scheduleConfigurationChanged(configCopy);
- }
- } catch (Exception e) {
- }
+ boolean updateDisplayOverrideConfigurationLocked(Configuration values, ActivityRecord starting,
+ boolean deferResume, int displayId) {
+ return updateDisplayOverrideConfigurationLocked(values, starting, deferResume /* deferResume */,
+ displayId, null /* result */);
+ }
+
+ /**
+ * Updates override configuration specific for the selected display. If no config is provided,
+ * new one will be computed in WM based on current display info.
+ */
+ private boolean updateDisplayOverrideConfigurationLocked(Configuration values,
+ ActivityRecord starting, boolean deferResume, int displayId,
+ UpdateConfigurationResult result) {
+ int changes = 0;
+ boolean kept = true;
+
+ if (mWindowManager != null) {
+ mWindowManager.deferSurfaceLayout();
+ }
+ try {
+ if (values != null) {
+ if (displayId == DEFAULT_DISPLAY) {
+ // Override configuration of the default display duplicates global config, so
+ // we're calling global config update instead for default display. It will also
+ // apply the correct override config.
+ changes = updateGlobalConfiguration(values, false /* initLocale */,
+ false /* persistent */, UserHandle.USER_NULL /* userId */, deferResume);
+ } else {
+ changes = performDisplayOverrideConfigUpdate(values, deferResume, displayId);
}
- Intent intent = new Intent(Intent.ACTION_CONFIGURATION_CHANGED);
- intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY
- | Intent.FLAG_RECEIVER_REPLACE_PENDING
- | Intent.FLAG_RECEIVER_FOREGROUND);
- broadcastIntentLocked(null, null, intent, null, null, 0, null, null,
- null, AppOpsManager.OP_NONE, null, false, false,
- MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
- if ((changes&ActivityInfo.CONFIG_LOCALE) != 0) {
- intent = new Intent(Intent.ACTION_LOCALE_CHANGED);
- intent.addFlags(Intent.FLAG_RECEIVER_FOREGROUND);
- if (!mProcessesReady) {
- intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY);
- }
- broadcastIntentLocked(null, null, intent,
- null, null, 0, null, null, null, AppOpsManager.OP_NONE,
- null, false, false, MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
+ }
+
+ kept = ensureConfigAndVisibilityAfterUpdate(starting, changes);
+ } finally {
+ if (mWindowManager != null) {
+ mWindowManager.continueSurfaceLayout();
+ }
+ }
+
+ if (result != null) {
+ result.changes = changes;
+ result.activityRelaunched = !kept;
+ }
+ return kept;
+ }
+
+ private int performDisplayOverrideConfigUpdate(Configuration values, boolean deferResume,
+ int displayId) {
+ mTempConfig.setTo(mStackSupervisor.getDisplayOverrideConfiguration(displayId));
+ final int changes = mTempConfig.updateFrom(values);
+ if (changes != 0) {
+ Slog.i(TAG, "Override config changes=" + Integer.toHexString(changes) + " "
+ + mTempConfig + " for displayId=" + displayId);
+ mStackSupervisor.setDisplayOverrideConfiguration(mTempConfig, displayId);
+
+ final boolean isDensityChange = (changes & ActivityInfo.CONFIG_DENSITY) != 0;
+ if (isDensityChange && displayId == DEFAULT_DISPLAY) {
+ // Reset the unsupported display size dialog.
+ mUiHandler.sendEmptyMessage(SHOW_UNSUPPORTED_DISPLAY_SIZE_DIALOG_MSG);
+
+ killAllBackgroundProcessesExcept(N,
+ ActivityManager.PROCESS_STATE_FOREGROUND_SERVICE);
+ }
+ }
+
+ // Update the configuration with WM first and check if any of the stacks need to be resized
+ // due to the configuration change. If so, resize the stacks now and do any relaunches if
+ // necessary. This way we don't need to relaunch again afterwards in
+ // ensureActivityConfigurationLocked().
+ if (mWindowManager != null) {
+ final int[] resizedStacks =
+ mWindowManager.setNewDisplayOverrideConfiguration(mTempConfig, displayId);
+ if (resizedStacks != null) {
+ for (int stackId : resizedStacks) {
+ resizeStackWithBoundsFromWindowManager(stackId, deferResume);
}
}
}
+ return changes;
+ }
+
+ /** Applies latest configuration and/or visibility updates if needed. */
+ private boolean ensureConfigAndVisibilityAfterUpdate(ActivityRecord starting, int changes) {
boolean kept = true;
final ActivityStack mainStack = mStackSupervisor.getFocusedStack();
// mainStack is null during startup.
// If the configuration changed, and the caller is not already
// in the process of starting an activity, then find the top
// activity to check if its configuration needs to change.
- starting = mainStack.topRunningActivityLocked(null);
+ starting = mainStack.topRunningActivityLocked();
}
if (starting != null) {
- kept = mainStack.ensureActivityConfigurationLocked(starting, changes);
+ kept = starting.ensureActivityConfigurationLocked(changes,
+ false /* preserveWindow */);
// And we need to make sure at this point that all other activities
// are made visible with the correct configuration.
- mStackSupervisor.ensureActivitiesVisibleLocked(starting, changes);
+ mStackSupervisor.ensureActivitiesVisibleLocked(starting, changes,
+ !PRESERVE_WINDOWS);
}
}
- if (values != null && mWindowManager != null) {
- mWindowManager.setNewConfiguration(mConfiguration);
- }
-
return kept;
}
+ /** Helper method that requests bounds from WM and applies them to stack. */
+ private void resizeStackWithBoundsFromWindowManager(int stackId, boolean deferResume) {
+ final Rect newStackBounds = new Rect();
+ mStackSupervisor.getStack(stackId).getBoundsForNewConfiguration(newStackBounds);
+ mStackSupervisor.resizeStackLocked(
+ stackId, !newStackBounds.isEmpty() ? newStackBounds : null /* bounds */,
+ null /* tempTaskBounds */, null /* tempTaskInsetBounds */,
+ false /* preserveWindows */, false /* allowResizeInDockedMode */, deferResume);
+ }
+
/**
- * Decide based on the configuration whether we should shouw the ANR,
- * crash, etc dialogs. The idea is that if there is no affordnace to
- * press the on-screen buttons, we shouldn't show the dialog.
+ * Decide based on the configuration whether we should show the ANR,
+ * crash, etc dialogs. The idea is that if there is no affordance to
+ * press the on-screen buttons, or the user experience would be more
+ * greatly impacted than the crash itself, we shouldn't show the dialog.
*
* A thought: SystemUI might also want to get told about this, the Power
* dialog / global actions also might want different behaviors.
*/
- private static final boolean shouldShowDialogs(Configuration config) {
- return !(config.keyboard == Configuration.KEYBOARD_NOKEYS
- && config.touchscreen == Configuration.TOUCHSCREEN_NOTOUCH
- && config.navigation == Configuration.NAVIGATION_NONAV);
+ private static boolean shouldShowDialogs(Configuration config) {
+ final boolean inputMethodExists = !(config.keyboard == Configuration.KEYBOARD_NOKEYS
+ && config.touchscreen == Configuration.TOUCHSCREEN_NOTOUCH
+ && config.navigation == Configuration.NAVIGATION_NONAV);
+ int modeType = config.uiMode & Configuration.UI_MODE_TYPE_MASK;
+ final boolean uiModeSupportsDialogs = (modeType != Configuration.UI_MODE_TYPE_CAR
+ && !(modeType == Configuration.UI_MODE_TYPE_WATCH && Build.IS_USER)
+ && modeType != Configuration.UI_MODE_TYPE_TELEVISION
+ && modeType != Configuration.UI_MODE_TYPE_VR_HEADSET);
+ return inputMethodExists && uiModeSupportsDialogs;
}
@Override
synchronized (this) {
ActivityRecord srec = ActivityRecord.forTokenLocked(token);
if (srec != null) {
- return srec.task.stack.shouldUpRecreateTaskLocked(srec, destAffinity);
+ return srec.getStack().shouldUpRecreateTaskLocked(srec, destAffinity);
}
}
return false;
synchronized (this) {
final ActivityRecord r = ActivityRecord.forTokenLocked(token);
if (r != null) {
- return r.task.stack.navigateUpToLocked(r, destIntent, resultCode, resultData);
+ return r.getStack().navigateUpToLocked(r, destIntent, resultCode, resultData);
}
return false;
}
// LIFETIME MANAGEMENT
// =========================================================
- // Returns which broadcast queue the app is the current [or imminent] receiver
- // on, or 'null' if the app is not an active broadcast recipient.
- private BroadcastQueue isReceivingBroadcast(ProcessRecord app) {
- BroadcastRecord r = app.curReceiver;
- if (r != null) {
- return r.queue;
+ // Returns whether the app is receiving broadcast.
+ // If receiving, fetch all broadcast queues which the app is
+ // the current [or imminent] receiver on.
+ private boolean isReceivingBroadcastLocked(ProcessRecord app,
+ ArraySet<BroadcastQueue> receivingQueues) {
+ if (!app.curReceivers.isEmpty()) {
+ for (BroadcastRecord r : app.curReceivers) {
+ receivingQueues.add(r.queue);
+ }
+ return true;
}
// It's not the current receiver, but it might be starting up to become one
- synchronized (this) {
- for (BroadcastQueue queue : mBroadcastQueues) {
- r = queue.mPendingBroadcast;
- if (r != null && r.curApp == app) {
- // found it; report which queue it's in
- return queue;
- }
+ for (BroadcastQueue queue : mBroadcastQueues) {
+ final BroadcastRecord r = queue.mPendingBroadcast;
+ if (r != null && r.curApp == app) {
+ // found it; report which queue it's in
+ receivingQueues.add(queue);
}
}
- return null;
+ return !receivingQueues.isEmpty();
}
- Association startAssociationLocked(int sourceUid, String sourceProcess, int targetUid,
- ComponentName targetComponent, String targetProcess) {
+ Association startAssociationLocked(int sourceUid, String sourceProcess, int sourceState,
+ int targetUid, ComponentName targetComponent, String targetProcess) {
if (!mTrackingAssociations) {
return null;
}
ass.mCount++;
ass.mNesting++;
if (ass.mNesting == 1) {
- ass.mStartTime = SystemClock.uptimeMillis();
+ ass.mStartTime = ass.mLastStateUptime = SystemClock.uptimeMillis();
+ ass.mLastState = sourceState;
}
return ass;
}
}
ass.mNesting--;
if (ass.mNesting == 0) {
- ass.mTime += SystemClock.uptimeMillis() - ass.mStartTime;
+ long uptime = SystemClock.uptimeMillis();
+ ass.mTime += uptime - ass.mStartTime;
+ ass.mStateTimes[ass.mLastState-ActivityManager.MIN_PROCESS_STATE]
+ += uptime - ass.mLastStateUptime;
+ ass.mLastState = ActivityManager.MAX_PROCESS_STATE + 2;
+ }
+ }
+
+ private void noteUidProcessState(final int uid, final int state) {
+ mBatteryStatsService.noteUidProcessState(uid, state);
+ if (mTrackingAssociations) {
+ for (int i1=0, N1=mAssociations.size(); i1<N1; i1++) {
+ ArrayMap<ComponentName, SparseArray<ArrayMap<String, Association>>> targetComponents
+ = mAssociations.valueAt(i1);
+ for (int i2=0, N2=targetComponents.size(); i2<N2; i2++) {
+ SparseArray<ArrayMap<String, Association>> sourceUids
+ = targetComponents.valueAt(i2);
+ ArrayMap<String, Association> sourceProcesses = sourceUids.get(uid);
+ if (sourceProcesses != null) {
+ for (int i4=0, N4=sourceProcesses.size(); i4<N4; i4++) {
+ Association ass = sourceProcesses.valueAt(i4);
+ if (ass.mNesting >= 1) {
+ // currently associated
+ long uptime = SystemClock.uptimeMillis();
+ ass.mStateTimes[ass.mLastState-ActivityManager.MIN_PROCESS_STATE]
+ += uptime - ass.mLastStateUptime;
+ ass.mLastState = state;
+ ass.mLastStateUptime = uptime;
+ }
+ }
+ }
+ }
+ }
}
}
if (app.thread == null) {
app.adjSeq = mAdjSeq;
- app.curSchedGroup = Process.THREAD_GROUP_BG_NONINTERACTIVE;
+ app.curSchedGroup = ProcessList.SCHED_GROUP_BACKGROUND;
app.curProcState = ActivityManager.PROCESS_STATE_CACHED_EMPTY;
return (app.curAdj=app.curRawAdj=ProcessList.CACHED_APP_MAX_ADJ);
}
if (app.maxAdj <= ProcessList.FOREGROUND_APP_ADJ) {
// The max adjustment doesn't allow this app to be anything
// below foreground, so it is not worth doing work for it.
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Making fixed: " + app);
app.adjType = "fixed";
app.adjSeq = mAdjSeq;
app.curRawAdj = app.maxAdj;
app.foregroundActivities = false;
- app.curSchedGroup = Process.THREAD_GROUP_DEFAULT;
+ app.curSchedGroup = ProcessList.SCHED_GROUP_DEFAULT;
app.curProcState = ActivityManager.PROCESS_STATE_PERSISTENT;
// System processes can do UI, and when they do we want to have
// them trim their memory after the user leaves the UI. To
app.systemNoUi = true;
if (app == TOP_APP) {
app.systemNoUi = false;
+ app.curSchedGroup = ProcessList.SCHED_GROUP_TOP_APP;
+ app.adjType = "pers-top-activity";
+ } else if (app.hasTopUi) {
+ app.systemNoUi = false;
+ app.curSchedGroup = ProcessList.SCHED_GROUP_TOP_APP;
+ app.adjType = "pers-top-ui";
} else if (activitiesSize > 0) {
for (int j = 0; j < activitiesSize; j++) {
final ActivityRecord r = app.activities.get(j);
app.systemNoUi = false;
- final int PROCESS_STATE_TOP = mTopProcessState;
+ final int PROCESS_STATE_CUR_TOP = mTopProcessState;
// Determine the importance of the process, starting with most
// important to least, and assign an appropriate OOM adjustment.
int schedGroup;
int procState;
boolean foregroundActivities = false;
- BroadcastQueue queue;
+ mTmpBroadcastQueue.clear();
if (app == TOP_APP) {
// The last app on the list is the foreground app.
adj = ProcessList.FOREGROUND_APP_ADJ;
- schedGroup = Process.THREAD_GROUP_DEFAULT;
+ schedGroup = ProcessList.SCHED_GROUP_TOP_APP;
app.adjType = "top-activity";
foregroundActivities = true;
- procState = PROCESS_STATE_TOP;
- } else if (app.instrumentationClass != null) {
+ procState = PROCESS_STATE_CUR_TOP;
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Making top: " + app);
+ } else if (app.instr != null) {
// Don't want to kill running instrumentation.
adj = ProcessList.FOREGROUND_APP_ADJ;
- schedGroup = Process.THREAD_GROUP_DEFAULT;
+ schedGroup = ProcessList.SCHED_GROUP_DEFAULT;
app.adjType = "instrumentation";
procState = ActivityManager.PROCESS_STATE_FOREGROUND_SERVICE;
- } else if ((queue = isReceivingBroadcast(app)) != null) {
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Making instrumentation: " + app);
+ } else if (isReceivingBroadcastLocked(app, mTmpBroadcastQueue)) {
// An app that is currently receiving a broadcast also
// counts as being in the foreground for OOM killer purposes.
// It's placed in a sched group based on the nature of the
// broadcast as reflected by which queue it's active in.
adj = ProcessList.FOREGROUND_APP_ADJ;
- schedGroup = (queue == mFgBroadcastQueue)
- ? Process.THREAD_GROUP_DEFAULT : Process.THREAD_GROUP_BG_NONINTERACTIVE;
+ schedGroup = (mTmpBroadcastQueue.contains(mFgBroadcastQueue))
+ ? ProcessList.SCHED_GROUP_DEFAULT : ProcessList.SCHED_GROUP_BACKGROUND;
app.adjType = "broadcast";
procState = ActivityManager.PROCESS_STATE_RECEIVER;
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Making broadcast: " + app);
} else if (app.executingServices.size() > 0) {
// An app that is currently executing a service callback also
// counts as being in the foreground.
adj = ProcessList.FOREGROUND_APP_ADJ;
schedGroup = app.execServicesFg ?
- Process.THREAD_GROUP_DEFAULT : Process.THREAD_GROUP_BG_NONINTERACTIVE;
+ ProcessList.SCHED_GROUP_DEFAULT : ProcessList.SCHED_GROUP_BACKGROUND;
app.adjType = "exec-service";
procState = ActivityManager.PROCESS_STATE_SERVICE;
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Making exec-service: " + app);
//Slog.i(TAG, "EXEC " + (app.execServicesFg ? "FG" : "BG") + ": " + app);
} else {
// As far as we know the process is empty. We may change our mind later.
- schedGroup = Process.THREAD_GROUP_BG_NONINTERACTIVE;
+ schedGroup = ProcessList.SCHED_GROUP_BACKGROUND;
// At this point we don't actually know the adjustment. Use the cached adj
// value that the caller wants us to.
adj = cachedAdj;
app.cached = true;
app.empty = true;
app.adjType = "cch-empty";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Making empty: " + app);
}
// Examine all activities if not already foreground.
if (!foregroundActivities && activitiesSize > 0) {
+ int minLayer = ProcessList.VISIBLE_APP_LAYER_MAX;
for (int j = 0; j < activitiesSize; j++) {
final ActivityRecord r = app.activities.get(j);
if (r.app != app) {
- Slog.w(TAG, "Wtf, activity " + r + " in proc activity list not using proc "
- + app + "?!? Using " + r.app + " instead.");
- continue;
+ Log.e(TAG, "Found activity " + r + " in proc activity list using " + r.app
+ + " instead of expected " + app);
+ if (r.app == null || (r.app.uid == app.uid)) {
+ // Only fix things up when they look sane
+ r.app = app;
+ } else {
+ continue;
+ }
}
if (r.visible) {
// App has a visible activity; only upgrade adjustment.
if (adj > ProcessList.VISIBLE_APP_ADJ) {
adj = ProcessList.VISIBLE_APP_ADJ;
- app.adjType = "visible";
+ app.adjType = "vis-activity";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to vis-activity: " + app);
}
- if (procState > PROCESS_STATE_TOP) {
- procState = PROCESS_STATE_TOP;
+ if (procState > PROCESS_STATE_CUR_TOP) {
+ procState = PROCESS_STATE_CUR_TOP;
+ app.adjType = "vis-activity";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to vis-activity: " + app);
}
- schedGroup = Process.THREAD_GROUP_DEFAULT;
+ schedGroup = ProcessList.SCHED_GROUP_DEFAULT;
app.cached = false;
app.empty = false;
foregroundActivities = true;
+ final TaskRecord task = r.getTask();
+ if (task != null && minLayer > 0) {
+ final int layer = task.mLayerRank;
+ if (layer >= 0 && minLayer > layer) {
+ minLayer = layer;
+ }
+ }
break;
} else if (r.state == ActivityState.PAUSING || r.state == ActivityState.PAUSED) {
if (adj > ProcessList.PERCEPTIBLE_APP_ADJ) {
adj = ProcessList.PERCEPTIBLE_APP_ADJ;
- app.adjType = "pausing";
+ app.adjType = "pause-activity";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to pause-activity: " + app);
}
- if (procState > PROCESS_STATE_TOP) {
- procState = PROCESS_STATE_TOP;
+ if (procState > PROCESS_STATE_CUR_TOP) {
+ procState = PROCESS_STATE_CUR_TOP;
+ app.adjType = "pause-activity";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to pause-activity: " + app);
}
- schedGroup = Process.THREAD_GROUP_DEFAULT;
+ schedGroup = ProcessList.SCHED_GROUP_DEFAULT;
app.cached = false;
app.empty = false;
foregroundActivities = true;
} else if (r.state == ActivityState.STOPPING) {
if (adj > ProcessList.PERCEPTIBLE_APP_ADJ) {
adj = ProcessList.PERCEPTIBLE_APP_ADJ;
- app.adjType = "stopping";
+ app.adjType = "stop-activity";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to stop-activity: " + app);
}
// For the process state, we will at this point consider the
// process to be cached. It will be cached either as an activity
if (!r.finishing) {
if (procState > ActivityManager.PROCESS_STATE_LAST_ACTIVITY) {
procState = ActivityManager.PROCESS_STATE_LAST_ACTIVITY;
+ app.adjType = "stop-activity";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to stop-activity: " + app);
}
}
app.cached = false;
if (procState > ActivityManager.PROCESS_STATE_CACHED_ACTIVITY) {
procState = ActivityManager.PROCESS_STATE_CACHED_ACTIVITY;
app.adjType = "cch-act";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to cached activity: " + app);
}
}
}
+ if (adj == ProcessList.VISIBLE_APP_ADJ) {
+ adj += minLayer;
+ }
}
- if (adj > ProcessList.PERCEPTIBLE_APP_ADJ) {
+ if (adj > ProcessList.PERCEPTIBLE_APP_ADJ
+ || procState > ActivityManager.PROCESS_STATE_FOREGROUND_SERVICE) {
if (app.foregroundServices) {
// The user is aware of this app, so make it visible.
adj = ProcessList.PERCEPTIBLE_APP_ADJ;
procState = ActivityManager.PROCESS_STATE_FOREGROUND_SERVICE;
app.cached = false;
app.adjType = "fg-service";
- schedGroup = Process.THREAD_GROUP_DEFAULT;
- } else if (app.forcingToForeground != null) {
- // The user is aware of this app, so make it visible.
+ schedGroup = ProcessList.SCHED_GROUP_DEFAULT;
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to fg service: " + app);
+ } else if (app.hasOverlayUi) {
+ // The process is display an overlay UI.
adj = ProcessList.PERCEPTIBLE_APP_ADJ;
procState = ActivityManager.PROCESS_STATE_IMPORTANT_FOREGROUND;
app.cached = false;
- app.adjType = "force-fg";
- app.adjSource = app.forcingToForeground;
- schedGroup = Process.THREAD_GROUP_DEFAULT;
+ app.adjType = "has-overlay-ui";
+ schedGroup = ProcessList.SCHED_GROUP_DEFAULT;
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to overlay ui: " + app);
+ }
+ }
+
+ if (adj > ProcessList.PERCEPTIBLE_APP_ADJ
+ || procState > ActivityManager.PROCESS_STATE_TRANSIENT_BACKGROUND) {
+ if (app.forcingToImportant != null) {
+ // This is currently used for toasts... they are not interactive, and
+ // we don't want them to cause the app to become fully foreground (and
+ // thus out of background check), so we yes the best background level we can.
+ adj = ProcessList.PERCEPTIBLE_APP_ADJ;
+ procState = ActivityManager.PROCESS_STATE_TRANSIENT_BACKGROUND;
+ app.cached = false;
+ app.adjType = "force-imp";
+ app.adjSource = app.forcingToImportant;
+ schedGroup = ProcessList.SCHED_GROUP_DEFAULT;
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to force imp: " + app);
}
}
if (adj > ProcessList.HEAVY_WEIGHT_APP_ADJ) {
// We don't want to kill the current heavy-weight process.
adj = ProcessList.HEAVY_WEIGHT_APP_ADJ;
- schedGroup = Process.THREAD_GROUP_BG_NONINTERACTIVE;
+ schedGroup = ProcessList.SCHED_GROUP_BACKGROUND;
app.cached = false;
app.adjType = "heavy";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to heavy: " + app);
}
if (procState > ActivityManager.PROCESS_STATE_HEAVY_WEIGHT) {
procState = ActivityManager.PROCESS_STATE_HEAVY_WEIGHT;
+ app.adjType = "heavy";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to heavy: " + app);
}
}
// This process is hosting what we currently consider to be the
// home app, so we don't want to let it go into the background.
adj = ProcessList.HOME_APP_ADJ;
- schedGroup = Process.THREAD_GROUP_BG_NONINTERACTIVE;
+ schedGroup = ProcessList.SCHED_GROUP_BACKGROUND;
app.cached = false;
app.adjType = "home";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to home: " + app);
}
if (procState > ActivityManager.PROCESS_STATE_HOME) {
procState = ActivityManager.PROCESS_STATE_HOME;
+ app.adjType = "home";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to home: " + app);
}
}
// We want to try to keep it around more aggressively, to give
// a good experience around switching between two apps.
adj = ProcessList.PREVIOUS_APP_ADJ;
- schedGroup = Process.THREAD_GROUP_BG_NONINTERACTIVE;
+ schedGroup = ProcessList.SCHED_GROUP_BACKGROUND;
app.cached = false;
app.adjType = "previous";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to prev: " + app);
}
if (procState > ActivityManager.PROCESS_STATE_LAST_ACTIVITY) {
procState = ActivityManager.PROCESS_STATE_LAST_ACTIVITY;
+ app.adjType = "previous";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to prev: " + app);
}
}
if (adj > ProcessList.BACKUP_APP_ADJ) {
if (DEBUG_BACKUP) Slog.v(TAG_BACKUP, "oom BACKUP_APP_ADJ for " + app);
adj = ProcessList.BACKUP_APP_ADJ;
- if (procState > ActivityManager.PROCESS_STATE_IMPORTANT_BACKGROUND) {
- procState = ActivityManager.PROCESS_STATE_IMPORTANT_BACKGROUND;
+ if (procState > ActivityManager.PROCESS_STATE_TRANSIENT_BACKGROUND) {
+ procState = ActivityManager.PROCESS_STATE_TRANSIENT_BACKGROUND;
}
app.adjType = "backup";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to backup: " + app);
app.cached = false;
}
if (procState > ActivityManager.PROCESS_STATE_BACKUP) {
procState = ActivityManager.PROCESS_STATE_BACKUP;
+ app.adjType = "backup";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to backup: " + app);
}
}
boolean mayBeTop = false;
+ String mayBeTopType = null;
+ Object mayBeTopSource = null;
+ Object mayBeTopTarget = null;
for (int is = app.services.size()-1;
is >= 0 && (adj > ProcessList.FOREGROUND_APP_ADJ
- || schedGroup == Process.THREAD_GROUP_BG_NONINTERACTIVE
+ || schedGroup == ProcessList.SCHED_GROUP_BACKGROUND
|| procState > ActivityManager.PROCESS_STATE_TOP);
is--) {
ServiceRecord s = app.services.valueAt(is);
app.hasStartedServices = true;
if (procState > ActivityManager.PROCESS_STATE_SERVICE) {
procState = ActivityManager.PROCESS_STATE_SERVICE;
+ app.adjType = "started-services";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to started service: " + app);
}
if (app.hasShownUi && app != mHomeProcess) {
// If this process has shown some UI, let it immediately
app.adjType = "cch-started-ui-services";
}
} else {
- if (now < (s.lastActivity + ActiveServices.MAX_SERVICE_INACTIVITY)) {
+ if (now < (s.lastActivity + mConstants.MAX_SERVICE_INACTIVITY)) {
// This service has seen some activity within
// recent memory, so we will keep its process ahead
// of the background processes.
if (adj > ProcessList.SERVICE_ADJ) {
adj = ProcessList.SERVICE_ADJ;
app.adjType = "started-services";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to started service: " + app);
app.cached = false;
}
}
}
}
}
+
for (int conni = s.connections.size()-1;
conni >= 0 && (adj > ProcessList.FOREGROUND_APP_ADJ
- || schedGroup == Process.THREAD_GROUP_BG_NONINTERACTIVE
+ || schedGroup == ProcessList.SCHED_GROUP_BACKGROUND
|| procState > ActivityManager.PROCESS_STATE_TOP);
conni--) {
ArrayList<ConnectionRecord> clist = s.connections.valueAt(conni);
for (int i = 0;
i < clist.size() && (adj > ProcessList.FOREGROUND_APP_ADJ
- || schedGroup == Process.THREAD_GROUP_BG_NONINTERACTIVE
+ || schedGroup == ProcessList.SCHED_GROUP_BACKGROUND
|| procState > ActivityManager.PROCESS_STATE_TOP);
i++) {
// XXX should compute this based on the max of
// Binding to ourself is not interesting.
continue;
}
+
if ((cr.flags&Context.BIND_WAIVE_PRIORITY) == 0) {
ProcessRecord client = cr.binding.client;
int clientAdj = computeOomAdjLocked(client, cachedAdj,
clientAdj = adj;
clientProcState = procState;
} else {
- if (now >= (s.lastActivity
- + ActiveServices.MAX_SERVICE_INACTIVITY)) {
+ if (now >= (s.lastActivity + mConstants.MAX_SERVICE_INACTIVITY)) {
// This service has not seen activity within
// recent memory, so allow it to drop to the
// LRU list if there is no other reason to keep
// memory.
if (app.hasShownUi && app != mHomeProcess
&& clientAdj > ProcessList.PERCEPTIBLE_APP_ADJ) {
- adjType = "cch-bound-ui-services";
+ if (adj >= ProcessList.CACHED_APP_MIN_ADJ) {
+ adjType = "cch-bound-ui-services";
+ }
} else {
+ int newAdj;
if ((cr.flags&(Context.BIND_ABOVE_CLIENT
|Context.BIND_IMPORTANT)) != 0) {
- adj = clientAdj >= ProcessList.PERSISTENT_SERVICE_ADJ
+ newAdj = clientAdj >= ProcessList.PERSISTENT_SERVICE_ADJ
? clientAdj : ProcessList.PERSISTENT_SERVICE_ADJ;
} else if ((cr.flags&Context.BIND_NOT_VISIBLE) != 0
&& clientAdj < ProcessList.PERCEPTIBLE_APP_ADJ
&& adj > ProcessList.PERCEPTIBLE_APP_ADJ) {
- adj = ProcessList.PERCEPTIBLE_APP_ADJ;
- } else if (clientAdj > ProcessList.VISIBLE_APP_ADJ) {
- adj = clientAdj;
+ newAdj = ProcessList.PERCEPTIBLE_APP_ADJ;
+ } else if (clientAdj >= ProcessList.PERCEPTIBLE_APP_ADJ) {
+ newAdj = clientAdj;
} else {
if (adj > ProcessList.VISIBLE_APP_ADJ) {
- adj = ProcessList.VISIBLE_APP_ADJ;
+ newAdj = Math.max(clientAdj, ProcessList.VISIBLE_APP_ADJ);
+ } else {
+ newAdj = adj;
}
}
if (!client.cached) {
app.cached = false;
}
- adjType = "service";
+ if (adj > newAdj) {
+ adj = newAdj;
+ adjType = "service";
+ }
}
}
- if ((cr.flags&Context.BIND_NOT_FOREGROUND) == 0) {
- if (client.curSchedGroup == Process.THREAD_GROUP_DEFAULT) {
- schedGroup = Process.THREAD_GROUP_DEFAULT;
+ if ((cr.flags & (Context.BIND_NOT_FOREGROUND
+ | Context.BIND_IMPORTANT_BACKGROUND)) == 0) {
+ // This will treat important bound services identically to
+ // the top app, which may behave differently than generic
+ // foreground work.
+ if (client.curSchedGroup > schedGroup) {
+ if ((cr.flags&Context.BIND_IMPORTANT) != 0) {
+ schedGroup = client.curSchedGroup;
+ } else {
+ schedGroup = ProcessList.SCHED_GROUP_DEFAULT;
+ }
}
if (clientProcState <= ActivityManager.PROCESS_STATE_TOP) {
if (clientProcState == ActivityManager.PROCESS_STATE_TOP) {
// is more important to continue considering it to be
// in the background state.
mayBeTop = true;
+ mayBeTopType = "service";
+ mayBeTopSource = cr.binding.client;
+ mayBeTopTarget = s.name;
clientProcState = ActivityManager.PROCESS_STATE_CACHED_EMPTY;
} else {
// Special handling for above-top states (persistent
}
}
}
+ } else if ((cr.flags & Context.BIND_IMPORTANT_BACKGROUND) == 0) {
+ if (clientProcState <
+ ActivityManager.PROCESS_STATE_TRANSIENT_BACKGROUND) {
+ clientProcState =
+ ActivityManager.PROCESS_STATE_TRANSIENT_BACKGROUND;
+ }
} else {
if (clientProcState <
ActivityManager.PROCESS_STATE_IMPORTANT_BACKGROUND) {
}
if (procState > clientProcState) {
procState = clientProcState;
+ if (adjType == null) {
+ adjType = "service";
+ }
}
if (procState < ActivityManager.PROCESS_STATE_IMPORTANT_BACKGROUND
&& (cr.flags&Context.BIND_SHOWING_UI) != 0) {
app.adjSource = cr.binding.client;
app.adjSourceProcState = clientProcState;
app.adjTarget = s.name;
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to " + adjType
+ + ": " + app + ", due to " + cr.binding.client
+ + " adj=" + adj + " procState=" + procState);
}
}
if ((cr.flags&Context.BIND_TREAT_LIKE_ACTIVITY) != 0) {
final ActivityRecord a = cr.activity;
if ((cr.flags&Context.BIND_ADJUST_WITH_ACTIVITY) != 0) {
if (a != null && adj > ProcessList.FOREGROUND_APP_ADJ &&
- (a.visible || a.state == ActivityState.RESUMED
- || a.state == ActivityState.PAUSING)) {
+ (a.visible || a.state == ActivityState.RESUMED ||
+ a.state == ActivityState.PAUSING)) {
adj = ProcessList.FOREGROUND_APP_ADJ;
if ((cr.flags&Context.BIND_NOT_FOREGROUND) == 0) {
- schedGroup = Process.THREAD_GROUP_DEFAULT;
+ if ((cr.flags&Context.BIND_IMPORTANT) != 0) {
+ schedGroup = ProcessList.SCHED_GROUP_TOP_APP_BOUND;
+ } else {
+ schedGroup = ProcessList.SCHED_GROUP_DEFAULT;
+ }
}
app.cached = false;
app.adjType = "service";
app.adjSource = a;
app.adjSourceProcState = procState;
app.adjTarget = s.name;
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to service w/activity: "
+ + app);
}
}
}
for (int provi = app.pubProviders.size()-1;
provi >= 0 && (adj > ProcessList.FOREGROUND_APP_ADJ
- || schedGroup == Process.THREAD_GROUP_BG_NONINTERACTIVE
+ || schedGroup == ProcessList.SCHED_GROUP_BACKGROUND
|| procState > ActivityManager.PROCESS_STATE_TOP);
provi--) {
ContentProviderRecord cpr = app.pubProviders.valueAt(provi);
for (int i = cpr.connections.size()-1;
i >= 0 && (adj > ProcessList.FOREGROUND_APP_ADJ
- || schedGroup == Process.THREAD_GROUP_BG_NONINTERACTIVE
+ || schedGroup == ProcessList.SCHED_GROUP_BACKGROUND
|| procState > ActivityManager.PROCESS_STATE_TOP);
i--) {
ContentProviderConnection conn = cpr.connections.get(i);
// we are going to consider it empty.
clientProcState = ActivityManager.PROCESS_STATE_CACHED_EMPTY;
}
+ String adjType = null;
if (adj > clientAdj) {
if (app.hasShownUi && app != mHomeProcess
&& clientAdj > ProcessList.PERCEPTIBLE_APP_ADJ) {
- app.adjType = "cch-ui-provider";
+ adjType = "cch-ui-provider";
} else {
adj = clientAdj > ProcessList.FOREGROUND_APP_ADJ
? clientAdj : ProcessList.FOREGROUND_APP_ADJ;
- app.adjType = "provider";
+ adjType = "provider";
}
app.cached &= client.cached;
- app.adjTypeCode = ActivityManager.RunningAppProcessInfo
- .REASON_PROVIDER_IN_USE;
- app.adjSource = client;
- app.adjSourceProcState = clientProcState;
- app.adjTarget = cpr.name;
}
if (clientProcState <= ActivityManager.PROCESS_STATE_TOP) {
if (clientProcState == ActivityManager.PROCESS_STATE_TOP) {
// in the background state.
mayBeTop = true;
clientProcState = ActivityManager.PROCESS_STATE_CACHED_EMPTY;
+ mayBeTopType = adjType = "provider-top";
+ mayBeTopSource = client;
+ mayBeTopTarget = cpr.name;
} else {
// Special handling for above-top states (persistent
// processes). These should not bring the current process
// give them the best state after that.
clientProcState =
ActivityManager.PROCESS_STATE_BOUND_FOREGROUND_SERVICE;
+ if (adjType == null) {
+ adjType = "provider";
+ }
}
}
if (procState > clientProcState) {
procState = clientProcState;
}
- if (client.curSchedGroup == Process.THREAD_GROUP_DEFAULT) {
- schedGroup = Process.THREAD_GROUP_DEFAULT;
+ if (client.curSchedGroup > schedGroup) {
+ schedGroup = ProcessList.SCHED_GROUP_DEFAULT;
+ }
+ if (adjType != null) {
+ app.adjType = adjType;
+ app.adjTypeCode = ActivityManager.RunningAppProcessInfo
+ .REASON_PROVIDER_IN_USE;
+ app.adjSource = client;
+ app.adjSourceProcState = clientProcState;
+ app.adjTarget = cpr.name;
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to " + adjType
+ + ": " + app + ", due to " + client
+ + " adj=" + adj + " procState=" + procState);
}
}
// If the provider has external (non-framework) process
if (cpr.hasExternalProcessHandles()) {
if (adj > ProcessList.FOREGROUND_APP_ADJ) {
adj = ProcessList.FOREGROUND_APP_ADJ;
- schedGroup = Process.THREAD_GROUP_DEFAULT;
+ schedGroup = ProcessList.SCHED_GROUP_DEFAULT;
app.cached = false;
- app.adjType = "provider";
+ app.adjType = "ext-provider";
app.adjTarget = cpr.name;
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to external provider: " + app);
}
if (procState > ActivityManager.PROCESS_STATE_IMPORTANT_FOREGROUND) {
procState = ActivityManager.PROCESS_STATE_IMPORTANT_FOREGROUND;
}
}
+ if (app.lastProviderTime > 0 &&
+ (app.lastProviderTime+mConstants.CONTENT_PROVIDER_RETAIN_TIME) > now) {
+ if (adj > ProcessList.PREVIOUS_APP_ADJ) {
+ adj = ProcessList.PREVIOUS_APP_ADJ;
+ schedGroup = ProcessList.SCHED_GROUP_BACKGROUND;
+ app.cached = false;
+ app.adjType = "recent-provider";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to recent provider: " + app);
+ }
+ if (procState > ActivityManager.PROCESS_STATE_LAST_ACTIVITY) {
+ procState = ActivityManager.PROCESS_STATE_LAST_ACTIVITY;
+ app.adjType = "recent-provider";
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "Raise to recent provider: " + app);
+ }
+ }
+
if (mayBeTop && procState > ActivityManager.PROCESS_STATE_TOP) {
// A client of one of our services or providers is in the top state. We
// *may* want to be in the top state, but not if we are already running in
// is top (states that tend to be longer-term) and otherwise allow it to go
// to the top state.
switch (procState) {
+ case ActivityManager.PROCESS_STATE_BOUND_FOREGROUND_SERVICE:
+ // Something else is keeping it at this level, just leave it.
+ break;
case ActivityManager.PROCESS_STATE_IMPORTANT_FOREGROUND:
case ActivityManager.PROCESS_STATE_IMPORTANT_BACKGROUND:
+ case ActivityManager.PROCESS_STATE_TRANSIENT_BACKGROUND:
case ActivityManager.PROCESS_STATE_SERVICE:
// These all are longer-term states, so pull them up to the top
// of the background states, but not all the way to the top state.
procState = ActivityManager.PROCESS_STATE_BOUND_FOREGROUND_SERVICE;
+ app.adjType = mayBeTopType;
+ app.adjSource = mayBeTopSource;
+ app.adjTarget = mayBeTopTarget;
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "May be top raise to " + mayBeTopType
+ + ": " + app + ", due to " + mayBeTopSource
+ + " adj=" + adj + " procState=" + procState);
break;
default:
// Otherwise, top is a better choice, so take it.
procState = ActivityManager.PROCESS_STATE_TOP;
+ app.adjType = mayBeTopType;
+ app.adjSource = mayBeTopSource;
+ app.adjTarget = mayBeTopTarget;
+ if (DEBUG_OOM_ADJ_REASON) Slog.d(TAG, "May be top raise to " + mayBeTopType
+ + ": " + app + ", due to " + mayBeTopSource
+ + " adj=" + adj + " procState=" + procState);
break;
}
}
if (adj > app.maxAdj) {
adj = app.maxAdj;
if (app.maxAdj <= ProcessList.PERCEPTIBLE_APP_ADJ) {
- schedGroup = Process.THREAD_GROUP_DEFAULT;
+ schedGroup = ProcessList.SCHED_GROUP_DEFAULT;
}
}
/**
* Record new PSS sample for a process.
*/
- void recordPssSampleLocked(ProcessRecord proc, int procState, long pss, long uss, long now) {
- EventLogTags.writeAmPss(proc.pid, proc.uid, proc.processName, pss * 1024, uss * 1024);
+ void recordPssSampleLocked(ProcessRecord proc, int procState, long pss, long uss, long swapPss,
+ long now) {
+ EventLogTags.writeAmPss(proc.pid, proc.uid, proc.processName, pss * 1024, uss * 1024,
+ swapPss * 1024);
proc.lastPssTime = now;
proc.baseProcessTracker.addPss(pss, uss, true, proc.pkgList);
if (DEBUG_PSS) Slog.d(TAG_PSS,
proc.initialIdlePss = pss;
}
proc.lastPss = pss;
+ proc.lastSwapPss = swapPss;
if (procState >= ActivityManager.PROCESS_STATE_HOME) {
proc.lastCachedPss = pss;
+ proc.lastCachedSwapPss = swapPss;
}
final SparseArray<Pair<Long, String>> watchUids
public void run() {
revokeUriPermission(ActivityThread.currentActivityThread()
.getApplicationThread(),
- DumpHeapActivity.JAVA_URI,
+ null, DumpHeapActivity.JAVA_URI,
Intent.FLAG_GRANT_READ_URI_PERMISSION
| Intent.FLAG_GRANT_WRITE_URI_PERMISSION,
UserHandle.myUserId());
if (DEBUG_PSS) Slog.d(TAG_PSS,
"Requesting dump heap from "
+ myProc + " to " + heapdumpFile);
- thread.dumpHeap(true, heapdumpFile.toString(), fd);
+ thread.dumpHeap(/* managed= */ true,
+ /* mallocInfo= */ false, /* runGc= */ false,
+ heapdumpFile.toString(), fd);
} catch (RemoteException e) {
}
}
void requestPssAllProcsLocked(long now, boolean always, boolean memLowered) {
if (!always) {
if (now < (mLastFullPssTime +
- (memLowered ? FULL_PSS_LOWERED_INTERVAL : FULL_PSS_MIN_INTERVAL))) {
+ (memLowered ? mConstants.FULL_PSS_LOWERED_INTERVAL
+ : mConstants.FULL_PSS_MIN_INTERVAL))) {
return;
}
}
if (memLowered || now > (app.lastStateTime+ProcessList.PSS_ALL_INTERVAL)) {
app.pssProcState = app.setProcState;
app.nextPssTime = ProcessList.computeNextPssTime(app.curProcState, true,
- mTestPssMode, isSleeping(), now);
+ mTestPssMode, isSleepingLocked(), now);
mPendingPssProcesses.add(app);
}
}
}
}
return !processingBroadcasts
- && (isSleeping() || mStackSupervisor.allResumedActivitiesIdle());
+ && (isSleepingLocked() || mStackSupervisor.allResumedActivitiesIdle());
}
/**
while (mProcessesToGc.size() > 0) {
ProcessRecord proc = mProcessesToGc.remove(0);
if (proc.curRawAdj > ProcessList.PERCEPTIBLE_APP_ADJ || proc.reportLowMemory) {
- if ((proc.lastRequestedGc+GC_MIN_INTERVAL)
+ if ((proc.lastRequestedGc+mConstants.GC_MIN_INTERVAL)
<= SystemClock.uptimeMillis()) {
// To avoid spamming the system, we will GC processes one
// at a time, waiting a few seconds between each.
ProcessRecord proc = mProcessesToGc.get(0);
Message msg = mHandler.obtainMessage(GC_BACKGROUND_PROCESSES_MSG);
- long when = proc.lastRequestedGc + GC_MIN_INTERVAL;
+ long when = proc.lastRequestedGc + mConstants.GC_MIN_INTERVAL;
long now = SystemClock.uptimeMillis();
- if (when < (now+GC_TIMEOUT)) {
- when = now + GC_TIMEOUT;
+ if (when < (now+mConstants.GC_TIMEOUT)) {
+ when = now + mConstants.GC_TIMEOUT;
}
mHandler.sendMessageAtTime(msg, when);
}
*/
final void scheduleAppGcLocked(ProcessRecord app) {
long now = SystemClock.uptimeMillis();
- if ((app.lastRequestedGc+GC_MIN_INTERVAL) > now) {
+ if ((app.lastRequestedGc+mConstants.GC_MIN_INTERVAL) > now) {
return;
}
if (!mProcessesToGc.contains(app)) {
}
}
- final void checkExcessivePowerUsageLocked(boolean doKills) {
+ final void checkExcessivePowerUsageLocked() {
updateCpuStatsNow();
BatteryStatsImpl stats = mBatteryStatsService.getActiveStatistics();
- boolean doWakeKills = doKills;
- boolean doCpuKills = doKills;
- if (mLastPowerCheckRealtime == 0) {
- doWakeKills = false;
- }
+ boolean doCpuKills = true;
if (mLastPowerCheckUptime == 0) {
doCpuKills = false;
}
- if (stats.isScreenOn()) {
- doWakeKills = false;
- }
- final long curRealtime = SystemClock.elapsedRealtime();
- final long realtimeSince = curRealtime - mLastPowerCheckRealtime;
final long curUptime = SystemClock.uptimeMillis();
final long uptimeSince = curUptime - mLastPowerCheckUptime;
- mLastPowerCheckRealtime = curRealtime;
mLastPowerCheckUptime = curUptime;
- if (realtimeSince < WAKE_LOCK_MIN_CHECK_DURATION) {
- doWakeKills = false;
- }
- if (uptimeSince < CPU_MIN_CHECK_DURATION) {
- doCpuKills = false;
- }
int i = mLruProcesses.size();
while (i > 0) {
i--;
ProcessRecord app = mLruProcesses.get(i);
if (app.setProcState >= ActivityManager.PROCESS_STATE_HOME) {
- long wtime;
- synchronized (stats) {
- wtime = stats.getProcessWakeTime(app.info.uid,
- app.pid, curRealtime);
+ if (app.lastCpuTime <= 0) {
+ continue;
}
- long wtimeUsed = wtime - app.lastWakeTime;
long cputimeUsed = app.curCpuTime - app.lastCpuTime;
if (DEBUG_POWER) {
StringBuilder sb = new StringBuilder(128);
- sb.append("Wake for ");
- app.toShortString(sb);
- sb.append(": over ");
- TimeUtils.formatDuration(realtimeSince, sb);
- sb.append(" used ");
- TimeUtils.formatDuration(wtimeUsed, sb);
- sb.append(" (");
- sb.append((wtimeUsed*100)/realtimeSince);
- sb.append("%)");
- Slog.i(TAG_POWER, sb.toString());
- sb.setLength(0);
sb.append("CPU for ");
app.toShortString(sb);
sb.append(": over ");
sb.append("%)");
Slog.i(TAG_POWER, sb.toString());
}
- // If a process has held a wake lock for more
- // than 50% of the time during this period,
- // that sounds bad. Kill!
- if (doWakeKills && realtimeSince > 0
- && ((wtimeUsed*100)/realtimeSince) >= 50) {
- synchronized (stats) {
- stats.reportExcessiveWakeLocked(app.info.uid, app.processName,
- realtimeSince, wtimeUsed);
+ // If the process has used too much CPU over the last duration, the
+ // user probably doesn't want this, so kill!
+ if (doCpuKills && uptimeSince > 0) {
+ // What is the limit for this process?
+ int cpuLimit;
+ long checkDur = curUptime - app.whenUnimportant;
+ if (checkDur <= mConstants.POWER_CHECK_INTERVAL) {
+ cpuLimit = mConstants.POWER_CHECK_MAX_CPU_1;
+ } else if (checkDur <= (mConstants.POWER_CHECK_INTERVAL*2)
+ || app.setProcState <= ActivityManager.PROCESS_STATE_HOME) {
+ cpuLimit = mConstants.POWER_CHECK_MAX_CPU_2;
+ } else if (checkDur <= (mConstants.POWER_CHECK_INTERVAL*3)) {
+ cpuLimit = mConstants.POWER_CHECK_MAX_CPU_3;
+ } else {
+ cpuLimit = mConstants.POWER_CHECK_MAX_CPU_4;
}
- app.kill("excessive wake held " + wtimeUsed + " during " + realtimeSince, true);
- app.baseProcessTracker.reportExcessiveWake(app.pkgList);
- } else if (doCpuKills && uptimeSince > 0
- && ((cputimeUsed*100)/uptimeSince) >= 25) {
- synchronized (stats) {
- stats.reportExcessiveCpuLocked(app.info.uid, app.processName,
- uptimeSince, cputimeUsed);
+ if (((cputimeUsed*100)/uptimeSince) >= cpuLimit) {
+ synchronized (stats) {
+ stats.reportExcessiveCpuLocked(app.info.uid, app.processName,
+ uptimeSince, cputimeUsed);
+ }
+ app.kill("excessive cpu " + cputimeUsed + " during " + uptimeSince
+ + " dur=" + checkDur + " limit=" + cpuLimit, true);
+ app.baseProcessTracker.reportExcessiveCpu(app.pkgList);
}
- app.kill("excessive cpu " + cputimeUsed + " during " + uptimeSince, true);
- app.baseProcessTracker.reportExcessiveCpu(app.pkgList);
- } else {
- app.lastWakeTime = wtime;
- app.lastCpuTime = app.curCpuTime;
}
+ app.lastCpuTime = app.curCpuTime;
}
}
}
int changes = 0;
if (app.curAdj != app.setAdj) {
- ProcessList.setOomAdj(app.pid, app.info.uid, app.curAdj);
- if (DEBUG_SWITCH || DEBUG_OOM_ADJ) Slog.v(TAG_OOM_ADJ,
- "Set " + app.pid + " " + app.processName + " adj " + app.curAdj + ": "
- + app.adjType);
+ ProcessList.setOomAdj(app.pid, app.uid, app.curAdj);
+ if (DEBUG_SWITCH || DEBUG_OOM_ADJ || mCurOomAdjUid == app.info.uid) {
+ String msg = "Set " + app.pid + " " + app.processName + " adj "
+ + app.curAdj + ": " + app.adjType;
+ reportOomAdjMessageLocked(TAG_OOM_ADJ, msg);
+ }
app.setAdj = app.curAdj;
+ app.verifiedAdj = ProcessList.INVALID_ADJ;
}
if (app.setSchedGroup != app.curSchedGroup) {
+ int oldSchedGroup = app.setSchedGroup;
app.setSchedGroup = app.curSchedGroup;
- if (DEBUG_SWITCH || DEBUG_OOM_ADJ) Slog.v(TAG_OOM_ADJ,
- "Setting process group of " + app.processName
- + " to " + app.curSchedGroup);
- if (app.waitingToKill != null && app.curReceiver == null
- && app.setSchedGroup == Process.THREAD_GROUP_BG_NONINTERACTIVE) {
+ if (DEBUG_SWITCH || DEBUG_OOM_ADJ || mCurOomAdjUid == app.uid) {
+ String msg = "Setting sched group of " + app.processName
+ + " to " + app.curSchedGroup;
+ reportOomAdjMessageLocked(TAG_OOM_ADJ, msg);
+ }
+ if (app.waitingToKill != null && app.curReceivers.isEmpty()
+ && app.setSchedGroup == ProcessList.SCHED_GROUP_BACKGROUND) {
app.kill(app.waitingToKill, true);
success = false;
} else {
- if (true) {
- long oldId = Binder.clearCallingIdentity();
- try {
- Process.setProcessGroup(app.pid, app.curSchedGroup);
- } catch (Exception e) {
+ int processGroup;
+ switch (app.curSchedGroup) {
+ case ProcessList.SCHED_GROUP_BACKGROUND:
+ processGroup = THREAD_GROUP_BG_NONINTERACTIVE;
+ break;
+ case ProcessList.SCHED_GROUP_TOP_APP:
+ case ProcessList.SCHED_GROUP_TOP_APP_BOUND:
+ processGroup = THREAD_GROUP_TOP_APP;
+ break;
+ default:
+ processGroup = THREAD_GROUP_DEFAULT;
+ break;
+ }
+ long oldId = Binder.clearCallingIdentity();
+ try {
+ setProcessGroup(app.pid, processGroup);
+ if (app.curSchedGroup == ProcessList.SCHED_GROUP_TOP_APP) {
+ // do nothing if we already switched to RT
+ if (oldSchedGroup != ProcessList.SCHED_GROUP_TOP_APP) {
+ mVrController.onTopProcChangedLocked(app);
+ if (mUseFifoUiScheduling) {
+ // Switch UI pipeline for app to SCHED_FIFO
+ app.savedPriority = Process.getThreadPriority(app.pid);
+ scheduleAsFifoPriority(app.pid, /* suppressLogs */true);
+ if (app.renderThreadTid != 0) {
+ scheduleAsFifoPriority(app.renderThreadTid,
+ /* suppressLogs */true);
+ if (DEBUG_OOM_ADJ) {
+ Slog.d("UI_FIFO", "Set RenderThread (TID " +
+ app.renderThreadTid + ") to FIFO");
+ }
+ } else {
+ if (DEBUG_OOM_ADJ) {
+ Slog.d("UI_FIFO", "Not setting RenderThread TID");
+ }
+ }
+ } else {
+ // Boost priority for top app UI and render threads
+ setThreadPriority(app.pid, TOP_APP_PRIORITY_BOOST);
+ if (app.renderThreadTid != 0) {
+ try {
+ setThreadPriority(app.renderThreadTid,
+ TOP_APP_PRIORITY_BOOST);
+ } catch (IllegalArgumentException e) {
+ // thread died, ignore
+ }
+ }
+ }
+ }
+ } else if (oldSchedGroup == ProcessList.SCHED_GROUP_TOP_APP &&
+ app.curSchedGroup != ProcessList.SCHED_GROUP_TOP_APP) {
+ mVrController.onTopProcChangedLocked(app);
+ if (mUseFifoUiScheduling) {
+ try {
+ // Reset UI pipeline to SCHED_OTHER
+ setThreadScheduler(app.pid, SCHED_OTHER, 0);
+ setThreadPriority(app.pid, app.savedPriority);
+ if (app.renderThreadTid != 0) {
+ setThreadScheduler(app.renderThreadTid,
+ SCHED_OTHER, 0);
+ setThreadPriority(app.renderThreadTid, -4);
+ }
+ } catch (IllegalArgumentException e) {
+ Slog.w(TAG,
+ "Failed to set scheduling policy, thread does not exist:\n"
+ + e);
+ } catch (SecurityException e) {
+ Slog.w(TAG, "Failed to set scheduling policy, not allowed:\n" + e);
+ }
+ } else {
+ // Reset priority for top app UI and render threads
+ setThreadPriority(app.pid, 0);
+ if (app.renderThreadTid != 0) {
+ setThreadPriority(app.renderThreadTid, 0);
+ }
+ }
+ }
+ } catch (Exception e) {
+ if (false) {
Slog.w(TAG, "Failed setting process group of " + app.pid
+ " to " + app.curSchedGroup);
- e.printStackTrace();
- } finally {
- Binder.restoreCallingIdentity(oldId);
- }
- } else {
- if (app.thread != null) {
- try {
- app.thread.setSchedulingGroup(app.curSchedGroup);
- } catch (RemoteException e) {
- }
+ Slog.w(TAG, "at location", e);
}
+ } finally {
+ Binder.restoreCallingIdentity(oldId);
}
- Process.setSwappiness(app.pid,
- app.curSchedGroup <= Process.THREAD_GROUP_BG_NONINTERACTIVE);
}
}
if (app.repForegroundActivities != app.foregroundActivities) {
}
if (app.repProcState != app.curProcState) {
app.repProcState = app.curProcState;
- changes |= ProcessChangeItem.CHANGE_PROCESS_STATE;
if (app.thread != null) {
try {
if (false) {
// states, which well tend to give noisy data.
long start = SystemClock.uptimeMillis();
long pss = Debug.getPss(app.pid, mTmpLong, null);
- recordPssSampleLocked(app, app.curProcState, pss, mTmpLong[0], now);
+ recordPssSampleLocked(app, app.curProcState, pss, mTmpLong[0], mTmpLong[1], now);
mPendingPssProcesses.remove(app);
Slog.i(TAG, "Recorded pss for " + app + " state " + app.setProcState
+ " to " + app.curProcState + ": "
}
app.lastStateTime = now;
app.nextPssTime = ProcessList.computeNextPssTime(app.curProcState, true,
- mTestPssMode, isSleeping(), now);
+ mTestPssMode, isSleepingLocked(), now);
if (DEBUG_PSS) Slog.d(TAG_PSS, "Process state change from "
+ ProcessList.makeProcStateString(app.setProcState) + " to "
+ ProcessList.makeProcStateString(app.curProcState) + " next pss in "
mTestPssMode)))) {
requestPssLocked(app, app.setProcState);
app.nextPssTime = ProcessList.computeNextPssTime(app.curProcState, false,
- mTestPssMode, isSleeping(), now);
+ mTestPssMode, isSleepingLocked(), now);
} else if (false && DEBUG_PSS) Slog.d(TAG_PSS,
"Not requesting PSS of " + app + ": next=" + (app.nextPssTime-now));
}
if (app.setProcState != app.curProcState) {
- if (DEBUG_SWITCH || DEBUG_OOM_ADJ) Slog.v(TAG_OOM_ADJ,
- "Proc state change of " + app.processName
- + " to " + app.curProcState);
+ if (DEBUG_SWITCH || DEBUG_OOM_ADJ || mCurOomAdjUid == app.uid) {
+ String msg = "Proc state change of " + app.processName
+ + " to " + app.curProcState;
+ reportOomAdjMessageLocked(TAG_OOM_ADJ, msg);
+ }
boolean setImportant = app.setProcState < ActivityManager.PROCESS_STATE_SERVICE;
boolean curImportant = app.curProcState < ActivityManager.PROCESS_STATE_SERVICE;
if (setImportant && !curImportant) {
// This app is no longer something we consider important enough to allow to
// use arbitrary amounts of battery power. Note
- // its current wake lock time to later know to kill it if
+ // its current CPU time to later know to kill it if
// it is not behaving well.
- BatteryStatsImpl stats = mBatteryStatsService.getActiveStatistics();
- synchronized (stats) {
- app.lastWakeTime = stats.getProcessWakeTime(app.info.uid,
- app.pid, nowElapsed);
- }
- app.lastCpuTime = app.curCpuTime;
-
+ app.whenUnimportant = now;
+ app.lastCpuTime = 0;
}
// Inform UsageStats of important process state change
// Must be called before updating setProcState
app.procStateChanged = true;
}
} else if (app.reportedInteraction && (nowElapsed-app.interactionEventTime)
- > USAGE_STATS_INTERACTION_INTERVAL) {
+ > mConstants.USAGE_STATS_INTERACTION_INTERVAL) {
// For apps that sit around for a long time in the interactive state, we need
// to report this at least once a day so they don't go idle.
maybeUpdateUsageStatsLocked(app, nowElapsed);
if (mPendingProcessChanges.size() == 0) {
if (DEBUG_PROCESS_OBSERVERS) Slog.i(TAG_PROCESS_OBSERVERS,
"*** Enqueueing dispatch processes changed!");
- mUiHandler.obtainMessage(DISPATCH_PROCESSES_CHANGED).sendToTarget();
+ mUiHandler.obtainMessage(DISPATCH_PROCESSES_CHANGED_UI_MSG).sendToTarget();
}
mPendingProcessChanges.add(item);
}
item.changes |= changes;
- item.processState = app.repProcState;
item.foregroundActivities = app.repForegroundActivities;
if (DEBUG_PROCESS_OBSERVERS) Slog.i(TAG_PROCESS_OBSERVERS,
"Item " + Integer.toHexString(System.identityHashCode(item))
+ " " + app.toShortString() + ": changes=" + item.changes
- + " procState=" + item.processState
+ " foreground=" + item.foregroundActivities
+ " type=" + app.adjType + " source=" + app.adjSource
+ " target=" + app.adjTarget);
return success;
}
- private final void enqueueUidChangeLocked(UidRecord uidRec, boolean gone) {
- if (uidRec.pendingChange == null) {
+ private boolean isEphemeralLocked(int uid) {
+ String packages[] = mContext.getPackageManager().getPackagesForUid(uid);
+ if (packages == null || packages.length != 1) { // Ephemeral apps cannot share uid
+ return false;
+ }
+ return getPackageManagerInternalLocked().isPackageEphemeral(UserHandle.getUserId(uid),
+ packages[0]);
+ }
+
+ @VisibleForTesting
+ final void enqueueUidChangeLocked(UidRecord uidRec, int uid, int change) {
+ final UidRecord.ChangeItem pendingChange;
+ if (uidRec == null || uidRec.pendingChange == null) {
if (mPendingUidChanges.size() == 0) {
if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
"*** Enqueueing dispatch uid changed!");
- mUiHandler.obtainMessage(DISPATCH_UIDS_CHANGED_MSG).sendToTarget();
+ mUiHandler.obtainMessage(DISPATCH_UIDS_CHANGED_UI_MSG).sendToTarget();
}
final int NA = mAvailUidChanges.size();
if (NA > 0) {
- uidRec.pendingChange = mAvailUidChanges.remove(NA-1);
+ pendingChange = mAvailUidChanges.remove(NA-1);
if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
- "Retrieving available item: " + uidRec.pendingChange);
+ "Retrieving available item: " + pendingChange);
} else {
- uidRec.pendingChange = new UidRecord.ChangeItem();
+ pendingChange = new UidRecord.ChangeItem();
if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
- "Allocating new item: " + uidRec.pendingChange);
+ "Allocating new item: " + pendingChange);
+ }
+ if (uidRec != null) {
+ uidRec.pendingChange = pendingChange;
+ if ((change & UidRecord.CHANGE_GONE) != 0 && !uidRec.idle) {
+ // If this uid is going away, and we haven't yet reported it is gone,
+ // then do so now.
+ change |= UidRecord.CHANGE_IDLE;
+ }
+ } else if (uid < 0) {
+ throw new IllegalArgumentException("No UidRecord or uid");
+ }
+ pendingChange.uidRecord = uidRec;
+ pendingChange.uid = uidRec != null ? uidRec.uid : uid;
+ mPendingUidChanges.add(pendingChange);
+ } else {
+ pendingChange = uidRec.pendingChange;
+ // If there is no change in idle or active state, then keep whatever was pending.
+ if ((change & (UidRecord.CHANGE_IDLE | UidRecord.CHANGE_ACTIVE)) == 0) {
+ change |= (pendingChange.change & (UidRecord.CHANGE_IDLE
+ | UidRecord.CHANGE_ACTIVE));
+ }
+ // If there is no change in cached or uncached state, then keep whatever was pending.
+ if ((change & (UidRecord.CHANGE_CACHED | UidRecord.CHANGE_UNCACHED)) == 0) {
+ change |= (pendingChange.change & (UidRecord.CHANGE_CACHED
+ | UidRecord.CHANGE_UNCACHED));
+ }
+ // If this is a report of the UID being gone, then we shouldn't keep any previous
+ // report of it being active or cached. (That is, a gone uid is never active,
+ // and never cached.)
+ if ((change & UidRecord.CHANGE_GONE) != 0) {
+ change &= ~(UidRecord.CHANGE_ACTIVE | UidRecord.CHANGE_CACHED);
+ if (!uidRec.idle) {
+ // If this uid is going away, and we haven't yet reported it is gone,
+ // then do so now.
+ change |= UidRecord.CHANGE_IDLE;
+ }
+ }
+ }
+ pendingChange.change = change;
+ pendingChange.processState = uidRec != null
+ ? uidRec.setProcState : ActivityManager.PROCESS_STATE_NONEXISTENT;
+ pendingChange.ephemeral = uidRec != null ? uidRec.ephemeral : isEphemeralLocked(uid);
+ pendingChange.procStateSeq = uidRec != null ? uidRec.curProcStateSeq : 0;
+ if (uidRec != null) {
+ uidRec.lastReportedChange = change;
+ uidRec.updateLastDispatchedProcStateSeq(change);
+ }
+
+ // Directly update the power manager, since we sit on top of it and it is critical
+ // it be kept in sync (so wake locks will be held as soon as appropriate).
+ if (mLocalPowerManager != null) {
+ // TO DO: dispatch cached/uncached changes here, so we don't need to report
+ // all proc state changes.
+ if ((change & UidRecord.CHANGE_ACTIVE) != 0) {
+ mLocalPowerManager.uidActive(pendingChange.uid);
+ }
+ if ((change & UidRecord.CHANGE_IDLE) != 0) {
+ mLocalPowerManager.uidIdle(pendingChange.uid);
+ }
+ if ((change & UidRecord.CHANGE_GONE) != 0) {
+ mLocalPowerManager.uidGone(pendingChange.uid);
+ } else {
+ mLocalPowerManager.updateUidProcState(pendingChange.uid,
+ pendingChange.processState);
}
- uidRec.pendingChange.uidRecord = uidRec;
- uidRec.pendingChange.uid = uidRec.uid;
- mPendingUidChanges.add(uidRec.pendingChange);
}
- uidRec.pendingChange.gone = gone;
- uidRec.pendingChange.processState = uidRec.setProcState;
}
private void maybeUpdateProviderUsageStatsLocked(ProcessRecord app, String providerPkgName,
String authority) {
if (app == null) return;
if (app.curProcState <= ActivityManager.PROCESS_STATE_IMPORTANT_FOREGROUND) {
- UserState userState = mStartedUsers.get(app.userId);
+ UserState userState = mUserController.getStartedUserStateLocked(app.userId);
if (userState == null) return;
final long now = SystemClock.elapsedRealtime();
Long lastReported = userState.mProviderLastReportedFg.get(authority);
if (lastReported == null || lastReported < now - 60 * 1000L) {
- mUsageStatsService.reportContentProviderUsage(
- authority, providerPkgName, app.userId);
+ if (mSystemReady) {
+ // Cannot touch the user stats if not system ready
+ mUsageStatsService.reportContentProviderUsage(
+ authority, providerPkgName, app.userId);
+ }
userState.mProviderLastReportedFg.put(authority, now);
}
}
app.fgInteractionTime = nowElapsed;
isInteraction = false;
} else {
- isInteraction = nowElapsed > app.fgInteractionTime + SERVICE_USAGE_INTERACTION_TIME;
+ isInteraction = nowElapsed > app.fgInteractionTime
+ + mConstants.SERVICE_USAGE_INTERACTION_TIME;
}
} else {
- isInteraction = app.curProcState
- <= ActivityManager.PROCESS_STATE_IMPORTANT_FOREGROUND;
+ isInteraction = app.curProcState <= ActivityManager.PROCESS_STATE_IMPORTANT_FOREGROUND;
app.fgInteractionTime = 0;
}
- if (isInteraction && (!app.reportedInteraction
- || (nowElapsed-app.interactionEventTime) > USAGE_STATS_INTERACTION_INTERVAL)) {
+ if (isInteraction && (!app.reportedInteraction || (nowElapsed-app.interactionEventTime)
+ > mConstants.USAGE_STATS_INTERACTION_INTERVAL)) {
app.interactionEventTime = nowElapsed;
String[] packages = app.getPackageList();
if (packages != null) {
if (proc.baseProcessTracker != null) {
proc.baseProcessTracker.setState(proc.repProcState, memFactor, now, proc.pkgList);
}
- if (proc.repProcState >= 0) {
- mBatteryStatsService.noteProcessState(proc.processName, proc.info.uid,
- proc.repProcState);
- }
}
}
}
private final ActivityRecord resumedAppLocked() {
- ActivityRecord act = mStackSupervisor.resumedAppLocked();
+ ActivityRecord act = mStackSupervisor.getResumedActivityLocked();
String pkg;
int uid;
if (act != null) {
return act;
}
- final boolean updateOomAdjLocked(ProcessRecord app) {
+ /**
+ * Update OomAdj for a specific process.
+ * @param app The process to update
+ * @param oomAdjAll If it's ok to call updateOomAdjLocked() for all running apps
+ * if necessary, or skip.
+ * @return whether updateOomAdjLocked(app) was successful.
+ */
+ final boolean updateOomAdjLocked(ProcessRecord app, boolean oomAdjAll) {
final ActivityRecord TOP_ACT = resumedAppLocked();
final ProcessRecord TOP_APP = TOP_ACT != null ? TOP_ACT.app : null;
final boolean wasCached = app.cached;
? app.curRawAdj : ProcessList.UNKNOWN_ADJ;
boolean success = updateOomAdjLocked(app, cachedAdj, TOP_APP, false,
SystemClock.uptimeMillis());
- if (wasCached != app.cached || app.curRawAdj == ProcessList.UNKNOWN_ADJ) {
+ if (oomAdjAll
+ && (wasCached != app.cached || app.curRawAdj == ProcessList.UNKNOWN_ADJ)) {
// Changed to/from cached state, so apps after it in the LRU
// list may also be changed.
updateOomAdjLocked();
uidRec.reset();
}
+ mStackSupervisor.rankTaskLayersIfNeeded();
+
mAdjSeq++;
mNewNumServiceProcs = 0;
mNewNumAServiceProcs = 0;
- final int emptyProcessLimit;
- final int cachedProcessLimit;
- if (mProcessLimit <= 0) {
- emptyProcessLimit = cachedProcessLimit = 0;
- } else if (mProcessLimit == 1) {
- emptyProcessLimit = 1;
- cachedProcessLimit = 0;
- } else {
- emptyProcessLimit = ProcessList.computeEmptyProcessLimit(mProcessLimit);
- cachedProcessLimit = mProcessLimit - emptyProcessLimit;
- }
+ final int emptyProcessLimit = mConstants.CUR_MAX_EMPTY_PROCESSES;
+ final int cachedProcessLimit = mConstants.CUR_MAX_CACHED_PROCESSES - emptyProcessLimit;
// Let's determine how many processes we have running vs.
// how many slots we have for background processes; we may want
}
break;
case ActivityManager.PROCESS_STATE_CACHED_EMPTY:
- if (numEmpty > ProcessList.TRIM_EMPTY_APPS
+ if (numEmpty > mConstants.CUR_TRIM_EMPTY_PROCESSES
&& app.lastActivityTime < oldTime) {
app.kill("empty for "
+ ((oldTime + ProcessList.MAX_EMPTY_TIME - app.lastActivityTime)
} else {
// Keeping this process, update its uid.
final UidRecord uidRec = app.uidRecord;
- if (uidRec != null && uidRec.curProcState > app.curProcState) {
- uidRec.curProcState = app.curProcState;
+ if (uidRec != null) {
+ uidRec.ephemeral = app.info.isInstantApp();
+ if (uidRec.curProcState > app.curProcState) {
+ uidRec.curProcState = app.curProcState;
+ }
+ if (app.foregroundServices) {
+ uidRec.foregroundServices = true;
+ }
}
}
}
}
+ incrementProcStateSeqAndNotifyAppsLocked();
+
mNumServiceProcs = mNewNumServiceProcs;
// Now determine the memory trimming level of background processes.
// memory they want.
final int numCachedAndEmpty = numCached + numEmpty;
int memFactor;
- if (numCached <= ProcessList.TRIM_CACHED_APPS
- && numEmpty <= ProcessList.TRIM_EMPTY_APPS) {
+ if (numCached <= mConstants.CUR_TRIM_CACHED_PROCESSES
+ && numEmpty <= mConstants.CUR_TRIM_EMPTY_PROCESSES) {
if (numCachedAndEmpty <= ProcessList.TRIM_CRITICAL_THRESHOLD) {
memFactor = ProcessStats.ADJ_MEM_FACTOR_CRITICAL;
} else if (numCachedAndEmpty <= ProcessList.TRIM_LOW_THRESHOLD) {
if (DEBUG_OOM_ADJ) Slog.d(TAG_OOM_ADJ, "Keeping last mem factor!");
}
}
+ if (memFactor != mLastMemoryLevel) {
+ EventLogTags.writeAmMemFactor(memFactor, mLastMemoryLevel);
+ }
mLastMemoryLevel = memFactor;
mLastNumProcesses = mLruProcesses.size();
- boolean allChanged = mProcessStats.setMemFactorLocked(memFactor, !isSleeping(), now);
+ boolean allChanged = mProcessStats.setMemFactorLocked(memFactor, !isSleepingLocked(), now);
final int trackerMemFactor = mProcessStats.getMemFactorLocked();
if (memFactor != ProcessStats.ADJ_MEM_FACTOR_NORMAL) {
if (mLowRamStartTime == 0) {
requestPssAllProcsLocked(now, false, mProcessStats.isMemFactorLowered());
}
+ ArrayList<UidRecord> becameIdle = null;
+
// Update from any uid changes.
+ if (mLocalPowerManager != null) {
+ mLocalPowerManager.startUidChanges();
+ }
for (int i=mActiveUids.size()-1; i>=0; i--) {
final UidRecord uidRec = mActiveUids.valueAt(i);
- if (uidRec.setProcState != uidRec.curProcState) {
+ int uidChange = UidRecord.CHANGE_PROCSTATE;
+ if (uidRec.curProcState != ActivityManager.PROCESS_STATE_NONEXISTENT
+ && (uidRec.setProcState != uidRec.curProcState
+ || uidRec.setWhitelist != uidRec.curWhitelist)) {
if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
"Changes in " + uidRec + ": proc state from " + uidRec.setProcState
- + " to " + uidRec.curProcState);
+ + " to " + uidRec.curProcState + ", whitelist from " + uidRec.setWhitelist
+ + " to " + uidRec.curWhitelist);
+ if (ActivityManager.isProcStateBackground(uidRec.curProcState)
+ && !uidRec.curWhitelist) {
+ // UID is now in the background (and not on the temp whitelist). Was it
+ // previously in the foreground (or on the temp whitelist)?
+ if (!ActivityManager.isProcStateBackground(uidRec.setProcState)
+ || uidRec.setWhitelist) {
+ uidRec.lastBackgroundTime = nowElapsed;
+ if (!mHandler.hasMessages(IDLE_UIDS_MSG)) {
+ // Note: the background settle time is in elapsed realtime, while
+ // the handler time base is uptime. All this means is that we may
+ // stop background uids later than we had intended, but that only
+ // happens because the device was sleeping so we are okay anyway.
+ mHandler.sendEmptyMessageDelayed(IDLE_UIDS_MSG,
+ mConstants.BACKGROUND_SETTLE_TIME);
+ }
+ }
+ if (uidRec.idle && !uidRec.setIdle) {
+ uidChange = UidRecord.CHANGE_IDLE;
+ if (becameIdle == null) {
+ becameIdle = new ArrayList<>();
+ }
+ becameIdle.add(uidRec);
+ }
+ } else {
+ if (uidRec.idle) {
+ uidChange = UidRecord.CHANGE_ACTIVE;
+ EventLogTags.writeAmUidActive(uidRec.uid);
+ uidRec.idle = false;
+ }
+ uidRec.lastBackgroundTime = 0;
+ }
+ final boolean wasCached = uidRec.setProcState
+ > ActivityManager.PROCESS_STATE_RECEIVER;
+ final boolean isCached = uidRec.curProcState
+ > ActivityManager.PROCESS_STATE_RECEIVER;
+ if (wasCached != isCached ||
+ uidRec.setProcState == ActivityManager.PROCESS_STATE_NONEXISTENT) {
+ uidChange |= isCached ? UidRecord.CHANGE_CACHED : UidRecord.CHANGE_UNCACHED;
+ }
uidRec.setProcState = uidRec.curProcState;
- enqueueUidChangeLocked(uidRec, false);
+ uidRec.setWhitelist = uidRec.curWhitelist;
+ uidRec.setIdle = uidRec.idle;
+ enqueueUidChangeLocked(uidRec, -1, uidChange);
+ noteUidProcessState(uidRec.uid, uidRec.curProcState);
+ if (uidRec.foregroundServices) {
+ mServices.foregroundServiceProcStateChangedLocked(uidRec);
+ }
+ }
+ }
+ if (mLocalPowerManager != null) {
+ mLocalPowerManager.finishUidChanges();
+ }
+
+ if (becameIdle != null) {
+ // If we have any new uids that became idle this time, we need to make sure
+ // they aren't left with running services.
+ for (int i = becameIdle.size() - 1; i >= 0; i--) {
+ mServices.stopInBackgroundLocked(becameIdle.get(i).uid);
}
}
}
}
- final void trimApplications() {
- synchronized (this) {
- int i;
-
- // First remove any unused application processes whose package
- // has been removed.
- for (i=mRemovedProcesses.size()-1; i>=0; i--) {
- final ProcessRecord app = mRemovedProcesses.get(i);
- if (app.activities.size() == 0
- && app.curReceiver == null && app.services.size() == 0) {
- Slog.i(
- TAG, "Exiting empty application process "
- + app.processName + " ("
- + (app.thread != null ? app.thread.asBinder() : null)
- + ")\n");
- if (app.pid > 0 && app.pid != MY_PID) {
- app.kill("empty", false);
- } else {
- try {
- app.thread.scheduleExit();
- } catch (Exception e) {
- // Ignore exceptions.
+ @Override
+ public void makePackageIdle(String packageName, int userId) {
+ if (checkCallingPermission(android.Manifest.permission.FORCE_STOP_PACKAGES)
+ != PackageManager.PERMISSION_GRANTED) {
+ String msg = "Permission Denial: makePackageIdle() from pid="
+ + Binder.getCallingPid()
+ + ", uid=" + Binder.getCallingUid()
+ + " requires " + android.Manifest.permission.FORCE_STOP_PACKAGES;
+ Slog.w(TAG, msg);
+ throw new SecurityException(msg);
+ }
+ final int callingPid = Binder.getCallingPid();
+ userId = mUserController.handleIncomingUser(callingPid, Binder.getCallingUid(),
+ userId, true, ALLOW_FULL_ONLY, "makePackageIdle", null);
+ long callingId = Binder.clearCallingIdentity();
+ synchronized(this) {
+ try {
+ IPackageManager pm = AppGlobals.getPackageManager();
+ int pkgUid = -1;
+ try {
+ pkgUid = pm.getPackageUid(packageName, MATCH_UNINSTALLED_PACKAGES
+ | MATCH_DEBUG_TRIAGED_MISSING, UserHandle.USER_SYSTEM);
+ } catch (RemoteException e) {
+ }
+ if (pkgUid == -1) {
+ throw new IllegalArgumentException("Unknown package name " + packageName);
+ }
+
+ if (mLocalPowerManager != null) {
+ mLocalPowerManager.startUidChanges();
+ }
+ final int appId = UserHandle.getAppId(pkgUid);
+ final int N = mActiveUids.size();
+ for (int i=N-1; i>=0; i--) {
+ final UidRecord uidRec = mActiveUids.valueAt(i);
+ final long bgTime = uidRec.lastBackgroundTime;
+ if (bgTime > 0 && !uidRec.idle) {
+ if (UserHandle.getAppId(uidRec.uid) == appId) {
+ if (userId == UserHandle.USER_ALL ||
+ userId == UserHandle.getUserId(uidRec.uid)) {
+ EventLogTags.writeAmUidIdle(uidRec.uid);
+ uidRec.idle = true;
+ uidRec.setIdle = true;
+ Slog.w(TAG, "Idling uid " + UserHandle.formatUid(uidRec.uid)
+ + " from package " + packageName + " user " + userId);
+ doStopUidLocked(uidRec.uid, uidRec);
+ }
}
}
- cleanUpApplicationRecordLocked(app, false, true, -1, false /*replacingPid*/);
- mRemovedProcesses.remove(i);
-
- if (app.persistent) {
- addAppLocked(app.info, false, null /* ABI override */);
- }
}
+ } finally {
+ if (mLocalPowerManager != null) {
+ mLocalPowerManager.finishUidChanges();
+ }
+ Binder.restoreCallingIdentity(callingId);
}
-
- // Now update the oom adj for all processes.
- updateOomAdjLocked();
}
}
- /** This method sends the specified signal to each of the persistent apps */
- public void signalPersistentProcesses(int sig) throws RemoteException {
- if (sig != Process.SIGNAL_USR1) {
- throw new SecurityException("Only SIGNAL_USR1 is allowed");
- }
-
+ final void idleUids() {
synchronized (this) {
- if (checkCallingPermission(android.Manifest.permission.SIGNAL_PERSISTENT_PROCESSES)
- != PackageManager.PERMISSION_GRANTED) {
- throw new SecurityException("Requires permission "
- + android.Manifest.permission.SIGNAL_PERSISTENT_PROCESSES);
+ final int N = mActiveUids.size();
+ if (N <= 0) {
+ return;
}
-
- for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) {
- ProcessRecord r = mLruProcesses.get(i);
- if (r.thread != null && r.persistent) {
- Process.sendSignal(r.pid, sig);
+ final long nowElapsed = SystemClock.elapsedRealtime();
+ final long maxBgTime = nowElapsed - mConstants.BACKGROUND_SETTLE_TIME;
+ long nextTime = 0;
+ if (mLocalPowerManager != null) {
+ mLocalPowerManager.startUidChanges();
+ }
+ for (int i=N-1; i>=0; i--) {
+ final UidRecord uidRec = mActiveUids.valueAt(i);
+ final long bgTime = uidRec.lastBackgroundTime;
+ if (bgTime > 0 && !uidRec.idle) {
+ if (bgTime <= maxBgTime) {
+ EventLogTags.writeAmUidIdle(uidRec.uid);
+ uidRec.idle = true;
+ uidRec.setIdle = true;
+ doStopUidLocked(uidRec.uid, uidRec);
+ } else {
+ if (nextTime == 0 || nextTime > bgTime) {
+ nextTime = bgTime;
+ }
+ }
}
}
+ if (mLocalPowerManager != null) {
+ mLocalPowerManager.finishUidChanges();
+ }
+ if (nextTime > 0) {
+ mHandler.removeMessages(IDLE_UIDS_MSG);
+ mHandler.sendEmptyMessageDelayed(IDLE_UIDS_MSG,
+ nextTime + mConstants.BACKGROUND_SETTLE_TIME - nowElapsed);
+ }
}
}
- private void stopProfilerLocked(ProcessRecord proc, int profileType) {
- if (proc == null || proc == mProfileProc) {
- proc = mProfileProc;
- profileType = mProfileType;
- clearProfilerLocked();
- }
- if (proc == null) {
+ /**
+ * Checks if any uid is coming from background to foreground or vice versa and if so, increments
+ * the {@link UidRecord#curProcStateSeq} corresponding to that uid using global seq counter
+ * {@link #mProcStateSeqCounter} and notifies the app if it needs to block.
+ */
+ @VisibleForTesting
+ @GuardedBy("this")
+ void incrementProcStateSeqAndNotifyAppsLocked() {
+ if (mWaitForNetworkTimeoutMs <= 0) {
return;
}
- try {
- proc.thread.profilerControl(false, null, profileType);
- } catch (RemoteException e) {
- throw new IllegalStateException("Process disappeared");
+ // Used for identifying which uids need to block for network.
+ ArrayList<Integer> blockingUids = null;
+ for (int i = mActiveUids.size() - 1; i >= 0; --i) {
+ final UidRecord uidRec = mActiveUids.valueAt(i);
+ // If the network is not restricted for uid, then nothing to do here.
+ if (!mInjector.isNetworkRestrictedForUid(uidRec.uid)) {
+ continue;
+ }
+ if (!UserHandle.isApp(uidRec.uid) || !uidRec.hasInternetPermission) {
+ continue;
+ }
+ // If process state is not changed, then there's nothing to do.
+ if (uidRec.setProcState == uidRec.curProcState) {
+ continue;
+ }
+ final int blockState = getBlockStateForUid(uidRec);
+ // No need to inform the app when the blockState is NETWORK_STATE_NO_CHANGE as
+ // there's nothing the app needs to do in this scenario.
+ if (blockState == NETWORK_STATE_NO_CHANGE) {
+ continue;
+ }
+ synchronized (uidRec.networkStateLock) {
+ uidRec.curProcStateSeq = ++mProcStateSeqCounter;
+ if (blockState == NETWORK_STATE_BLOCK) {
+ if (blockingUids == null) {
+ blockingUids = new ArrayList<>();
+ }
+ blockingUids.add(uidRec.uid);
+ } else {
+ if (DEBUG_NETWORK) {
+ Slog.d(TAG_NETWORK, "uid going to background, notifying all blocking"
+ + " threads for uid: " + uidRec);
+ }
+ if (uidRec.waitingForNetwork) {
+ uidRec.networkStateLock.notifyAll();
+ }
+ }
+ }
}
- }
- private void clearProfilerLocked() {
- if (mProfileFd != null) {
- try {
- mProfileFd.close();
- } catch (IOException e) {
- }
+ // There are no uids that need to block, so nothing more to do.
+ if (blockingUids == null) {
+ return;
}
- mProfileApp = null;
- mProfileProc = null;
- mProfileFile = null;
- mProfileType = 0;
- mAutoStopProfiler = false;
- mSamplingInterval = 0;
- }
- public boolean profileControl(String process, int userId, boolean start,
+ for (int i = mLruProcesses.size() - 1; i >= 0; --i) {
+ final ProcessRecord app = mLruProcesses.get(i);
+ if (!blockingUids.contains(app.uid)) {
+ continue;
+ }
+ if (!app.killedByAm && app.thread != null) {
+ final UidRecord uidRec = mActiveUids.get(app.uid);
+ try {
+ if (DEBUG_NETWORK) {
+ Slog.d(TAG_NETWORK, "Informing app thread that it needs to block: "
+ + uidRec);
+ }
+ app.thread.setNetworkBlockSeq(uidRec.curProcStateSeq);
+ } catch (RemoteException ignored) {
+ }
+ }
+ }
+ }
+
+ /**
+ * Checks if the uid is coming from background to foreground or vice versa and returns
+ * appropriate block state based on this.
+ *
+ * @return blockState based on whether the uid is coming from background to foreground or
+ * vice versa. If bg->fg or fg->bg, then {@link #NETWORK_STATE_BLOCK} or
+ * {@link #NETWORK_STATE_UNBLOCK} respectively, otherwise
+ * {@link #NETWORK_STATE_NO_CHANGE}.
+ */
+ @VisibleForTesting
+ int getBlockStateForUid(UidRecord uidRec) {
+ // Denotes whether uid's process state is currently allowed network access.
+ final boolean isAllowed = isProcStateAllowedWhileIdleOrPowerSaveMode(uidRec.curProcState)
+ || isProcStateAllowedWhileOnRestrictBackground(uidRec.curProcState);
+ // Denotes whether uid's process state was previously allowed network access.
+ final boolean wasAllowed = isProcStateAllowedWhileIdleOrPowerSaveMode(uidRec.setProcState)
+ || isProcStateAllowedWhileOnRestrictBackground(uidRec.setProcState);
+
+ // When the uid is coming to foreground, AMS should inform the app thread that it should
+ // block for the network rules to get updated before launching an activity.
+ if (!wasAllowed && isAllowed) {
+ return NETWORK_STATE_BLOCK;
+ }
+ // When the uid is going to background, AMS should inform the app thread that if an
+ // activity launch is blocked for the network rules to get updated, it should be unblocked.
+ if (wasAllowed && !isAllowed) {
+ return NETWORK_STATE_UNBLOCK;
+ }
+ return NETWORK_STATE_NO_CHANGE;
+ }
+
+ final void runInBackgroundDisabled(int uid) {
+ synchronized (this) {
+ UidRecord uidRec = mActiveUids.get(uid);
+ if (uidRec != null) {
+ // This uid is actually running... should it be considered background now?
+ if (uidRec.idle) {
+ doStopUidLocked(uidRec.uid, uidRec);
+ }
+ } else {
+ // This uid isn't actually running... still send a report about it being "stopped".
+ doStopUidLocked(uid, null);
+ }
+ }
+ }
+
+ final void doStopUidLocked(int uid, final UidRecord uidRec) {
+ mServices.stopInBackgroundLocked(uid);
+ enqueueUidChangeLocked(uidRec, uid, UidRecord.CHANGE_IDLE);
+ }
+
+ /**
+ * Whitelists {@code targetUid} to temporarily bypass Power Save mode.
+ */
+ void tempWhitelistForPendingIntentLocked(int callerPid, int callerUid, int targetUid,
+ long duration, String tag) {
+ if (DEBUG_WHITELISTS) {
+ Slog.d(TAG, "tempWhitelistForPendingIntentLocked(" + callerPid + ", " + callerUid + ", "
+ + targetUid + ", " + duration + ")");
+ }
+
+ synchronized (mPidsSelfLocked) {
+ final ProcessRecord pr = mPidsSelfLocked.get(callerPid);
+ if (pr == null) {
+ Slog.w(TAG, "tempWhitelistForPendingIntentLocked() no ProcessRecord for pid "
+ + callerPid);
+ return;
+ }
+ if (!pr.whitelistManager) {
+ if (checkPermission(CHANGE_DEVICE_IDLE_TEMP_WHITELIST, callerPid, callerUid)
+ != PackageManager.PERMISSION_GRANTED) {
+ if (DEBUG_WHITELISTS) {
+ Slog.d(TAG, "tempWhitelistForPendingIntentLocked() for target " + targetUid
+ + ": pid " + callerPid + " is not allowed");
+ }
+ return;
+ }
+ }
+ }
+
+ tempWhitelistUidLocked(targetUid, duration, tag);
+ }
+
+ /**
+ * Whitelists {@code targetUid} to temporarily bypass Power Save mode.
+ */
+ void tempWhitelistUidLocked(int targetUid, long duration, String tag) {
+ mPendingTempWhitelist.put(targetUid, new PendingTempWhitelist(targetUid, duration, tag));
+ setUidTempWhitelistStateLocked(targetUid, true);
+ mUiHandler.obtainMessage(PUSH_TEMP_WHITELIST_UI_MSG).sendToTarget();
+ }
+
+ void pushTempWhitelist() {
+ final int N;
+ final PendingTempWhitelist[] list;
+
+ // First copy out the pending changes... we need to leave them in the map for now,
+ // in case someone needs to check what is coming up while we don't have the lock held.
+ synchronized(this) {
+ N = mPendingTempWhitelist.size();
+ list = new PendingTempWhitelist[N];
+ for (int i = 0; i < N; i++) {
+ list[i] = mPendingTempWhitelist.valueAt(i);
+ }
+ }
+
+ // Now safely dispatch changes to device idle controller.
+ for (int i = 0; i < N; i++) {
+ PendingTempWhitelist ptw = list[i];
+ mLocalDeviceIdleController.addPowerSaveTempWhitelistAppDirect(ptw.targetUid,
+ ptw.duration, true, ptw.tag);
+ }
+
+ // And now we can safely remove them from the map.
+ synchronized(this) {
+ for (int i = 0; i < N; i++) {
+ PendingTempWhitelist ptw = list[i];
+ int index = mPendingTempWhitelist.indexOfKey(ptw.targetUid);
+ if (index >= 0 && mPendingTempWhitelist.valueAt(index) == ptw) {
+ mPendingTempWhitelist.removeAt(index);
+ }
+ }
+ }
+ }
+
+ final void setAppIdTempWhitelistStateLocked(int appId, boolean onWhitelist) {
+ boolean changed = false;
+ for (int i=mActiveUids.size()-1; i>=0; i--) {
+ final UidRecord uidRec = mActiveUids.valueAt(i);
+ if (UserHandle.getAppId(uidRec.uid) == appId && uidRec.curWhitelist != onWhitelist) {
+ uidRec.curWhitelist = onWhitelist;
+ changed = true;
+ }
+ }
+ if (changed) {
+ updateOomAdjLocked();
+ }
+ }
+
+ final void setUidTempWhitelistStateLocked(int uid, boolean onWhitelist) {
+ boolean changed = false;
+ final UidRecord uidRec = mActiveUids.get(uid);
+ if (uidRec != null && uidRec.curWhitelist != onWhitelist) {
+ uidRec.curWhitelist = onWhitelist;
+ updateOomAdjLocked();
+ }
+ }
+
+ final void trimApplications() {
+ synchronized (this) {
+ int i;
+
+ // First remove any unused application processes whose package
+ // has been removed.
+ for (i=mRemovedProcesses.size()-1; i>=0; i--) {
+ final ProcessRecord app = mRemovedProcesses.get(i);
+ if (app.activities.size() == 0
+ && app.curReceivers.isEmpty() && app.services.size() == 0) {
+ Slog.i(
+ TAG, "Exiting empty application process "
+ + app.toShortString() + " ("
+ + (app.thread != null ? app.thread.asBinder() : null)
+ + ")\n");
+ if (app.pid > 0 && app.pid != MY_PID) {
+ app.kill("empty", false);
+ } else {
+ try {
+ app.thread.scheduleExit();
+ } catch (Exception e) {
+ // Ignore exceptions.
+ }
+ }
+ cleanUpApplicationRecordLocked(app, false, true, -1, false /*replacingPid*/);
+ mRemovedProcesses.remove(i);
+
+ if (app.persistent) {
+ addAppLocked(app.info, null, false, null /* ABI override */);
+ }
+ }
+ }
+
+ // Now update the oom adj for all processes.
+ updateOomAdjLocked();
+ }
+ }
+
+ /** This method sends the specified signal to each of the persistent apps */
+ public void signalPersistentProcesses(int sig) throws RemoteException {
+ if (sig != SIGNAL_USR1) {
+ throw new SecurityException("Only SIGNAL_USR1 is allowed");
+ }
+
+ synchronized (this) {
+ if (checkCallingPermission(android.Manifest.permission.SIGNAL_PERSISTENT_PROCESSES)
+ != PackageManager.PERMISSION_GRANTED) {
+ throw new SecurityException("Requires permission "
+ + android.Manifest.permission.SIGNAL_PERSISTENT_PROCESSES);
+ }
+
+ for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) {
+ ProcessRecord r = mLruProcesses.get(i);
+ if (r.thread != null && r.persistent) {
+ sendSignal(r.pid, sig);
+ }
+ }
+ }
+ }
+
+ private void stopProfilerLocked(ProcessRecord proc, int profileType) {
+ if (proc == null || proc == mProfileProc) {
+ proc = mProfileProc;
+ profileType = mProfileType;
+ clearProfilerLocked();
+ }
+ if (proc == null) {
+ return;
+ }
+ try {
+ proc.thread.profilerControl(false, null, profileType);
+ } catch (RemoteException e) {
+ throw new IllegalStateException("Process disappeared");
+ }
+ }
+
+ private void clearProfilerLocked() {
+ if (mProfilerInfo !=null && mProfilerInfo.profileFd != null) {
+ try {
+ mProfilerInfo.profileFd.close();
+ } catch (IOException e) {
+ }
+ }
+ mProfileApp = null;
+ mProfileProc = null;
+ mProfilerInfo = null;
+ }
+
+ public boolean profileControl(String process, int userId, boolean start,
ProfilerInfo profilerInfo, int profileType) throws RemoteException {
try {
profilerInfo.profileFd = fd;
proc.thread.profilerControl(start, profilerInfo, profileType);
fd = null;
- mProfileFd = null;
+ try {
+ mProfilerInfo.profileFd.close();
+ } catch (IOException e) {
+ }
+ mProfilerInfo.profileFd = null;
} else {
stopProfilerLocked(proc, profileType);
if (profilerInfo != null && profilerInfo.profileFd != null) {
}
private ProcessRecord findProcessLocked(String process, int userId, String callName) {
- userId = handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(),
+ userId = mUserController.handleIncomingUser(Binder.getCallingPid(), Binder.getCallingUid(),
userId, true, ALLOW_FULL_ONLY, callName, null);
ProcessRecord proc = null;
try {
return proc;
}
- public boolean dumpHeap(String process, int userId, boolean managed,
- String path, ParcelFileDescriptor fd) throws RemoteException {
+ public boolean dumpHeap(String process, int userId, boolean managed, boolean mallocInfo,
+ boolean runGc, String path, ParcelFileDescriptor fd) throws RemoteException {
try {
synchronized (this) {
}
}
- proc.thread.dumpHeap(managed, path, fd);
+ proc.thread.dumpHeap(managed, mallocInfo, runGc, path, fd);
fd = null;
return true;
}
}
if (DEBUG_PSS) Slog.d(TAG_PSS, "Dump heap finished for " + path);
mHandler.sendEmptyMessage(POST_DUMP_HEAP_NOTIFICATION_MSG);
+
+ // Forced gc to clean up the remnant hprof fd.
+ Runtime.getRuntime().gc();
}
}
*/
@Override
public boolean startUserInBackground(final int userId) {
- return startUser(userId, /* foreground */ false);
+ return mUserController.startUser(userId, /* foreground */ false);
}
- /**
- * Start user, if its not already running, and bring it to foreground.
- */
- boolean startUserInForeground(final int userId, Dialog dlg) {
- boolean result = startUser(userId, /* foreground */ true);
- dlg.dismiss();
- return result;
+ @Override
+ public boolean unlockUser(int userId, byte[] token, byte[] secret, IProgressListener listener) {
+ return mUserController.unlockUser(userId, token, secret, listener);
}
- /**
- * Refreshes the list of users related to the current user when either a
- * user switch happens or when a new related user is started in the
- * background.
- */
- private void updateCurrentProfileIdsLocked() {
- final List<UserInfo> profiles = getUserManagerLocked().getProfiles(
- mCurrentUserId, false /* enabledOnly */);
- int[] currentProfileIds = new int[profiles.size()]; // profiles will not be null
- for (int i = 0; i < currentProfileIds.length; i++) {
- currentProfileIds[i] = profiles.get(i).id;
- }
- mCurrentProfileIds = currentProfileIds;
-
- synchronized (mUserProfileGroupIdsSelfLocked) {
- mUserProfileGroupIdsSelfLocked.clear();
- final List<UserInfo> users = getUserManagerLocked().getUsers(false);
- for (int i = 0; i < users.size(); i++) {
- UserInfo user = users.get(i);
- if (user.profileGroupId != UserInfo.NO_PROFILE_GROUP_ID) {
- mUserProfileGroupIdsSelfLocked.put(user.id, user.profileGroupId);
- }
+ @Override
+ public boolean switchUser(final int targetUserId) {
+ enforceShellRestriction(UserManager.DISALLOW_DEBUGGING_FEATURES, targetUserId);
+ int currentUserId;
+ UserInfo targetUserInfo;
+ synchronized (this) {
+ currentUserId = mUserController.getCurrentUserIdLocked();
+ targetUserInfo = mUserController.getUserInfo(targetUserId);
+ if (targetUserId == currentUserId) {
+ Slog.i(TAG, "user #" + targetUserId + " is already the current user");
+ return true;
+ }
+ if (targetUserInfo == null) {
+ Slog.w(TAG, "No user info for user #" + targetUserId);
+ return false;
+ }
+ if (!targetUserInfo.isDemo() && UserManager.isDeviceInDemoMode(mContext)) {
+ Slog.w(TAG, "Cannot switch to non-demo user #" + targetUserId
+ + " when device is in demo mode");
+ return false;
}
+ if (!targetUserInfo.supportsSwitchTo()) {
+ Slog.w(TAG, "Cannot switch to User #" + targetUserId + ": not supported");
+ return false;
+ }
+ if (targetUserInfo.isManagedProfile()) {
+ Slog.w(TAG, "Cannot switch to User #" + targetUserId + ": not a full user");
+ return false;
+ }
+ mUserController.setTargetUserIdLocked(targetUserId);
}
+ if (mUserController.mUserSwitchUiEnabled) {
+ UserInfo currentUserInfo = mUserController.getUserInfo(currentUserId);
+ Pair<UserInfo, UserInfo> userNames = new Pair<>(currentUserInfo, targetUserInfo);
+ mUiHandler.removeMessages(START_USER_SWITCH_UI_MSG);
+ mUiHandler.sendMessage(mHandler.obtainMessage(
+ START_USER_SWITCH_UI_MSG, userNames));
+ } else {
+ mHandler.removeMessages(START_USER_SWITCH_FG_MSG);
+ mHandler.sendMessage(mHandler.obtainMessage(
+ START_USER_SWITCH_FG_MSG, targetUserId, 0));
+ }
+ return true;
}
- private Set<Integer> getProfileIdsLocked(int userId) {
- Set<Integer> userIds = new HashSet<Integer>();
- final List<UserInfo> profiles = getUserManagerLocked().getProfiles(
- userId, false /* enabledOnly */);
- for (UserInfo user : profiles) {
- userIds.add(Integer.valueOf(user.id));
+ void scheduleStartProfilesLocked() {
+ if (!mHandler.hasMessages(START_PROFILES_MSG)) {
+ mHandler.sendMessageDelayed(mHandler.obtainMessage(START_PROFILES_MSG),
+ DateUtils.SECOND_IN_MILLIS);
}
- return userIds;
}
@Override
- public boolean switchUser(final int userId) {
- enforceShellRestriction(UserManager.DISALLOW_DEBUGGING_FEATURES, userId);
- String userName;
+ public int stopUser(final int userId, boolean force, final IStopUserCallback callback) {
+ return mUserController.stopUser(userId, force, callback);
+ }
+
+ @Override
+ public UserInfo getCurrentUser() {
+ return mUserController.getCurrentUser();
+ }
+
+ String getStartedUserState(int userId) {
synchronized (this) {
- UserInfo userInfo = getUserManagerLocked().getUserInfo(userId);
- if (userInfo == null) {
- Slog.w(TAG, "No user info for user #" + userId);
- return false;
- }
- if (userInfo.isManagedProfile()) {
- Slog.w(TAG, "Cannot switch to User #" + userId + ": not a full user");
- return false;
- }
- userName = userInfo.name;
- mTargetUserId = userId;
+ final UserState userState = mUserController.getStartedUserStateLocked(userId);
+ return UserState.stateToString(userState.state);
}
- mUiHandler.removeMessages(START_USER_SWITCH_MSG);
- mUiHandler.sendMessage(mUiHandler.obtainMessage(START_USER_SWITCH_MSG, userId, 0, userName));
- return true;
}
- private void showUserSwitchDialog(int userId, String userName) {
- // The dialog will show and then initiate the user switch by calling startUserInForeground
- Dialog d = new UserSwitchingDialog(this, mContext, userId, userName,
- true /* above system */);
- d.show();
+ @Override
+ public boolean isUserRunning(int userId, int flags) {
+ if (!mUserController.isSameProfileGroup(userId, UserHandle.getCallingUserId())
+ && checkCallingPermission(INTERACT_ACROSS_USERS)
+ != PackageManager.PERMISSION_GRANTED) {
+ String msg = "Permission Denial: isUserRunning() from pid="
+ + Binder.getCallingPid()
+ + ", uid=" + Binder.getCallingUid()
+ + " requires " + INTERACT_ACROSS_USERS;
+ Slog.w(TAG, msg);
+ throw new SecurityException(msg);
+ }
+ synchronized (this) {
+ return mUserController.isUserRunningLocked(userId, flags);
+ }
}
- private boolean startUser(final int userId, final boolean foreground) {
- if (checkCallingPermission(INTERACT_ACROSS_USERS_FULL)
+ @Override
+ public int[] getRunningUserIds() {
+ if (checkCallingPermission(INTERACT_ACROSS_USERS)
!= PackageManager.PERMISSION_GRANTED) {
- String msg = "Permission Denial: switchUser() from pid="
+ String msg = "Permission Denial: isUserRunning() from pid="
+ Binder.getCallingPid()
+ ", uid=" + Binder.getCallingUid()
- + " requires " + INTERACT_ACROSS_USERS_FULL;
+ + " requires " + INTERACT_ACROSS_USERS;
Slog.w(TAG, msg);
throw new SecurityException(msg);
}
+ synchronized (this) {
+ return mUserController.getStartedUserArrayLocked();
+ }
+ }
- if (DEBUG_MU) Slog.i(TAG_MU, "starting userid:" + userId + " fore:" + foreground);
+ @Override
+ public void registerUserSwitchObserver(IUserSwitchObserver observer, String name) {
+ mUserController.registerUserSwitchObserver(observer, name);
+ }
- final long ident = Binder.clearCallingIdentity();
- try {
- synchronized (this) {
- final int oldUserId = mCurrentUserId;
- if (oldUserId == userId) {
- return true;
- }
+ @Override
+ public void unregisterUserSwitchObserver(IUserSwitchObserver observer) {
+ mUserController.unregisterUserSwitchObserver(observer);
+ }
- mStackSupervisor.setLockTaskModeLocked(null, ActivityManager.LOCK_TASK_MODE_NONE,
- "startUser", false);
+ ApplicationInfo getAppInfoForUser(ApplicationInfo info, int userId) {
+ if (info == null) return null;
+ ApplicationInfo newInfo = new ApplicationInfo(info);
+ newInfo.initForUser(userId);
+ return newInfo;
+ }
- final UserInfo userInfo = getUserManagerLocked().getUserInfo(userId);
- if (userInfo == null) {
- Slog.w(TAG, "No user info for user #" + userId);
- return false;
- }
- if (foreground && userInfo.isManagedProfile()) {
- Slog.w(TAG, "Cannot switch to User #" + userId + ": not a full user");
- return false;
- }
+ public boolean isUserStopped(int userId) {
+ synchronized (this) {
+ return mUserController.getStartedUserStateLocked(userId) == null;
+ }
+ }
- if (foreground) {
- mWindowManager.startFreezingScreen(R.anim.screen_user_exit,
- R.anim.screen_user_enter);
- }
+ ActivityInfo getActivityInfoForUser(ActivityInfo aInfo, int userId) {
+ if (aInfo == null
+ || (userId < 1 && aInfo.applicationInfo.uid < UserHandle.PER_USER_RANGE)) {
+ return aInfo;
+ }
- boolean needStart = false;
+ ActivityInfo info = new ActivityInfo(aInfo);
+ info.applicationInfo = getAppInfoForUser(info.applicationInfo, userId);
+ return info;
+ }
- // If the user we are switching to is not currently started, then
- // we need to start it now.
- if (mStartedUsers.get(userId) == null) {
- mStartedUsers.put(userId, new UserState(new UserHandle(userId), false));
- updateStartedUserArrayLocked();
- needStart = true;
- }
+ private boolean processSanityChecksLocked(ProcessRecord process) {
+ if (process == null || process.thread == null) {
+ return false;
+ }
- final Integer userIdInt = Integer.valueOf(userId);
- mUserLru.remove(userIdInt);
- mUserLru.add(userIdInt);
-
- if (foreground) {
- mCurrentUserId = userId;
- mTargetUserId = UserHandle.USER_NULL; // reset, mCurrentUserId has caught up
- updateCurrentProfileIdsLocked();
- mWindowManager.setCurrentUser(userId, mCurrentProfileIds);
- // Once the internal notion of the active user has switched, we lock the device
- // with the option to show the user switcher on the keyguard.
- mWindowManager.lockNow(null);
- } else {
- final Integer currentUserIdInt = Integer.valueOf(mCurrentUserId);
- updateCurrentProfileIdsLocked();
- mWindowManager.setCurrentProfileIds(mCurrentProfileIds);
- mUserLru.remove(currentUserIdInt);
- mUserLru.add(currentUserIdInt);
- }
-
- final UserState uss = mStartedUsers.get(userId);
-
- // Make sure user is in the started state. If it is currently
- // stopping, we need to knock that off.
- if (uss.mState == UserState.STATE_STOPPING) {
- // If we are stopping, we haven't sent ACTION_SHUTDOWN,
- // so we can just fairly silently bring the user back from
- // the almost-dead.
- uss.mState = UserState.STATE_RUNNING;
- updateStartedUserArrayLocked();
- needStart = true;
- } else if (uss.mState == UserState.STATE_SHUTDOWN) {
- // This means ACTION_SHUTDOWN has been sent, so we will
- // need to treat this as a new boot of the user.
- uss.mState = UserState.STATE_BOOTING;
- updateStartedUserArrayLocked();
- needStart = true;
- }
-
- if (uss.mState == UserState.STATE_BOOTING) {
- // Booting up a new user, need to tell system services about it.
- // Note that this is on the same handler as scheduling of broadcasts,
- // which is important because it needs to go first.
- mHandler.sendMessage(mHandler.obtainMessage(SYSTEM_USER_START_MSG, userId, 0));
- }
-
- if (foreground) {
- mHandler.sendMessage(mHandler.obtainMessage(SYSTEM_USER_CURRENT_MSG, userId,
- oldUserId));
- mHandler.removeMessages(REPORT_USER_SWITCH_MSG);
- mHandler.removeMessages(USER_SWITCH_TIMEOUT_MSG);
- mHandler.sendMessage(mHandler.obtainMessage(REPORT_USER_SWITCH_MSG,
- oldUserId, userId, uss));
- mHandler.sendMessageDelayed(mHandler.obtainMessage(USER_SWITCH_TIMEOUT_MSG,
- oldUserId, userId, uss), USER_SWITCH_TIMEOUT);
- }
-
- if (needStart) {
- // Send USER_STARTED broadcast
- Intent intent = new Intent(Intent.ACTION_USER_STARTED);
- intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY
- | Intent.FLAG_RECEIVER_FOREGROUND);
- intent.putExtra(Intent.EXTRA_USER_HANDLE, userId);
- broadcastIntentLocked(null, null, intent,
- null, null, 0, null, null, null, AppOpsManager.OP_NONE,
- null, false, false, MY_PID, Process.SYSTEM_UID, userId);
- }
-
- if ((userInfo.flags&UserInfo.FLAG_INITIALIZED) == 0) {
- if (userId != UserHandle.USER_OWNER) {
- Intent intent = new Intent(Intent.ACTION_USER_INITIALIZE);
- intent.addFlags(Intent.FLAG_RECEIVER_FOREGROUND);
- broadcastIntentLocked(null, null, intent, null,
- new IIntentReceiver.Stub() {
- public void performReceive(Intent intent, int resultCode,
- String data, Bundle extras, boolean ordered,
- boolean sticky, int sendingUser) {
- onUserInitialized(uss, foreground, oldUserId, userId);
- }
- }, 0, null, null, null, AppOpsManager.OP_NONE,
- null, true, false, MY_PID, Process.SYSTEM_UID, userId);
- uss.initializing = true;
- } else {
- getUserManagerLocked().makeInitialized(userInfo.id);
- }
- }
-
- if (foreground) {
- if (!uss.initializing) {
- moveUserToForeground(uss, oldUserId, userId);
- }
- } else {
- mStackSupervisor.startBackgroundUserLocked(userId, uss);
- }
-
- if (needStart) {
- Intent intent = new Intent(Intent.ACTION_USER_STARTING);
- intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY);
- intent.putExtra(Intent.EXTRA_USER_HANDLE, userId);
- broadcastIntentLocked(null, null, intent,
- null, new IIntentReceiver.Stub() {
- @Override
- public void performReceive(Intent intent, int resultCode,
- String data, Bundle extras, boolean ordered, boolean sticky,
- int sendingUser) throws RemoteException {
- }
- }, 0, null, null,
- new String[] {INTERACT_ACROSS_USERS}, AppOpsManager.OP_NONE,
- null, true, false, MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
- }
- }
- } finally {
- Binder.restoreCallingIdentity(ident);
- }
+ boolean isDebuggable = "1".equals(SystemProperties.get(SYSTEM_DEBUGGABLE, "0"));
+ if (!isDebuggable) {
+ if ((process.info.flags&ApplicationInfo.FLAG_DEBUGGABLE) == 0) {
+ return false;
+ }
+ }
return true;
}
- void dispatchForegroundProfileChanged(int userId) {
- final int N = mUserSwitchObservers.beginBroadcast();
- for (int i = 0; i < N; i++) {
- try {
- mUserSwitchObservers.getBroadcastItem(i).onForegroundProfileSwitch(userId);
- } catch (RemoteException e) {
- // Ignore
+ public boolean startBinderTracking() throws RemoteException {
+ synchronized (this) {
+ mBinderTransactionTrackingEnabled = true;
+ // TODO: hijacking SET_ACTIVITY_WATCHER, but should be changed to its own
+ // permission (same as profileControl).
+ if (checkCallingPermission(android.Manifest.permission.SET_ACTIVITY_WATCHER)
+ != PackageManager.PERMISSION_GRANTED) {
+ throw new SecurityException("Requires permission "
+ + android.Manifest.permission.SET_ACTIVITY_WATCHER);
}
- }
- mUserSwitchObservers.finishBroadcast();
- }
- void sendUserSwitchBroadcastsLocked(int oldUserId, int newUserId) {
- long ident = Binder.clearCallingIdentity();
- try {
- Intent intent;
- if (oldUserId >= 0) {
- // Send USER_BACKGROUND broadcast to all profiles of the outgoing user
- List<UserInfo> profiles = mUserManager.getProfiles(oldUserId, false);
- int count = profiles.size();
- for (int i = 0; i < count; i++) {
- int profileUserId = profiles.get(i).id;
- intent = new Intent(Intent.ACTION_USER_BACKGROUND);
- intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY
- | Intent.FLAG_RECEIVER_FOREGROUND);
- intent.putExtra(Intent.EXTRA_USER_HANDLE, profileUserId);
- broadcastIntentLocked(null, null, intent,
- null, null, 0, null, null, null, AppOpsManager.OP_NONE,
- null, false, false, MY_PID, Process.SYSTEM_UID, profileUserId);
- }
- }
- if (newUserId >= 0) {
- // Send USER_FOREGROUND broadcast to all profiles of the incoming user
- List<UserInfo> profiles = mUserManager.getProfiles(newUserId, false);
- int count = profiles.size();
- for (int i = 0; i < count; i++) {
- int profileUserId = profiles.get(i).id;
- intent = new Intent(Intent.ACTION_USER_FOREGROUND);
- intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY
- | Intent.FLAG_RECEIVER_FOREGROUND);
- intent.putExtra(Intent.EXTRA_USER_HANDLE, profileUserId);
- broadcastIntentLocked(null, null, intent,
- null, null, 0, null, null, null, AppOpsManager.OP_NONE,
- null, false, false, MY_PID, Process.SYSTEM_UID, profileUserId);
- }
- intent = new Intent(Intent.ACTION_USER_SWITCHED);
- intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY
- | Intent.FLAG_RECEIVER_FOREGROUND);
- intent.putExtra(Intent.EXTRA_USER_HANDLE, newUserId);
- broadcastIntentLocked(null, null, intent,
- null, null, 0, null, null,
- new String[] {android.Manifest.permission.MANAGE_USERS},
- AppOpsManager.OP_NONE, null, false, false, MY_PID, Process.SYSTEM_UID,
- UserHandle.USER_ALL);
+ for (int i = 0; i < mLruProcesses.size(); i++) {
+ ProcessRecord process = mLruProcesses.get(i);
+ if (!processSanityChecksLocked(process)) {
+ continue;
+ }
+ try {
+ process.thread.startBinderTracking();
+ } catch (RemoteException e) {
+ Log.v(TAG, "Process disappared");
+ }
}
- } finally {
- Binder.restoreCallingIdentity(ident);
+ return true;
}
}
- void dispatchUserSwitch(final UserState uss, final int oldUserId,
- final int newUserId) {
- final int N = mUserSwitchObservers.beginBroadcast();
- if (N > 0) {
- final IRemoteCallback callback = new IRemoteCallback.Stub() {
- int mCount = 0;
- @Override
- public void sendResult(Bundle data) throws RemoteException {
- synchronized (ActivityManagerService.this) {
- if (mCurUserSwitchCallback == this) {
- mCount++;
- if (mCount == N) {
- sendContinueUserSwitchLocked(uss, oldUserId, newUserId);
- }
+ public boolean stopBinderTrackingAndDump(ParcelFileDescriptor fd) throws RemoteException {
+ try {
+ synchronized (this) {
+ mBinderTransactionTrackingEnabled = false;
+ // TODO: hijacking SET_ACTIVITY_WATCHER, but should be changed to its own
+ // permission (same as profileControl).
+ if (checkCallingPermission(android.Manifest.permission.SET_ACTIVITY_WATCHER)
+ != PackageManager.PERMISSION_GRANTED) {
+ throw new SecurityException("Requires permission "
+ + android.Manifest.permission.SET_ACTIVITY_WATCHER);
+ }
+
+ if (fd == null) {
+ throw new IllegalArgumentException("null fd");
+ }
+
+ PrintWriter pw = new FastPrintWriter(new FileOutputStream(fd.getFileDescriptor()));
+ pw.println("Binder transaction traces for all processes.\n");
+ for (ProcessRecord process : mLruProcesses) {
+ if (!processSanityChecksLocked(process)) {
+ continue;
+ }
+
+ pw.println("Traces for process: " + process.processName);
+ pw.flush();
+ try {
+ TransferPipe tp = new TransferPipe();
+ try {
+ process.thread.stopBinderTrackingAndDump(tp.getWriteFd());
+ tp.go(fd.getFileDescriptor());
+ } finally {
+ tp.kill();
}
+ } catch (IOException e) {
+ pw.println("Failure while dumping IPC traces from " + process +
+ ". Exception: " + e);
+ pw.flush();
+ } catch (RemoteException e) {
+ pw.println("Got a RemoteException while dumping IPC traces from " +
+ process + ". Exception: " + e);
+ pw.flush();
}
}
- };
- synchronized (this) {
- uss.switching = true;
- mCurUserSwitchCallback = callback;
+ fd = null;
+ return true;
}
- for (int i=0; i<N; i++) {
+ } finally {
+ if (fd != null) {
try {
- mUserSwitchObservers.getBroadcastItem(i).onUserSwitching(
- newUserId, callback);
- } catch (RemoteException e) {
+ fd.close();
+ } catch (IOException e) {
}
}
- } else {
- synchronized (this) {
- sendContinueUserSwitchLocked(uss, oldUserId, newUserId);
- }
- }
- mUserSwitchObservers.finishBroadcast();
- }
-
- void timeoutUserSwitch(UserState uss, int oldUserId, int newUserId) {
- synchronized (this) {
- Slog.w(TAG, "User switch timeout: from " + oldUserId + " to " + newUserId);
- sendContinueUserSwitchLocked(uss, oldUserId, newUserId);
}
}
- void sendContinueUserSwitchLocked(UserState uss, int oldUserId, int newUserId) {
- mCurUserSwitchCallback = null;
- mHandler.removeMessages(USER_SWITCH_TIMEOUT_MSG);
- mHandler.sendMessage(mHandler.obtainMessage(CONTINUE_USER_SWITCH_MSG,
- oldUserId, newUserId, uss));
- }
-
- void onUserInitialized(UserState uss, boolean foreground, int oldUserId, int newUserId) {
- synchronized (this) {
- if (foreground) {
- moveUserToForeground(uss, oldUserId, newUserId);
+ @VisibleForTesting
+ final class LocalService extends ActivityManagerInternal {
+ @Override
+ public void grantUriPermissionFromIntent(int callingUid, String targetPkg, Intent intent,
+ int targetUserId) {
+ synchronized (ActivityManagerService.this) {
+ ActivityManagerService.this.grantUriPermissionFromIntentLocked(callingUid,
+ targetPkg, intent, null, targetUserId);
}
}
- completeSwitchAndInitialize(uss, newUserId, true, false);
- }
-
- void moveUserToForeground(UserState uss, int oldUserId, int newUserId) {
- boolean homeInFront = mStackSupervisor.switchUserLocked(newUserId, uss);
- if (homeInFront) {
- startHomeActivityLocked(newUserId, "moveUserToFroreground");
- } else {
- mStackSupervisor.resumeTopActivitiesLocked();
+ @Override
+ public String checkContentProviderAccess(String authority, int userId) {
+ return ActivityManagerService.this.checkContentProviderAccess(authority, userId);
}
- EventLogTags.writeAmSwitchUser(newUserId);
- getUserManagerLocked().onUserForeground(newUserId);
- sendUserSwitchBroadcastsLocked(oldUserId, newUserId);
- }
- void continueUserSwitch(UserState uss, int oldUserId, int newUserId) {
- completeSwitchAndInitialize(uss, newUserId, false, true);
- }
+ @Override
+ public void onWakefulnessChanged(int wakefulness) {
+ ActivityManagerService.this.onWakefulnessChanged(wakefulness);
+ }
- void completeSwitchAndInitialize(UserState uss, int newUserId,
- boolean clearInitializing, boolean clearSwitching) {
- boolean unfrozen = false;
- synchronized (this) {
- if (clearInitializing) {
- uss.initializing = false;
- getUserManagerLocked().makeInitialized(uss.mHandle.getIdentifier());
- }
- if (clearSwitching) {
- uss.switching = false;
- }
- if (!uss.switching && !uss.initializing) {
- mWindowManager.stopFreezingScreen();
- unfrozen = true;
- }
+ @Override
+ public int startIsolatedProcess(String entryPoint, String[] entryPointArgs,
+ String processName, String abiOverride, int uid, Runnable crashHandler) {
+ return ActivityManagerService.this.startIsolatedProcess(entryPoint, entryPointArgs,
+ processName, abiOverride, uid, crashHandler);
}
- if (unfrozen) {
- mHandler.removeMessages(REPORT_USER_SWITCH_COMPLETE_MSG);
- mHandler.sendMessage(mHandler.obtainMessage(REPORT_USER_SWITCH_COMPLETE_MSG,
- newUserId, 0));
+
+ @Override
+ public SleepToken acquireSleepToken(String tag, int displayId) {
+ Preconditions.checkNotNull(tag);
+ return ActivityManagerService.this.acquireSleepToken(tag, displayId);
}
- stopGuestUserIfBackground();
- }
- /** Called on handler thread */
- void dispatchUserSwitchComplete(int userId) {
- final int observerCount = mUserSwitchObservers.beginBroadcast();
- for (int i = 0; i < observerCount; i++) {
- try {
- mUserSwitchObservers.getBroadcastItem(i).onUserSwitchComplete(userId);
- } catch (RemoteException e) {
+ @Override
+ public ComponentName getHomeActivityForUser(int userId) {
+ synchronized (ActivityManagerService.this) {
+ ActivityRecord homeActivity = mStackSupervisor.getHomeActivityForUser(userId);
+ return homeActivity == null ? null : homeActivity.realActivity;
}
}
- mUserSwitchObservers.finishBroadcast();
- }
- /**
- * Stops the guest user if it has gone to the background.
- */
- private void stopGuestUserIfBackground() {
- synchronized (this) {
- final int num = mUserLru.size();
- for (int i = 0; i < num; i++) {
- Integer oldUserId = mUserLru.get(i);
- UserState oldUss = mStartedUsers.get(oldUserId);
- if (oldUserId == UserHandle.USER_OWNER || oldUserId == mCurrentUserId
- || oldUss.mState == UserState.STATE_STOPPING
- || oldUss.mState == UserState.STATE_SHUTDOWN) {
- continue;
- }
- UserInfo userInfo = mUserManager.getUserInfo(oldUserId);
- if (userInfo.isGuest()) {
- // This is a user to be stopped.
- stopUserLocked(oldUserId, null);
- break;
- }
+ @Override
+ public void onUserRemoved(int userId) {
+ synchronized (ActivityManagerService.this) {
+ ActivityManagerService.this.onUserStoppedLocked(userId);
}
+ mBatteryStatsService.onUserRemoved(userId);
}
- }
- void scheduleStartProfilesLocked() {
- if (!mHandler.hasMessages(START_PROFILES_MSG)) {
- mHandler.sendMessageDelayed(mHandler.obtainMessage(START_PROFILES_MSG),
- DateUtils.SECOND_IN_MILLIS);
+ @Override
+ public void onLocalVoiceInteractionStarted(IBinder activity,
+ IVoiceInteractionSession voiceSession, IVoiceInteractor voiceInteractor) {
+ synchronized (ActivityManagerService.this) {
+ ActivityManagerService.this.onLocalVoiceInteractionStartedLocked(activity,
+ voiceSession, voiceInteractor);
+ }
}
- }
- void startProfilesLocked() {
- if (DEBUG_MU) Slog.i(TAG_MU, "startProfilesLocked");
- List<UserInfo> profiles = getUserManagerLocked().getProfiles(
- mCurrentUserId, false /* enabledOnly */);
- List<UserInfo> toStart = new ArrayList<UserInfo>(profiles.size());
- for (UserInfo user : profiles) {
- if ((user.flags & UserInfo.FLAG_INITIALIZED) == UserInfo.FLAG_INITIALIZED
- && user.id != mCurrentUserId) {
- toStart.add(user);
+ @Override
+ public void notifyAppTransitionStarting(SparseIntArray reasons, long timestamp) {
+ synchronized (ActivityManagerService.this) {
+ mStackSupervisor.mActivityMetricsLogger.notifyTransitionStarting(
+ reasons, timestamp);
}
}
- final int n = toStart.size();
- int i = 0;
- for (; i < n && i < (MAX_RUNNING_USERS - 1); ++i) {
- startUserInBackground(toStart.get(i).id);
- }
- if (i < n) {
- Slog.w(TAG_MU, "More profiles than MAX_RUNNING_USERS");
- }
- }
- void finishUserBoot(UserState uss) {
- synchronized (this) {
- if (uss.mState == UserState.STATE_BOOTING
- && mStartedUsers.get(uss.mHandle.getIdentifier()) == uss) {
- uss.mState = UserState.STATE_RUNNING;
- final int userId = uss.mHandle.getIdentifier();
- Intent intent = new Intent(Intent.ACTION_BOOT_COMPLETED, null);
- intent.putExtra(Intent.EXTRA_USER_HANDLE, userId);
- intent.addFlags(Intent.FLAG_RECEIVER_NO_ABORT);
- broadcastIntentLocked(null, null, intent,
- null, null, 0, null, null,
- new String[] {android.Manifest.permission.RECEIVE_BOOT_COMPLETED},
- AppOpsManager.OP_NONE, null, true, false, MY_PID, Process.SYSTEM_UID,
- userId);
+ @Override
+ public void notifyAppTransitionFinished() {
+ synchronized (ActivityManagerService.this) {
+ mStackSupervisor.notifyAppTransitionDone();
}
}
- }
- void finishUserSwitch(UserState uss) {
- synchronized (this) {
- finishUserBoot(uss);
-
- startProfilesLocked();
-
- int num = mUserLru.size();
- int i = 0;
- while (num > MAX_RUNNING_USERS && i < mUserLru.size()) {
- Integer oldUserId = mUserLru.get(i);
- UserState oldUss = mStartedUsers.get(oldUserId);
- if (oldUss == null) {
- // Shouldn't happen, but be sane if it does.
- mUserLru.remove(i);
- num--;
- continue;
- }
- if (oldUss.mState == UserState.STATE_STOPPING
- || oldUss.mState == UserState.STATE_SHUTDOWN) {
- // This user is already stopping, doesn't count.
- num--;
- i++;
- continue;
- }
- if (oldUserId == UserHandle.USER_OWNER || oldUserId == mCurrentUserId) {
- // Owner and current can't be stopped, but count as running.
- i++;
- continue;
- }
- // This is a user to be stopped.
- stopUserLocked(oldUserId, null);
- num--;
- i++;
+ @Override
+ public void notifyAppTransitionCancelled() {
+ synchronized (ActivityManagerService.this) {
+ mStackSupervisor.notifyAppTransitionDone();
}
}
- }
- @Override
- public int stopUser(final int userId, final IStopUserCallback callback) {
- if (checkCallingPermission(INTERACT_ACROSS_USERS_FULL)
- != PackageManager.PERMISSION_GRANTED) {
- String msg = "Permission Denial: switchUser() from pid="
- + Binder.getCallingPid()
- + ", uid=" + Binder.getCallingUid()
- + " requires " + INTERACT_ACROSS_USERS_FULL;
- Slog.w(TAG, msg);
- throw new SecurityException(msg);
- }
- if (userId < 0 || userId == UserHandle.USER_OWNER) {
- throw new IllegalArgumentException("Can't stop primary user " + userId);
- }
- enforceShellRestriction(UserManager.DISALLOW_DEBUGGING_FEATURES, userId);
- synchronized (this) {
- return stopUserLocked(userId, callback);
+ @Override
+ public List<IBinder> getTopVisibleActivities() {
+ synchronized (ActivityManagerService.this) {
+ return mStackSupervisor.getTopVisibleActivities();
+ }
}
- }
- private int stopUserLocked(final int userId, final IStopUserCallback callback) {
- if (DEBUG_MU) Slog.i(TAG_MU, "stopUserLocked userId=" + userId);
- if (mCurrentUserId == userId && mTargetUserId == UserHandle.USER_NULL) {
- return ActivityManager.USER_OP_IS_CURRENT;
+ @Override
+ public void notifyDockedStackMinimizedChanged(boolean minimized) {
+ synchronized (ActivityManagerService.this) {
+ mStackSupervisor.setDockedStackMinimized(minimized);
+ }
}
- final UserState uss = mStartedUsers.get(userId);
- if (uss == null) {
- // User is not started, nothing to do... but we do need to
- // callback if requested.
- if (callback != null) {
- mHandler.post(new Runnable() {
- @Override
- public void run() {
- try {
- callback.userStopped(userId);
- } catch (RemoteException e) {
+ @Override
+ public void killForegroundAppsForUser(int userHandle) {
+ synchronized (ActivityManagerService.this) {
+ final ArrayList<ProcessRecord> procs = new ArrayList<>();
+ final int NP = mProcessNames.getMap().size();
+ for (int ip = 0; ip < NP; ip++) {
+ final SparseArray<ProcessRecord> apps = mProcessNames.getMap().valueAt(ip);
+ final int NA = apps.size();
+ for (int ia = 0; ia < NA; ia++) {
+ final ProcessRecord app = apps.valueAt(ia);
+ if (app.persistent) {
+ // We don't kill persistent processes.
+ continue;
+ }
+ if (app.removed) {
+ procs.add(app);
+ } else if (app.userId == userHandle && app.foregroundActivities) {
+ app.removed = true;
+ procs.add(app);
}
}
- });
+ }
+
+ final int N = procs.size();
+ for (int i = 0; i < N; i++) {
+ removeProcessLocked(procs.get(i), false, true, "kill all fg");
+ }
}
- return ActivityManager.USER_OP_SUCCESS;
}
- if (callback != null) {
- uss.mStopCallbacks.add(callback);
+ @Override
+ public void setPendingIntentWhitelistDuration(IIntentSender target, IBinder whitelistToken,
+ long duration) {
+ if (!(target instanceof PendingIntentRecord)) {
+ Slog.w(TAG, "markAsSentFromNotification(): not a PendingIntentRecord: " + target);
+ return;
+ }
+ synchronized (ActivityManagerService.this) {
+ ((PendingIntentRecord) target).setWhitelistDurationLocked(whitelistToken, duration);
+ }
}
- if (uss.mState != UserState.STATE_STOPPING
- && uss.mState != UserState.STATE_SHUTDOWN) {
- uss.mState = UserState.STATE_STOPPING;
- updateStartedUserArrayLocked();
-
- long ident = Binder.clearCallingIdentity();
- try {
- // We are going to broadcast ACTION_USER_STOPPING and then
- // once that is done send a final ACTION_SHUTDOWN and then
- // stop the user.
- final Intent stoppingIntent = new Intent(Intent.ACTION_USER_STOPPING);
- stoppingIntent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY);
- stoppingIntent.putExtra(Intent.EXTRA_USER_HANDLE, userId);
- stoppingIntent.putExtra(Intent.EXTRA_SHUTDOWN_USERSPACE_ONLY, true);
- final Intent shutdownIntent = new Intent(Intent.ACTION_SHUTDOWN);
- // This is the result receiver for the final shutdown broadcast.
- final IIntentReceiver shutdownReceiver = new IIntentReceiver.Stub() {
- @Override
- public void performReceive(Intent intent, int resultCode, String data,
- Bundle extras, boolean ordered, boolean sticky, int sendingUser) {
- finishUserStop(uss);
- }
- };
- // This is the result receiver for the initial stopping broadcast.
- final IIntentReceiver stoppingReceiver = new IIntentReceiver.Stub() {
- @Override
- public void performReceive(Intent intent, int resultCode, String data,
- Bundle extras, boolean ordered, boolean sticky, int sendingUser) {
- // On to the next.
- synchronized (ActivityManagerService.this) {
- if (uss.mState != UserState.STATE_STOPPING) {
- // Whoops, we are being started back up. Abort, abort!
- return;
- }
- uss.mState = UserState.STATE_SHUTDOWN;
- }
- mBatteryStatsService.noteEvent(
- BatteryStats.HistoryItem.EVENT_USER_RUNNING_FINISH,
- Integer.toString(userId), userId);
- mSystemServiceManager.stopUser(userId);
- broadcastIntentLocked(null, null, shutdownIntent,
- null, shutdownReceiver, 0, null, null, null, AppOpsManager.OP_NONE,
- null, true, false, MY_PID, Process.SYSTEM_UID, userId);
- }
- };
- // Kick things off.
- broadcastIntentLocked(null, null, stoppingIntent,
- null, stoppingReceiver, 0, null, null,
- new String[] {INTERACT_ACROSS_USERS}, AppOpsManager.OP_NONE,
- null, true, false, MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
- } finally {
- Binder.restoreCallingIdentity(ident);
+ @Override
+ public void setDeviceIdleWhitelist(int[] appids) {
+ synchronized (ActivityManagerService.this) {
+ mDeviceIdleWhitelist = appids;
}
}
- return ActivityManager.USER_OP_SUCCESS;
- }
-
- void finishUserStop(UserState uss) {
- final int userId = uss.mHandle.getIdentifier();
- boolean stopped;
- ArrayList<IStopUserCallback> callbacks;
- synchronized (this) {
- callbacks = new ArrayList<IStopUserCallback>(uss.mStopCallbacks);
- if (mStartedUsers.get(userId) != uss) {
- stopped = false;
- } else if (uss.mState != UserState.STATE_SHUTDOWN) {
- stopped = false;
- } else {
- stopped = true;
- // User can no longer run.
- mStartedUsers.remove(userId);
- mUserLru.remove(Integer.valueOf(userId));
- updateStartedUserArrayLocked();
-
- // Clean up all state and processes associated with the user.
- // Kill all the processes for the user.
- forceStopUserLocked(userId, "finish user");
+ @Override
+ public void updateDeviceIdleTempWhitelist(int[] appids, int changingAppId, boolean adding) {
+ synchronized (ActivityManagerService.this) {
+ mDeviceIdleTempWhitelist = appids;
+ setAppIdTempWhitelistStateLocked(changingAppId, adding);
}
+ }
- // Explicitly remove the old information in mRecentTasks.
- mRecentTasks.removeTasksForUserLocked(userId);
+ @Override
+ public void updatePersistentConfigurationForUser(@NonNull Configuration values,
+ int userId) {
+ Preconditions.checkNotNull(values, "Configuration must not be null");
+ Preconditions.checkArgumentNonnegative(userId, "userId " + userId + " not supported");
+ synchronized (ActivityManagerService.this) {
+ updateConfigurationLocked(values, null, false, true, userId,
+ false /* deferResume */);
+ }
}
- for (int i=0; i<callbacks.size(); i++) {
+ @Override
+ public int startActivitiesAsPackage(String packageName, int userId, Intent[] intents,
+ Bundle bOptions) {
+ Preconditions.checkNotNull(intents, "intents");
+ final String[] resolvedTypes = new String[intents.length];
+ for (int i = 0; i < intents.length; i++) {
+ resolvedTypes[i] = intents[i].resolveTypeIfNeeded(mContext.getContentResolver());
+ }
+
+ // UID of the package on user userId.
+ // "= 0" is needed because otherwise catch(RemoteException) would make it look like
+ // packageUid may not be initialized.
+ int packageUid = 0;
try {
- if (stopped) callbacks.get(i).userStopped(userId);
- else callbacks.get(i).userStopAborted(userId);
+ packageUid = AppGlobals.getPackageManager().getPackageUid(
+ packageName, PackageManager.MATCH_DEBUG_TRIAGED_MISSING, userId);
} catch (RemoteException e) {
+ // Shouldn't happen.
}
- }
- if (stopped) {
- mSystemServiceManager.cleanupUser(userId);
- synchronized (this) {
- mStackSupervisor.removeUserLocked(userId);
+ synchronized (ActivityManagerService.this) {
+ return startActivitiesInPackage(packageUid, packageName, intents, resolvedTypes,
+ /*resultTo*/ null, bOptions, userId);
}
}
- }
-
- @Override
- public UserInfo getCurrentUser() {
- if ((checkCallingPermission(INTERACT_ACROSS_USERS)
- != PackageManager.PERMISSION_GRANTED) && (
- checkCallingPermission(INTERACT_ACROSS_USERS_FULL)
- != PackageManager.PERMISSION_GRANTED)) {
- String msg = "Permission Denial: getCurrentUser() from pid="
- + Binder.getCallingPid()
- + ", uid=" + Binder.getCallingUid()
- + " requires " + INTERACT_ACROSS_USERS;
- Slog.w(TAG, msg);
- throw new SecurityException(msg);
- }
- synchronized (this) {
- int userId = mTargetUserId != UserHandle.USER_NULL ? mTargetUserId : mCurrentUserId;
- return getUserManagerLocked().getUserInfo(userId);
- }
- }
- int getCurrentUserIdLocked() {
- return mTargetUserId != UserHandle.USER_NULL ? mTargetUserId : mCurrentUserId;
- }
-
- @Override
- public boolean isUserRunning(int userId, boolean orStopped) {
- if (checkCallingPermission(INTERACT_ACROSS_USERS)
- != PackageManager.PERMISSION_GRANTED) {
- String msg = "Permission Denial: isUserRunning() from pid="
- + Binder.getCallingPid()
- + ", uid=" + Binder.getCallingUid()
- + " requires " + INTERACT_ACROSS_USERS;
- Slog.w(TAG, msg);
- throw new SecurityException(msg);
- }
- synchronized (this) {
- return isUserRunningLocked(userId, orStopped);
+ @Override
+ public int getUidProcessState(int uid) {
+ return getUidState(uid);
}
- }
- boolean isUserRunningLocked(int userId, boolean orStopped) {
- UserState state = mStartedUsers.get(userId);
- if (state == null) {
- return false;
- }
- if (orStopped) {
- return true;
- }
- return state.mState != UserState.STATE_STOPPING
- && state.mState != UserState.STATE_SHUTDOWN;
- }
+ @Override
+ public void notifyKeyguardFlagsChanged(@Nullable Runnable callback) {
+ synchronized (ActivityManagerService.this) {
- @Override
- public int[] getRunningUserIds() {
- if (checkCallingPermission(INTERACT_ACROSS_USERS)
- != PackageManager.PERMISSION_GRANTED) {
- String msg = "Permission Denial: isUserRunning() from pid="
- + Binder.getCallingPid()
- + ", uid=" + Binder.getCallingUid()
- + " requires " + INTERACT_ACROSS_USERS;
- Slog.w(TAG, msg);
- throw new SecurityException(msg);
- }
- synchronized (this) {
- return mStartedUserArray;
- }
- }
+ // We might change the visibilities here, so prepare an empty app transition which
+ // might be overridden later if we actually change visibilities.
+ final boolean wasTransitionSet =
+ mWindowManager.getPendingAppTransition() != TRANSIT_NONE;
+ if (!wasTransitionSet) {
+ mWindowManager.prepareAppTransition(TRANSIT_NONE,
+ false /* alwaysKeepCurrent */);
+ }
+ mStackSupervisor.ensureActivitiesVisibleLocked(null, 0, !PRESERVE_WINDOWS);
- private void updateStartedUserArrayLocked() {
- int num = 0;
- for (int i=0; i<mStartedUsers.size(); i++) {
- UserState uss = mStartedUsers.valueAt(i);
- // This list does not include stopping users.
- if (uss.mState != UserState.STATE_STOPPING
- && uss.mState != UserState.STATE_SHUTDOWN) {
- num++;
+ // If there was a transition set already we don't want to interfere with it as we
+ // might be starting it too early.
+ if (!wasTransitionSet) {
+ mWindowManager.executeAppTransition();
+ }
}
- }
- mStartedUserArray = new int[num];
- num = 0;
- for (int i=0; i<mStartedUsers.size(); i++) {
- UserState uss = mStartedUsers.valueAt(i);
- if (uss.mState != UserState.STATE_STOPPING
- && uss.mState != UserState.STATE_SHUTDOWN) {
- mStartedUserArray[num] = mStartedUsers.keyAt(i);
- num++;
+ if (callback != null) {
+ callback.run();
}
- }
- }
-
- @Override
- public void registerUserSwitchObserver(IUserSwitchObserver observer) {
- if (checkCallingPermission(INTERACT_ACROSS_USERS_FULL)
- != PackageManager.PERMISSION_GRANTED) {
- String msg = "Permission Denial: registerUserSwitchObserver() from pid="
- + Binder.getCallingPid()
- + ", uid=" + Binder.getCallingUid()
- + " requires " + INTERACT_ACROSS_USERS_FULL;
- Slog.w(TAG, msg);
- throw new SecurityException(msg);
- }
-
- mUserSwitchObservers.register(observer);
- }
-
- @Override
- public void unregisterUserSwitchObserver(IUserSwitchObserver observer) {
- mUserSwitchObservers.unregister(observer);
- }
-
- int[] getUsersLocked() {
- UserManagerService ums = getUserManagerLocked();
- return ums != null ? ums.getUserIds() : new int[] { 0 };
- }
-
- UserManagerService getUserManagerLocked() {
- if (mUserManager == null) {
- IBinder b = ServiceManager.getService(Context.USER_SERVICE);
- mUserManager = (UserManagerService)IUserManager.Stub.asInterface(b);
- }
- return mUserManager;
- }
-
- private int applyUserId(int uid, int userId) {
- return UserHandle.getUid(userId, uid);
- }
-
- ApplicationInfo getAppInfoForUser(ApplicationInfo info, int userId) {
- if (info == null) return null;
- ApplicationInfo newInfo = new ApplicationInfo(info);
- newInfo.uid = applyUserId(info.uid, userId);
- newInfo.dataDir = Environment
- .getDataUserPackageDirectory(info.volumeUuid, userId, info.packageName)
- .getAbsolutePath();
- return newInfo;
- }
+ }
- ActivityInfo getActivityInfoForUser(ActivityInfo aInfo, int userId) {
- if (aInfo == null
- || (userId < 1 && aInfo.applicationInfo.uid < UserHandle.PER_USER_RANGE)) {
- return aInfo;
+ @Override
+ public boolean isSystemReady() {
+ // no need to synchronize(this) just to read & return the value
+ return mSystemReady;
}
- ActivityInfo info = new ActivityInfo(aInfo);
- info.applicationInfo = getAppInfoForUser(info.applicationInfo, userId);
- return info;
- }
+ @Override
+ public void notifyKeyguardTrustedChanged() {
+ synchronized (ActivityManagerService.this) {
+ if (mKeyguardController.isKeyguardShowing(DEFAULT_DISPLAY)) {
+ mStackSupervisor.ensureActivitiesVisibleLocked(null, 0, !PRESERVE_WINDOWS);
+ }
+ }
+ }
- private final class LocalService extends ActivityManagerInternal {
+ /**
+ * Sets if the given pid has an overlay UI or not.
+ *
+ * @param pid The pid we are setting overlay UI for.
+ * @param hasOverlayUi True if the process has overlay UI.
+ * @see android.view.WindowManager.LayoutParams#TYPE_APPLICATION_OVERLAY
+ */
@Override
- public void grantUriPermissionFromIntent(int callingUid, String targetPkg, Intent intent,
- int targetUserId) {
+ public void setHasOverlayUi(int pid, boolean hasOverlayUi) {
synchronized (ActivityManagerService.this) {
- ActivityManagerService.this.grantUriPermissionFromIntentLocked(callingUid,
- targetPkg, intent, null, targetUserId);
+ final ProcessRecord pr;
+ synchronized (mPidsSelfLocked) {
+ pr = mPidsSelfLocked.get(pid);
+ if (pr == null) {
+ Slog.w(TAG, "setHasOverlayUi called on unknown pid: " + pid);
+ return;
+ }
+ }
+ if (pr.hasOverlayUi == hasOverlayUi) {
+ return;
+ }
+ pr.hasOverlayUi = hasOverlayUi;
+ //Slog.i(TAG, "Setting hasOverlayUi=" + pr.hasOverlayUi + " for pid=" + pid);
+ updateOomAdjLocked(pr, true);
}
}
+ /**
+ * Called after the network policy rules are updated by
+ * {@link com.android.server.net.NetworkPolicyManagerService} for a specific {@param uid}
+ * and {@param procStateSeq}.
+ */
@Override
- public String checkContentProviderAccess(String authority, int userId) {
- return ActivityManagerService.this.checkContentProviderAccess(authority, userId);
+ public void notifyNetworkPolicyRulesUpdated(int uid, long procStateSeq) {
+ if (DEBUG_NETWORK) {
+ Slog.d(TAG_NETWORK, "Got update from NPMS for uid: "
+ + uid + " seq: " + procStateSeq);
+ }
+ UidRecord record;
+ synchronized (ActivityManagerService.this) {
+ record = mActiveUids.get(uid);
+ if (record == null) {
+ if (DEBUG_NETWORK) {
+ Slog.d(TAG_NETWORK, "No active uidRecord for uid: " + uid
+ + " procStateSeq: " + procStateSeq);
+ }
+ return;
+ }
+ }
+ synchronized (record.networkStateLock) {
+ if (record.lastNetworkUpdatedProcStateSeq >= procStateSeq) {
+ if (DEBUG_NETWORK) {
+ Slog.d(TAG_NETWORK, "procStateSeq: " + procStateSeq + " has already"
+ + " been handled for uid: " + uid);
+ }
+ return;
+ }
+ record.lastNetworkUpdatedProcStateSeq = procStateSeq;
+ if (record.curProcStateSeq > procStateSeq) {
+ if (DEBUG_NETWORK) {
+ Slog.d(TAG_NETWORK, "No need to handle older seq no., Uid: " + uid
+ + ", curProcstateSeq: " + record.curProcStateSeq
+ + ", procStateSeq: " + procStateSeq);
+ }
+ return;
+ }
+ if (record.waitingForNetwork) {
+ if (DEBUG_NETWORK) {
+ Slog.d(TAG_NETWORK, "Notifying all blocking threads for uid: " + uid
+ + ", procStateSeq: " + procStateSeq);
+ }
+ record.networkStateLock.notifyAll();
+ }
+ }
}
+ /**
+ * Called after virtual display Id is updated by
+ * {@link com.android.server.vr.Vr2dDisplay} with a specific
+ * {@param vrVr2dDisplayId}.
+ */
@Override
- public void onWakefulnessChanged(int wakefulness) {
- ActivityManagerService.this.onWakefulnessChanged(wakefulness);
+ public void setVr2dDisplayId(int vr2dDisplayId) {
+ if (DEBUG_STACK) {
+ Slog.d(TAG, "setVr2dDisplayId called for: " +
+ vr2dDisplayId);
+ }
+ synchronized (ActivityManagerService.this) {
+ mVr2dDisplayId = vr2dDisplayId;
+ }
}
@Override
- public int startIsolatedProcess(String entryPoint, String[] entryPointArgs,
- String processName, String abiOverride, int uid, Runnable crashHandler) {
- return ActivityManagerService.this.startIsolatedProcess(entryPoint, entryPointArgs,
- processName, abiOverride, uid, crashHandler);
+ public void saveANRState(String reason) {
+ synchronized (ActivityManagerService.this) {
+ final StringWriter sw = new StringWriter();
+ final PrintWriter pw = new FastPrintWriter(sw, false, 1024);
+ pw.println(" ANR time: " + DateFormat.getDateTimeInstance().format(new Date()));
+ if (reason != null) {
+ pw.println(" Reason: " + reason);
+ }
+ pw.println();
+ mActivityStarter.dump(pw, " ", null);
+ pw.println();
+ pw.println("-------------------------------------------------------------------------------");
+ dumpActivitiesLocked(null /* fd */, pw, null /* args */, 0 /* opti */,
+ true /* dumpAll */, false /* dumpClient */, null /* dumpPackage */,
+ "" /* header */);
+ pw.println();
+ pw.close();
+
+ mLastANRState = sw.toString();
+ }
}
@Override
- public SleepToken acquireSleepToken(String tag) {
- Preconditions.checkNotNull(tag);
+ public void clearSavedANRState() {
+ synchronized (ActivityManagerService.this) {
+ mLastANRState = null;
+ }
+ }
+ @Override
+ public void setFocusedActivity(IBinder token) {
synchronized (ActivityManagerService.this) {
- SleepTokenImpl token = new SleepTokenImpl(tag);
- mSleepTokens.add(token);
- updateSleepIfNeededLocked();
- return token;
+ final ActivityRecord r = ActivityRecord.forTokenLocked(token);
+ if (r == null) {
+ throw new IllegalArgumentException(
+ "setFocusedActivity: No activity record matching token=" + token);
+ }
+ if (mStackSupervisor.moveFocusableActivityStackToFrontLocked(
+ r, "setFocusedActivity")) {
+ mStackSupervisor.resumeFocusedStackTopActivityLocked();
+ }
}
}
@Override
- public ComponentName getHomeActivityForUser(int userId) {
+ public boolean hasRunningActivity(int uid, @Nullable String packageName) {
+ if (packageName == null) return false;
+
synchronized (ActivityManagerService.this) {
- ActivityRecord homeActivity = mStackSupervisor.getHomeActivityForUser(userId);
- return homeActivity == null ? null : homeActivity.realActivity;
+ for (int i = 0; i < mLruProcesses.size(); i++) {
+ final ProcessRecord processRecord = mLruProcesses.get(i);
+ if (processRecord.uid == uid) {
+ for (int j = 0; j < processRecord.activities.size(); j++) {
+ final ActivityRecord activityRecord = processRecord.activities.get(j);
+ if (packageName.equals(activityRecord.packageName)) {
+ return true;
+ }
+ }
+ }
+ }
}
+ return false;
}
}
- private final class SleepTokenImpl extends SleepToken {
- private final String mTag;
- private final long mAcquireTime;
-
- public SleepTokenImpl(String tag) {
- mTag = tag;
- mAcquireTime = SystemClock.uptimeMillis();
+ /**
+ * Called by app main thread to wait for the network policy rules to get updated.
+ *
+ * @param procStateSeq The sequence number indicating the process state change that the main
+ * thread is interested in.
+ */
+ @Override
+ public void waitForNetworkStateUpdate(long procStateSeq) {
+ final int callingUid = Binder.getCallingUid();
+ if (DEBUG_NETWORK) {
+ Slog.d(TAG_NETWORK, "Called from " + callingUid + " to wait for seq: " + procStateSeq);
+ }
+ UidRecord record;
+ synchronized (this) {
+ record = mActiveUids.get(callingUid);
+ if (record == null) {
+ return;
+ }
+ }
+ synchronized (record.networkStateLock) {
+ if (record.lastDispatchedProcStateSeq < procStateSeq) {
+ if (DEBUG_NETWORK) {
+ Slog.d(TAG_NETWORK, "Uid state change for seq no. " + procStateSeq + " is not "
+ + "dispatched to NPMS yet, so don't wait. Uid: " + callingUid
+ + " lastProcStateSeqDispatchedToObservers: "
+ + record.lastDispatchedProcStateSeq);
+ }
+ return;
+ }
+ if (record.curProcStateSeq > procStateSeq) {
+ if (DEBUG_NETWORK) {
+ Slog.d(TAG_NETWORK, "Ignore the wait requests for older seq numbers. Uid: "
+ + callingUid + ", curProcStateSeq: " + record.curProcStateSeq
+ + ", procStateSeq: " + procStateSeq);
+ }
+ return;
+ }
+ if (record.lastNetworkUpdatedProcStateSeq >= procStateSeq) {
+ if (DEBUG_NETWORK) {
+ Slog.d(TAG_NETWORK, "Network rules have been already updated for seq no. "
+ + procStateSeq + ", so no need to wait. Uid: "
+ + callingUid + ", lastProcStateSeqWithUpdatedNetworkState: "
+ + record.lastNetworkUpdatedProcStateSeq);
+ }
+ return;
+ }
+ try {
+ if (DEBUG_NETWORK) {
+ Slog.d(TAG_NETWORK, "Starting to wait for the network rules update."
+ + " Uid: " + callingUid + " procStateSeq: " + procStateSeq);
+ }
+ final long startTime = SystemClock.uptimeMillis();
+ record.waitingForNetwork = true;
+ record.networkStateLock.wait(mWaitForNetworkTimeoutMs);
+ record.waitingForNetwork = false;
+ final long totalTime = SystemClock.uptimeMillis() - startTime;
+ if (totalTime >= mWaitForNetworkTimeoutMs || DEBUG_NETWORK) {
+ Slog.wtf(TAG_NETWORK, "Total time waited for network rules to get updated: "
+ + totalTime + ". Uid: " + callingUid + " procStateSeq: "
+ + procStateSeq + " UidRec: " + record
+ + " validateUidRec: " + mValidateUids.get(callingUid));
+ }
+ } catch (InterruptedException e) {
+ Thread.currentThread().interrupt();
+ }
}
+ }
- @Override
- public void release() {
- synchronized (ActivityManagerService.this) {
- if (mSleepTokens.remove(this)) {
- updateSleepIfNeededLocked();
+ public void waitForBroadcastIdle(PrintWriter pw) {
+ enforceCallingPermission(permission.DUMP, "waitForBroadcastIdle()");
+ while (true) {
+ boolean idle = true;
+ synchronized (this) {
+ for (BroadcastQueue queue : mBroadcastQueues) {
+ if (!queue.isIdle()) {
+ final String msg = "Waiting for queue " + queue + " to become idle...";
+ pw.println(msg);
+ pw.flush();
+ Slog.v(TAG, msg);
+ idle = false;
+ }
}
}
+
+ if (idle) {
+ final String msg = "All broadcast queues are idle!";
+ pw.println(msg);
+ pw.flush();
+ Slog.v(TAG, msg);
+ return;
+ } else {
+ SystemClock.sleep(1000);
+ }
}
+ }
- @Override
- public String toString() {
- return "{\"" + mTag + "\", acquire at " + TimeUtils.formatUptime(mAcquireTime) + "}";
+ /**
+ * Return the user id of the last resumed activity.
+ */
+ @Override
+ public @UserIdInt int getLastResumedActivityUserId() {
+ enforceCallingPermission(
+ permission.INTERACT_ACROSS_USERS_FULL, "getLastResumedActivityUserId()");
+ synchronized (this) {
+ if (mLastResumedActivity == null) {
+ return mUserController.getCurrentUserIdLocked();
+ }
+ return mLastResumedActivity.userId;
}
}
synchronized (ActivityManagerService.this) {
long origId = Binder.clearCallingIdentity();
try {
- if (!removeTaskByIdLocked(mTaskId, false)) {
+ // We remove the task from recents to preserve backwards
+ if (!mStackSupervisor.removeTaskByIdLocked(mTaskId, false,
+ REMOVE_FROM_RECENTS)) {
throw new IllegalArgumentException("Unable to find task ID " + mTaskId);
}
} finally {
public void moveToFront() {
checkCaller();
// Will bring task to front if it already has a root activity.
- startActivityFromRecentsInner(mTaskId, null);
+ final long origId = Binder.clearCallingIdentity();
+ try {
+ synchronized (this) {
+ mStackSupervisor.startActivityFromRecentsInner(mTaskId, null);
+ }
+ } finally {
+ Binder.restoreCallingIdentity(origId);
+ }
}
@Override
public int startActivity(IBinder whoThread, String callingPackage,
- Intent intent, String resolvedType, Bundle options) {
+ Intent intent, String resolvedType, Bundle bOptions) {
checkCaller();
int callingUser = UserHandle.getCallingUserId();
if (tr == null) {
throw new IllegalArgumentException("Unable to find task ID " + mTaskId);
}
- appThread = ApplicationThreadNative.asInterface(whoThread);
+ appThread = IApplicationThread.Stub.asInterface(whoThread);
if (appThread == null) {
throw new IllegalArgumentException("Bad app thread " + appThread);
}
}
- return mStackSupervisor.startActivityMayWait(appThread, -1, callingPackage, intent,
+ return mActivityStarter.startActivityMayWait(appThread, -1, callingPackage, intent,
resolvedType, null, null, null, null, 0, 0, null, null,
- null, options, false, callingUser, null, tr);
+ null, bOptions, false, callingUser, tr, "AppTaskImpl");
}
@Override
}
}
}
+
+ /**
+ * Kill processes for the user with id userId and that depend on the package named packageName
+ */
+ @Override
+ public void killPackageDependents(String packageName, int userId) {
+ enforceCallingPermission(android.Manifest.permission.KILL_UID, "killPackageDependents()");
+ if (packageName == null) {
+ throw new NullPointerException(
+ "Cannot kill the dependents of a package without its name.");
+ }
+
+ long callingId = Binder.clearCallingIdentity();
+ IPackageManager pm = AppGlobals.getPackageManager();
+ int pkgUid = -1;
+ try {
+ pkgUid = pm.getPackageUid(packageName, MATCH_DEBUG_TRIAGED_MISSING, userId);
+ } catch (RemoteException e) {
+ }
+ if (userId != UserHandle.USER_ALL && pkgUid == -1) {
+ throw new IllegalArgumentException(
+ "Cannot kill dependents of non-existing package " + packageName);
+ }
+ try {
+ synchronized(this) {
+ killPackageProcessesLocked(packageName, UserHandle.getAppId(pkgUid), userId,
+ ProcessList.FOREGROUND_APP_ADJ, false, true, true, false,
+ "dep: " + packageName);
+ }
+ } finally {
+ Binder.restoreCallingIdentity(callingId);
+ }
+ }
+
+ @Override
+ public void dismissKeyguard(IBinder token, IKeyguardDismissCallback callback)
+ throws RemoteException {
+ final long callingId = Binder.clearCallingIdentity();
+ try {
+ mKeyguardController.dismissKeyguard(token, callback);
+ } finally {
+ Binder.restoreCallingIdentity(callingId);
+ }
+ }
+
+ @Override
+ public int restartUserInBackground(final int userId) {
+ return mUserController.restartUser(userId, /* foreground */ false);
+ }
+
+ @Override
+ public void scheduleApplicationInfoChanged(List<String> packageNames, int userId) {
+ enforceCallingPermission(android.Manifest.permission.CHANGE_CONFIGURATION,
+ "scheduleApplicationInfoChanged()");
+
+ synchronized (this) {
+ final long origId = Binder.clearCallingIdentity();
+ try {
+ updateApplicationInfoLocked(packageNames, userId);
+ } finally {
+ Binder.restoreCallingIdentity(origId);
+ }
+ }
+ }
+
+ void updateApplicationInfoLocked(@NonNull List<String> packagesToUpdate, int userId) {
+ final boolean updateFrameworkRes = packagesToUpdate.contains("android");
+ for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
+ final ProcessRecord app = mLruProcesses.get(i);
+ if (app.thread == null) {
+ continue;
+ }
+
+ if (userId != UserHandle.USER_ALL && app.userId != userId) {
+ continue;
+ }
+
+ final int packageCount = app.pkgList.size();
+ for (int j = 0; j < packageCount; j++) {
+ final String packageName = app.pkgList.keyAt(j);
+ if (updateFrameworkRes || packagesToUpdate.contains(packageName)) {
+ try {
+ final ApplicationInfo ai = AppGlobals.getPackageManager()
+ .getApplicationInfo(packageName, STOCK_PM_FLAGS, app.userId);
+ if (ai != null) {
+ app.thread.scheduleApplicationInfoChanged(ai);
+ }
+ } catch (RemoteException e) {
+ Slog.w(TAG, String.format("Failed to update %s ApplicationInfo for %s",
+ packageName, app));
+ }
+ }
+ }
+ }
+ }
+
+ /**
+ * Attach an agent to the specified process (proces name or PID)
+ */
+ public void attachAgent(String process, String path) {
+ try {
+ synchronized (this) {
+ ProcessRecord proc = findProcessLocked(process, UserHandle.USER_SYSTEM, "attachAgent");
+ if (proc == null || proc.thread == null) {
+ throw new IllegalArgumentException("Unknown process: " + process);
+ }
+
+ boolean isDebuggable = "1".equals(SystemProperties.get(SYSTEM_DEBUGGABLE, "0"));
+ if (!isDebuggable) {
+ if ((proc.info.flags & ApplicationInfo.FLAG_DEBUGGABLE) == 0) {
+ throw new SecurityException("Process not debuggable: " + proc);
+ }
+ }
+
+ proc.thread.attachAgent(path);
+ }
+ } catch (RemoteException e) {
+ throw new IllegalStateException("Process disappeared");
+ }
+ }
+
+ @VisibleForTesting
+ public static class Injector {
+ private NetworkManagementInternal mNmi;
+
+ public Context getContext() {
+ return null;
+ }
+
+ public AppOpsService getAppOpsService(File file, Handler handler) {
+ return new AppOpsService(file, handler);
+ }
+
+ public Handler getUiHandler(ActivityManagerService service) {
+ return service.new UiHandler();
+ }
+
+ public boolean isNetworkRestrictedForUid(int uid) {
+ if (ensureHasNetworkManagementInternal()) {
+ return mNmi.isNetworkRestrictedForUid(uid);
+ }
+ return false;
+ }
+
+ private boolean ensureHasNetworkManagementInternal() {
+ if (mNmi == null) {
+ mNmi = LocalServices.getService(NetworkManagementInternal.class);
+ }
+ return mNmi != null;
+ }
+ }
+
+ @Override
+ public void setShowWhenLocked(IBinder token, boolean showWhenLocked)
+ throws RemoteException {
+ synchronized (this) {
+ final ActivityRecord r = ActivityRecord.isInStackLocked(token);
+ if (r == null) {
+ return;
+ }
+ final long origId = Binder.clearCallingIdentity();
+ try {
+ r.setShowWhenLocked(showWhenLocked);
+ } finally {
+ Binder.restoreCallingIdentity(origId);
+ }
+ }
+ }
+
+ @Override
+ public void setTurnScreenOn(IBinder token, boolean turnScreenOn) throws RemoteException {
+ synchronized (this) {
+ final ActivityRecord r = ActivityRecord.isInStackLocked(token);
+ if (r == null) {
+ return;
+ }
+ final long origId = Binder.clearCallingIdentity();
+ try {
+ r.setTurnScreenOn(turnScreenOn);
+ } finally {
+ Binder.restoreCallingIdentity(origId);
+ }
+ }
+ }
}