+++ /dev/null
-#
-# Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-ifeq (Makefile.conf,$(wildcard Makefile.conf))
-include Makefile.conf
-else
-dummy:
- @echo
- @echo "Please, run configure script as first..."
- @echo
-endif
-
-
-all: include/asoundlib.h
- $(MAKE) -C src
- $(MAKE) -C doc
- @echo
- @echo "ALSA library were sucessfully compiled."
- @echo
-
-include/asoundlib.h: include/header.h include/version.h include/error.h include/footer.h \
- include/control.h include/mixer.h include/pcm.h include/rawmidi.h
- cat include/header.h include/version.h include/error.h \
- include/control.h include/mixer.h \
- include/pcm.h include/rawmidi.h \
- include/footer.h > include/asoundlib.h
-
-install: all
- $(INSTALL) -m 755 -o root -g root -d ${aclocaldir}
- $(INSTALL) -m 755 -o root -g root aclocal.m4 ${aclocaldir}/alsa-lib.m4
- $(INSTALL) -m 755 -o root -g root -d ${includedir}/sys
- $(INSTALL) -m 644 -o root -g root include/asoundlib.h ${includedir}/sys
- $(INSTALL) -m 755 -o root -g root -d ${libdir}
- $(INSTALL) -m 644 -o root -g root lib/libasound.a ${libdir}
- $(LN_S) -f libasound.so.${SND_LIB_VERSION} ${libdir}/libasound.so
- $(LN_S) -f libasound.so.${SND_LIB_VERSION} ${libdir}/libasound.so.${SND_LIB_MAJOR}
- $(INSTALL) -m 644 -o root -g root lib/libasound.so.${SND_LIB_VERSION} ${libdir}
- /sbin/ldconfig
-
-clean:
- $(MAKE) -C include clean
- $(MAKE) -C src clean
- $(MAKE) -C test clean
- $(MAKE) -C doc clean
- $(MAKE) -C utils clean
- rm -f core .depend *.o *.orig *~
- rm -f `find . -name "out.txt"`
-
-mrproper: clean
- rm -f config.cache config.log config.status Makefile.conf \
- utils/alsa-lib.spec include/config.h include/version.h
-
-cvsclean: mrproper
- rm -f configure include/asoundlib.h
-
-pack: mrproper
- chown -R root.root ../alsa-lib
- mv ../alsa-lib ../alsa-lib-$(SND_LIB_VERSION)
- tar cvz -C .. -f ../alsa-lib-$(SND_LIB_VERSION).tar.gz alsa-lib-$(SND_LIB_VERSION)
- mv ../alsa-lib-$(SND_LIB_VERSION) ../alsa-lib
-
--- /dev/null
+SUBDIRS=doc include src test utils
+
+
+INCLUDES=-I$(top_srcdir)/include
+++ /dev/null
-#
-# Configuration Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-srcdir=@srcdir@
-VPATH=@srcdir@
-prefix=@prefix@
-exec_prefix=@exec_prefix@
-includedir=@includedir@
-libdir=@libdir@
-aclocaldir=/usr/share/aclocal
-c_opts=@CFLAGS@
-INSTALL=@INSTALL@
-SND_LIB_VERSION=@SND_LIB_VERSION@
-SND_LIB_MAJOR=@SND_LIB_MAJOR@
-SND_LIB_MINOR=@SND_LIB_MINOR@
-SND_LIB_SUBMINOR=@SND_LIB_SUBMINOR@
-
-CC=@CC@
-CPP=@CPP@
-INCLUDE=-I../include -I../../include
-COPTS = $(c_opts)
-COPTS += -Wall -Wstrict-prototypes -fomit-frame-pointer -pipe
-LINKER=ld
-LN_S=@LN_S@
--- /dev/null
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = .
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+SUBDIRS=doc include src test utils
+
+INCLUDES=-I$(top_srcdir)/include
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ./include/config.h
+CONFIG_CLEAN_FILES =
+DIST_COMMON = COPYING ChangeLog Makefile.am Makefile.in acinclude.m4 \
+aclocal.m4 config.guess config.sub configure.in install-sh ltconfig \
+ltmain.sh missing mkinstalldirs
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+all: all-recursive all-am
+
+.SUFFIXES:
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+ cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps Makefile
+
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ cd $(top_builddir) \
+ && CONFIG_FILES=$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+$(ACLOCAL_M4): configure.in acinclude.m4
+ cd $(srcdir) && $(ACLOCAL)
+
+config.status: $(srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+ $(SHELL) ./config.status --recheck
+$(srcdir)/configure: $(srcdir)/configure.in $(ACLOCAL_M4) $(CONFIGURE_DEPENDENCIES)
+ cd $(srcdir) && $(AUTOCONF)
+
+# This directory's subdirectories are mostly independent; you can cd
+# into them and run `make' without going through this Makefile.
+# To change the values of `make' variables: instead of editing Makefiles,
+# (1) if the variable is set in `config.status', edit `config.status'
+# (which will cause the Makefiles to be regenerated when you run `make');
+# (2) otherwise, pass the desired values on the `make' command line.
+
+@SET_MAKE@
+
+all-recursive install-data-recursive install-exec-recursive \
+installdirs-recursive install-recursive uninstall-recursive \
+check-recursive installcheck-recursive info-recursive dvi-recursive:
+ @set fnord $(MAKEFLAGS); amf=$$2; \
+ list='$(SUBDIRS)'; for subdir in $$list; do \
+ target=`echo $@ | sed s/-recursive//`; \
+ echo "Making $$target in $$subdir"; \
+ (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$target) \
+ || case "$$amf" in *=*) exit 1;; *k*) fail=yes;; *) exit 1;; esac; \
+ done && test -z "$$fail"
+
+mostlyclean-recursive clean-recursive distclean-recursive \
+maintainer-clean-recursive:
+ @set fnord $(MAKEFLAGS); amf=$$2; \
+ rev=''; list='$(SUBDIRS)'; for subdir in $$list; do \
+ rev="$$subdir $$rev"; \
+ done; \
+ for subdir in $$rev; do \
+ target=`echo $@ | sed s/-recursive//`; \
+ echo "Making $$target in $$subdir"; \
+ (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$target) \
+ || case "$$amf" in *=*) exit 1;; *k*) fail=yes;; *) exit 1;; esac; \
+ done && test -z "$$fail"
+tags-recursive:
+ list='$(SUBDIRS)'; for subdir in $$list; do \
+ (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) tags); \
+ done
+
+tags: TAGS
+
+ID: $(HEADERS) $(SOURCES) $(LISP)
+ here=`pwd` && cd $(srcdir) \
+ && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP)
+
+TAGS: tags-recursive $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP)
+ tags=; \
+ here=`pwd`; \
+ list='$(SUBDIRS)'; for subdir in $$list; do \
+ test -f $$subdir/TAGS && tags="$$tags -i $$here/$$subdir/TAGS"; \
+ done; \
+ list='$(SOURCES) $(HEADERS)'; \
+ unique=`for i in $$list; do echo $$i; done | \
+ awk ' { files[$$0] = 1; } \
+ END { for (i in files) print i; }'`; \
+ test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \
+ || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS)
+
+mostlyclean-tags:
+
+clean-tags:
+
+distclean-tags:
+ -rm -f TAGS ID
+
+maintainer-clean-tags:
+
+distdir = $(PACKAGE)-$(VERSION)
+top_distdir = $(distdir)
+
+# This target untars the dist file and tries a VPATH configuration. Then
+# it guarantees that the distribution is self-contained by making another
+# tarfile.
+distcheck: dist
+ -rm -rf $(distdir)
+ GZIP=$(GZIP) $(TAR) zxf $(distdir).tar.gz
+ mkdir $(distdir)/=build
+ mkdir $(distdir)/=inst
+ dc_install_base=`cd $(distdir)/=inst && pwd`; \
+ cd $(distdir)/=build \
+ && ../configure --srcdir=.. --prefix=$$dc_install_base \
+ && $(MAKE) $(AM_MAKEFLAGS) \
+ && $(MAKE) $(AM_MAKEFLAGS) dvi \
+ && $(MAKE) $(AM_MAKEFLAGS) check \
+ && $(MAKE) $(AM_MAKEFLAGS) install \
+ && $(MAKE) $(AM_MAKEFLAGS) installcheck \
+ && $(MAKE) $(AM_MAKEFLAGS) dist
+ -rm -rf $(distdir)
+ @echo "========================"; \
+ echo "$(distdir).tar.gz is ready for distribution"; \
+ echo "========================"
+dist: distdir
+ -chmod -R a+r $(distdir)
+ GZIP=$(GZIP) $(TAR) chozf $(distdir).tar.gz $(distdir)
+ -rm -rf $(distdir)
+dist-all: distdir
+ -chmod -R a+r $(distdir)
+ GZIP=$(GZIP) $(TAR) chozf $(distdir).tar.gz $(distdir)
+ -rm -rf $(distdir)
+distdir: $(DISTFILES)
+ -rm -rf $(distdir)
+ mkdir $(distdir)
+ -chmod 777 $(distdir)
+ @for file in $(DISTFILES); do \
+ d=$(srcdir); \
+ test -f $(distdir)/$$file \
+ || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+ || cp -p $$d/$$file $(distdir)/$$file; \
+ done
+ for subdir in $(SUBDIRS); do \
+ test -d $(distdir)/$$subdir \
+ || mkdir $(distdir)/$$subdir \
+ || exit 1; \
+ chmod 777 $(distdir)/$$subdir; \
+ (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) top_distdir=../$(distdir) distdir=../$(distdir)/$$subdir distdir) \
+ || exit 1; \
+ done
+info: info-recursive
+dvi: dvi-recursive
+check: all-am
+ $(MAKE) $(AM_MAKEFLAGS) check-recursive
+installcheck: installcheck-recursive
+all-am: Makefile
+
+install-exec: install-exec-recursive
+ @$(NORMAL_INSTALL)
+
+install-data: install-data-recursive
+ @$(NORMAL_INSTALL)
+
+install: install-recursive
+ @:
+
+uninstall: uninstall-recursive
+
+install-strip:
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs: installdirs-recursive
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -rm -f Makefile $(CONFIG_CLEAN_FILES)
+ -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean-am: mostlyclean-tags mostlyclean-generic
+
+clean-am: clean-tags clean-generic mostlyclean-am
+
+distclean-am: distclean-tags distclean-generic clean-am
+
+maintainer-clean-am: maintainer-clean-tags maintainer-clean-generic \
+ distclean-am
+
+mostlyclean: mostlyclean-recursive mostlyclean-am
+
+clean: clean-recursive clean-am
+
+distclean: distclean-recursive distclean-am
+ -rm -f config.status
+ -rm -f libtool
+
+maintainer-clean: maintainer-clean-recursive maintainer-clean-am
+ @echo "This command is intended for maintainers to use;"
+ @echo "it deletes files that may require special tools to rebuild."
+ -rm -f config.status
+
+.PHONY: install-data-recursive uninstall-data-recursive \
+install-exec-recursive uninstall-exec-recursive installdirs-recursive \
+uninstalldirs-recursive all-recursive check-recursive \
+installcheck-recursive info-recursive dvi-recursive \
+mostlyclean-recursive distclean-recursive clean-recursive \
+maintainer-clean-recursive tags tags-recursive mostlyclean-tags \
+distclean-tags clean-tags maintainer-clean-tags distdir info dvi \
+installcheck all-am install-exec install-data install uninstall all \
+installdirs mostlyclean-generic distclean-generic clean-generic \
+maintainer-clean-generic clean mostlyclean distclean maintainer-clean
+
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
--- /dev/null
+/* Package name */
+#undef PACKAGE
+
+/* Package version */
+#undef VERSION
+
+/* Sound library version string */
+#undef SND_LIB_VERSION
--- /dev/null
+dnl Configure Paths for Alsa
+dnl Christopher Lansdown (lansdoct@cs.alfred.edu)
+dnl 29/10/1998
+dnl AM_PATH_ALSA(MINIMUM-VERSION)
+dnl Test for libasound, and define ALSA_CFLAGS and ALSA_LIBS as appropriate.
+dnl enables arguments --with-alsa-prefix= --with-alsa-enc-prefix= --disable-alsatest
+dnl
+AC_DEFUN(AM_PATH_ALSA,
+[dnl
+dnl Get the clfags and libraries for alsa
+dnl
+AC_ARG_WITH(alsa-prefix,[ --with-alsa-prefix=PFX Prefix where Alsa library is installed(optional)],
+ [alsa_prefix="$withval"], [alsa_prefix=""])
+AC_ARG_WITH(alsa-inc-prefix, [ --with-alsa-inc-prefix=PFX Prefix where include libraries are (optional)],
+ [alsa_inc_prefix="$withval"], [alsa_inc_prefix=""])
+AC_ARG_ENABLE(alsatest, [ --disable-alsatest Do not try to compile and run a test Alsa program], [enable_alsatest=no], [enable_alsatest=yes])
+
+dnl Add any special include directories
+AC_MSG_CHECKING(for ALSA CFLAGS)
+if test "$alsa_inc_prefix" != "" ; then
+ ALSA_CFLAGS="$ALSA_CFLAGS -I$alsa_inc_prefix"
+ CFLAGS="-I$alsa_inc_prefix"
+fi
+AC_MSG_RESULT($ALSA_CFLAGS)
+
+dnl add any special lib dirs
+AC_MSG_CHECKING(for ALSA LDFLAGS)
+if test "$alsa_prefix" != "" ; then
+ ALSA_LIBS="$ALSA_LIBS -L$alsa_prefix"
+ LIBS="-L$alsa_prefix"
+fi
+
+dnl add the alsa library
+ALSA_LIBS="$ALSA_LIBS -lasound"
+LDFLAGS="$ALSA_LIBS -lasound"
+AC_MSG_RESULT($ALSA_LIBS)
+
+dnl Check for the presence of the library
+dnl if test $enable_alsatest = yes; then
+dnl AC_MSG_CHECKING(for working libasound)
+dnl AC_TRY_RUN([
+dnl #include <sys/asoundlib.h>
+dnl void main(void)
+dnl {
+dnl snd_cards();
+dnl exit(0);
+dnl }
+dnl ],
+dnl [AC_MSG_RESULT("present")],
+dnl [AC_MSG_RESULT("not found. ")
+dnl AC_MSG_ERROR(Fatal error: Install alsa-lib package or use --with-alsa-prefix option...)],
+dnl [AC_MSG_RESULT(unsopported)
+dnl AC_MSG_ERROR(Cross-compiling isn't supported...)]
+dnl )
+dnl fi
+
+dnl Check for a working version of libasound that is of the right version.
+min_alsa_version=ifelse([$1], ,0.1.1,$1)
+AC_MSG_CHECKING(for libasound headers version >= $min_alsa_version)
+no_alsa=""
+ alsa_min_major_version=`echo $min_alsa_version | \
+ sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\1/'`
+ alsa_min_minor_version=`echo $min_alsa_version | \
+ sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\2/'`
+ alsa_min_micro_version=`echo $min_alsa_version | \
+ sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\3/'`
+
+AC_TRY_COMPILE([
+#include <sys/asoundlib.h>
+], [
+void main(void)
+{
+# if(SOUNDLIB_VERSION_MAJOR > $alsa_min_major_version)
+ exit(0);
+# else
+# if(SOUNDLIB_VERSION_MAJOR < $alsa_min_major_version)
+# error not present
+# endif
+
+# if(SOUNDLIB_VERSION_MINOR > $alsa_min_minor_version)
+ exit(0);
+# else
+# if(SOUNDLIB_VERSION_MINOR < $alsa_min_minor_version)
+# error not present
+# endif
+
+# if(SOUNDLIB_VERSION_SUBMINOR < $alsa_min_micro_version)
+# error not present
+# endif
+# endif
+# endif
+exit(0);
+}
+],
+ [AC_MSG_RESULT(found.)],
+ [AC_MSG_RESULT(not present.)
+ AC_MSG_ERROR(Sufficiently new version of libasound not found.)]
+)
+
+dnl Now that we know that we have the right version, let's see if we have the library and not just the headers.
+AC_CHECK_LIB([asound], [snd_cards],,
+ [AC_MSG_ERROR(No linkable libasound was found.)]
+)
+
+dnl That should be it. Now just export out symbols:
+AC_SUBST(ALSA_CFLAGS)
+AC_SUBST(ALSA_LIBS)
+])
+
+dnl aclocal.m4 generated automatically by aclocal 1.3b
+
+dnl Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+dnl This file is free software; the Free Software Foundation
+dnl gives unlimited permission to copy and/or distribute it,
+dnl with or without modifications, as long as this notice is preserved.
+
+dnl This program is distributed in the hope that it will be useful,
+dnl but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+dnl even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+dnl PARTICULAR PURPOSE.
+
dnl Configure Paths for Alsa
dnl Christopher Lansdown (lansdoct@cs.alfred.edu)
dnl 29/10/1998
AC_SUBST(ALSA_LIBS)
])
+
+# Do all the work for Automake. This macro actually does too much --
+# some checks are only needed if your package does certain things.
+# But this isn't really a big deal.
+
+# serial 1
+
+dnl Usage:
+dnl AM_INIT_AUTOMAKE(package,version, [no-define])
+
+AC_DEFUN(AM_INIT_AUTOMAKE,
+[AC_REQUIRE([AM_PROG_INSTALL])
+PACKAGE=[$1]
+AC_SUBST(PACKAGE)
+VERSION=[$2]
+AC_SUBST(VERSION)
+dnl test to see if srcdir already configured
+if test "`cd $srcdir && pwd`" != "`pwd`" && test -f $srcdir/config.status; then
+ AC_MSG_ERROR([source directory already configured; run "make distclean" there first])
+fi
+ifelse([$3],,
+AC_DEFINE_UNQUOTED(PACKAGE, "$PACKAGE")
+AC_DEFINE_UNQUOTED(VERSION, "$VERSION"))
+AC_REQUIRE([AM_SANITY_CHECK])
+AC_REQUIRE([AC_ARG_PROGRAM])
+dnl FIXME This is truly gross.
+missing_dir=`cd $ac_aux_dir && pwd`
+AM_MISSING_PROG(ACLOCAL, aclocal, $missing_dir)
+AM_MISSING_PROG(AUTOCONF, autoconf, $missing_dir)
+AM_MISSING_PROG(AUTOMAKE, automake, $missing_dir)
+AM_MISSING_PROG(AUTOHEADER, autoheader, $missing_dir)
+AM_MISSING_PROG(MAKEINFO, makeinfo, $missing_dir)
+AC_REQUIRE([AC_PROG_MAKE_SET])])
+
+
+# serial 1
+
+AC_DEFUN(AM_PROG_INSTALL,
+[AC_REQUIRE([AC_PROG_INSTALL])
+test -z "$INSTALL_SCRIPT" && INSTALL_SCRIPT='${INSTALL_PROGRAM}'
+AC_SUBST(INSTALL_SCRIPT)dnl
+])
+
+#
+# Check to make sure that the build environment is sane.
+#
+
+AC_DEFUN(AM_SANITY_CHECK,
+[AC_MSG_CHECKING([whether build environment is sane])
+# Just in case
+sleep 1
+echo timestamp > conftestfile
+# Do `set' in a subshell so we don't clobber the current shell's
+# arguments. Must try -L first in case configure is actually a
+# symlink; some systems play weird games with the mod time of symlinks
+# (eg FreeBSD returns the mod time of the symlink's containing
+# directory).
+if (
+ set X `ls -Lt $srcdir/configure conftestfile 2> /dev/null`
+ if test "[$]*" = "X"; then
+ # -L didn't work.
+ set X `ls -t $srcdir/configure conftestfile`
+ fi
+ if test "[$]*" != "X $srcdir/configure conftestfile" \
+ && test "[$]*" != "X conftestfile $srcdir/configure"; then
+
+ # If neither matched, then we have a broken ls. This can happen
+ # if, for instance, CONFIG_SHELL is bash and it inherits a
+ # broken ls alias from the environment. This has actually
+ # happened. Such a system could not be considered "sane".
+ AC_MSG_ERROR([ls -t appears to fail. Make sure there is not a broken
+alias in your environment])
+ fi
+
+ test "[$]2" = conftestfile
+ )
+then
+ # Ok.
+ :
+else
+ AC_MSG_ERROR([newly created file is older than distributed files!
+Check your system clock])
+fi
+rm -f conftest*
+AC_MSG_RESULT(yes)])
+
+dnl AM_MISSING_PROG(NAME, PROGRAM, DIRECTORY)
+dnl The program must properly implement --version.
+AC_DEFUN(AM_MISSING_PROG,
+[AC_MSG_CHECKING(for working $2)
+# Run test in a subshell; some versions of sh will print an error if
+# an executable is not found, even if stderr is redirected.
+# Redirect stdin to placate older versions of autoconf. Sigh.
+if ($2 --version) < /dev/null > /dev/null 2>&1; then
+ $1=$2
+ AC_MSG_RESULT(found)
+else
+ $1="$3/missing $2"
+ AC_MSG_RESULT(missing)
+fi
+AC_SUBST($1)])
+
+
+# serial 25 AM_PROG_LIBTOOL
+AC_DEFUN(AM_PROG_LIBTOOL,
+[AC_REQUIRE([AM_ENABLE_SHARED])dnl
+AC_REQUIRE([AM_ENABLE_STATIC])dnl
+AC_REQUIRE([AC_CANONICAL_HOST])dnl
+AC_REQUIRE([AC_PROG_RANLIB])dnl
+AC_REQUIRE([AC_PROG_CC])dnl
+AC_REQUIRE([AM_PROG_LD])dnl
+AC_REQUIRE([AM_PROG_NM])dnl
+AC_REQUIRE([AC_PROG_LN_S])dnl
+dnl
+# Always use our own libtool.
+LIBTOOL='$(SHELL) $(top_builddir)/libtool'
+AC_SUBST(LIBTOOL)dnl
+
+# Check for any special flags to pass to ltconfig.
+libtool_flags=
+test "$enable_shared" = no && libtool_flags="$libtool_flags --disable-shared"
+test "$enable_static" = no && libtool_flags="$libtool_flags --disable-static"
+test "$silent" = yes && libtool_flags="$libtool_flags --silent"
+test "$ac_cv_prog_gcc" = yes && libtool_flags="$libtool_flags --with-gcc"
+test "$ac_cv_prog_gnu_ld" = yes && libtool_flags="$libtool_flags --with-gnu-ld"
+
+# Some flags need to be propagated to the compiler or linker for good
+# libtool support.
+case "$host" in
+*-*-irix6*)
+ # Find out which ABI we are using.
+ echo '[#]line __oline__ "configure"' > conftest.$ac_ext
+ if AC_TRY_EVAL(ac_compile); then
+ case "`/usr/bin/file conftest.o`" in
+ *32-bit*)
+ LD="${LD-ld} -32"
+ ;;
+ *N32*)
+ LD="${LD-ld} -n32"
+ ;;
+ *64-bit*)
+ LD="${LD-ld} -64"
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+
+*-*-sco3.2v5*)
+ # On SCO OpenServer 5, we need -belf to get full-featured binaries.
+ CFLAGS="$CFLAGS -belf"
+ ;;
+esac
+
+# Actually configure libtool. ac_aux_dir is where install-sh is found.
+CC="$CC" CFLAGS="$CFLAGS" CPPFLAGS="$CPPFLAGS" \
+LD="$LD" NM="$NM" RANLIB="$RANLIB" LN_S="$LN_S" \
+${CONFIG_SHELL-/bin/sh} $ac_aux_dir/ltconfig --no-reexec \
+$libtool_flags --no-verify $ac_aux_dir/ltmain.sh $host \
+|| AC_MSG_ERROR([libtool configure failed])
+
+# Redirect the config.log output again, so that the ltconfig log is not
+# clobbered by the next message.
+exec 5>>./config.log
+])
+
+# AM_ENABLE_SHARED - implement the --enable-shared flag
+# Usage: AM_ENABLE_SHARED[(DEFAULT)]
+# Where DEFAULT is either `yes' or `no'. If omitted, it defaults to
+# `yes'.
+AC_DEFUN(AM_ENABLE_SHARED,
+[define([AM_ENABLE_SHARED_DEFAULT], ifelse($1, no, no, yes))dnl
+AC_ARG_ENABLE(shared,
+changequote(<<, >>)dnl
+<< --enable-shared[=PKGS] build shared libraries [default=>>AM_ENABLE_SHARED_DEFAULT],
+changequote([, ])dnl
+[p=${PACKAGE-default}
+case "$enableval" in
+yes) enable_shared=yes ;;
+no) enable_shared=no ;;
+*)
+ enable_shared=no
+ # Look at the argument we got. We use all the common list separators.
+ IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:,"
+ for pkg in $enableval; do
+ if test "X$pkg" = "X$p"; then
+ enable_shared=yes
+ fi
+ done
+ IFS="$ac_save_ifs"
+ ;;
+esac],
+enable_shared=AM_ENABLE_SHARED_DEFAULT)dnl
+])
+
+# AM_DISABLE_SHARED - set the default shared flag to --disable-shared
+AC_DEFUN(AM_DISABLE_SHARED,
+[AM_ENABLE_SHARED(no)])
+
+# AM_DISABLE_STATIC - set the default static flag to --disable-static
+AC_DEFUN(AM_DISABLE_STATIC,
+[AM_ENABLE_STATIC(no)])
+
+# AM_ENABLE_STATIC - implement the --enable-static flag
+# Usage: AM_ENABLE_STATIC[(DEFAULT)]
+# Where DEFAULT is either `yes' or `no'. If omitted, it defaults to
+# `yes'.
+AC_DEFUN(AM_ENABLE_STATIC,
+[define([AM_ENABLE_STATIC_DEFAULT], ifelse($1, no, no, yes))dnl
+AC_ARG_ENABLE(static,
+changequote(<<, >>)dnl
+<< --enable-static[=PKGS] build static libraries [default=>>AM_ENABLE_STATIC_DEFAULT],
+changequote([, ])dnl
+[p=${PACKAGE-default}
+case "$enableval" in
+yes) enable_static=yes ;;
+no) enable_static=no ;;
+*)
+ enable_static=no
+ # Look at the argument we got. We use all the common list separators.
+ IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:,"
+ for pkg in $enableval; do
+ if test "X$pkg" = "X$p"; then
+ enable_static=yes
+ fi
+ done
+ IFS="$ac_save_ifs"
+ ;;
+esac],
+enable_static=AM_ENABLE_STATIC_DEFAULT)dnl
+])
+
+
+# AM_PROG_LD - find the path to the GNU or non-GNU linker
+AC_DEFUN(AM_PROG_LD,
+[AC_ARG_WITH(gnu-ld,
+[ --with-gnu-ld assume the C compiler uses GNU ld [default=no]],
+test "$withval" = no || with_gnu_ld=yes, with_gnu_ld=no)
+AC_REQUIRE([AC_PROG_CC])
+ac_prog=ld
+if test "$ac_cv_prog_gcc" = yes; then
+ # Check if gcc -print-prog-name=ld gives a path.
+ AC_MSG_CHECKING([for ld used by GCC])
+ ac_prog=`($CC -print-prog-name=ld) 2>&5`
+ case "$ac_prog" in
+ # Accept absolute paths.
+changequote(,)dnl
+ /* | [A-Za-z]:\\*)
+changequote([,])dnl
+ test -z "$LD" && LD="$ac_prog"
+ ;;
+ "")
+ # If it fails, then pretend we aren't using GCC.
+ ac_prog=ld
+ ;;
+ *)
+ # If it is relative, then search for the first ld in PATH.
+ with_gnu_ld=unknown
+ ;;
+ esac
+elif test "$with_gnu_ld" = yes; then
+ AC_MSG_CHECKING([for GNU ld])
+else
+ AC_MSG_CHECKING([for non-GNU ld])
+fi
+AC_CACHE_VAL(ac_cv_path_LD,
+[if test -z "$LD"; then
+ IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:"
+ for ac_dir in $PATH; do
+ test -z "$ac_dir" && ac_dir=.
+ if test -f "$ac_dir/$ac_prog"; then
+ ac_cv_path_LD="$ac_dir/$ac_prog"
+ # Check to see if the program is GNU ld. I'd rather use --version,
+ # but apparently some GNU ld's only accept -v.
+ # Break only if it was the GNU/non-GNU ld that we prefer.
+ if "$ac_cv_path_LD" -v 2>&1 < /dev/null | egrep '(GNU|with BFD)' > /dev/null; then
+ test "$with_gnu_ld" != no && break
+ else
+ test "$with_gnu_ld" != yes && break
+ fi
+ fi
+ done
+ IFS="$ac_save_ifs"
+else
+ ac_cv_path_LD="$LD" # Let the user override the test with a path.
+fi])
+LD="$ac_cv_path_LD"
+if test -n "$LD"; then
+ AC_MSG_RESULT($LD)
+else
+ AC_MSG_RESULT(no)
+fi
+test -z "$LD" && AC_MSG_ERROR([no acceptable ld found in \$PATH])
+AC_SUBST(LD)
+AM_PROG_LD_GNU
+])
+
+AC_DEFUN(AM_PROG_LD_GNU,
+[AC_CACHE_CHECK([if the linker ($LD) is GNU ld], ac_cv_prog_gnu_ld,
+[# I'd rather use --version here, but apparently some GNU ld's only accept -v.
+if $LD -v 2>&1 </dev/null | egrep '(GNU|with BFD)' 1>&5; then
+ ac_cv_prog_gnu_ld=yes
+else
+ ac_cv_prog_gnu_ld=no
+fi])
+])
+
+# AM_PROG_NM - find the path to a BSD-compatible name lister
+AC_DEFUN(AM_PROG_NM,
+[AC_MSG_CHECKING([for BSD-compatible nm])
+AC_CACHE_VAL(ac_cv_path_NM,
+[if test -n "$NM"; then
+ # Let the user override the test.
+ ac_cv_path_NM="$NM"
+else
+ IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:"
+ for ac_dir in /usr/ucb /usr/ccs/bin $PATH /bin; do
+ test -z "$ac_dir" && ac_dir=.
+ if test -f $ac_dir/nm; then
+ # Check to see if the nm accepts a BSD-compat flag.
+ # Adding the `sed 1q' prevents false positives on HP-UX, which says:
+ # nm: unknown option "B" ignored
+ if ($ac_dir/nm -B /dev/null 2>&1 | sed '1q'; exit 0) | egrep /dev/null >/dev/null; then
+ ac_cv_path_NM="$ac_dir/nm -B"
+ elif ($ac_dir/nm -p /dev/null 2>&1 | sed '1q'; exit 0) | egrep /dev/null >/dev/null; then
+ ac_cv_path_NM="$ac_dir/nm -p"
+ else
+ ac_cv_path_NM="$ac_dir/nm"
+ fi
+ break
+ fi
+ done
+ IFS="$ac_save_ifs"
+ test -z "$ac_cv_path_NM" && ac_cv_path_NM=nm
+fi])
+NM="$ac_cv_path_NM"
+AC_MSG_RESULT([$NM])
+AC_SUBST(NM)
+])
+
+# Like AC_CONFIG_HEADER, but automatically create stamp file.
+
+AC_DEFUN(AM_CONFIG_HEADER,
+[AC_PREREQ([2.12])
+AC_CONFIG_HEADER([$1])
+dnl When config.status generates a header, we must update the stamp-h file.
+dnl This file resides in the same directory as the config header
+dnl that is generated. We must strip everything past the first ":",
+dnl and everything past the last "/".
+AC_OUTPUT_COMMANDS(changequote(<<,>>)dnl
+ifelse(patsubst(<<$1>>, <<[^ ]>>, <<>>), <<>>,
+<<test -z "<<$>>CONFIG_HEADERS" || echo timestamp > patsubst(<<$1>>, <<^\([^:]*/\)?.*>>, <<\1>>)stamp-h<<>>dnl>>,
+<<am_indx=1
+for am_file in <<$1>>; do
+ case " <<$>>CONFIG_HEADERS " in
+ *" <<$>>am_file "*<<)>>
+ echo timestamp > `echo <<$>>am_file | sed -e 's%:.*%%' -e 's%[^/]*$%%'`stamp-h$am_indx
+ ;;
+ esac
+ am_indx=`expr "<<$>>am_indx" + 1`
+done<<>>dnl>>)
+changequote([,]))])
+
--- /dev/null
+#! /bin/sh
+# Attempt to guess a canonical system name.
+# Copyright (C) 1992, 93, 94, 95, 96, 97, 1998 Free Software Foundation, Inc.
+#
+# This file is free software; you can redistribute it and/or modify it
+# under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# Written by Per Bothner <bothner@cygnus.com>.
+# The master version of this file is at the FSF in /home/gd/gnu/lib.
+#
+# This script attempts to guess a canonical system name similar to
+# config.sub. If it succeeds, it prints the system name on stdout, and
+# exits with 0. Otherwise, it exits with 1.
+#
+# The plan is that this can be called by configure scripts if you
+# don't specify an explicit system type (host/target name).
+#
+# Only a few systems have been added to this list; please add others
+# (but try to keep the structure clean).
+#
+
+# This is needed to find uname on a Pyramid OSx when run in the BSD universe.
+# (ghazi@noc.rutgers.edu 8/24/94.)
+if (test -f /.attbin/uname) >/dev/null 2>&1 ; then
+ PATH=$PATH:/.attbin ; export PATH
+fi
+
+UNAME_MACHINE=`(uname -m) 2>/dev/null` || UNAME_MACHINE=unknown
+UNAME_RELEASE=`(uname -r) 2>/dev/null` || UNAME_RELEASE=unknown
+UNAME_SYSTEM=`(uname -s) 2>/dev/null` || UNAME_SYSTEM=unknown
+UNAME_VERSION=`(uname -v) 2>/dev/null` || UNAME_VERSION=unknown
+
+trap 'rm -f dummy.c dummy.o dummy; exit 1' 1 2 15
+
+# Note: order is significant - the case branches are not exclusive.
+
+case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in
+ alpha:OSF1:*:*)
+ if test $UNAME_RELEASE = "V4.0"; then
+ UNAME_RELEASE=`/usr/sbin/sizer -v | awk '{print $3}'`
+ fi
+ # A Vn.n version is a released version.
+ # A Tn.n version is a released field test version.
+ # A Xn.n version is an unreleased experimental baselevel.
+ # 1.2 uses "1.2" for uname -r.
+ cat <<EOF >dummy.s
+ .globl main
+ .ent main
+main:
+ .frame \$30,0,\$26,0
+ .prologue 0
+ .long 0x47e03d80 # implver $0
+ lda \$2,259
+ .long 0x47e20c21 # amask $2,$1
+ srl \$1,8,\$2
+ sll \$2,2,\$2
+ sll \$0,3,\$0
+ addl \$1,\$0,\$0
+ addl \$2,\$0,\$0
+ ret \$31,(\$26),1
+ .end main
+EOF
+ ${CC-cc} dummy.s -o dummy 2>/dev/null
+ if test "$?" = 0 ; then
+ ./dummy
+ case "$?" in
+ 7)
+ UNAME_MACHINE="alpha"
+ ;;
+ 15)
+ UNAME_MACHINE="alphaev5"
+ ;;
+ 14)
+ UNAME_MACHINE="alphaev56"
+ ;;
+ 10)
+ UNAME_MACHINE="alphapca56"
+ ;;
+ 16)
+ UNAME_MACHINE="alphaev6"
+ ;;
+ esac
+ fi
+ rm -f dummy.s dummy
+ echo ${UNAME_MACHINE}-dec-osf`echo ${UNAME_RELEASE} | sed -e 's/^[VTX]//' | tr [[A-Z]] [[a-z]]`
+ exit 0 ;;
+ 21064:Windows_NT:50:3)
+ echo alpha-dec-winnt3.5
+ exit 0 ;;
+ Amiga*:UNIX_System_V:4.0:*)
+ echo m68k-cbm-sysv4
+ exit 0;;
+ amiga:NetBSD:*:*)
+ echo m68k-cbm-netbsd${UNAME_RELEASE}
+ exit 0 ;;
+ amiga:OpenBSD:*:*)
+ echo m68k-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ arc64:OpenBSD:*:*)
+ echo mips64el-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ arc:OpenBSD:*:*)
+ echo mipsel-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ hkmips:OpenBSD:*:*)
+ echo mips-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ pmax:OpenBSD:*:*)
+ echo mipsel-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ sgi:OpenBSD:*:*)
+ echo mips-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ wgrisc:OpenBSD:*:*)
+ echo mipsel-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ arm:RISC*:1.[012]*:*|arm:riscix:1.[012]*:*)
+ echo arm-acorn-riscix${UNAME_RELEASE}
+ exit 0;;
+ arm32:NetBSD:*:*)
+ echo arm-unknown-netbsd`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'`
+ exit 0 ;;
+ SR2?01:HI-UX/MPP:*:*)
+ echo hppa1.1-hitachi-hiuxmpp
+ exit 0;;
+ Pyramid*:OSx*:*:*|MIS*:OSx*:*:*)
+ # akee@wpdis03.wpafb.af.mil (Earle F. Ake) contributed MIS and NILE.
+ if test "`(/bin/universe) 2>/dev/null`" = att ; then
+ echo pyramid-pyramid-sysv3
+ else
+ echo pyramid-pyramid-bsd
+ fi
+ exit 0 ;;
+ NILE:*:*:dcosx)
+ echo pyramid-pyramid-svr4
+ exit 0 ;;
+ sun4*:SunOS:5.*:* | tadpole*:SunOS:5.*:*)
+ echo sparc-sun-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit 0 ;;
+ i86pc:SunOS:5.*:*)
+ echo i386-pc-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit 0 ;;
+ sun4*:SunOS:6*:*)
+ # According to config.sub, this is the proper way to canonicalize
+ # SunOS6. Hard to guess exactly what SunOS6 will be like, but
+ # it's likely to be more like Solaris than SunOS4.
+ echo sparc-sun-solaris3`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit 0 ;;
+ sun4*:SunOS:*:*)
+ case "`/usr/bin/arch -k`" in
+ Series*|S4*)
+ UNAME_RELEASE=`uname -v`
+ ;;
+ esac
+ # Japanese Language versions have a version number like `4.1.3-JL'.
+ echo sparc-sun-sunos`echo ${UNAME_RELEASE}|sed -e 's/-/_/'`
+ exit 0 ;;
+ sun3*:SunOS:*:*)
+ echo m68k-sun-sunos${UNAME_RELEASE}
+ exit 0 ;;
+ sun*:*:4.2BSD:*)
+ UNAME_RELEASE=`(head -1 /etc/motd | awk '{print substr($5,1,3)}') 2>/dev/null`
+ test "x${UNAME_RELEASE}" = "x" && UNAME_RELEASE=3
+ case "`/bin/arch`" in
+ sun3)
+ echo m68k-sun-sunos${UNAME_RELEASE}
+ ;;
+ sun4)
+ echo sparc-sun-sunos${UNAME_RELEASE}
+ ;;
+ esac
+ exit 0 ;;
+ aushp:SunOS:*:*)
+ echo sparc-auspex-sunos${UNAME_RELEASE}
+ exit 0 ;;
+ atari*:NetBSD:*:*)
+ echo m68k-atari-netbsd${UNAME_RELEASE}
+ exit 0 ;;
+ atari*:OpenBSD:*:*)
+ echo m68k-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ sun3*:NetBSD:*:*)
+ echo m68k-sun-netbsd${UNAME_RELEASE}
+ exit 0 ;;
+ sun3*:OpenBSD:*:*)
+ echo m68k-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ mac68k:NetBSD:*:*)
+ echo m68k-apple-netbsd${UNAME_RELEASE}
+ exit 0 ;;
+ mac68k:OpenBSD:*:*)
+ echo m68k-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ mvme68k:OpenBSD:*:*)
+ echo m68k-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ mvme88k:OpenBSD:*:*)
+ echo m88k-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ powerpc:machten:*:*)
+ echo powerpc-apple-machten${UNAME_RELEASE}
+ exit 0 ;;
+ RISC*:Mach:*:*)
+ echo mips-dec-mach_bsd4.3
+ exit 0 ;;
+ RISC*:ULTRIX:*:*)
+ echo mips-dec-ultrix${UNAME_RELEASE}
+ exit 0 ;;
+ VAX*:ULTRIX*:*:*)
+ echo vax-dec-ultrix${UNAME_RELEASE}
+ exit 0 ;;
+ 2020:CLIX:*:*)
+ echo clipper-intergraph-clix${UNAME_RELEASE}
+ exit 0 ;;
+ mips:*:*:UMIPS | mips:*:*:RISCos)
+ sed 's/^ //' << EOF >dummy.c
+ int main (argc, argv) int argc; char **argv; {
+ #if defined (host_mips) && defined (MIPSEB)
+ #if defined (SYSTYPE_SYSV)
+ printf ("mips-mips-riscos%ssysv\n", argv[1]); exit (0);
+ #endif
+ #if defined (SYSTYPE_SVR4)
+ printf ("mips-mips-riscos%ssvr4\n", argv[1]); exit (0);
+ #endif
+ #if defined (SYSTYPE_BSD43) || defined(SYSTYPE_BSD)
+ printf ("mips-mips-riscos%sbsd\n", argv[1]); exit (0);
+ #endif
+ #endif
+ exit (-1);
+ }
+EOF
+ ${CC-cc} dummy.c -o dummy \
+ && ./dummy `echo "${UNAME_RELEASE}" | sed -n 's/\([0-9]*\).*/\1/p'` \
+ && rm dummy.c dummy && exit 0
+ rm -f dummy.c dummy
+ echo mips-mips-riscos${UNAME_RELEASE}
+ exit 0 ;;
+ Night_Hawk:Power_UNIX:*:*)
+ echo powerpc-harris-powerunix
+ exit 0 ;;
+ m88k:CX/UX:7*:*)
+ echo m88k-harris-cxux7
+ exit 0 ;;
+ m88k:*:4*:R4*)
+ echo m88k-motorola-sysv4
+ exit 0 ;;
+ m88k:*:3*:R3*)
+ echo m88k-motorola-sysv3
+ exit 0 ;;
+ AViiON:dgux:*:*)
+ # DG/UX returns AViiON for all architectures
+ UNAME_PROCESSOR=`/usr/bin/uname -p`
+ if [ $UNAME_PROCESSOR = mc88100 -o $UNAME_PROCESSOR = mc88110 ] ; then
+ if [ ${TARGET_BINARY_INTERFACE}x = m88kdguxelfx \
+ -o ${TARGET_BINARY_INTERFACE}x = x ] ; then
+ echo m88k-dg-dgux${UNAME_RELEASE}
+ else
+ echo m88k-dg-dguxbcs${UNAME_RELEASE}
+ fi
+ else echo i586-dg-dgux${UNAME_RELEASE}
+ fi
+ exit 0 ;;
+ M88*:DolphinOS:*:*) # DolphinOS (SVR3)
+ echo m88k-dolphin-sysv3
+ exit 0 ;;
+ M88*:*:R3*:*)
+ # Delta 88k system running SVR3
+ echo m88k-motorola-sysv3
+ exit 0 ;;
+ XD88*:*:*:*) # Tektronix XD88 system running UTekV (SVR3)
+ echo m88k-tektronix-sysv3
+ exit 0 ;;
+ Tek43[0-9][0-9]:UTek:*:*) # Tektronix 4300 system running UTek (BSD)
+ echo m68k-tektronix-bsd
+ exit 0 ;;
+ *:IRIX*:*:*)
+ echo mips-sgi-irix`echo ${UNAME_RELEASE}|sed -e 's/-/_/g'`
+ exit 0 ;;
+ ????????:AIX?:[12].1:2) # AIX 2.2.1 or AIX 2.1.1 is RT/PC AIX.
+ echo romp-ibm-aix # uname -m gives an 8 hex-code CPU id
+ exit 0 ;; # Note that: echo "'`uname -s`'" gives 'AIX '
+ i?86:AIX:*:*)
+ echo i386-ibm-aix
+ exit 0 ;;
+ *:AIX:2:3)
+ if grep bos325 /usr/include/stdio.h >/dev/null 2>&1; then
+ sed 's/^ //' << EOF >dummy.c
+ #include <sys/systemcfg.h>
+
+ main()
+ {
+ if (!__power_pc())
+ exit(1);
+ puts("powerpc-ibm-aix3.2.5");
+ exit(0);
+ }
+EOF
+ ${CC-cc} dummy.c -o dummy && ./dummy && rm dummy.c dummy && exit 0
+ rm -f dummy.c dummy
+ echo rs6000-ibm-aix3.2.5
+ elif grep bos324 /usr/include/stdio.h >/dev/null 2>&1; then
+ echo rs6000-ibm-aix3.2.4
+ else
+ echo rs6000-ibm-aix3.2
+ fi
+ exit 0 ;;
+ *:AIX:*:4)
+ if /usr/sbin/lsattr -EHl proc0 | grep POWER >/dev/null 2>&1; then
+ IBM_ARCH=rs6000
+ else
+ IBM_ARCH=powerpc
+ fi
+ if [ -x /usr/bin/oslevel ] ; then
+ IBM_REV=`/usr/bin/oslevel`
+ else
+ IBM_REV=4.${UNAME_RELEASE}
+ fi
+ echo ${IBM_ARCH}-ibm-aix${IBM_REV}
+ exit 0 ;;
+ *:AIX:*:*)
+ echo rs6000-ibm-aix
+ exit 0 ;;
+ ibmrt:4.4BSD:*|romp-ibm:BSD:*)
+ echo romp-ibm-bsd4.4
+ exit 0 ;;
+ ibmrt:*BSD:*|romp-ibm:BSD:*) # covers RT/PC NetBSD and
+ echo romp-ibm-bsd${UNAME_RELEASE} # 4.3 with uname added to
+ exit 0 ;; # report: romp-ibm BSD 4.3
+ *:BOSX:*:*)
+ echo rs6000-bull-bosx
+ exit 0 ;;
+ DPX/2?00:B.O.S.:*:*)
+ echo m68k-bull-sysv3
+ exit 0 ;;
+ 9000/[34]??:4.3bsd:1.*:*)
+ echo m68k-hp-bsd
+ exit 0 ;;
+ hp300:4.4BSD:*:* | 9000/[34]??:4.3bsd:2.*:*)
+ echo m68k-hp-bsd4.4
+ exit 0 ;;
+ 9000/[3478]??:HP-UX:*:*)
+ case "${UNAME_MACHINE}" in
+ 9000/31? ) HP_ARCH=m68000 ;;
+ 9000/[34]?? ) HP_ARCH=m68k ;;
+ 9000/7?? | 9000/8?[1679] ) HP_ARCH=hppa1.1 ;;
+ 9000/8?? ) HP_ARCH=hppa1.0 ;;
+ esac
+ HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'`
+ echo ${HP_ARCH}-hp-hpux${HPUX_REV}
+ exit 0 ;;
+ 3050*:HI-UX:*:*)
+ sed 's/^ //' << EOF >dummy.c
+ #include <unistd.h>
+ int
+ main ()
+ {
+ long cpu = sysconf (_SC_CPU_VERSION);
+ /* The order matters, because CPU_IS_HP_MC68K erroneously returns
+ true for CPU_PA_RISC1_0. CPU_IS_PA_RISC returns correct
+ results, however. */
+ if (CPU_IS_PA_RISC (cpu))
+ {
+ switch (cpu)
+ {
+ case CPU_PA_RISC1_0: puts ("hppa1.0-hitachi-hiuxwe2"); break;
+ case CPU_PA_RISC1_1: puts ("hppa1.1-hitachi-hiuxwe2"); break;
+ case CPU_PA_RISC2_0: puts ("hppa2.0-hitachi-hiuxwe2"); break;
+ default: puts ("hppa-hitachi-hiuxwe2"); break;
+ }
+ }
+ else if (CPU_IS_HP_MC68K (cpu))
+ puts ("m68k-hitachi-hiuxwe2");
+ else puts ("unknown-hitachi-hiuxwe2");
+ exit (0);
+ }
+EOF
+ ${CC-cc} dummy.c -o dummy && ./dummy && rm dummy.c dummy && exit 0
+ rm -f dummy.c dummy
+ echo unknown-hitachi-hiuxwe2
+ exit 0 ;;
+ 9000/7??:4.3bsd:*:* | 9000/8?[79]:4.3bsd:*:* )
+ echo hppa1.1-hp-bsd
+ exit 0 ;;
+ 9000/8??:4.3bsd:*:*)
+ echo hppa1.0-hp-bsd
+ exit 0 ;;
+ hp7??:OSF1:*:* | hp8?[79]:OSF1:*:* )
+ echo hppa1.1-hp-osf
+ exit 0 ;;
+ hp8??:OSF1:*:*)
+ echo hppa1.0-hp-osf
+ exit 0 ;;
+ i?86:OSF1:*:*)
+ if [ -x /usr/sbin/sysversion ] ; then
+ echo ${UNAME_MACHINE}-unknown-osf1mk
+ else
+ echo ${UNAME_MACHINE}-unknown-osf1
+ fi
+ exit 0 ;;
+ parisc*:Lites*:*:*)
+ echo hppa1.1-hp-lites
+ exit 0 ;;
+ C1*:ConvexOS:*:* | convex:ConvexOS:C1*:*)
+ echo c1-convex-bsd
+ exit 0 ;;
+ C2*:ConvexOS:*:* | convex:ConvexOS:C2*:*)
+ if getsysinfo -f scalar_acc
+ then echo c32-convex-bsd
+ else echo c2-convex-bsd
+ fi
+ exit 0 ;;
+ C34*:ConvexOS:*:* | convex:ConvexOS:C34*:*)
+ echo c34-convex-bsd
+ exit 0 ;;
+ C38*:ConvexOS:*:* | convex:ConvexOS:C38*:*)
+ echo c38-convex-bsd
+ exit 0 ;;
+ C4*:ConvexOS:*:* | convex:ConvexOS:C4*:*)
+ echo c4-convex-bsd
+ exit 0 ;;
+ CRAY*X-MP:*:*:*)
+ echo xmp-cray-unicos
+ exit 0 ;;
+ CRAY*Y-MP:*:*:*)
+ echo ymp-cray-unicos${UNAME_RELEASE}
+ exit 0 ;;
+ CRAY*[A-Z]90:*:*:*)
+ echo ${UNAME_MACHINE}-cray-unicos${UNAME_RELEASE} \
+ | sed -e 's/CRAY.*\([A-Z]90\)/\1/' \
+ -e y/ABCDEFGHIJKLMNOPQRSTUVWXYZ/abcdefghijklmnopqrstuvwxyz/
+ exit 0 ;;
+ CRAY*TS:*:*:*)
+ echo t90-cray-unicos${UNAME_RELEASE}
+ exit 0 ;;
+ CRAY-2:*:*:*)
+ echo cray2-cray-unicos
+ exit 0 ;;
+ F300:UNIX_System_V:*:*)
+ FUJITSU_SYS=`uname -p | tr [A-Z] [a-z] | sed -e 's/\///'`
+ FUJITSU_REL=`echo ${UNAME_RELEASE} | sed -e 's/ /_/'`
+ echo "f300-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}"
+ exit 0 ;;
+ F301:UNIX_System_V:*:*)
+ echo f301-fujitsu-uxpv`echo $UNAME_RELEASE | sed 's/ .*//'`
+ exit 0 ;;
+ hp3[0-9][05]:NetBSD:*:*)
+ echo m68k-hp-netbsd${UNAME_RELEASE}
+ exit 0 ;;
+ hp300:OpenBSD:*:*)
+ echo m68k-unknown-openbsd${UNAME_RELEASE}
+ exit 0 ;;
+ i?86:BSD/386:*:* | *:BSD/OS:*:*)
+ echo ${UNAME_MACHINE}-pc-bsdi${UNAME_RELEASE}
+ exit 0 ;;
+ *:FreeBSD:*:*)
+ echo ${UNAME_MACHINE}-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'`
+ exit 0 ;;
+ *:NetBSD:*:*)
+ echo ${UNAME_MACHINE}-unknown-netbsd`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'`
+ exit 0 ;;
+ *:OpenBSD:*:*)
+ echo ${UNAME_MACHINE}-unknown-openbsd`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'`
+ exit 0 ;;
+ i*:CYGWIN*:*)
+ echo ${UNAME_MACHINE}-pc-cygwin32
+ exit 0 ;;
+ i*:MINGW*:*)
+ echo ${UNAME_MACHINE}-pc-mingw32
+ exit 0 ;;
+ p*:CYGWIN*:*)
+ echo powerpcle-unknown-cygwin32
+ exit 0 ;;
+ prep*:SunOS:5.*:*)
+ echo powerpcle-unknown-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit 0 ;;
+ *:GNU:*:*)
+ echo `echo ${UNAME_MACHINE}|sed -e 's,[-/].*$,,'`-unknown-gnu`echo ${UNAME_RELEASE}|sed -e 's,/.*$,,'`
+ exit 0 ;;
+ *:Linux:*:*)
+ # uname on the ARM produces all sorts of strangeness, and we need to
+ # filter it out.
+ case "$UNAME_MACHINE" in
+ arm* | sa110*) UNAME_MACHINE="arm" ;;
+ esac
+
+ # The BFD linker knows what the default object file format is, so
+ # first see if it will tell us.
+ ld_help_string=`ld --help 2>&1`
+ ld_supported_emulations=`echo $ld_help_string \
+ | sed -ne '/supported emulations:/!d
+ s/[ ][ ]*/ /g
+ s/.*supported emulations: *//
+ s/ .*//
+ p'`
+ case "$ld_supported_emulations" in
+ i?86linux) echo "${UNAME_MACHINE}-pc-linux-gnuaout" ; exit 0 ;;
+ i?86coff) echo "${UNAME_MACHINE}-pc-linux-gnucoff" ; exit 0 ;;
+ sparclinux) echo "${UNAME_MACHINE}-unknown-linux-gnuaout" ; exit 0 ;;
+ armlinux) echo "${UNAME_MACHINE}-unknown-linux-gnuaout" ; exit 0 ;;
+ m68klinux) echo "${UNAME_MACHINE}-unknown-linux-gnuaout" ; exit 0 ;;
+ elf32ppc) echo "powerpc-unknown-linux-gnu" ; exit 0 ;;
+ esac
+
+ if test "${UNAME_MACHINE}" = "alpha" ; then
+ sed 's/^ //' <<EOF >dummy.s
+ .globl main
+ .ent main
+ main:
+ .frame \$30,0,\$26,0
+ .prologue 0
+ .long 0x47e03d80 # implver $0
+ lda \$2,259
+ .long 0x47e20c21 # amask $2,$1
+ srl \$1,8,\$2
+ sll \$2,2,\$2
+ sll \$0,3,\$0
+ addl \$1,\$0,\$0
+ addl \$2,\$0,\$0
+ ret \$31,(\$26),1
+ .end main
+EOF
+ LIBC=""
+ ${CC-cc} dummy.s -o dummy 2>/dev/null
+ if test "$?" = 0 ; then
+ ./dummy
+ case "$?" in
+ 7)
+ UNAME_MACHINE="alpha"
+ ;;
+ 15)
+ UNAME_MACHINE="alphaev5"
+ ;;
+ 14)
+ UNAME_MACHINE="alphaev56"
+ ;;
+ 10)
+ UNAME_MACHINE="alphapca56"
+ ;;
+ 16)
+ UNAME_MACHINE="alphaev6"
+ ;;
+ esac
+
+ objdump --private-headers dummy | \
+ grep ld.so.1 > /dev/null
+ if test "$?" = 0 ; then
+ LIBC="libc1"
+ fi
+ fi
+ rm -f dummy.s dummy
+ echo ${UNAME_MACHINE}-unknown-linux-gnu${LIBC} ; exit 0
+ elif test "${UNAME_MACHINE}" = "mips" ; then
+ cat >dummy.c <<EOF
+main(argc, argv)
+ int argc;
+ char *argv[];
+{
+#ifdef __MIPSEB__
+ printf ("%s-unknown-linux-gnu\n", argv[1]);
+#endif
+#ifdef __MIPSEL__
+ printf ("%sel-unknown-linux-gnu\n", argv[1]);
+#endif
+ return 0;
+}
+EOF
+ ${CC-cc} dummy.c -o dummy 2>/dev/null && ./dummy "${UNAME_MACHINE}" && rm dummy.c dummy && exit 0
+ rm -f dummy.c dummy
+ else
+ # Either a pre-BFD a.out linker (linux-gnuoldld)
+ # or one that does not give us useful --help.
+ # GCC wants to distinguish between linux-gnuoldld and linux-gnuaout.
+ # If ld does not provide *any* "supported emulations:"
+ # that means it is gnuoldld.
+ echo "$ld_help_string" | grep >/dev/null 2>&1 "supported emulations:"
+ test $? != 0 && echo "${UNAME_MACHINE}-pc-linux-gnuoldld" && exit 0
+
+ case "${UNAME_MACHINE}" in
+ i?86)
+ VENDOR=pc;
+ ;;
+ *)
+ VENDOR=unknown;
+ ;;
+ esac
+ # Determine whether the default compiler is a.out or elf
+ cat >dummy.c <<EOF
+#include <features.h>
+main(argc, argv)
+ int argc;
+ char *argv[];
+{
+#ifdef __ELF__
+# ifdef __GLIBC__
+# if __GLIBC__ >= 2
+ printf ("%s-${VENDOR}-linux-gnu\n", argv[1]);
+# else
+ printf ("%s-${VENDOR}-linux-gnulibc1\n", argv[1]);
+# endif
+# else
+ printf ("%s-${VENDOR}-linux-gnulibc1\n", argv[1]);
+# endif
+#else
+ printf ("%s-${VENDOR}-linux-gnuaout\n", argv[1]);
+#endif
+ return 0;
+}
+EOF
+ ${CC-cc} dummy.c -o dummy 2>/dev/null && ./dummy "${UNAME_MACHINE}" && rm dummy.c dummy && exit 0
+ rm -f dummy.c dummy
+ fi ;;
+# ptx 4.0 does uname -s correctly, with DYNIX/ptx in there. earlier versions
+# are messed up and put the nodename in both sysname and nodename.
+ i?86:DYNIX/ptx:4*:*)
+ echo i386-sequent-sysv4
+ exit 0 ;;
+ i?86:UNIX_SV:4.2MP:2.*)
+ # Unixware is an offshoot of SVR4, but it has its own version
+ # number series starting with 2...
+ # I am not positive that other SVR4 systems won't match this,
+ # I just have to hope. -- rms.
+ # Use sysv4.2uw... so that sysv4* matches it.
+ echo ${UNAME_MACHINE}-pc-sysv4.2uw${UNAME_VERSION}
+ exit 0 ;;
+ i?86:*:4.*:* | i?86:SYSTEM_V:4.*:*)
+ if grep Novell /usr/include/link.h >/dev/null 2>/dev/null; then
+ echo ${UNAME_MACHINE}-univel-sysv${UNAME_RELEASE}
+ else
+ echo ${UNAME_MACHINE}-pc-sysv${UNAME_RELEASE}
+ fi
+ exit 0 ;;
+ i?86:*:3.2:*)
+ if test -f /usr/options/cb.name; then
+ UNAME_REL=`sed -n 's/.*Version //p' </usr/options/cb.name`
+ echo ${UNAME_MACHINE}-pc-isc$UNAME_REL
+ elif /bin/uname -X 2>/dev/null >/dev/null ; then
+ UNAME_REL=`(/bin/uname -X|egrep Release|sed -e 's/.*= //')`
+ (/bin/uname -X|egrep i80486 >/dev/null) && UNAME_MACHINE=i486
+ (/bin/uname -X|egrep '^Machine.*Pentium' >/dev/null) \
+ && UNAME_MACHINE=i586
+ echo ${UNAME_MACHINE}-pc-sco$UNAME_REL
+ else
+ echo ${UNAME_MACHINE}-pc-sysv32
+ fi
+ exit 0 ;;
+ pc:*:*:*)
+ # uname -m prints for DJGPP always 'pc', but it prints nothing about
+ # the processor, so we play safe by assuming i386.
+ echo i386-pc-msdosdjgpp
+ exit 0 ;;
+ Intel:Mach:3*:*)
+ echo i386-pc-mach3
+ exit 0 ;;
+ paragon:*:*:*)
+ echo i860-intel-osf1
+ exit 0 ;;
+ i860:*:4.*:*) # i860-SVR4
+ if grep Stardent /usr/include/sys/uadmin.h >/dev/null 2>&1 ; then
+ echo i860-stardent-sysv${UNAME_RELEASE} # Stardent Vistra i860-SVR4
+ else # Add other i860-SVR4 vendors below as they are discovered.
+ echo i860-unknown-sysv${UNAME_RELEASE} # Unknown i860-SVR4
+ fi
+ exit 0 ;;
+ mini*:CTIX:SYS*5:*)
+ # "miniframe"
+ echo m68010-convergent-sysv
+ exit 0 ;;
+ M68*:*:R3V[567]*:*)
+ test -r /sysV68 && echo 'm68k-motorola-sysv' && exit 0 ;;
+ 3[34]??:*:4.0:3.0 | 3[34]??,*:*:4.0:3.0 | 4850:*:4.0:3.0)
+ OS_REL=''
+ test -r /etc/.relid \
+ && OS_REL=.`sed -n 's/[^ ]* [^ ]* \([0-9][0-9]\).*/\1/p' < /etc/.relid`
+ /bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+ && echo i486-ncr-sysv4.3${OS_REL} && exit 0
+ /bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \
+ && echo i586-ncr-sysv4.3${OS_REL} && exit 0 ;;
+ 3[34]??:*:4.0:* | 3[34]??,*:*:4.0:*)
+ /bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+ && echo i486-ncr-sysv4 && exit 0 ;;
+ m68*:LynxOS:2.*:*)
+ echo m68k-unknown-lynxos${UNAME_RELEASE}
+ exit 0 ;;
+ mc68030:UNIX_System_V:4.*:*)
+ echo m68k-atari-sysv4
+ exit 0 ;;
+ i?86:LynxOS:2.*:*)
+ echo i386-unknown-lynxos${UNAME_RELEASE}
+ exit 0 ;;
+ TSUNAMI:LynxOS:2.*:*)
+ echo sparc-unknown-lynxos${UNAME_RELEASE}
+ exit 0 ;;
+ rs6000:LynxOS:2.*:* | PowerPC:LynxOS:2.*:*)
+ echo rs6000-unknown-lynxos${UNAME_RELEASE}
+ exit 0 ;;
+ SM[BE]S:UNIX_SV:*:*)
+ echo mips-dde-sysv${UNAME_RELEASE}
+ exit 0 ;;
+ RM*:SINIX-*:*:*)
+ echo mips-sni-sysv4
+ exit 0 ;;
+ *:SINIX-*:*:*)
+ if uname -p 2>/dev/null >/dev/null ; then
+ UNAME_MACHINE=`(uname -p) 2>/dev/null`
+ echo ${UNAME_MACHINE}-sni-sysv4
+ else
+ echo ns32k-sni-sysv
+ fi
+ exit 0 ;;
+ PENTIUM:CPunix:4.0*:*) # Unisys `ClearPath HMP IX 4000' SVR4/MP effort
+ # says <Richard.M.Bartel@ccMail.Census.GOV>
+ echo i586-unisys-sysv4
+ exit 0 ;;
+ *:UNIX_System_V:4*:FTX*)
+ # From Gerald Hewes <hewes@openmarket.com>.
+ # How about differentiating between stratus architectures? -djm
+ echo hppa1.1-stratus-sysv4
+ exit 0 ;;
+ *:*:*:FTX*)
+ # From seanf@swdc.stratus.com.
+ echo i860-stratus-sysv4
+ exit 0 ;;
+ mc68*:A/UX:*:*)
+ echo m68k-apple-aux${UNAME_RELEASE}
+ exit 0 ;;
+ news*:NEWS-OS:*:6*)
+ echo mips-sony-newsos6
+ exit 0 ;;
+ R3000:*System_V*:*:* | R4000:UNIX_SYSV:*:*)
+ if [ -d /usr/nec ]; then
+ echo mips-nec-sysv${UNAME_RELEASE}
+ else
+ echo mips-unknown-sysv${UNAME_RELEASE}
+ fi
+ exit 0 ;;
+esac
+
+#echo '(No uname command or uname output not recognized.)' 1>&2
+#echo "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" 1>&2
+
+cat >dummy.c <<EOF
+#ifdef _SEQUENT_
+# include <sys/types.h>
+# include <sys/utsname.h>
+#endif
+main ()
+{
+#if defined (sony)
+#if defined (MIPSEB)
+ /* BFD wants "bsd" instead of "newsos". Perhaps BFD should be changed,
+ I don't know.... */
+ printf ("mips-sony-bsd\n"); exit (0);
+#else
+#include <sys/param.h>
+ printf ("m68k-sony-newsos%s\n",
+#ifdef NEWSOS4
+ "4"
+#else
+ ""
+#endif
+ ); exit (0);
+#endif
+#endif
+
+#if defined (__arm) && defined (__acorn) && defined (__unix)
+ printf ("arm-acorn-riscix"); exit (0);
+#endif
+
+#if defined (hp300) && !defined (hpux)
+ printf ("m68k-hp-bsd\n"); exit (0);
+#endif
+
+#if defined (NeXT)
+#if !defined (__ARCHITECTURE__)
+#define __ARCHITECTURE__ "m68k"
+#endif
+ int version;
+ version=`(hostinfo | sed -n 's/.*NeXT Mach \([0-9]*\).*/\1/p') 2>/dev/null`;
+ printf ("%s-next-nextstep%d\n", __ARCHITECTURE__, version);
+ exit (0);
+#endif
+
+#if defined (MULTIMAX) || defined (n16)
+#if defined (UMAXV)
+ printf ("ns32k-encore-sysv\n"); exit (0);
+#else
+#if defined (CMU)
+ printf ("ns32k-encore-mach\n"); exit (0);
+#else
+ printf ("ns32k-encore-bsd\n"); exit (0);
+#endif
+#endif
+#endif
+
+#if defined (__386BSD__)
+ printf ("i386-pc-bsd\n"); exit (0);
+#endif
+
+#if defined (sequent)
+#if defined (i386)
+ printf ("i386-sequent-dynix\n"); exit (0);
+#endif
+#if defined (ns32000)
+ printf ("ns32k-sequent-dynix\n"); exit (0);
+#endif
+#endif
+
+#if defined (_SEQUENT_)
+ struct utsname un;
+
+ uname(&un);
+
+ if (strncmp(un.version, "V2", 2) == 0) {
+ printf ("i386-sequent-ptx2\n"); exit (0);
+ }
+ if (strncmp(un.version, "V1", 2) == 0) { /* XXX is V1 correct? */
+ printf ("i386-sequent-ptx1\n"); exit (0);
+ }
+ printf ("i386-sequent-ptx\n"); exit (0);
+
+#endif
+
+#if defined (vax)
+#if !defined (ultrix)
+ printf ("vax-dec-bsd\n"); exit (0);
+#else
+ printf ("vax-dec-ultrix\n"); exit (0);
+#endif
+#endif
+
+#if defined (alliant) && defined (i860)
+ printf ("i860-alliant-bsd\n"); exit (0);
+#endif
+
+ exit (1);
+}
+EOF
+
+${CC-cc} dummy.c -o dummy 2>/dev/null && ./dummy && rm dummy.c dummy && exit 0
+rm -f dummy.c dummy
+
+# Apollos put the system type in the environment.
+
+test -d /usr/apollo && { echo ${ISP}-apollo-${SYSTYPE}; exit 0; }
+
+# Convex versions that predate uname can use getsysinfo(1)
+
+if [ -x /usr/convex/getsysinfo ]
+then
+ case `getsysinfo -f cpu_type` in
+ c1*)
+ echo c1-convex-bsd
+ exit 0 ;;
+ c2*)
+ if getsysinfo -f scalar_acc
+ then echo c32-convex-bsd
+ else echo c2-convex-bsd
+ fi
+ exit 0 ;;
+ c34*)
+ echo c34-convex-bsd
+ exit 0 ;;
+ c38*)
+ echo c38-convex-bsd
+ exit 0 ;;
+ c4*)
+ echo c4-convex-bsd
+ exit 0 ;;
+ esac
+fi
+
+#echo '(Unable to guess system type)' 1>&2
+
+exit 1
--- /dev/null
+#! /bin/sh
+# Configuration validation subroutine script, version 1.1.
+# Copyright (C) 1991, 92-97, 1998 Free Software Foundation, Inc.
+# This file is (in principle) common to ALL GNU software.
+# The presence of a machine in this file suggests that SOME GNU software
+# can handle that machine. It does not imply ALL GNU software can.
+#
+# This file is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place - Suite 330,
+# Boston, MA 02111-1307, USA.
+
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# Configuration subroutine to validate and canonicalize a configuration type.
+# Supply the specified configuration type as an argument.
+# If it is invalid, we print an error message on stderr and exit with code 1.
+# Otherwise, we print the canonical config type on stdout and succeed.
+
+# This file is supposed to be the same for all GNU packages
+# and recognize all the CPU types, system types and aliases
+# that are meaningful with *any* GNU software.
+# Each package is responsible for reporting which valid configurations
+# it does not support. The user should be able to distinguish
+# a failure to support a valid configuration from a meaningless
+# configuration.
+
+# The goal of this file is to map all the various variations of a given
+# machine specification into a single specification in the form:
+# CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM
+# or in some cases, the newer four-part form:
+# CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM
+# It is wrong to echo any other type of specification.
+
+if [ x$1 = x ]
+then
+ echo Configuration name missing. 1>&2
+ echo "Usage: $0 CPU-MFR-OPSYS" 1>&2
+ echo "or $0 ALIAS" 1>&2
+ echo where ALIAS is a recognized configuration type. 1>&2
+ exit 1
+fi
+
+# First pass through any local machine types.
+case $1 in
+ *local*)
+ echo $1
+ exit 0
+ ;;
+ *)
+ ;;
+esac
+
+# Separate what the user gave into CPU-COMPANY and OS or KERNEL-OS (if any).
+# Here we must recognize all the valid KERNEL-OS combinations.
+maybe_os=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\2/'`
+case $maybe_os in
+ linux-gnu*)
+ os=-$maybe_os
+ basic_machine=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\1/'`
+ ;;
+ *)
+ basic_machine=`echo $1 | sed 's/-[^-]*$//'`
+ if [ $basic_machine != $1 ]
+ then os=`echo $1 | sed 's/.*-/-/'`
+ else os=; fi
+ ;;
+esac
+
+### Let's recognize common machines as not being operating systems so
+### that things like config.sub decstation-3100 work. We also
+### recognize some manufacturers as not being operating systems, so we
+### can provide default operating systems below.
+case $os in
+ -sun*os*)
+ # Prevent following clause from handling this invalid input.
+ ;;
+ -dec* | -mips* | -sequent* | -encore* | -pc532* | -sgi* | -sony* | \
+ -att* | -7300* | -3300* | -delta* | -motorola* | -sun[234]* | \
+ -unicom* | -ibm* | -next | -hp | -isi* | -apollo | -altos* | \
+ -convergent* | -ncr* | -news | -32* | -3600* | -3100* | -hitachi* |\
+ -c[123]* | -convex* | -sun | -crds | -omron* | -dg | -ultra | -tti* | \
+ -harris | -dolphin | -highlevel | -gould | -cbm | -ns | -masscomp | \
+ -apple)
+ os=
+ basic_machine=$1
+ ;;
+ -hiux*)
+ os=-hiuxwe2
+ ;;
+ -sco5)
+ os=sco3.2v5
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco4)
+ os=-sco3.2v4
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco3.2.[4-9]*)
+ os=`echo $os | sed -e 's/sco3.2./sco3.2v/'`
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco3.2v[4-9]*)
+ # Don't forget version if it is 3.2v4 or newer.
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco*)
+ os=-sco3.2v2
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -isc)
+ os=-isc2.2
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -clix*)
+ basic_machine=clipper-intergraph
+ ;;
+ -isc*)
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -lynx*)
+ os=-lynxos
+ ;;
+ -ptx*)
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-sequent/'`
+ ;;
+ -windowsnt*)
+ os=`echo $os | sed -e 's/windowsnt/winnt/'`
+ ;;
+ -psos*)
+ os=-psos
+ ;;
+esac
+
+# Decode aliases for certain CPU-COMPANY combinations.
+case $basic_machine in
+ # Recognize the basic CPU types without company name.
+ # Some are omitted here because they have special meanings below.
+ tahoe | i860 | m32r | m68k | m68000 | m88k | ns32k | arc | arm \
+ | arme[lb] | pyramid | mn10200 | mn10300 \
+ | tron | a29k | 580 | i960 | h8300 | hppa | hppa1.0 | hppa1.1 \
+ | alpha | alphaev5 | alphaev56 | we32k | ns16k | clipper \
+ | i370 | sh | powerpc | powerpcle | 1750a | dsp16xx | pdp11 \
+ | mips64 | mipsel | mips64el | mips64orion | mips64orionel \
+ | mipstx39 | mipstx39el \
+ | sparc | sparclet | sparclite | sparc64 | v850)
+ basic_machine=$basic_machine-unknown
+ ;;
+ # We use `pc' rather than `unknown'
+ # because (1) that's what they normally are, and
+ # (2) the word "unknown" tends to confuse beginning users.
+ i[34567]86)
+ basic_machine=$basic_machine-pc
+ ;;
+ # Object if more than one company name word.
+ *-*-*)
+ echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2
+ exit 1
+ ;;
+ # Recognize the basic CPU types with company name.
+ vax-* | tahoe-* | i[34567]86-* | i860-* | m32r-* | m68k-* | m68000-* \
+ | m88k-* | sparc-* | ns32k-* | fx80-* | arc-* | arm-* | c[123]* \
+ | mips-* | pyramid-* | tron-* | a29k-* | romp-* | rs6000-* \
+ | power-* | none-* | 580-* | cray2-* | h8300-* | i960-* \
+ | xmp-* | ymp-* | hppa-* | hppa1.0-* | hppa1.1-* \
+ | alpha-* | alphaev5-* | alphaev56-* | we32k-* | cydra-* \
+ | ns16k-* | pn-* | np1-* | xps100-* | clipper-* | orion-* \
+ | sparclite-* | pdp11-* | sh-* | powerpc-* | powerpcle-* \
+ | sparc64-* | mips64-* | mipsel-* \
+ | mips64el-* | mips64orion-* | mips64orionel-* \
+ | mipstx39-* | mipstx39el-* \
+ | f301-*)
+ ;;
+ # Recognize the various machine names and aliases which stand
+ # for a CPU type and a company and sometimes even an OS.
+ 3b1 | 7300 | 7300-att | att-7300 | pc7300 | safari | unixpc)
+ basic_machine=m68000-att
+ ;;
+ 3b*)
+ basic_machine=we32k-att
+ ;;
+ alliant | fx80)
+ basic_machine=fx80-alliant
+ ;;
+ altos | altos3068)
+ basic_machine=m68k-altos
+ ;;
+ am29k)
+ basic_machine=a29k-none
+ os=-bsd
+ ;;
+ amdahl)
+ basic_machine=580-amdahl
+ os=-sysv
+ ;;
+ amiga | amiga-*)
+ basic_machine=m68k-cbm
+ ;;
+ amigaos | amigados)
+ basic_machine=m68k-cbm
+ os=-amigaos
+ ;;
+ amigaunix | amix)
+ basic_machine=m68k-cbm
+ os=-sysv4
+ ;;
+ apollo68)
+ basic_machine=m68k-apollo
+ os=-sysv
+ ;;
+ aux)
+ basic_machine=m68k-apple
+ os=-aux
+ ;;
+ balance)
+ basic_machine=ns32k-sequent
+ os=-dynix
+ ;;
+ convex-c1)
+ basic_machine=c1-convex
+ os=-bsd
+ ;;
+ convex-c2)
+ basic_machine=c2-convex
+ os=-bsd
+ ;;
+ convex-c32)
+ basic_machine=c32-convex
+ os=-bsd
+ ;;
+ convex-c34)
+ basic_machine=c34-convex
+ os=-bsd
+ ;;
+ convex-c38)
+ basic_machine=c38-convex
+ os=-bsd
+ ;;
+ cray | ymp)
+ basic_machine=ymp-cray
+ os=-unicos
+ ;;
+ cray2)
+ basic_machine=cray2-cray
+ os=-unicos
+ ;;
+ [ctj]90-cray)
+ basic_machine=c90-cray
+ os=-unicos
+ ;;
+ crds | unos)
+ basic_machine=m68k-crds
+ ;;
+ da30 | da30-*)
+ basic_machine=m68k-da30
+ ;;
+ decstation | decstation-3100 | pmax | pmax-* | pmin | dec3100 | decstatn)
+ basic_machine=mips-dec
+ ;;
+ delta | 3300 | motorola-3300 | motorola-delta \
+ | 3300-motorola | delta-motorola)
+ basic_machine=m68k-motorola
+ ;;
+ delta88)
+ basic_machine=m88k-motorola
+ os=-sysv3
+ ;;
+ dpx20 | dpx20-*)
+ basic_machine=rs6000-bull
+ os=-bosx
+ ;;
+ dpx2* | dpx2*-bull)
+ basic_machine=m68k-bull
+ os=-sysv3
+ ;;
+ ebmon29k)
+ basic_machine=a29k-amd
+ os=-ebmon
+ ;;
+ elxsi)
+ basic_machine=elxsi-elxsi
+ os=-bsd
+ ;;
+ encore | umax | mmax)
+ basic_machine=ns32k-encore
+ ;;
+ fx2800)
+ basic_machine=i860-alliant
+ ;;
+ genix)
+ basic_machine=ns32k-ns
+ ;;
+ gmicro)
+ basic_machine=tron-gmicro
+ os=-sysv
+ ;;
+ h3050r* | hiux*)
+ basic_machine=hppa1.1-hitachi
+ os=-hiuxwe2
+ ;;
+ h8300hms)
+ basic_machine=h8300-hitachi
+ os=-hms
+ ;;
+ harris)
+ basic_machine=m88k-harris
+ os=-sysv3
+ ;;
+ hp300-*)
+ basic_machine=m68k-hp
+ ;;
+ hp300bsd)
+ basic_machine=m68k-hp
+ os=-bsd
+ ;;
+ hp300hpux)
+ basic_machine=m68k-hp
+ os=-hpux
+ ;;
+ hp9k2[0-9][0-9] | hp9k31[0-9])
+ basic_machine=m68000-hp
+ ;;
+ hp9k3[2-9][0-9])
+ basic_machine=m68k-hp
+ ;;
+ hp9k7[0-9][0-9] | hp7[0-9][0-9] | hp9k8[0-9]7 | hp8[0-9]7)
+ basic_machine=hppa1.1-hp
+ ;;
+ hp9k8[0-9][0-9] | hp8[0-9][0-9])
+ basic_machine=hppa1.0-hp
+ ;;
+ hppa-next)
+ os=-nextstep3
+ ;;
+ i370-ibm* | ibm*)
+ basic_machine=i370-ibm
+ os=-mvs
+ ;;
+# I'm not sure what "Sysv32" means. Should this be sysv3.2?
+ i[34567]86v32)
+ basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+ os=-sysv32
+ ;;
+ i[34567]86v4*)
+ basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+ os=-sysv4
+ ;;
+ i[34567]86v)
+ basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+ os=-sysv
+ ;;
+ i[34567]86sol2)
+ basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+ os=-solaris2
+ ;;
+ iris | iris4d)
+ basic_machine=mips-sgi
+ case $os in
+ -irix*)
+ ;;
+ *)
+ os=-irix4
+ ;;
+ esac
+ ;;
+ isi68 | isi)
+ basic_machine=m68k-isi
+ os=-sysv
+ ;;
+ m88k-omron*)
+ basic_machine=m88k-omron
+ ;;
+ magnum | m3230)
+ basic_machine=mips-mips
+ os=-sysv
+ ;;
+ merlin)
+ basic_machine=ns32k-utek
+ os=-sysv
+ ;;
+ miniframe)
+ basic_machine=m68000-convergent
+ ;;
+ mipsel*-linux*)
+ basic_machine=mipsel-unknown
+ os=-linux-gnu
+ ;;
+ mips*-linux*)
+ basic_machine=mips-unknown
+ os=-linux-gnu
+ ;;
+ mips3*-*)
+ basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`
+ ;;
+ mips3*)
+ basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`-unknown
+ ;;
+ ncr3000)
+ basic_machine=i486-ncr
+ os=-sysv4
+ ;;
+ news | news700 | news800 | news900)
+ basic_machine=m68k-sony
+ os=-newsos
+ ;;
+ news1000)
+ basic_machine=m68030-sony
+ os=-newsos
+ ;;
+ news-3600 | risc-news)
+ basic_machine=mips-sony
+ os=-newsos
+ ;;
+ next | m*-next )
+ basic_machine=m68k-next
+ case $os in
+ -nextstep* )
+ ;;
+ -ns2*)
+ os=-nextstep2
+ ;;
+ *)
+ os=-nextstep3
+ ;;
+ esac
+ ;;
+ nh3000)
+ basic_machine=m68k-harris
+ os=-cxux
+ ;;
+ nh[45]000)
+ basic_machine=m88k-harris
+ os=-cxux
+ ;;
+ nindy960)
+ basic_machine=i960-intel
+ os=-nindy
+ ;;
+ np1)
+ basic_machine=np1-gould
+ ;;
+ pa-hitachi)
+ basic_machine=hppa1.1-hitachi
+ os=-hiuxwe2
+ ;;
+ paragon)
+ basic_machine=i860-intel
+ os=-osf
+ ;;
+ pbd)
+ basic_machine=sparc-tti
+ ;;
+ pbb)
+ basic_machine=m68k-tti
+ ;;
+ pc532 | pc532-*)
+ basic_machine=ns32k-pc532
+ ;;
+ pentium | p5 | k5 | nexen)
+ basic_machine=i586-pc
+ ;;
+ pentiumpro | p6 | k6 | 6x86)
+ basic_machine=i686-pc
+ ;;
+ pentiumii | pentium2)
+ basic_machine=i786-pc
+ ;;
+ pentium-* | p5-* | k5-* | nexen-*)
+ basic_machine=i586-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ pentiumpro-* | p6-* | k6-* | 6x86-*)
+ basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ pentiumii-* | pentium2-*)
+ basic_machine=i786-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ pn)
+ basic_machine=pn-gould
+ ;;
+ power) basic_machine=rs6000-ibm
+ ;;
+ ppc) basic_machine=powerpc-unknown
+ ;;
+ ppc-*) basic_machine=powerpc-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ ppcle | powerpclittle | ppc-le | powerpc-little)
+ basic_machine=powerpcle-unknown
+ ;;
+ ppcle-* | powerpclittle-*)
+ basic_machine=powerpcle-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ ps2)
+ basic_machine=i386-ibm
+ ;;
+ rm[46]00)
+ basic_machine=mips-siemens
+ ;;
+ rtpc | rtpc-*)
+ basic_machine=romp-ibm
+ ;;
+ sequent)
+ basic_machine=i386-sequent
+ ;;
+ sh)
+ basic_machine=sh-hitachi
+ os=-hms
+ ;;
+ sps7)
+ basic_machine=m68k-bull
+ os=-sysv2
+ ;;
+ spur)
+ basic_machine=spur-unknown
+ ;;
+ sun2)
+ basic_machine=m68000-sun
+ ;;
+ sun2os3)
+ basic_machine=m68000-sun
+ os=-sunos3
+ ;;
+ sun2os4)
+ basic_machine=m68000-sun
+ os=-sunos4
+ ;;
+ sun3os3)
+ basic_machine=m68k-sun
+ os=-sunos3
+ ;;
+ sun3os4)
+ basic_machine=m68k-sun
+ os=-sunos4
+ ;;
+ sun4os3)
+ basic_machine=sparc-sun
+ os=-sunos3
+ ;;
+ sun4os4)
+ basic_machine=sparc-sun
+ os=-sunos4
+ ;;
+ sun4sol2)
+ basic_machine=sparc-sun
+ os=-solaris2
+ ;;
+ sun3 | sun3-*)
+ basic_machine=m68k-sun
+ ;;
+ sun4)
+ basic_machine=sparc-sun
+ ;;
+ sun386 | sun386i | roadrunner)
+ basic_machine=i386-sun
+ ;;
+ symmetry)
+ basic_machine=i386-sequent
+ os=-dynix
+ ;;
+ tx39)
+ basic_machine=mipstx39-unknown
+ ;;
+ tx39el)
+ basic_machine=mipstx39el-unknown
+ ;;
+ tower | tower-32)
+ basic_machine=m68k-ncr
+ ;;
+ udi29k)
+ basic_machine=a29k-amd
+ os=-udi
+ ;;
+ ultra3)
+ basic_machine=a29k-nyu
+ os=-sym1
+ ;;
+ vaxv)
+ basic_machine=vax-dec
+ os=-sysv
+ ;;
+ vms)
+ basic_machine=vax-dec
+ os=-vms
+ ;;
+ vpp*|vx|vx-*)
+ basic_machine=f301-fujitsu
+ ;;
+ vxworks960)
+ basic_machine=i960-wrs
+ os=-vxworks
+ ;;
+ vxworks68)
+ basic_machine=m68k-wrs
+ os=-vxworks
+ ;;
+ vxworks29k)
+ basic_machine=a29k-wrs
+ os=-vxworks
+ ;;
+ xmp)
+ basic_machine=xmp-cray
+ os=-unicos
+ ;;
+ xps | xps100)
+ basic_machine=xps100-honeywell
+ ;;
+ none)
+ basic_machine=none-none
+ os=-none
+ ;;
+
+# Here we handle the default manufacturer of certain CPU types. It is in
+# some cases the only manufacturer, in others, it is the most popular.
+ mips)
+ if [ x$os = x-linux-gnu ]; then
+ basic_machine=mips-unknown
+ else
+ basic_machine=mips-mips
+ fi
+ ;;
+ romp)
+ basic_machine=romp-ibm
+ ;;
+ rs6000)
+ basic_machine=rs6000-ibm
+ ;;
+ vax)
+ basic_machine=vax-dec
+ ;;
+ pdp11)
+ basic_machine=pdp11-dec
+ ;;
+ we32k)
+ basic_machine=we32k-att
+ ;;
+ sparc)
+ basic_machine=sparc-sun
+ ;;
+ cydra)
+ basic_machine=cydra-cydrome
+ ;;
+ orion)
+ basic_machine=orion-highlevel
+ ;;
+ orion105)
+ basic_machine=clipper-highlevel
+ ;;
+ *)
+ echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2
+ exit 1
+ ;;
+esac
+
+# Here we canonicalize certain aliases for manufacturers.
+case $basic_machine in
+ *-digital*)
+ basic_machine=`echo $basic_machine | sed 's/digital.*/dec/'`
+ ;;
+ *-commodore*)
+ basic_machine=`echo $basic_machine | sed 's/commodore.*/cbm/'`
+ ;;
+ *)
+ ;;
+esac
+
+# Decode manufacturer-specific aliases for certain operating systems.
+
+if [ x"$os" != x"" ]
+then
+case $os in
+ # First match some system type aliases
+ # that might get confused with valid system types.
+ # -solaris* is a basic system type, with this one exception.
+ -solaris1 | -solaris1.*)
+ os=`echo $os | sed -e 's|solaris1|sunos4|'`
+ ;;
+ -solaris)
+ os=-solaris2
+ ;;
+ -svr4*)
+ os=-sysv4
+ ;;
+ -unixware*)
+ os=-sysv4.2uw
+ ;;
+ -gnu/linux*)
+ os=`echo $os | sed -e 's|gnu/linux|linux-gnu|'`
+ ;;
+ # First accept the basic system types.
+ # The portable systems comes first.
+ # Each alternative MUST END IN A *, to match a version number.
+ # -sysv* is not here because it comes later, after sysvr4.
+ -gnu* | -bsd* | -mach* | -minix* | -genix* | -ultrix* | -irix* \
+ | -*vms* | -sco* | -esix* | -isc* | -aix* | -sunos | -sunos[34]*\
+ | -hpux* | -unos* | -osf* | -luna* | -dgux* | -solaris* | -sym* \
+ | -amigaos* | -amigados* | -msdos* | -newsos* | -unicos* | -aof* \
+ | -aos* \
+ | -nindy* | -vxsim* | -vxworks* | -ebmon* | -hms* | -mvs* \
+ | -clix* | -riscos* | -uniplus* | -iris* | -rtu* | -xenix* \
+ | -hiux* | -386bsd* | -netbsd* | -openbsd* | -freebsd* | -riscix* \
+ | -lynxos* | -bosx* | -nextstep* | -cxux* | -aout* | -elf* \
+ | -ptx* | -coff* | -ecoff* | -winnt* | -domain* | -vsta* \
+ | -udi* | -eabi* | -lites* | -ieee* | -go32* | -aux* \
+ | -cygwin32* | -pe* | -psos* | -moss* | -proelf* | -rtems* \
+ | -mingw32* | -linux-gnu* | -uxpv*)
+ # Remember, each alternative MUST END IN *, to match a version number.
+ ;;
+ -linux*)
+ os=`echo $os | sed -e 's|linux|linux-gnu|'`
+ ;;
+ -sunos5*)
+ os=`echo $os | sed -e 's|sunos5|solaris2|'`
+ ;;
+ -sunos6*)
+ os=`echo $os | sed -e 's|sunos6|solaris3|'`
+ ;;
+ -osfrose*)
+ os=-osfrose
+ ;;
+ -osf*)
+ os=-osf
+ ;;
+ -utek*)
+ os=-bsd
+ ;;
+ -dynix*)
+ os=-bsd
+ ;;
+ -acis*)
+ os=-aos
+ ;;
+ -ctix* | -uts*)
+ os=-sysv
+ ;;
+ -ns2 )
+ os=-nextstep2
+ ;;
+ # Preserve the version number of sinix5.
+ -sinix5.*)
+ os=`echo $os | sed -e 's|sinix|sysv|'`
+ ;;
+ -sinix*)
+ os=-sysv4
+ ;;
+ -triton*)
+ os=-sysv3
+ ;;
+ -oss*)
+ os=-sysv3
+ ;;
+ -svr4)
+ os=-sysv4
+ ;;
+ -svr3)
+ os=-sysv3
+ ;;
+ -sysvr4)
+ os=-sysv4
+ ;;
+ # This must come after -sysvr4.
+ -sysv*)
+ ;;
+ -xenix)
+ os=-xenix
+ ;;
+ -none)
+ ;;
+ *)
+ # Get rid of the `-' at the beginning of $os.
+ os=`echo $os | sed 's/[^-]*-//'`
+ echo Invalid configuration \`$1\': system \`$os\' not recognized 1>&2
+ exit 1
+ ;;
+esac
+else
+
+# Here we handle the default operating systems that come with various machines.
+# The value should be what the vendor currently ships out the door with their
+# machine or put another way, the most popular os provided with the machine.
+
+# Note that if you're going to try to match "-MANUFACTURER" here (say,
+# "-sun"), then you have to tell the case statement up towards the top
+# that MANUFACTURER isn't an operating system. Otherwise, code above
+# will signal an error saying that MANUFACTURER isn't an operating
+# system, and we'll never get to this point.
+
+case $basic_machine in
+ *-acorn)
+ os=-riscix1.2
+ ;;
+ arm*-semi)
+ os=-aout
+ ;;
+ pdp11-*)
+ os=-none
+ ;;
+ *-dec | vax-*)
+ os=-ultrix4.2
+ ;;
+ m68*-apollo)
+ os=-domain
+ ;;
+ i386-sun)
+ os=-sunos4.0.2
+ ;;
+ m68000-sun)
+ os=-sunos3
+ # This also exists in the configure program, but was not the
+ # default.
+ # os=-sunos4
+ ;;
+ *-tti) # must be before sparc entry or we get the wrong os.
+ os=-sysv3
+ ;;
+ sparc-* | *-sun)
+ os=-sunos4.1.1
+ ;;
+ *-ibm)
+ os=-aix
+ ;;
+ *-hp)
+ os=-hpux
+ ;;
+ *-hitachi)
+ os=-hiux
+ ;;
+ i860-* | *-att | *-ncr | *-altos | *-motorola | *-convergent)
+ os=-sysv
+ ;;
+ *-cbm)
+ os=-amigaos
+ ;;
+ *-dg)
+ os=-dgux
+ ;;
+ *-dolphin)
+ os=-sysv3
+ ;;
+ m68k-ccur)
+ os=-rtu
+ ;;
+ m88k-omron*)
+ os=-luna
+ ;;
+ *-next )
+ os=-nextstep
+ ;;
+ *-sequent)
+ os=-ptx
+ ;;
+ *-crds)
+ os=-unos
+ ;;
+ *-ns)
+ os=-genix
+ ;;
+ i370-*)
+ os=-mvs
+ ;;
+ *-next)
+ os=-nextstep3
+ ;;
+ *-gould)
+ os=-sysv
+ ;;
+ *-highlevel)
+ os=-bsd
+ ;;
+ *-encore)
+ os=-bsd
+ ;;
+ *-sgi)
+ os=-irix
+ ;;
+ *-siemens)
+ os=-sysv4
+ ;;
+ *-masscomp)
+ os=-rtu
+ ;;
+ f301-fujitsu)
+ os=-uxpv
+ ;;
+ *)
+ os=-none
+ ;;
+esac
+fi
+
+# Here we handle the case where we know the os, and the CPU type, but not the
+# manufacturer. We pick the logical manufacturer.
+vendor=unknown
+case $basic_machine in
+ *-unknown)
+ case $os in
+ -riscix*)
+ vendor=acorn
+ ;;
+ -sunos*)
+ vendor=sun
+ ;;
+ -aix*)
+ vendor=ibm
+ ;;
+ -hpux*)
+ vendor=hp
+ ;;
+ -hiux*)
+ vendor=hitachi
+ ;;
+ -unos*)
+ vendor=crds
+ ;;
+ -dgux*)
+ vendor=dg
+ ;;
+ -luna*)
+ vendor=omron
+ ;;
+ -genix*)
+ vendor=ns
+ ;;
+ -mvs*)
+ vendor=ibm
+ ;;
+ -ptx*)
+ vendor=sequent
+ ;;
+ -vxsim* | -vxworks*)
+ vendor=wrs
+ ;;
+ -aux*)
+ vendor=apple
+ ;;
+ esac
+ basic_machine=`echo $basic_machine | sed "s/unknown/$vendor/"`
+ ;;
+esac
+
+echo $basic_machine$os
dnl Process this file with autoconf to produce a configure script.
+AC_INIT(src/control/control.c)
+AM_INIT_AUTOMAKE(alsa-lib, 0.1.2)
-AC_INIT(Makefile.conf.in)
AC_PREFIX_DEFAULT(/usr)
dnl Checks for programs.
AC_PROG_CC
-AC_PROG_RANLIB
AC_PROG_INSTALL
AC_PROG_LN_S
+AM_PROG_LIBTOOL
dnl Checks for header files.
AC_HEADER_STDC
-AC_CONFIG_HEADER(include/config.h)
+AM_CONFIG_HEADER(include/config.h)
AC_CHECK_HEADERS(linux/asound.h)
dnl Checks for typedefs, structures, and compiler characteristics.
dnl Checks for library functions.
AC_PROG_GCC_TRADITIONAL
-dnl Check for ALSA driver package.
-myprefix=$prefix
-if test "$myprefix" = "NONE"; then
- myprefix=$ac_default_prefix
-fi
-CFLAGS="-I$myprefix/include"
-#echo "CFLAGS=$CFLAGS"
-AC_MSG_CHECKING(for alsa-driver package)
-AC_TRY_RUN([
-#include <linux/asound.h>
-void main(void)
-{
-#if !defined( SND_PROTOCOL_VERSION ) || !defined( SND_PROTOCOL_UNCOMPATIBLE )
- exit(1);
-#else
- exit(0);
-#endif
-}
-],
- AC_MSG_RESULT("present"),
- AC_MSG_RESULT("not found"); echo "Fatal error: Install alsa-driver v0.2.0pre6+ package at first..."; exit 1;,
- AC_MSG_RESULT("not supported"); echo "Fatal error: Cross-compiling isn't supported..."; exit 1;,
-)
+AM_PATH_ALSA
-dnl Check for version...
-AC_MSG_CHECKING(for library version)
-SND_LIB_VERSION=`cat $srcdir/version`
-AC_DEFINE_UNQUOTED(SND_LIB_VERSION, "$SND_LIB_VERSION")
-AC_SUBST(SND_LIB_VERSION)
-SND_LIB_MAJOR=`echo $SND_LIB_VERSION | cut -d . -f 1`
-AC_SUBST(SND_LIB_MAJOR)
-SND_LIB_MINOR=`echo $SND_LIB_VERSION | cut -d . -f 2`
-AC_SUBST(SND_LIB_MINOR)
-SND_LIB_SUBMINOR=`echo $SND_LIB_VERSION | cut -d . -f 3`
-AC_SUBST(SND_LIB_SUBMINOR)
-AC_MSG_RESULT($SND_LIB_VERSION)
-
-AC_OUTPUT(Makefile.conf include/version.h utils/alsa-lib.spec)
+AC_OUTPUT(Makefile doc/Makefile include/Makefile src/Makefile \
+ src/control/Makefile src/mixer/Makefile src/pcm/Makefile \
+ src/rawmidi/Makefile test/Makefile utils/Makefile include/version.h \
+ utils/alsa-lib.spec)
+++ /dev/null
-#
-# Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-include ../Makefile.conf
-
-TARGETS=soundapi.txt \
- soundapi.html
-
-all: $(TARGETS)
-
-soundapi.txt: soundapi.sgml
- sgml2txt soundapi.sgml
-
-soundapi.html: soundapi.sgml
- sgml2html soundapi.sgml
-
-clean:
- rm -f core .depend *.orig *~
--- /dev/null
+
+
+INCLUDES=-I$(top_srcdir)/include
--- /dev/null
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ../include/config.h
+CONFIG_CLEAN_FILES =
+DIST_COMMON = Makefile.am Makefile.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+all: Makefile
+
+.SUFFIXES:
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+ cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps doc/Makefile
+
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ cd $(top_builddir) \
+ && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+tags: TAGS
+TAGS:
+
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = doc
+
+distdir: $(DISTFILES)
+ @for file in $(DISTFILES); do \
+ d=$(srcdir); \
+ test -f $(distdir)/$$file \
+ || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+ || cp -p $$d/$$file $(distdir)/$$file; \
+ done
+info:
+dvi:
+check: all
+installcheck:
+install-exec:
+ @$(NORMAL_INSTALL)
+
+install-data:
+ @$(NORMAL_INSTALL)
+
+install: install-exec install-data all
+ @:
+
+uninstall:
+
+install-strip:
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs:
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -rm -f Makefile $(CONFIG_CLEAN_FILES)
+ -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean: mostlyclean-generic
+
+clean: clean-generic mostlyclean
+
+distclean: distclean-generic clean
+ -rm -f config.status
+ -rm -f libtool
+
+maintainer-clean: maintainer-clean-generic distclean
+ @echo "This command is intended for maintainers to use;"
+ @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: tags distdir info dvi installcheck install-exec install-data \
+install uninstall all installdirs mostlyclean-generic distclean-generic \
+clean-generic maintainer-clean-generic clean mostlyclean distclean \
+maintainer-clean
+
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
--- /dev/null
+sysincludedir = ${includedir}/sys
+sysinclude_HEADERS = asoundlib.h
+
+# This is the order they will be concatenated into asoundlib.h!
+#
+header_files=header.h version.h error.h control.h mixer.h pcm.h rawmidi.h \
+ footer.h
+
+noinst_HEADERS=$(header_files)
+
+$(srcdir)/asoundlib.h: $(header_files)
+ cat $^ > $@
+
+
+INCLUDES=-I$(top_srcdir)/include
--- /dev/null
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+sysincludedir = ${includedir}/sys
+sysinclude_HEADERS = asoundlib.h
+
+# This is the order they will be concatenated into asoundlib.h!
+#
+header_files=header.h version.h error.h control.h mixer.h pcm.h rawmidi.h \
+ footer.h
+
+noinst_HEADERS=$(header_files)
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = config.h
+CONFIG_CLEAN_FILES = version.h
+HEADERS = $(noinst_HEADERS) $(sysinclude_HEADERS)
+
+DIST_COMMON = Makefile.am Makefile.in config.h.in stamp-h.in \
+version.h.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+all: Makefile $(HEADERS) config.h
+
+.SUFFIXES:
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+ cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps include/Makefile
+
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ cd $(top_builddir) \
+ && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+
+config.h: stamp-h
+ @:
+stamp-h: $(srcdir)/config.h.in $(top_builddir)/config.status
+ cd $(top_builddir) \
+ && CONFIG_FILES= CONFIG_HEADERS=include/config.h \
+ $(SHELL) ./config.status
+ @echo timestamp > stamp-h
+$(srcdir)/config.h.in: $(srcdir)/stamp-h.in
+$(srcdir)/stamp-h.in: $(top_srcdir)/configure.in $(ACLOCAL_M4)
+ cd $(top_srcdir) && $(AUTOHEADER)
+ @echo timestamp > $(srcdir)/stamp-h.in
+
+mostlyclean-hdr:
+
+clean-hdr:
+
+distclean-hdr:
+ -rm -f config.h
+
+maintainer-clean-hdr:
+version.h: $(top_builddir)/config.status version.h.in
+ cd $(top_builddir) && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+install-sysincludeHEADERS: $(sysinclude_HEADERS)
+ @$(NORMAL_INSTALL)
+ $(mkinstalldirs) $(DESTDIR)$(sysincludedir)
+ @list='$(sysinclude_HEADERS)'; for p in $$list; do \
+ if test -f "$$p"; then d= ; else d="$(srcdir)/"; fi; \
+ echo " $(INSTALL_DATA) $$d$$p $(DESTDIR)$(sysincludedir)/$$p"; \
+ $(INSTALL_DATA) $$d$$p $(DESTDIR)$(sysincludedir)/$$p; \
+ done
+
+uninstall-sysincludeHEADERS:
+ @$(NORMAL_UNINSTALL)
+ list='$(sysinclude_HEADERS)'; for p in $$list; do \
+ rm -f $(DESTDIR)$(sysincludedir)/$$p; \
+ done
+
+tags: TAGS
+
+ID: $(HEADERS) $(SOURCES) $(LISP)
+ here=`pwd` && cd $(srcdir) \
+ && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP)
+
+TAGS: $(HEADERS) $(SOURCES) config.h.in $(TAGS_DEPENDENCIES) $(LISP)
+ tags=; \
+ here=`pwd`; \
+ list='$(SOURCES) $(HEADERS)'; \
+ unique=`for i in $$list; do echo $$i; done | \
+ awk ' { files[$$0] = 1; } \
+ END { for (i in files) print i; }'`; \
+ test -z "$(ETAGS_ARGS)config.h.in$$unique$(LISP)$$tags" \
+ || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags config.h.in $$unique $(LISP) -o $$here/TAGS)
+
+mostlyclean-tags:
+
+clean-tags:
+
+distclean-tags:
+ -rm -f TAGS ID
+
+maintainer-clean-tags:
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = include
+
+distdir: $(DISTFILES)
+ @for file in $(DISTFILES); do \
+ d=$(srcdir); \
+ test -f $(distdir)/$$file \
+ || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+ || cp -p $$d/$$file $(distdir)/$$file; \
+ done
+info:
+dvi:
+check: all
+installcheck:
+install-exec:
+ @$(NORMAL_INSTALL)
+
+install-data: install-sysincludeHEADERS
+ @$(NORMAL_INSTALL)
+
+install: install-exec install-data all
+ @:
+
+uninstall: uninstall-sysincludeHEADERS
+
+install-strip:
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs:
+ $(mkinstalldirs) $(DESTDIR)$(sysincludedir)
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -rm -f Makefile $(CONFIG_CLEAN_FILES)
+ -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean: mostlyclean-hdr mostlyclean-tags mostlyclean-generic
+
+clean: clean-hdr clean-tags clean-generic mostlyclean
+
+distclean: distclean-hdr distclean-tags distclean-generic clean
+ -rm -f config.status
+ -rm -f libtool
+
+maintainer-clean: maintainer-clean-hdr maintainer-clean-tags \
+ maintainer-clean-generic distclean
+ @echo "This command is intended for maintainers to use;"
+ @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: mostlyclean-hdr distclean-hdr clean-hdr maintainer-clean-hdr \
+uninstall-sysincludeHEADERS install-sysincludeHEADERS tags \
+mostlyclean-tags distclean-tags clean-tags maintainer-clean-tags \
+distdir info dvi installcheck install-exec install-data install \
+uninstall all installdirs mostlyclean-generic distclean-generic \
+clean-generic maintainer-clean-generic clean mostlyclean distclean \
+maintainer-clean
+
+
+$(srcdir)/asoundlib.h: $(header_files)
+ cat $^ > $@
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
-/*
- * Configuration header file for compilation of the ALSA driver
- */
+/* include/config.h.in. Generated automatically from configure.in by autoheader. */
-#undef SND_LIB_VERSION
+/* Define to empty if the keyword does not work. */
+#undef const
+
+/* Define as __inline if that's what the C compiler calls it. */
+#undef inline
+
+/* Define if you have the ANSI C header files. */
+#undef STDC_HEADERS
+
+/* Define if you can safely include both <sys/time.h> and <time.h>. */
+#undef TIME_WITH_SYS_TIME
+
+/* Define if your processor stores words with the most significant
+ byte first (like Motorola and SPARC, unlike Intel and VAX). */
#undef WORDS_BIGENDIAN
+
+/* Package name */
+#undef PACKAGE
+
+/* Package version */
+#undef VERSION
+
+/* Sound library version string */
+#undef SND_LIB_VERSION
+
+/* Define if you have the <linux/asound.h> header file. */
+#undef HAVE_LINUX_ASOUND_H
#define SOUNDLIB_VERSION_MAJOR @SND_LIB_MAJOR@
#define SOUNDLIB_VERSION_MINOR @SND_LIB_MINOR@
#define SOUNDLIB_VERSION_SUBMINOR @SND_LIB_SUBMINOR@
-#define SOUNDLIB_VERSION ( ( LIBULTRA_VERSION_MAJOR << 16 ) | ( LIBULTRA_VERSION_MINOR << 8 ) | LIB_ULTRA_VERSION_SUBMINOR )
+#define SOUNDLIB_VERSION ( ( SOUNDLIB_VERSION_MAJOR << 16 ) | ( SOUNDLIB_VERSION_MINOR << 8 ) | SOUNDLIB_VERSION_SUBMINOR )
--- /dev/null
+#! /bin/sh
+
+# ltconfig - Create a system-specific libtool.
+# Copyright (C) 1996-1998 Free Software Foundation, Inc.
+# Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996
+#
+# This file is free software; you can redistribute it and/or modify it
+# under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# A lot of this script is taken from autoconf-2.10.
+
+# Check that we are running under the correct shell.
+SHELL=${CONFIG_SHELL-/bin/sh}
+echo=echo
+if test "X$1" = X--no-reexec; then
+ # Discard the --no-reexec flag, and continue.
+ shift
+elif test "X`($echo '\t') 2>/dev/null`" = 'X\t'; then
+ # Yippee, $echo works!
+ :
+else
+ # Restart under the correct shell.
+ exec "$SHELL" "$0" --no-reexec ${1+"$@"}
+fi
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+if test "${CDPATH+set}" = set; then CDPATH=; export CDPATH; fi
+
+if test "X`($echo '\t') 2>/dev/null`" != 'X\t'; then
+ # The Solaris, AIX, and Digital Unix default echo programs unquote
+ # backslashes. This makes it impossible to quote backslashes using
+ # echo "$something" | sed 's/\\/\\\\/g'
+ #
+ # So, first we look for a working echo in the user's PATH.
+ IFS="${IFS= }"; save_ifs="$IFS"; IFS="${IFS}:"
+ for dir in $PATH /usr/ucb; do
+ if test -f $dir/echo && test "X`($dir/echo '\t') 2>/dev/null`" = 'X\t'; then
+ echo="$dir/echo"
+ break
+ fi
+ done
+ IFS="$save_ifs"
+
+ if test "X$echo" = Xecho; then
+ # We didn't find a better echo, so look for alternatives.
+ if test "X`(print -r '\t') 2>/dev/null`" = 'X\t'; then
+ # This shell has a builtin print -r that does the trick.
+ echo='print -r'
+ elif test -f /bin/ksh && test "X$CONFIG_SHELL" != X/bin/ksh; then
+ # If we have ksh, try running ltconfig again with it.
+ CONFIG_SHELL=/bin/ksh
+ export CONFIG_SHELL
+ exec "$CONFIG_SHELL" "$0" --no-reexec ${1+"$@"}
+ else
+ # Try using printf.
+ echo='printf %s\n'
+ if test "X`($echo '\t') 2>/dev/null`" != 'X\t'; then
+ # Oops. We lost completely, so just stick with echo.
+ echo=echo
+ fi
+ fi
+ fi
+fi
+
+# Sed substitution that helps us do robust quoting. It backslashifies
+# metacharacters that are still active within double-quoted strings.
+Xsed='sed -e s/^X//'
+sed_quote_subst='s/\([\\"\\`$\\\\]\)/\\\1/g'
+
+# Same as above, but do not quote variable references.
+double_quote_subst='s/\([\\"\\`\\\\]\)/\\\1/g'
+
+# The name of this program.
+progname=`$echo "X$0" | $Xsed -e 's%^.*/%%'`
+
+# Constants:
+PROGRAM=ltconfig
+PACKAGE=libtool
+VERSION=1.2b
+ac_compile='${CC-cc} -c $CFLAGS $CPPFLAGS conftest.c 1>&5'
+ac_link='${CC-cc} -o conftest $CFLAGS $CPPFLAGS $LDFLAGS conftest.c $LIBS 1>&5'
+rm="rm -f"
+
+help="Try \`$progname --help' for more information."
+
+# Global variables:
+default_ofile=libtool
+can_build_shared=yes
+enable_shared=yes
+# All known linkers require a `.a' archive for static linking.
+enable_static=yes
+ltmain=
+silent=
+srcdir=
+ac_config_guess=
+ac_config_sub=
+host=
+nonopt=
+ofile="$default_ofile"
+verify_host=yes
+with_gcc=no
+with_gnu_ld=no
+
+old_AR="$AR"
+old_CC="$CC"
+old_CFLAGS="$CFLAGS"
+old_CPPFLAGS="$CPPFLAGS"
+old_LD="$LD"
+old_LN_S="$LN_S"
+old_NM="$NM"
+old_RANLIB="$RANLIB"
+
+# Parse the command line options.
+args=
+prev=
+for option
+do
+ case "$option" in
+ -*=*) optarg=`echo "$option" | sed 's/[-_a-zA-Z0-9]*=//'` ;;
+ *) optarg= ;;
+ esac
+
+ # If the previous option needs an argument, assign it.
+ if test -n "$prev"; then
+ eval "$prev=\$option"
+ prev=
+ continue
+ fi
+
+ case "$option" in
+ --help) cat <<EOM
+Usage: $progname [OPTION]... LTMAIN [HOST]
+
+Generate a system-specific libtool script.
+
+ --debug enable verbose shell tracing
+ --disable-shared do not build shared libraries
+ --disable-static do not build static libraries
+ --help display this help and exit
+ --no-verify do not verify that HOST is a valid host type
+-o, --output=FILE specify the output file [default=$default_ofile]
+ --quiet same as \`--silent'
+ --silent do not print informational messages
+ --srcdir=DIR find \`config.guess' in DIR
+ --version output version information and exit
+ --with-gcc assume that the GNU C compiler will be used
+ --with-gnu-ld assume that the C compiler uses the GNU linker
+
+LTMAIN is the \`ltmain.sh' shell script fragment that provides basic libtool
+functionality.
+
+HOST is the canonical host system name [default=guessed].
+EOM
+ exit 0
+ ;;
+
+ --debug)
+ echo "$progname: enabling shell trace mode"
+ set -x
+ ;;
+
+ --disable-shared) enable_shared=no ;;
+
+ --disable-static) enable_static=no ;;
+
+ --quiet | --silent) silent=yes ;;
+
+ --srcdir) prev=srcdir ;;
+ --srcdir=*) srcdir="$optarg" ;;
+
+ --no-verify) verify_host=no ;;
+
+ --output | -o) prev=ofile ;;
+ --output=*) ofile="$optarg" ;;
+
+ --version) echo "$PROGRAM (GNU $PACKAGE) $VERSION"; exit 0 ;;
+
+ --with-gcc) with_gcc=yes ;;
+ --with-gnu-ld) with_gnu_ld=yes ;;
+
+ -*)
+ echo "$progname: unrecognized option \`$option'" 1>&2
+ echo "$help" 1>&2
+ exit 1
+ ;;
+
+ *)
+ if test -z "$ltmain"; then
+ ltmain="$option"
+ elif test -z "$host"; then
+# This generates an unnecessary warning for sparc-sun-solaris4.1.3_U1
+# if test -n "`echo $option| sed 's/[-a-z0-9.]//g'`"; then
+# echo "$progname: warning \`$option' is not a valid host type" 1>&2
+# fi
+ host="$option"
+ else
+ echo "$progname: too many arguments" 1>&2
+ echo "$help" 1>&2
+ exit 1
+ fi ;;
+ esac
+done
+
+if test -z "$ltmain"; then
+ echo "$progname: you must specify a LTMAIN file" 1>&2
+ echo "$help" 1>&2
+ exit 1
+fi
+
+if test ! -f "$ltmain"; then
+ echo "$progname: \`$ltmain' does not exist" 1>&2
+ echo "$help" 1>&2
+ exit 1
+fi
+
+# Quote any args containing shell metacharacters.
+ltconfig_args=
+for arg
+do
+ case "$arg" in
+ *" "*|*" "*|*[\[\]\~\#\$\^\&\*\(\)\{\}\\\|\;\<\>\?]*)
+ ltconfig_args="$ltconfig_args '$arg'" ;;
+ *) ltconfig_args="$ltconfig_args $arg" ;;
+ esac
+done
+
+# A relevant subset of AC_INIT.
+
+# File descriptor usage:
+# 0 standard input
+# 1 file creation
+# 2 errors and warnings
+# 3 some systems may open it to /dev/tty
+# 4 used on the Kubota Titan
+# 5 compiler messages saved in config.log
+# 6 checking for... messages and results
+if test "$silent" = yes; then
+ exec 6>/dev/null
+else
+ exec 6>&1
+fi
+exec 5>>./config.log
+
+# NLS nuisances.
+# Only set LANG and LC_ALL to C if already set.
+# These must not be set unconditionally because not all systems understand
+# e.g. LANG=C (notably SCO).
+if test "${LC_ALL+set}" = set; then LC_ALL=C; export LC_ALL; fi
+if test "${LANG+set}" = set; then LANG=C; export LANG; fi
+
+if (echo "testing\c"; echo 1,2,3) | grep c >/dev/null; then
+ # Stardent Vistra SVR4 grep lacks -e, says ghazi@caip.rutgers.edu.
+ if (echo -n testing; echo 1,2,3) | sed s/-n/xn/ | grep xn >/dev/null; then
+ ac_n= ac_c='
+' ac_t=' '
+ else
+ ac_n=-n ac_c= ac_t=
+ fi
+else
+ ac_n= ac_c='\c' ac_t=
+fi
+
+if test -z "$srcdir"; then
+ # Assume the source directory is the same one as the path to ltmain.sh.
+ srcdir=`$echo "$ltmain" | $Xsed -e 's%/[^/]*$%%'`
+ test "$srcdir" = "$ltmain" && srcdir=.
+fi
+
+trap "$rm conftest*; exit 1" 1 2 15
+if test "$verify_host" = yes; then
+ # Check for config.guess and config.sub.
+ ac_aux_dir=
+ for ac_dir in $srcdir $srcdir/.. $srcdir/../..; do
+ if test -f $ac_dir/config.guess; then
+ ac_aux_dir=$ac_dir
+ break
+ fi
+ done
+ if test -z "$ac_aux_dir"; then
+ echo "$progname: cannot find config.guess in $srcdir $srcdir/.. $srcdir/../.." 1>&2
+ echo "$help" 1>&2
+ exit 1
+ fi
+ ac_config_guess=$ac_aux_dir/config.guess
+ ac_config_sub=$ac_aux_dir/config.sub
+
+ # Make sure we can run config.sub.
+ if $SHELL $ac_config_sub sun4 >/dev/null 2>&1; then :
+ else
+ echo "$progname: cannot run $ac_config_sub" 1>&2
+ echo "$help" 1>&2
+ exit 1
+ fi
+
+ echo $ac_n "checking host system type""... $ac_c" 1>&6
+
+ host_alias=$host
+ case "$host_alias" in
+ "")
+ if host_alias=`$SHELL $ac_config_guess`; then :
+ else
+ echo "$progname: cannot guess host type; you must specify one" 1>&2
+ echo "$help" 1>&2
+ exit 1
+ fi ;;
+ esac
+ host=`$SHELL $ac_config_sub $host_alias`
+ echo "$ac_t$host" 1>&6
+
+ # Make sure the host verified.
+ test -z "$host" && exit 1
+
+elif test -z "$host"; then
+ echo "$progname: you must specify a host type if you use \`--no-verify'" 1>&2
+ echo "$help" 1>&2
+ exit 1
+else
+ host_alias=$host
+fi
+
+# Transform linux* to *-*-linux-gnu*, to support old configure scripts.
+case "$host_os" in
+linux-gnu*) ;;
+linux*) host=`echo $host | sed 's/^\(.*-.*-linux\)\(.*\)$/\1-gnu\2/'`
+esac
+
+host_cpu=`echo $host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\1/'`
+host_vendor=`echo $host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\2/'`
+host_os=`echo $host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\3/'`
+
+case "$host_os" in
+aix3*)
+ # AIX sometimes has problems with the GCC collect2 program. For some
+ # reason, if we set the COLLECT_NAMES environment variable, the problems
+ # vanish in a puff of smoke.
+ if test "${COLLECT_NAMES+set}" != set; then
+ COLLECT_NAMES=
+ export COLLECT_NAMES
+ fi
+ ;;
+esac
+
+# Determine commands to create old-style static archives.
+old_archive_cmds='$AR cru $oldlib$oldobjs'
+old_postinstall_cmds='chmod 644 $oldlib'
+old_postuninstall_cmds=
+
+# Set a sane default for `AR'.
+test -z "$AR" && AR=ar
+
+# If RANLIB is not set, then run the test.
+if test "${RANLIB+set}" != "set"; then
+ result=no
+
+ echo $ac_n "checking for ranlib... $ac_c" 1>&6
+ IFS="${IFS= }"; save_ifs="$IFS"; IFS="${IFS}:"
+ for dir in $PATH; do
+ test -z "$dir" && dir=.
+ if test -f $dir/ranlib; then
+ RANLIB="ranlib"
+ result="ranlib"
+ break
+ fi
+ done
+ IFS="$save_ifs"
+
+ echo "$ac_t$result" 1>&6
+fi
+
+if test -n "$RANLIB"; then
+ old_archive_cmds="$old_archive_cmds;\$RANLIB \$oldlib"
+ old_postinstall_cmds="\$RANLIB \$oldlib;$old_postinstall_cmds"
+fi
+
+# Check to see if we are using GCC.
+if test "$with_gcc" != yes || test -z "$CC"; then
+ # If CC is not set, then try to find GCC or a usable CC.
+ if test -z "$CC"; then
+ echo $ac_n "checking for gcc... $ac_c" 1>&6
+ IFS="${IFS= }"; save_ifs="$IFS"; IFS="${IFS}:"
+ for dir in $PATH; do
+ IFS="$save_ifs"
+ test -z "$dir" && dir=.
+ if test -f $dir/gcc; then
+ CC="gcc"
+ break
+ fi
+ done
+ IFS="$save_ifs"
+
+ if test -n "$CC"; then
+ echo "$ac_t$CC" 1>&6
+ else
+ echo "$ac_t"no 1>&6
+ fi
+ fi
+
+ # Not "gcc", so try "cc", rejecting "/usr/ucb/cc".
+ if test -z "$CC"; then
+ echo $ac_n "checking for cc... $ac_c" 1>&6
+ IFS="${IFS= }"; save_ifs="$IFS"; IFS="${IFS}:"
+ cc_rejected=no
+ for dir in $PATH; do
+ test -z "$dir" && dir=.
+ if test -f $dir/cc; then
+ if test "$dir/cc" = "/usr/ucb/cc"; then
+ cc_rejected=yes
+ continue
+ fi
+ CC="cc"
+ break
+ fi
+ done
+ IFS="$save_ifs"
+ if test $cc_rejected = yes; then
+ # We found a bogon in the path, so make sure we never use it.
+ set dummy $CC
+ shift
+ if test $# -gt 0; then
+ # We chose a different compiler from the bogus one.
+ # However, it has the same name, so the bogon will be chosen
+ # first if we set CC to just the name; use the full file name.
+ shift
+ set dummy "$dir/cc" "$@"
+ shift
+ CC="$@"
+ fi
+ fi
+
+ if test -n "$CC"; then
+ echo "$ac_t$CC" 1>&6
+ else
+ echo "$ac_t"no 1>&6
+ fi
+
+ if test -z "$CC"; then
+ echo "$progname: error: no acceptable cc found in \$PATH" 1>&2
+ exit 1
+ fi
+ fi
+
+ # Now see if the compiler is really GCC.
+ with_gcc=no
+ echo $ac_n "checking whether we are using GNU C... $ac_c" 1>&6
+ echo "$progname:462: checking whether we are using GNU C" >&5
+
+ $rm conftest.c
+ cat > conftest.c <<EOF
+#ifdef __GNUC__
+ yes;
+#endif
+EOF
+ if { ac_try='${CC-cc} -E conftest.c'; { (eval echo $progname:470: \"$ac_try\") 1>&5; (eval $ac_try) 2>&5; }; } | egrep yes >/dev/null 2>&1; then
+ with_gcc=yes
+ fi
+ $rm conftest.c
+ echo "$ac_t$with_gcc" 1>&6
+fi
+
+# Allow CC to be a program name with arguments.
+set dummy $CC
+compiler="$2"
+
+echo $ac_n "checking for $compiler option to produce PIC... $ac_c" 1>&6
+pic_flag=
+special_shlib_compile_flags=
+wl=
+link_static_flag=
+no_builtin_flag=
+
+if test "$with_gcc" = yes; then
+ wl='-Wl,'
+ link_static_flag='-static'
+ no_builtin_flag=' -fno-builtin'
+
+ case "$host_os" in
+ aix3* | aix4* | irix5* | irix6* | osf3* | osf4*)
+ # PIC is the default for these OSes.
+ ;;
+ os2*)
+ # We can build DLLs from non-PIC.
+ ;;
+ amigaos*)
+ # FIXME: we need at least 68020 code to build shared libraries, but
+ # adding the `-m68020' flag to GCC prevents building anything better,
+ # like `-m68040'.
+ pic_flag='-m68020 -resident32 -malways-restore-a4'
+ ;;
+ *)
+ pic_flag='-fPIC'
+ ;;
+ esac
+else
+ # PORTME Check for PIC flags for the system compiler.
+ case "$host_os" in
+ aix3* | aix4*)
+ # All AIX code is PIC.
+ link_static_flag='-bnso -bI:/lib/syscalls.exp'
+ ;;
+
+ hpux9* | hpux10* | hpux11*)
+ # Is there a better link_static_flag that works with the bundled CC?
+ wl='-Wl,'
+ link_static_flag="${wl}-a ${wl}archive"
+ pic_flag='+Z'
+ ;;
+
+ irix5* | irix6*)
+ wl='-Wl,'
+ link_static_flag='-non_shared'
+ # PIC (with -KPIC) is the default.
+ ;;
+
+ os2*)
+ # We can build DLLs from non-PIC.
+ ;;
+
+ osf3* | osf4*)
+ # All OSF/1 code is PIC.
+ wl='-Wl,'
+ link_static_flag='-non_shared'
+ ;;
+
+ sco3.2v5*)
+ pic_flag='-Kpic'
+ link_static_flag='-dn'
+ special_shlib_compile_flags='-belf'
+ ;;
+
+ solaris2*)
+ pic_flag='-KPIC'
+ link_static_flag='-Bstatic'
+ wl='-Wl,'
+ ;;
+
+ sunos4*)
+ pic_flag='-PIC'
+ link_static_flag='-Bstatic'
+ wl='-Qoption ld '
+ ;;
+
+ sysv4.2uw2*)
+ pic_flag='-KPIC'
+ link_static_flag='-Bstatic'
+ wl='-Wl,'
+ ;;
+
+ uts4*)
+ pic_flag='-pic'
+ link_static_flag='-Bstatic'
+ ;;
+
+ *)
+ can_build_shared=no
+ ;;
+ esac
+fi
+
+if test -n "$pic_flag"; then
+ echo "$ac_t$pic_flag" 1>&6
+
+ # Check to make sure the pic_flag actually works.
+ echo $ac_n "checking if $compiler PIC flag $pic_flag works... $ac_c" 1>&6
+ $rm conftest*
+ echo "int some_variable = 0;" > conftest.c
+ save_CFLAGS="$CFLAGS"
+ CFLAGS="$CFLAGS $pic_flag -DPIC"
+ echo "$progname:585: checking if $compiler PIC flag $pic_flag works" >&5
+ if { (eval echo $progname:586: \"$ac_compile\") 1>&5; (eval $ac_compile) 2>conftest.err; } && test -s conftest.o; then
+ # Append any warnings to the config.log.
+ cat conftest.err 1>&5
+
+ # On HP-UX, both CC and GCC only warn that PIC is supported... then they
+ # create non-PIC objects. So, if there were any warnings, we assume that
+ # PIC is not supported.
+ if test -s conftest.err; then
+ echo "$ac_t"no 1>&6
+ can_build_shared=no
+ pic_flag=
+ else
+ echo "$ac_t"yes 1>&6
+ pic_flag=" $pic_flag"
+ fi
+ else
+ # Append any errors to the config.log.
+ cat conftest.err 1>&5
+ can_build_shared=no
+ pic_flag=
+ echo "$ac_t"no 1>&6
+ fi
+ CFLAGS="$save_CFLAGS"
+ $rm conftest*
+else
+ echo "$ac_t"none 1>&6
+fi
+
+# Check for any special shared library compilation flags.
+if test -n "$special_shlib_compile_flags"; then
+ echo "$progname: warning: \`$CC' requires \`$special_shlib_compile_flags' to build shared libraries" 1>&2
+ if echo "$old_CC $old_CFLAGS " | egrep -e "[ ]$special_shlib_compile_flags[ ]" >/dev/null; then :
+ else
+ echo "$progname: add \`$special_shlib_compile_flags' to the CC or CFLAGS env variable and reconfigure" 1>&2
+ can_build_shared=no
+ fi
+fi
+
+echo $ac_n "checking if $compiler static flag $link_static_flag works... $ac_c" 1>&6
+$rm conftest*
+echo 'main(){return(0);}' > conftest.c
+save_LDFLAGS="$LDFLAGS"
+LDFLAGS="$LDFLAGS $link_static_flag"
+echo "$progname:629: checking if $compiler static flag $link_static_flag works" >&5
+if { (eval echo $progname:630: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest; then
+ echo "$ac_t$link_static_flag" 1>&6
+else
+ echo "$ac_t"none 1>&6
+ link_static_flag=
+fi
+LDFLAGS="$save_LDFLAGS"
+$rm conftest*
+
+if test -z "$LN_S"; then
+ # Check to see if we can use ln -s, or we need hard links.
+ echo $ac_n "checking whether ln -s works... $ac_c" 1>&6
+ $rm conftestdata
+ if ln -s X conftestdata 2>/dev/null; then
+ $rm conftestdata
+ LN_S="ln -s"
+ else
+ LN_S=ln
+ fi
+ if test "$LN_S" = "ln -s"; then
+ echo "$ac_t"yes 1>&6
+ else
+ echo "$ac_t"no 1>&6
+ fi
+fi
+
+# Make sure LD is an absolute path.
+if test -z "$LD"; then
+ ac_prog=ld
+ if test "$with_gcc" = yes; then
+ # Check if gcc -print-prog-name=ld gives a path.
+ echo $ac_n "checking for ld used by GCC... $ac_c" 1>&6
+ echo "$progname:662: checking for ld used by GCC" >&5
+ ac_prog=`($CC -print-prog-name=ld) 2>&5`
+ case "$ac_prog" in
+ # Accept absolute paths.
+ /* | [A-Za-z]:[/\\]*)
+ test -z "$LD" && LD="$ac_prog"
+ ;;
+ "")
+ # If it fails, then pretend we are not using GCC.
+ ac_prog=ld
+ ;;
+ *)
+ # If it is relative, then search for the first ld in PATH.
+ with_gnu_ld=unknown
+ ;;
+ esac
+ elif test "$with_gnu_ld" = yes; then
+ echo $ac_n "checking for GNU ld... $ac_c" 1>&6
+ echo "$progname:680: checking for GNU ld" >&5
+ else
+ echo $ac_n "checking for non-GNU ld""... $ac_c" 1>&6
+ echo "$progname:683: checking for non-GNU ld" >&5
+ fi
+
+ if test -z "$LD"; then
+ IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:"
+ for ac_dir in $PATH; do
+ test -z "$ac_dir" && ac_dir=.
+ if test -f "$ac_dir/$ac_prog"; then
+ LD="$ac_dir/$ac_prog"
+ # Check to see if the program is GNU ld. I'd rather use --version,
+ # but apparently some GNU ld's only accept -v.
+ # Break only if it was the GNU/non-GNU ld that we prefer.
+ if "$LD" -v 2>&1 < /dev/null | egrep '(GNU|with BFD)' > /dev/null; then
+ test "$with_gnu_ld" != no && break
+ else
+ test "$with_gnu_ld" != yes && break
+ fi
+ fi
+ done
+ IFS="$ac_save_ifs"
+ fi
+
+ if test -n "$LD"; then
+ echo "$ac_t$LD" 1>&6
+ else
+ echo "$ac_t"no 1>&6
+ fi
+
+ if test -z "$LD"; then
+ echo "$progname: error: no acceptable ld found in \$PATH" 1>&2
+ exit 1
+ fi
+fi
+
+# Check to see if it really is or is not GNU ld.
+echo $ac_n "checking if the linker ($LD) is GNU ld... $ac_c" 1>&6
+# I'd rather use --version here, but apparently some GNU ld's only accept -v.
+if $LD -v 2>&1 </dev/null | egrep '(GNU|with BFD)' 1>&5; then
+ with_gnu_ld=yes
+else
+ with_gnu_ld=no
+fi
+echo "$ac_t$with_gnu_ld" 1>&6
+
+# See if the linker supports building shared libraries.
+echo $ac_n "checking whether the linker ($LD) supports shared libraries... $ac_c" 1>&6
+
+allow_undefined_flag=
+no_undefined_flag=
+archive_cmds=
+old_archive_from_new_cmds=
+export_dynamic_flag_spec=
+whole_archive_flag_spec=
+hardcode_libdir_flag_spec=
+hardcode_libdir_separator=
+hardcode_direct=no
+hardcode_minus_L=no
+hardcode_shlibpath_var=unsupported
+runpath_var=
+
+ld_shlibs=yes
+if test "$with_gnu_ld" = yes; then
+
+ # See if GNU ld supports shared libraries.
+ case "$host_os" in
+ amigaos*)
+ archive_cmds='$rm $objdir/a2ixlibrary.data;$echo "#define NAME $libname" > $objdir/a2ixlibrary.data;$echo "#define LIBRARY_ID 1" >> $objdir/a2ixlibrary.data;$echo "#define VERSION $major" >> $objdir/a2ixlibrary.data;$echo "#define REVISION $revision" >> $objdir/a2ixlibrary.data;$AR cru $lib$libobjs;$RANLIB $lib;(cd $objdir && a2ixlibrary -32)'
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_minus_L=yes
+ ;;
+
+ linux-gnu*)
+ if $LD --help 2>&1 | egrep ': supported targets:.* elf' > /dev/null; then
+ archive_cmds='$CC -shared ${wl}-soname $wl$soname -o $lib$libobjs $deplibs'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+
+ sunos4*)
+ archive_cmds='$LD -assert pure-text -Bstatic -o $lib$libobjs'
+ hardcode_direct=yes
+ hardcode_minus_L=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ *)
+ if $LD --help 2>&1 | egrep ': supported targets:.* elf' > /dev/null; then
+ archive_cmds='$CC -shared ${wl}-soname $wl$soname -o $lib$libobjs'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+ esac
+
+ if test "$ld_shlibs" = yes; then
+ runpath_var=LD_RUN_PATH
+ hardcode_libdir_flag_spec='${wl}--rpath ${wl}$libdir'
+ export_dynamic_flag_spec='${wl}--export-dynamic'
+ whole_archive_flag_spec='${wl}--whole-archive$convenience ${wl}--no-whole-archive'
+ fi
+else
+ # PORTME fill in a description of your system's linker (not GNU ld)
+ case "$host_os" in
+ aix3*)
+ allow_undefined_flag=unsupported
+ archive_cmds='$NM$libobjs | $global_symbol_pipe | sed '\''s/.* //'\'' > $lib.exp;$LD -o $objdir/$soname$libobjs -bE:$lib.exp -T512 -H512 -bM:SRE;$AR cru $lib $objdir/$soname'
+ # Note: this linker hardcodes the directories in LIBPATH if there
+ # are no directories specified by -L.
+ hardcode_minus_L=yes
+ if test "$with_gcc" = yes && test -z "$link_static_flag"; then
+ # Neither direct hardcoding nor static linking is supported with a
+ # broken collect2.
+ hardcode_direct=unsupported
+ fi
+ ;;
+
+ aix4*)
+ allow_undefined_flag=unsupported
+ archive_cmds='$NM$libobjs | $global_symbol_pipe | sed '\''s/.* //'\'' > $lib.exp;$CC -o $objdir/$soname$libobjs ${wl}-bE:$lib.exp ${wl}-bM:SRE ${wl}-bnoentry;$AR cru $lib $objdir/$soname'
+ hardcode_direct=yes
+ hardcode_minus_L=yes
+ ;;
+
+ amigaos*)
+ archive_cmds='$rm $objdir/a2ixlibrary.data;$echo "#define NAME $libname" > $objdir/a2ixlibrary.data;$echo "#define LIBRARY_ID 1" >> $objdir/a2ixlibrary.data;$echo "#define VERSION $major" >> $objdir/a2ixlibrary.data;$echo "#define REVISION $revision" >> $objdir/a2ixlibrary.data;$AR cru $lib$libobjs;$RANLIB $lib;(cd $objdir && a2ixlibrary -32)'
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_minus_L=yes
+ ;;
+
+ # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor
+ # support. Future versions do this automatically, but an explicit c++rt0.o
+ # does not break anything, and helps significantly (at the cost of a little
+ # extra space).
+ freebsd2.2*)
+ archive_cmds='$LD -Bshareable -o $lib$libobjs /usr/lib/c++rt0.o'
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_direct=yes
+ hardcode_minus_L=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ # Unfortunately, older versions of FreeBSD 2 do not have this feature.
+ freebsd2*)
+ archive_cmds='$LD -Bshareable -o $lib$libobjs'
+ hardcode_direct=yes
+ hardcode_minus_L=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ # FreeBSD 3, at last, uses gcc -shared to do shared libraries.
+ freebsd3*)
+ archive_cmds='$CC -shared -o $lib$libobjs'
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_direct=yes
+ hardcode_minus_L=no
+ hardcode_shlibpath_var=no
+ ;;
+
+ hpux9*)
+ archive_cmds='$rm $objdir/$soname;$LD -b +s +b $install_libdir -o $objdir/$soname$libobjs;mv $objdir/$soname $lib'
+ hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+ hardcode_direct=yes
+ hardcode_minus_L=yes
+ export_dynamic_flag_spec='${wl}-E'
+ ;;
+
+ hpux10* | hpux11*)
+ archive_cmds='$LD -b +h $soname +s +b $install_libdir -o $lib$libobjs'
+ hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+ hardcode_direct=yes
+ hardcode_minus_L=yes
+ export_dynamic_flag_spec='${wl}-E'
+ ;;
+
+ irix5* | irix6*)
+ if test "$with_gcc" = yes; then
+ archive_cmds='$CC -shared -o $lib ${wl}-soname ${wl}$soname ${wl}-set_version ${wl}$verstring$libobjs'
+ else
+ archive_cmds='$LD -shared -o $lib -soname $soname -set_version $verstring$libobjs'
+ fi
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ ;;
+
+ netbsd*)
+ # Tested with NetBSD 1.2 ld
+ archive_cmds='$LD -Bshareable -o $lib$libobjs'
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_direct=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ openbsd*)
+ archive_cmds='$LD -Bshareable -o $lib$libobjs'
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_direct=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ os2*)
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_minus_L=yes
+ allow_undefined_flag=unsupported
+ archive_cmds='$echo "LIBRARY $libname INITINSTANCE" > $objdir/$libname.def;$echo "DESCRIPTION \"$libname\"" >> $objdir/$libname.def;$echo DATA >> $objdir/$libname.def;$echo " SINGLE NONSHARED" >> $objdir/$libname.def;$echo EXPORTS >> $objdir/$libname.def;emxexp$libobjs >> $objdir/$libname.def;$CC -Zdll -Zcrtdll -o $lib$libobjs $objdir/$libname.def'
+ old_archive_from_new_cmds='emximp -o $objdir/$libname.a $objdir/$libname.def'
+ ;;
+
+ osf3* | osf4*)
+ allow_undefined_flag=' -expect_unresolved \*'
+ archive_cmds='$LD -shared${allow_undefined_flag} -o $lib -soname $soname -set_version $verstring$libobjs$deplibs'
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator=:
+ ;;
+
+ sco3.2v5*)
+ archive_cmds='$LD -G -o $lib$libobjs'
+ hardcode_direct=yes
+ ;;
+
+ solaris2*)
+ no_undefined_flag=' -z text'
+ archive_cmds='$LD -G${allow_undefined_flag} -h $soname -o $lib$libobjs'
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_shlibpath_var=no
+
+ # Solaris 2 before 2.5 hardcodes -L paths.
+ case "$host_os" in
+ solaris2.[0-4]*)
+ hardcode_minus_L=yes
+ ;;
+ esac
+ ;;
+
+ sunos4*)
+ archive_cmds='$LD -assert pure-text -Bstatic -o $lib$libobjs'
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_direct=yes
+ hardcode_minus_L=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ uts4*)
+ archive_cmds='$LD -G -h $soname -o $lib$libobjs'
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_direct=no
+ hardcode_minus_L=no
+ hardcode_shlibpath_var=no
+ ;;
+
+ *)
+ ld_shlibs=no
+ can_build_shared=no
+ ;;
+ esac
+fi
+echo "$ac_t$ld_shlibs" 1>&6
+
+if test -z "$NM"; then
+ echo $ac_n "checking for BSD-compatible nm... $ac_c" 1>&6
+ case "$NM" in
+ /* | [A-Za-z]:[/\\]*) ;; # Let the user override the test with a path.
+ *)
+ IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:"
+ for ac_dir in /usr/ucb /usr/ccs/bin $PATH /bin; do
+ test -z "$ac_dir" && ac_dir=.
+ if test -f $ac_dir/nm; then
+ # Check to see if the nm accepts a BSD-compat flag.
+ # Adding the `sed 1q' prevents false positives on HP-UX, which says:
+ # nm: unknown option "B" ignored
+ if ($ac_dir/nm -B /dev/null 2>&1 | sed '1q'; exit 0) | egrep /dev/null >/dev/null; then
+ NM="$ac_dir/nm -B"
+ elif ($ac_dir/nm -p /dev/null 2>&1 | sed '1q'; exit 0) | egrep /dev/null >/dev/null; then
+ NM="$ac_dir/nm -p"
+ else
+ NM="$ac_dir/nm"
+ fi
+ break
+ fi
+ done
+ IFS="$ac_save_ifs"
+ test -z "$NM" && NM=nm
+ ;;
+ esac
+ echo "$ac_t$NM" 1>&6
+fi
+
+# Check for command to grab the raw symbol name followed by C symbol from nm.
+echo $ac_n "checking command to parse $NM output... $ac_c" 1>&6
+
+# These are sane defaults that work on at least a few old systems.
+# [They come from Ultrix. What could be older than Ultrix?!! ;)]
+
+# Character class describing NM global symbol codes.
+symcode='[BCDEGRSTU]'
+
+# Regexp to match symbols that can be accessed directly from C.
+sympat='\([_A-Za-z][_A-Za-z0-9]*\)'
+
+# Transform the above into a raw symbol and a C symbol.
+symxfrm='\1 \1'
+
+# Define system-specific variables.
+case "$host_os" in
+aix*)
+ symcode='[BCDTU]'
+ ;;
+irix*)
+ # Cannot use undefined symbols on IRIX because inlined functions mess us up.
+ symcode='[BCDEGRST]'
+ ;;
+solaris2*)
+ symcode='[BDTU]'
+ ;;
+esac
+
+# If we're using GNU nm, then use its standard symbol codes.
+if $NM -V 2>&1 | egrep '(GNU|with BFD)' > /dev/null; then
+ symcode='[ABCDGISTUW]'
+fi
+
+# Write the raw and C identifiers.
+global_symbol_pipe="sed -n -e 's/^.* $symcode $sympat$/$symxfrm/p'"
+
+# Check to see that the pipe works correctly.
+pipe_works=no
+$rm conftest*
+cat > conftest.c <<EOF
+#ifdef __cplusplus
+extern "C" {
+#endif
+char nm_test_var;
+void nm_test_func(){}
+#ifdef __cplusplus
+}
+#endif
+main(){nm_test_var='a';nm_test_func();return(0);}
+EOF
+
+echo "$progname:1021: checking if global_symbol_pipe works" >&5
+if { (eval echo $progname:1022: \"$ac_compile\") 1>&5; (eval $ac_compile) 2>&5; } && test -s conftest.o; then
+ # Now try to grab the symbols.
+ nlist=conftest.nm
+ if { echo "$progname:1025: eval \"$NM conftest.o | $global_symbol_pipe > $nlist\"" >&5; eval "$NM conftest.o | $global_symbol_pipe > $nlist 2>&5"; } && test -s "$nlist"; then
+
+ # Try sorting and uniquifying the output.
+ if sort "$nlist" | uniq > "$nlist"T; then
+ mv -f "$nlist"T "$nlist"
+ wcout=`wc "$nlist" 2>/dev/null`
+ count=`$echo "X$wcout" | $Xsed -e 's/^[ ]*\([0-9][0-9]*\).*$/\1/'`
+ (test "$count" -ge 0) 2>/dev/null || count=-1
+ else
+ rm -f "$nlist"T
+ count=-1
+ fi
+
+ # Make sure that we snagged all the symbols we need.
+ if egrep ' nm_test_var$' "$nlist" >/dev/null; then
+ if egrep ' nm_test_func$' "$nlist" >/dev/null; then
+ cat <<EOF > conftest.c
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+EOF
+ # Now generate the symbol file.
+ sed 's/^.* \(.*\)$/extern char \1;/' < "$nlist" >> conftest.c
+
+ cat <<EOF >> conftest.c
+#if defined (__STDC__) && __STDC__
+# define __ptr_t void *
+#else
+# define __ptr_t char *
+#endif
+
+/* The number of symbols in dld_preloaded_symbols, -1 if unsorted. */
+int dld_preloaded_symbol_count = $count;
+
+/* The mapping between symbol names and symbols. */
+struct {
+ char *name;
+ __ptr_t address;
+}
+dld_preloaded_symbols[] =
+{
+EOF
+ sed 's/^\(.*\) \(.*\)$/ {"\1", (__ptr_t) \&\2},/' < "$nlist" >> conftest.c
+ cat <<\EOF >> conftest.c
+ {0, (__ptr_t) 0}
+};
+
+#ifdef __cplusplus
+}
+#endif
+EOF
+ # Now try linking the two files.
+ mv conftest.o conftestm.o
+ save_LIBS="$LIBS"
+ save_CFLAGS="$CFLAGS"
+ LIBS='conftestm.o'
+ CFLAGS="$CFLAGS$no_builtin_flag"
+ if { (eval echo $progname:1083: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest; then
+ pipe_works=yes
+ else
+ echo "$progname: failed program was:" >&5
+ cat conftest.c >&5
+ fi
+ LIBS="$save_LIBS"
+ else
+ echo "cannot find nm_test_func in $nlist" >&5
+ fi
+ else
+ echo "cannot find nm_test_var in $nlist" >&5
+ fi
+ else
+ echo "cannot run $global_symbol_pipe" >&5
+ fi
+else
+ echo "$progname: failed program was:" >&5
+ cat conftest.c >&5
+fi
+$rm conftest*
+
+# Do not use the global_symbol_pipe unless it works.
+echo "$ac_t$pipe_works" 1>&6
+test "$pipe_works" = yes || global_symbol_pipe=
+
+# Check hardcoding attributes.
+echo $ac_n "checking how to hardcode library paths into programs... $ac_c" 1>&6
+hardcode_action=
+if test -n "$hardcode_libdir_flag_spec" || \
+ test -n "$runpath_var"; then
+
+ # We can hardcode non-existant directories.
+ if test "$hardcode_direct" != no && \
+ test "$hardcode_minus_L" != no && \
+ test "$hardcode_shlibpath_var" != no; then
+
+ # Linking always hardcodes the temporary library directory.
+ hardcode_action=relink
+ else
+ # We can link without hardcoding, and we can hardcode nonexisting dirs.
+ hardcode_action=immediate
+ fi
+else
+ # We cannot hardcode anything, or else we can only hardcode existing
+ # directories.
+ hardcode_action=unsupported
+fi
+echo "$ac_t$hardcode_action" 1>&6
+
+
+reload_flag=
+reload_cmds='$LD$reload_flag -o $output$reload_objs'
+echo $ac_n "checking for $LD option to reload object files... $ac_c" 1>&6
+# PORTME Some linkers may need a different reload flag.
+reload_flag='-r'
+echo "$ac_t$reload_flag" 1>&6
+test -n "$reload_flag" && reload_flag=" $reload_flag"
+
+# PORTME Fill in your ld.so characteristics
+library_names_spec=
+libname_spec='lib$name'
+soname_spec=
+postinstall_cmds=
+postuninstall_cmds=
+finish_cmds=
+finish_eval=
+shlibpath_var=
+version_type=none
+dynamic_linker="$host_os ld.so"
+
+echo $ac_n "checking dynamic linker characteristics... $ac_c" 1>&6
+case "$host_os" in
+aix3* | aix4*)
+ version_type=linux
+ library_names_spec='${libname}${release}.so$versuffix $libname.a'
+ shlibpath_var=LIBPATH
+
+ # AIX has no versioning support, so we append a major version to the name.
+ soname_spec='${libname}${release}.so$major'
+ ;;
+
+amigaos*)
+ library_names_spec='$libname.ixlibrary $libname.a'
+ # Create ${libname}_ixlibrary.a entries in /sys/libs.
+ finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`$echo "X$lib" | $Xsed -e '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; test $rm /sys/libs/${libname}_ixlibrary.a; $show "(cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a)"; (cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a) || exit 1; done'
+ ;;
+
+freebsd2* | freebsd3*)
+ version_type=sunos
+ library_names_spec='${libname}${release}.so$versuffix $libname.so'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+gnu*)
+ version_type=linux
+ library_names_spec='${libname}${release}.so$versuffix ${libname}.so'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+hpux9* | hpux10* | hpux11*)
+ # Give a soname corresponding to the major version so that dld.sl refuses to
+ # link against other versions.
+ dynamic_linker="$host_os dld.sl"
+ version_type=sunos
+ shlibpath_var=SHLIB_PATH
+ library_names_spec='${libname}${release}.sl$versuffix ${libname}${release}.sl$major $libname.sl'
+ soname_spec='${libname}${release}.sl$major'
+ # HP-UX runs *really* slowly unless shared libraries are mode 555.
+ postinstall_cmds='chmod 555 $lib'
+ ;;
+
+irix5* | irix6*)
+ version_type=osf
+ soname_spec='${libname}${release}.so'
+ library_names_spec='${libname}${release}.so$versuffix $libname.so'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+# No shared lib support for Linux oldld, aout, or coff.
+linux-gnuoldld* | linux-gnuaout* | linux-gnucoff*)
+ dynamic_linker=no
+ ;;
+
+# This must be Linux ELF.
+linux-gnu*)
+ version_type=linux
+ library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so'
+ soname_spec='${libname}${release}.so$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+
+ if test -f /lib/ld.so.1; then
+ dynamic_linker='GNU ld.so'
+ else
+ # Only the GNU ld.so supports shared libraries on MkLinux.
+ case "$host_cpu" in
+ powerpc*) dynamic_linker=no ;;
+ *) dynamic_linker='Linux ld.so' ;;
+ esac
+ fi
+ ;;
+
+netbsd* | openbsd*)
+ version_type=sunos
+ library_names_spec='${libname}${release}.so$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+os2*)
+ libname_spec='$name'
+ library_names_spec='$libname.dll $libname.a'
+ dynamic_linker='OS/2 ld.exe'
+ shlibpath_var=LIBPATH
+ ;;
+
+osf3* | osf4*)
+ version_type=osf
+ soname_spec='${libname}${release}.so'
+ library_names_spec='${libname}${release}.so$versuffix $libname.so'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+sco3.2v5*)
+ version_type=osf
+ soname_spec='${libname}${release}.so$major'
+ library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+solaris2*)
+ version_type=linux
+ library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so'
+ soname_spec='${libname}${release}.so$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ # ldd complains unless libraries are executable
+ postinstall_cmds='chmod +x $lib'
+ ;;
+
+sunos4*)
+ version_type=sunos
+ library_names_spec='${libname}${release}.so$versuffix'
+ finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+sysv4.2uw2*)
+ version_type=linux
+ library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so'
+ soname_spec='${libname}${release}.so$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+uts4*)
+ version_type=linux
+ library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so'
+ soname_spec='${libname}${release}.so$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+*)
+ dynamic_linker=no
+ ;;
+esac
+echo "$ac_t$dynamic_linker"
+test "$dynamic_linker" = no && can_build_shared=no
+
+# Report the final consequences.
+echo "checking if libtool supports shared libraries... $can_build_shared" 1>&6
+
+echo $ac_n "checking whether to build shared libraries... $ac_c" 1>&6
+test "$can_build_shared" = "no" && enable_shared=no
+
+# On AIX, shared libraries and static libraries use the same namespace, and
+# are all built from PIC.
+case "$host_os" in
+aix*)
+ test "$enable_shared" = yes && enable_static=no
+ if test -n "$RANLIB"; then
+ archive_cmds="$archive_cmds;\$RANLIB \$lib"
+ postinstall_cmds='$RANLIB $lib'
+ fi
+ ;;
+esac
+
+echo "$ac_t$enable_shared" 1>&6
+
+# Make sure either enable_shared or enable_static is yes.
+test "$enable_shared" = yes || enable_static=yes
+
+echo "checking whether to build static libraries... $enable_static" 1>&6
+
+echo $ac_n "checking for objdir... $ac_c" 1>&6
+rm -f .libs 2>/dev/null
+mkdir .libs 2>/dev/null
+if test -d .libs; then
+ objdir=.libs
+else
+ # MS-DOS does not allow filenames that begin with a dot.
+ objdir=_libs
+fi
+rmdir .libs 2>/dev/null
+echo "$ac_t$objdir" 1>&6
+
+# Copy echo and quote the copy, instead of the original, because it is
+# used later.
+ltecho="$echo"
+
+# Now quote all the things that may contain metacharacters.
+for var in ltecho old_CC old_CFLAGS old_CPPFLAGS old_LD old_NM old_RANLIB \
+ old_LN_S AR CC LD LN_S NM reload_flag reload_cmds wl pic_flag \
+ link_static_flag no_builtin_flag export_dynamic_flag_spec \
+ whole_archive_flag_spec libname_spec library_names_spec soname_spec RANLIB \
+ old_archive_cmds old_archive_from_new_cmds old_postinstall_cmds \
+ old_postuninstall_cmds archive_cmds postinstall_cmds postuninstall_cmds \
+ allow_undefined_flag no_undefined_flag \
+ finish_cmds finish_eval global_symbol_pipe \
+ hardcode_libdir_flag_spec hardcode_libdir_separator; do
+
+ case "$var" in
+ reload_cmds | old_archive_cmds | old_archive_from_new_cmds | \
+ old_postinstall_cmds | old_postuninstall_cmds | archive_cmds | \
+ postinstall_cmds | postuninstall_cmds | finish_cmds)
+ # Double-quote double-evaled strings.
+ eval "$var=\`\$echo \"X\$$var\" | \$Xsed -e \"\$double_quote_subst\" -e \"\$sed_quote_subst\"\`"
+ ;;
+ *)
+ eval "$var=\`\$echo \"X\$$var\" | \$Xsed -e \"\$sed_quote_subst\"\`"
+ ;;
+ esac
+done
+
+trap "$rm \"$ofile\"; exit 1" 1 2 15
+echo "creating $ofile"
+$rm "$ofile"
+cat <<EOF > "$ofile"
+#! $SHELL
+
+# `$echo "$ofile" | sed 's%^.*/%%'` - Provide generalized library-building support services.
+# Generated automatically by $PROGRAM - GNU $PACKAGE $VERSION
+# NOTE: Changes made to this file will be lost: look at ltconfig or ltmain.sh.
+#
+# Copyright (C) 1996-1998 Free Software Foundation, Inc.
+# Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# Sed that helps us avoid accidentally triggering echo(1) options like -n.
+Xsed="sed -e s/^X//"
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+if test "\${CDPATH+set}" = set; then CDPATH=; export CDPATH; fi
+
+### BEGIN LIBTOOL CONFIG
+# Libtool was configured as follows, on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+#
+# CC="$old_CC" CFLAGS="$old_CFLAGS" CPPFLAGS="$old_CPPFLAGS" \\
+# LD="$old_LD" NM="$old_NM" RANLIB="$old_RANLIB" LN_S="$old_LN_S" \\
+# $0$ltconfig_args
+#
+# Compiler and other test output produced by $progname, useful for
+# debugging $progname, is in ./config.log if it exists.
+
+# The version of $progname that generated this script.
+LTCONFIG_VERSION="$VERSION"
+
+# Shell to use when invoking shell scripts.
+SHELL="$SHELL"
+
+# Whether or not to build shared libraries.
+build_libtool_libs=$enable_shared
+
+# Whether or not to build static libraries.
+build_old_libs=$enable_static
+
+# The host system.
+host_alias="$host_alias"
+host="$host"
+
+# An echo program that does not interpret backslashes.
+echo="$ltecho"
+
+# The archiver.
+AR="$AR"
+
+# The default C compiler.
+CC="$CC"
+
+# The linker used to build libraries.
+LD="$LD"
+
+# Whether we need hard or soft links.
+LN_S="$LN_S"
+
+# A BSD-compatible nm program.
+NM="$NM"
+
+# The name of the directory that contains temporary libtool files.
+objdir="$objdir"
+
+# How to create reloadable object files.
+reload_flag="$reload_flag"
+reload_cmds="$reload_cmds"
+
+# How to pass a linker flag through the compiler.
+wl="$wl"
+
+# Additional compiler flags for building library objects.
+pic_flag="$pic_flag"
+
+# Compiler flag to prevent dynamic linking.
+link_static_flag="$link_static_flag"
+
+# Compiler flag to turn off builtin functions.
+no_builtin_flag="$no_builtin_flag"
+
+# Compiler flag to allow reflexive dlopens.
+export_dynamic_flag_spec="$export_dynamic_flag_spec"
+
+# Compiler flag to generate shared objects directly from archives.
+whole_archive_flag_spec="$whole_archive_flag_spec"
+
+# Library versioning type.
+version_type=$version_type
+
+# Format of library name prefix.
+libname_spec="$libname_spec"
+
+# List of archive names. First name is the real one, the rest are links.
+# The last name is the one that the linker finds with -lNAME.
+library_names_spec="$library_names_spec"
+
+# The coded name of the library, if different from the real name.
+soname_spec="$soname_spec"
+
+# Commands used to build and install an old-style archive.
+RANLIB="$RANLIB"
+old_archive_cmds="$old_archive_cmds"
+old_postinstall_cmds="$old_postinstall_cmds"
+old_postuninstall_cmds="$old_postuninstall_cmds"
+
+# Create an old-style archive from a shared archive.
+old_archive_from_new_cmds="$old_archive_from_new_cmds"
+
+# Commands used to build and install a shared archive.
+archive_cmds="$archive_cmds"
+postinstall_cmds="$postinstall_cmds"
+postuninstall_cmds="$postuninstall_cmds"
+
+# Flag that allows shared libraries with undefined symbols to be built.
+allow_undefined_flag="$allow_undefined_flag"
+
+# Flag that forces no undefined symbols.
+no_undefined_flag="$no_undefined_flag"
+
+# Commands used to finish a libtool library installation in a directory.
+finish_cmds="$finish_cmds"
+
+# Same as above, but a single script fragment to be evaled but not shown.
+finish_eval="$finish_eval"
+
+# Take the output of nm and produce a listing of raw symbols and C names.
+global_symbol_pipe="$global_symbol_pipe"
+
+# This is the shared library runtime path variable.
+runpath_var=$runpath_var
+
+# This is the shared library path variable.
+shlibpath_var=$shlibpath_var
+
+# How to hardcode a shared library path into an executable.
+hardcode_action=$hardcode_action
+
+# Flag to hardcode \$libdir into a binary during linking.
+# This must work even if \$libdir does not exist.
+hardcode_libdir_flag_spec="$hardcode_libdir_flag_spec"
+
+# Whether we need a single -rpath flag with a separated argument.
+hardcode_libdir_separator="$hardcode_libdir_separator"
+
+# Set to yes if using DIR/libNAME.so during linking hardcodes DIR into the
+# resulting binary.
+hardcode_direct=$hardcode_direct
+
+# Set to yes if using the -LDIR flag during linking hardcodes DIR into the
+# resulting binary.
+hardcode_minus_L=$hardcode_minus_L
+
+# Set to yes if using SHLIBPATH_VAR=DIR during linking hardcodes DIR into
+# the resulting binary.
+hardcode_shlibpath_var=$hardcode_shlibpath_var
+EOF
+
+case "$host_os" in
+aix3*)
+ cat <<\EOF >> "$ofile"
+
+# AIX sometimes has problems with the GCC collect2 program. For some
+# reason, if we set the COLLECT_NAMES environment variable, the problems
+# vanish in a puff of smoke.
+if test "${COLLECT_NAMES+set}" != set; then
+ COLLECT_NAMES=
+ export COLLECT_NAMES
+fi
+EOF
+ ;;
+esac
+
+echo '### END LIBTOOL CONFIG' >> "$ofile"
+echo >> "$ofile"
+
+# Append the ltmain.sh script.
+cat "$ltmain" >> "$ofile" || (rm -f "$ofile"; exit 1)
+
+chmod +x "$ofile"
+exit 0
+
+# Local Variables:
+# mode:shell-script
+# sh-indentation:2
+# End:
--- /dev/null
+# ltmain.sh - Provide generalized library-building support services.
+# NOTE: Changing this file will not affect anything until you rerun ltconfig.
+#
+# Copyright (C) 1996-1998 Free Software Foundation, Inc.
+# Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# Check that we have a working $echo.
+if test "X$1" = X--no-reexec; then
+ # Discard the --no-reexec flag, and continue.
+ shift
+elif test "X`($echo '\t') 2>/dev/null`" = 'X\t'; then
+ # Yippee, $echo works!
+ :
+else
+ # Restart under the correct shell, and then maybe $echo will work.
+ exec $SHELL "$0" --no-reexec ${1+"$@"}
+fi
+
+# The name of this program.
+progname=`$echo "$0" | sed 's%^.*/%%'`
+modename="$progname"
+
+# Constants.
+PROGRAM=ltmain.sh
+PACKAGE=libtool
+VERSION=1.2b
+
+default_mode=
+help="Try \`$progname --help' for more information."
+magic="%%%MAGIC variable%%%"
+mkdir="mkdir"
+mv="mv -f"
+rm="rm -f"
+
+# Sed substitution that helps us do robust quoting. It backslashifies
+# metacharacters that are still active within double-quoted strings.
+Xsed='sed -e s/^X//'
+sed_quote_subst='s/\([\\`\\"$\\\\]\)/\\\1/g'
+
+# NLS nuisances.
+# Only set LANG and LC_ALL to C if already set.
+# These must not be set unconditionally because not all systems understand
+# e.g. LANG=C (notably SCO).
+# We save the old values to restore during execute mode.
+if test "${LC_ALL+set}" = set; then
+ save_LC_ALL="$LC_ALL"; LC_ALL=C; export LC_ALL
+fi
+if test "${LANG+set}" = set; then
+ save_LANG="$LANG"; LANG=C; export LANG
+fi
+
+if test "$LTCONFIG_VERSION" != "$VERSION"; then
+ echo "$modename: ltconfig version \`$LTCONFIG_VERSION' does not match $PROGRAM version \`$VERSION'" 1>&2
+ echo "Fatal configuration error. See the $PACKAGE docs for more information." 1>&2
+ exit 1
+fi
+
+if test "$build_libtool_libs" != yes && test "$build_old_libs" != yes; then
+ echo "$modename: not configured to build any kind of library" 1>&2
+ echo "Fatal configuration error. See the $PACKAGE docs for more information." 1>&2
+ exit 1
+fi
+
+# Global variables.
+mode=$default_mode
+nonopt=
+prev=
+prevopt=
+run=
+show="$echo"
+show_help=
+execute_dlfiles=
+
+# Parse our command line options once, thoroughly.
+while test $# -gt 0
+do
+ arg="$1"
+ shift
+
+ case "$arg" in
+ -*=*) optarg=`$echo "X$arg" | $Xsed -e 's/[-_a-zA-Z0-9]*=//'` ;;
+ *) optarg= ;;
+ esac
+
+ # If the previous option needs an argument, assign it.
+ if test -n "$prev"; then
+ case "$prev" in
+ execute_dlfiles)
+ eval "$prev=\"\$$prev \$arg\""
+ ;;
+ *)
+ eval "$prev=\$arg"
+ ;;
+ esac
+
+ prev=
+ prevopt=
+ continue
+ fi
+
+ # Have we seen a non-optional argument yet?
+ case "$arg" in
+ --help)
+ show_help=yes
+ ;;
+
+ --version)
+ echo "$PROGRAM (GNU $PACKAGE) $VERSION"
+ exit 0
+ ;;
+
+ --config)
+ sed -e '1,/^### BEGIN LIBTOOL CONFIG/d' -e '/^### END LIBTOOL CONFIG/,$d' $0
+ exit 0
+ ;;
+
+ --debug)
+ echo "$progname: enabling shell trace mode"
+ set -x
+ ;;
+
+ --dry-run | -n)
+ run=:
+ ;;
+
+ --features)
+ echo "host: $host"
+ if test "$build_libtool_libs" = yes; then
+ echo "enable shared libraries"
+ else
+ echo "disable shared libraries"
+ fi
+ if test "$build_old_libs" = yes; then
+ echo "enable static libraries"
+ else
+ echo "disable static libraries"
+ fi
+ exit 0
+ ;;
+
+ --finish) mode="finish" ;;
+
+ --mode) prevopt="--mode" prev=mode ;;
+ --mode=*) mode="$optarg" ;;
+
+ --quiet | --silent)
+ show=:
+ ;;
+
+ -dlopen)
+ prevopt="-dlopen"
+ prev=execute_dlfiles
+ ;;
+
+ -*)
+ $echo "$modename: unrecognized option \`$arg'" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ ;;
+
+ *)
+ nonopt="$arg"
+ break
+ ;;
+ esac
+done
+
+if test -n "$prevopt"; then
+ $echo "$modename: option \`$prevopt' requires an argument" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+fi
+
+if test -z "$show_help"; then
+
+ # Infer the operation mode.
+ if test -z "$mode"; then
+ case "$nonopt" in
+ *cc | *++ | gcc* | *-gcc*)
+ mode=link
+ for arg
+ do
+ case "$arg" in
+ -c)
+ mode=compile
+ break
+ ;;
+ esac
+ done
+ ;;
+ *db | *dbx | *strace | *truss)
+ mode=execute
+ ;;
+ *install*|cp|mv)
+ mode=install
+ ;;
+ *rm)
+ mode=uninstall
+ ;;
+ *)
+ # If we have no mode, but dlfiles were specified, then do execute mode.
+ test -n "$execute_dlfiles" && mode=execute
+
+ # Just use the default operation mode.
+ if test -z "$mode"; then
+ if test -n "$nonopt"; then
+ $echo "$modename: warning: cannot infer operation mode from \`$nonopt'" 1>&2
+ else
+ $echo "$modename: warning: cannot infer operation mode without MODE-ARGS" 1>&2
+ fi
+ fi
+ ;;
+ esac
+ fi
+
+ # Only execute mode is allowed to have -dlopen flags.
+ if test -n "$execute_dlfiles" && test "$mode" != execute; then
+ $echo "$modename: unrecognized option \`-dlopen'" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ fi
+
+ # Change the help message to a mode-specific one.
+ generic_help="$help"
+ help="Try \`$modename --help --mode=$mode' for more information."
+
+ # These modes are in order of execution frequency so that they run quickly.
+ case "$mode" in
+ # libtool compile mode
+ compile)
+ modename="$modename: compile"
+ # Get the compilation command and the source file.
+ base_compile=
+ lastarg=
+ srcfile="$nonopt"
+ suppress_output=
+
+ for arg
+ do
+ # Accept any command-line options.
+ case "$arg" in
+ -o)
+ $echo "$modename: you cannot specify the output filename with \`-o'" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ ;;
+
+ -static)
+ build_old_libs=yes
+ continue
+ ;;
+ esac
+
+ # Accept the current argument as the source file.
+ lastarg="$srcfile"
+ srcfile="$arg"
+
+ # Aesthetically quote the previous argument.
+
+ # Backslashify any backslashes, double quotes, and dollar signs.
+ # These are the only characters that are still specially
+ # interpreted inside of double-quoted scrings.
+ lastarg=`$echo "X$lastarg" | $Xsed -e "$sed_quote_subst"`
+
+ # Double-quote args containing other shell metacharacters.
+ # Many Bourne shells cannot handle close brackets correctly in scan
+ # sets, so we specify it separately.
+ case "$lastarg" in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*)
+ lastarg="\"$lastarg\""
+ ;;
+ esac
+
+ # Add the previous argument to base_compile.
+ if test -z "$base_compile"; then
+ base_compile="$lastarg"
+ else
+ base_compile="$base_compile $lastarg"
+ fi
+ done
+
+ # Get the name of the library object.
+ libobj=`$echo "X$srcfile" | $Xsed -e 's%^.*/%%'`
+
+ # Recognize several different file suffixes.
+ xform='[cCFSfms]'
+ case "$libobj" in
+ *.ada) xform=ada ;;
+ *.adb) xform=adb ;;
+ *.ads) xform=ads ;;
+ *.asm) xform=asm ;;
+ *.c++) xform=c++ ;;
+ *.cc) xform=cc ;;
+ *.cpp) xform=cpp ;;
+ *.cxx) xform=cxx ;;
+ *.f90) xform=f90 ;;
+ *.for) xform=for ;;
+ esac
+
+ libobj=`$echo "X$libobj" | $Xsed -e "s/\.$xform$/.lo/"`
+
+ case "$libobj" in
+ *.lo) obj=`$echo "X$libobj" | $Xsed -e 's/\.lo$/.o/'` ;;
+ *)
+ $echo "$modename: cannot determine name of library object from \`$srcfile'" 1>&2
+ exit 1
+ ;;
+ esac
+
+ if test -z "$base_compile"; then
+ $echo "$modename: you must specify a compilation command" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ fi
+
+ # Delete any leftover library objects.
+ if test "$build_old_libs" = yes; then
+ $run $rm $obj $libobj
+ trap "$run $rm $obj $libobj; exit 1" 1 2 15
+ else
+ $run $rm $libobj
+ trap "$run $rm $libobj; exit 1" 1 2 15
+ fi
+
+ # Only build a PIC object if we are building libtool libraries.
+ if test "$build_libtool_libs" = yes; then
+ # Without this assignment, base_compile gets emptied.
+ fbsd_hideous_sh_bug=$base_compile
+
+ # All platforms use -DPIC, to notify preprocessed assembler code.
+ $show "$base_compile$pic_flag -DPIC $srcfile"
+ if $run eval "$base_compile\$pic_flag -DPIC \$srcfile"; then :
+ else
+ test -n "$obj" && $run $rm $obj
+ exit 1
+ fi
+
+ # If we have no pic_flag, then copy the object into place and finish.
+ if test -z "$pic_flag"; then
+ $show "$LN_S $obj $libobj"
+ $run $LN_S $obj $libobj
+ exit $?
+ fi
+
+ # Just move the object, then go on to compile the next one
+ $show "$mv $obj $libobj"
+ $run $mv $obj $libobj || exit $?
+
+ # Allow error messages only from the first compilation.
+ suppress_output=' >/dev/null 2>&1'
+ fi
+
+ # Only build a position-dependent object if we build old libraries.
+ if test "$build_old_libs" = yes; then
+ # Suppress compiler output if we already did a PIC compilation.
+ $show "$base_compile $srcfile$suppress_output"
+ if $run eval "$base_compile \$srcfile$suppress_output"; then :
+ else
+ $run $rm $obj $libobj
+ exit 1
+ fi
+ fi
+
+ # Create an invalid libtool object if no PIC, so that we do not
+ # accidentally link it into a program.
+ if test "$build_libtool_libs" != yes; then
+ $show "echo timestamp > $libobj"
+ $run eval "echo timestamp > \$libobj" || exit $?
+ fi
+
+ exit 0
+ ;;
+
+ # libtool link mode
+ link)
+ modename="$modename: link"
+ CC="$nonopt"
+ allow_undefined=yes
+ compile_command="$CC"
+ finalize_command="$CC"
+
+ compile_shlibpath=
+ finalize_shlibpath=
+ convenience=
+ old_convenience=
+ deplibs=
+ dlfiles=
+ dlprefiles=
+ export_dynamic=no
+ generated=
+ hardcode_libdirs=
+ libobjs=
+ link_against_libtool_libs=
+ ltlibs=
+ objs=
+ prev=
+ prevarg=
+ release=
+ rpath=
+ perm_rpath=
+ temp_rpath=
+ vinfo=
+
+ # We need to know -static, to get the right output filenames.
+ for arg
+ do
+ case "$arg" in
+ -all-static | -static)
+ if test "X$arg" = "X-all-static" && test "$build_libtool_libs" = yes && test -z "$link_static_flag"; then
+ $echo "$modename: warning: complete static linking is impossible in this configuration" 1>&2
+ fi
+ build_libtool_libs=no
+ build_old_libs=yes
+ break
+ ;;
+ esac
+ done
+
+ # See if our shared archives depend on static archives.
+ test -n "$old_archive_from_new_cmds" && build_old_libs=yes
+
+ # Go through the arguments, transforming them on the way.
+ while test $# -gt 0; do
+ arg="$1"
+ shift
+
+ # If the previous option needs an argument, assign it.
+ if test -n "$prev"; then
+ case "$prev" in
+ output)
+ compile_command="$compile_command @OUTPUT@"
+ finalize_command="$finalize_command @OUTPUT@"
+ ;;
+ esac
+
+ case "$prev" in
+ dlfiles|dlprefiles)
+ case "$arg" in
+ *.la | *.lo) ;; # We handle these cases below.
+ *)
+ dlprefiles="$dlprefiles $arg"
+ test "$prev" = dlfiles && dlfiles="$dlfiles $arg"
+ prev=
+ ;;
+ esac
+ ;;
+ release)
+ release="-$arg"
+ prev=
+ continue
+ ;;
+ rpath)
+ rpath="$rpath $arg"
+ prev=
+ continue
+ ;;
+ *)
+ eval "$prev=\"\$arg\""
+ prev=
+ continue
+ ;;
+ esac
+ fi
+
+ prevarg="$arg"
+
+ case "$arg" in
+ -all-static)
+ if test -n "$link_static_flag"; then
+ compile_command="$compile_command $link_static_flag"
+ finalize_command="$finalize_command $link_static_flag"
+ fi
+ continue
+ ;;
+
+ -allow-undefined)
+ # FIXME: remove this flag sometime in the future.
+ $echo "$modename: \`-allow-undefined' is deprecated because it is the default" 1>&2
+ continue
+ ;;
+
+ -dlopen)
+ prev=dlfiles
+ continue
+ ;;
+
+ -dlpreopen)
+ prev=dlprefiles
+ continue
+ ;;
+
+ -export-dynamic)
+ if test "$export_dynamic" != yes; then
+ export_dynamic=yes
+ if test -n "$export_dynamic_flag_spec"; then
+ eval arg=\"$export_dynamic_flag_spec\"
+ else
+ arg=
+ fi
+
+ # Add the symbol object into the linking commands.
+ compile_command="$compile_command @SYMFILE@"
+ finalize_command="$finalize_command @SYMFILE@"
+ fi
+ ;;
+
+ -L*)
+ dir=`$echo "X$arg" | $Xsed -e 's%^-L\(.*\)$%\1%'`
+ case "$dir" in
+ /* | [A-Za-z]:[/\\]*)
+ # Add the corresponding hardcode_libdir_flag, if it is not identical.
+ ;;
+ *)
+ $echo "$modename: \`-L$dir' cannot specify a relative directory" 1>&2
+ exit 1
+ ;;
+ esac
+ deplibs="$deplibs $arg"
+ ;;
+
+ -l*) deplibs="$deplibs $arg" ;;
+
+ -no-undefined)
+ allow_undefined=no
+ continue
+ ;;
+
+ -o) prev=output ;;
+
+ -release)
+ prev=release
+ continue
+ ;;
+
+ -rpath)
+ prev=rpath
+ continue
+ ;;
+
+ -static)
+ # If we have no pic_flag, then this is the same as -all-static.
+ if test -z "$pic_flag" && test -n "$link_static_flag"; then
+ compile_command="$compile_command $link_static_flag"
+ finalize_command="$finalize_command $link_static_flag"
+ fi
+ continue
+ ;;
+
+ -version-info)
+ prev=vinfo
+ continue
+ ;;
+
+ # Some other compiler flag.
+ -* | +*)
+ # Unknown arguments in both finalize_command and compile_command need
+ # to be aesthetically quoted because they are evaled later.
+ arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"`
+ case "$arg" in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*)
+ arg="\"$arg\""
+ ;;
+ esac
+ ;;
+
+ *.o | *.a)
+ # A standard object.
+ objs="$objs $arg"
+ ;;
+
+ *.lo)
+ # A library object.
+ if test "$prev" = dlfiles; then
+ dlfiles="$dlfiles $arg"
+ if test "$build_libtool_libs" = yes; then
+ prev=
+ continue
+ else
+ # If libtool objects are unsupported, then we need to preload.
+ prev=dlprefiles
+ fi
+ fi
+
+ if test "$prev" = dlprefiles; then
+ # Preload the old-style object.
+ dlprefiles="$dlprefiles "`$echo "X$arg" | $Xsed -e 's/\.lo$/.o/'`
+ prev=
+ fi
+ libobjs="$libobjs $arg"
+ ;;
+
+ *.la)
+ # A libtool-controlled library.
+
+ dlname=
+ libdir=
+ library_names=
+ old_library=
+
+ # Check to see that this really is a libtool archive.
+ if (sed -e '2q' $arg | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then :
+ else
+ $echo "$modename: \`$arg' is not a valid libtool archive" 1>&2
+ exit 1
+ fi
+
+ # If there is no directory component, then add one.
+ case "$arg" in
+ */* | *\\*) . $arg ;;
+ *) . ./$arg ;;
+ esac
+
+ # Get the name of the library we link against.
+ linklib=
+ for l in $old_library $library_names; do
+ linklib="$l"
+ done
+
+ if test -z "$linklib"; then
+ $echo "$modename: cannot find name of link library for \`$arg'" 1>&2
+ exit 1
+ fi
+
+ # Find the relevant object directory and library name.
+ name=`$echo "X$arg" | $Xsed -e 's%^.*/%%' -e 's/\.la$//' -e 's/^lib//'`
+ dir=`$echo "X$arg" | $Xsed -e 's%/[^/]*$%%'`
+ if test "X$dir" = "X$arg"; then
+ dir="$objdir"
+ else
+ dir="$dir/$objdir"
+ fi
+
+ if test -z "$libdir"; then
+ # It is a libtool convenience library, so add in its objects.
+ convenience="$convenience $dir/$old_library"l
+ old_convenience="$old_convenience $dir/$old_library"
+ compile_command="$compile_command $dir/$old_library"
+ finalize_command="$finalize_command $dir/$old_library"
+ continue
+ fi
+
+ # This library was specified with -dlopen.
+ if test "$prev" = dlfiles; then
+ dlfiles="$dlfiles $arg"
+ if test -z "$dlname"; then
+ # If there is no dlname, we need to preload.
+ prev=dlprefiles
+ else
+ # We should not create a dependency on this library, but we
+ # may need any libraries it requires.
+ compile_command="$compile_command$dependency_libs"
+ finalize_command="$finalize_command$dependency_libs"
+ prev=
+ continue
+ fi
+ fi
+
+ # The library was specified with -dlpreopen.
+ if test "$prev" = dlprefiles; then
+ # Prefer using a static library (so that no silly _DYNAMIC symbols
+ # are required to link).
+ if test -n "$old_library"; then
+ dlprefiles="$dlprefiles $dir/$old_library"
+ else
+ dlprefiles="$dlprefiles $dir/$linklib"
+ fi
+ prev=
+ fi
+
+ if test "$build_libtool_libs" = yes && test -n "$library_names"; then
+ link_against_libtool_libs="$link_against_libtool_libs $arg"
+ if test -n "$shlibpath_var"; then
+ # Make sure the rpath contains only unique directories.
+ case "$temp_rpath " in
+ *" $dir "*) ;;
+ *) temp_rpath="$temp_rpath $dir" ;;
+ esac
+ fi
+
+ # This is the magic to use -rpath.
+ if test -n "$hardcode_libdir_flag_spec"; then
+ if test -n "$hardcode_libdir_separator"; then
+ if test -z "$hardcode_libdirs"; then
+ # Put the magic libdir with the hardcode flag.
+ hardcode_libdirs="$libdir"
+ libdir="@HARDCODE_LIBDIRS@"
+ else
+ # Just accumulate the unique libdirs.
+ case "$hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator" in
+ *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*)
+ ;;
+ *)
+ hardcode_libdirs="$hardcode_libdirs$hardcode_libdir_separator$libdir"
+ ;;
+ esac
+ libdir=
+ fi
+ fi
+
+ if test -n "$libdir"; then
+ eval flag=\"$hardcode_libdir_flag_spec\"
+
+ compile_command="$compile_command $flag"
+ finalize_command="$finalize_command $flag"
+ fi
+ elif test -n "$runpath_var"; then
+ # Do the same for the permanent run path.
+ case "$perm_rpath " in
+ *" $libdir "*) ;;
+ *) perm_rpath="$perm_rpath $libdir" ;;
+ esac
+ fi
+
+
+ lib_linked=yes
+ case "$hardcode_action" in
+ immediate | unsupported)
+ if test "$hardcode_direct" = no; then
+ compile_command="$compile_command $dir/$linklib"
+ elif test "$hardcode_minus_L" = no; then
+ compile_command="$compile_command -L$dir -l$name"
+ elif test "$hardcode_shlibpath_var" = no; then
+ compile_shlibpath="$compile_shlibpath$dir:"
+ compile_command="$compile_command -l$name"
+ else
+ lib_linked=no
+ fi
+ ;;
+
+ relink)
+ # We need an absolute path.
+ case "$dir" in
+ /* | [A-Za-z]:[/\\]*) ;;
+ *)
+ absdir=`cd "$dir" && pwd`
+ if test -z "$absdir"; then
+ $echo "$modename: cannot determine absolute directory name of \`$dir'" 1>&2
+ exit 1
+ fi
+ dir="$absdir"
+ ;;
+ esac
+
+ if test "$hardcode_direct" = yes; then
+ compile_command="$compile_command $dir/$linklib"
+ elif test "$hardcode_minus_L" = yes; then
+ compile_command="$compile_command -L$dir -l$name"
+ elif test "$hardcode_shlibpath_var" = yes; then
+ compile_shlibpath="$compile_shlibpath$dir:"
+ compile_command="$compile_command -l$name"
+ else
+ lib_linked=no
+ fi
+ ;;
+
+ *)
+ lib_linked=no
+ ;;
+ esac
+
+ if test "$lib_linked" != yes; then
+ $echo "$modename: configuration error: unsupported hardcode properties"
+ exit 1
+ fi
+
+ # Finalize command for both is simple: just hardcode it.
+ if test "$hardcode_direct" = yes; then
+ finalize_command="$finalize_command $libdir/$linklib"
+ elif test "$hardcode_minus_L" = yes; then
+ finalize_command="$finalize_command -L$libdir -l$name"
+ elif test "$hardcode_shlibpath_var" = yes; then
+ finalize_shlibpath="$finalize_shlibpath$libdir:"
+ finalize_command="$finalize_command -l$name"
+ else
+ # We cannot seem to hardcode it, guess we'll fake it.
+ finalize_command="$finalize_command -L$libdir -l$name"
+ fi
+ else
+ # Transform directly to old archives if we don't build new libraries.
+ if test -n "$pic_flag" && test -z "$old_library"; then
+ $echo "$modename: cannot find static library for \`$arg'" 1>&2
+ exit 1
+ fi
+
+ # Here we assume that one of hardcode_direct or hardcode_minus_L
+ # is not unsupported. This is valid on all known static and
+ # shared platforms.
+ if test "$hardcode_direct" != unsupported; then
+ test -n "$old_library" && linklib="$old_library"
+ compile_command="$compile_command $dir/$linklib"
+ finalize_command="$finalize_command $dir/$linklib"
+ else
+ compile_command="$compile_command -L$dir -l$name"
+ finalize_command="$finalize_command -L$dir -l$name"
+ fi
+ fi
+
+ # Add in any libraries that this one depends upon.
+ compile_command="$compile_command$dependency_libs"
+ finalize_command="$finalize_command$dependency_libs"
+ continue
+ ;;
+
+ # Some other compiler argument.
+ *)
+ # Unknown arguments in both finalize_command and compile_command need
+ # to be aesthetically quoted because they are evaled later.
+ arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"`
+ case "$arg" in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*)
+ arg="\"$arg\""
+ ;;
+ esac
+ ;;
+ esac
+
+ # Now actually substitute the argument into the commands.
+ if test -n "$arg"; then
+ compile_command="$compile_command $arg"
+ finalize_command="$finalize_command $arg"
+ fi
+ done
+
+ if test -n "$prev"; then
+ $echo "$modename: the \`$prevarg' option requires an argument" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ fi
+
+ oldlibs=
+ case "$output" in
+ "")
+ $echo "$modename: you must specify an output file" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ ;;
+
+ */* | *\\*)
+ $echo "$modename: output file \`$output' must have no directory components" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ ;;
+
+ *.a)
+ if test -n "$link_against_libtool_libs"; then
+ $echo "$modename: error: cannot link libtool libraries into archives" 1>&2
+ exit 1
+ fi
+
+ if test -n "$deplibs"; then
+ $echo "$modename: warning: \`-l' and \`-L' are ignored for archives" 1>&2
+ fi
+
+ if test -n "$dlfiles$dlprefiles"; then
+ $echo "$modename: warning: \`-dlopen' is ignored for archives" 1>&2
+ fi
+
+ if test -n "$rpath"; then
+ $echo "$modename: warning: \`-rpath' is ignored for archives" 1>&2
+ fi
+
+ if test -n "$vinfo"; then
+ $echo "$modename: warning: \`-version-info' is ignored for archives" 1>&2
+ fi
+
+ if test -n "$release"; then
+ $echo "$modename: warning: \`-release' is ignored for archives" 1>&2
+ fi
+
+ # Now set the variables for building old libraries.
+ build_libtool_libs=no
+ oldlibs="$output"
+ ;;
+
+ *.la)
+ # Make sure we only generate libraries of the form `libNAME.la'.
+ case "$output" in
+ lib*) ;;
+ *)
+ $echo "$modename: libtool library \`$output' must begin with \`lib'" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ ;;
+ esac
+
+ name=`$echo "X$output" | $Xsed -e 's/\.la$//' -e 's/^lib//'`
+ eval libname=\"$libname_spec\"
+
+ # All the library-specific variables (install_libdir is set above).
+ library_names=
+ old_library=
+ dlname=
+
+ if test -n "$objs"; then
+ $echo "$modename: cannot build libtool library \`$output' from non-libtool objects:$objs" 2>&1
+ exit 1
+ fi
+
+ # How the heck are we supposed to write a wrapper for a shared library?
+ if test -n "$link_against_libtool_libs"; then
+ $echo "$modename: error: cannot link shared libraries into libtool libraries" 1>&2
+ exit 1
+ fi
+
+ if test -n "$dlfiles$dlprefiles"; then
+ $echo "$modename: warning: \`-dlopen' is ignored for libtool libraries" 1>&2
+ fi
+
+ set dummy $rpath
+ if test $# -gt 2; then
+ $echo "$modename: warning: ignoring multiple \`-rpath's for a libtool library" 1>&2
+ fi
+ install_libdir="$2"
+
+ # Now set the variables for building old libraries.
+ oldlibs="$objdir/$libname.a"
+ if test -z "$rpath"; then
+ # Building a libtool convenience library.
+ oldlibs="$objdir/$libname.al $oldlibs"
+ build_libtool_libs=convenience
+
+ if test -n "$vinfo"; then
+ $echo "$modename: warning: \`-version-info' is ignored for convenience libraries" 1>&2
+ fi
+
+ if test -n "$release"; then
+ $echo "$modename: warning: \`-release' is ignored for convenience libraries" 1>&2
+ fi
+ else
+
+ # Parse the version information argument.
+ IFS="${IFS= }"; save_ifs="$IFS"; IFS=':'
+ set dummy $vinfo 0 0 0
+ IFS="$save_ifs"
+
+ if test -n "$8"; then
+ $echo "$modename: too many parameters to \`-version-info'" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ fi
+
+ current="$2"
+ revision="$3"
+ age="$4"
+
+ # Check that each of the things are valid numbers.
+ case "$current" in
+ 0 | [1-9] | [1-9][0-9]*) ;;
+ *)
+ $echo "$modename: CURRENT \`$current' is not a nonnegative integer" 1>&2
+ $echo "$modename: \`$vinfo' is not valid version information" 1>&2
+ exit 1
+ ;;
+ esac
+
+ case "$revision" in
+ 0 | [1-9] | [1-9][0-9]*) ;;
+ *)
+ $echo "$modename: REVISION \`$revision' is not a nonnegative integer" 1>&2
+ $echo "$modename: \`$vinfo' is not valid version information" 1>&2
+ exit 1
+ ;;
+ esac
+
+ case "$age" in
+ 0 | [1-9] | [1-9][0-9]*) ;;
+ *)
+ $echo "$modename: AGE \`$age' is not a nonnegative integer" 1>&2
+ $echo "$modename: \`$vinfo' is not valid version information" 1>&2
+ exit 1
+ ;;
+ esac
+
+ if test $age -gt $current; then
+ $echo "$modename: AGE \`$age' is greater than the current interface number \`$current'" 1>&2
+ $echo "$modename: \`$vinfo' is not valid version information" 1>&2
+ exit 1
+ fi
+
+ # Calculate the version variables.
+ major=
+ versuffix=
+ verstring=
+ case "$version_type" in
+ none) ;;
+
+ linux)
+ major=.`expr $current - $age`
+ versuffix="$major.$age.$revision"
+ ;;
+
+ osf)
+ major=`expr $current - $age`
+ versuffix=".$current.$age.$revision"
+ verstring="$current.$age.$revision"
+
+ # Add in all the interfaces that we are compatible with.
+ loop=$age
+ while test $loop != 0; do
+ iface=`expr $current - $loop`
+ loop=`expr $loop - 1`
+ verstring="$verstring:${iface}.0"
+ done
+
+ # Make executables depend on our current version.
+ verstring="$verstring:${current}.0"
+ ;;
+
+ sunos)
+ major=".$current"
+ versuffix=".$current.$revision"
+ ;;
+
+ *)
+ $echo "$modename: unknown library version type \`$version_type'" 1>&2
+ echo "Fatal configuration error. See the $PACKAGE docs for more information." 1>&2
+ exit 1
+ ;;
+ esac
+
+ # Clear the version info if we defaulted, and they specified a release.
+ if test -z "$vinfo" && test -n "$release"; then
+ major=
+ versuffix=
+ verstring="0.0"
+ fi
+
+ # Check to see if the archive will have undefined symbols.
+ if test "$allow_undefined" = yes; then
+ if test "$allow_undefined_flag" = unsupported; then
+ $echo "$modename: warning: undefined symbols not allowed in $host shared libraries" 1>&2
+ build_libtool_libs=no
+ build_old_libs=yes
+ fi
+ else
+ # Don't allow undefined symbols.
+ allow_undefined_flag="$no_undefined_flag"
+ fi
+
+ # Add libc to deplibs on all systems.
+ dependency_libs="$deplibs"
+ deplibs="$deplibs -lc"
+ fi
+
+ # Create the output directory, or remove our outputs if we need to.
+ if test -d $objdir; then
+ $show "${rm}r $objdir/$output $objdir/$libname.* $objdir/${libname}${release}.*"
+ $run ${rm}r $objdir/$output $objdir/$libname.* $objdir/${libname}${release}.*
+ else
+ $show "$mkdir $objdir"
+ $run $mkdir $objdir
+ status=$?
+ if test $status -ne 0 && test ! -d $objdir; then
+ exit $status
+ fi
+ fi
+
+ if test "$build_libtool_libs" = yes; then
+ # Get the real and link names of the library.
+ eval library_names=\"$library_names_spec\"
+ set dummy $library_names
+ realname="$2"
+ shift; shift
+
+ if test -n "$soname_spec"; then
+ eval soname=\"$soname_spec\"
+ else
+ soname="$realname"
+ fi
+
+ lib="$objdir/$realname"
+ for link
+ do
+ linknames="$linknames $link"
+ done
+
+ # Use standard objects if they are PIC.
+ test -z "$pic_flag" && libobjs=`$echo "X$libobjs " | $Xsed -e 's/\.lo /.o /g' -e 's/ $//g'`
+
+ # Transform .lo files to .o files.
+ test "$build_old_libs" = yes && oldobjs="$objs"`$echo "X$libobjs " | $Xsed -e 's/[^ ]*\.a //g' -e 's/\.lo /.o /g' -e 's/ $//g'`
+
+ if test -n "$whole_archive_flag_spec"; then
+ if test -n "$convenience"; then
+ eval libobjs=\"\$libobjs $whole_archive_flag_spec\"
+ fi
+ else
+ for xlib in $convenience; do
+ # Extract the objects.
+ xdir="$xlib"x
+ generated="$generated $xdir"
+ xlib=`echo "$xlib" | $Xsed -e 's%^.*/%%'`
+
+ $show "${rm}r $xdir"
+ $run ${rm}r "$xdir"
+ $show "mkdir $xdir"
+ $run mkdir "$xdir"
+ status=$?
+ if test $status -ne 0 && test ! -d "$xdir"; then
+ exit $status
+ fi
+ $show "(cd $xdir && $AR x ../$xlib)"
+ $run eval "(cd \$xdir && $AR x ../\$xlib)" || exit $?
+
+ libobjs="$libobjs `echo $xdir/*`"
+ done
+ fi
+
+ # Do each of the archive commands.
+ eval cmds=\"$archive_cmds\"
+ IFS="${IFS= }"; save_ifs="$IFS"; IFS=';'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ $show "$cmd"
+ $run eval "$cmd" || exit $?
+ done
+ IFS="$save_ifs"
+
+ # Create links to the real library.
+ for linkname in $linknames; do
+ if test "$realname" != "$linkname"; then
+ $show "(cd $objdir && $LN_S $realname $linkname)"
+ $run eval '(cd $objdir && $LN_S $realname $linkname)' || exit $?
+ fi
+ done
+
+ # If -export-dynamic was specified, set the dlname.
+ if test "$export_dynamic" = yes; then
+ # On all known operating systems, these are identical.
+ dlname="$soname"
+ fi
+ fi
+ ;;
+
+ *.lo | *.o)
+ if test -n "$link_against_libtool_libs"; then
+ $echo "$modename: error: cannot link libtool libraries into objects" 1>&2
+ exit 1
+ fi
+
+ if test -n "$deplibs"; then
+ $echo "$modename: warning: \`-l' and \`-L' are ignored for objects" 1>&2
+ fi
+
+ if test -n "$dlfiles$dlprefiles"; then
+ $echo "$modename: warning: \`-dlopen' is ignored for objects" 1>&2
+ fi
+
+ if test -n "$rpath"; then
+ $echo "$modename: warning: \`-rpath' is ignored for objects" 1>&2
+ fi
+
+ if test -n "$vinfo"; then
+ $echo "$modename: warning: \`-version-info' is ignored for objects" 1>&2
+ fi
+
+ if test -n "$release"; then
+ $echo "$modename: warning: \`-release' is ignored for objects" 1>&2
+ fi
+
+ case "$output" in
+ *.lo)
+ if test -n "$objs"; then
+ $echo "$modename: cannot build library object \`$output' from non-libtool objects" 1>&2
+ exit 1
+ fi
+ libobj="$output"
+ obj=`$echo "X$output" | $Xsed -e 's/\.lo$/.o/'`
+ ;;
+ *)
+ libobj=
+ obj="$output"
+ ;;
+ esac
+
+ # Delete the old objects.
+ $run $rm $obj $libobj
+
+ # Create the old-style object.
+ reload_objs="$objs"`$echo "X$libobjs " | $Xsed -e 's/[^ ]*\.a //g' -e 's/\.lo /.o /g' -e 's/ $//g'`
+
+ output="$obj"
+ eval cmds=\"$reload_cmds\"
+ IFS="${IFS= }"; save_ifs="$IFS"; IFS=';'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ $show "$cmd"
+ $run eval "$cmd" || exit $?
+ done
+ IFS="$save_ifs"
+
+ # Exit if we aren't doing a library object file.
+ test -z "$libobj" && exit 0
+
+ if test "$build_libtool_libs" != yes; then
+ # Create an invalid libtool object if no PIC, so that we don't
+ # accidentally link it into a program.
+ $show "echo timestamp > $libobj"
+ $run eval "echo timestamp > $libobj" || exit $?
+ exit 0
+ fi
+
+ if test -n "$pic_flag"; then
+ # Only do commands if we really have different PIC objects.
+ reload_objs="$libobjs"
+ output="$libobj"
+ eval cmds=\"$reload_cmds\"
+ IFS="${IFS= }"; save_ifs="$IFS"; IFS=';'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ $show "$cmd"
+ $run eval "$cmd" || exit $?
+ done
+ IFS="$save_ifs"
+ else
+ # Just create a symlink.
+ $show "$LN_S $obj $libobj"
+ $run $LN_S $obj $libobj || exit $?
+ fi
+
+ exit 0
+ ;;
+
+ *)
+ if test -n "$vinfo"; then
+ $echo "$modename: warning: \`-version-info' is ignored for programs" 1>&2
+ fi
+
+ if test -n "$release"; then
+ $echo "$modename: warning: \`-release' is ignored for programs" 1>&2
+ fi
+
+ if test -n "$rpath"; then
+ # If the user specified any rpath flags, then add them.
+ for libdir in $rpath; do
+ if test -n "$hardcode_libdir_flag_spec"; then
+ if test -n "$hardcode_libdir_separator"; then
+ if test -z "$hardcode_libdirs"; then
+ # Put the magic libdir with the hardcode flag.
+ hardcode_libdirs="$libdir"
+ libdir="@HARDCODE_LIBDIRS@"
+ else
+ # Just accumulate the unique libdirs.
+ case "$hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator" in
+ *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*)
+ ;;
+ *)
+ hardcode_libdirs="$hardcode_libdirs$hardcode_libdir_separator$libdir"
+ ;;
+ esac
+ libdir=
+ fi
+ fi
+
+ if test -n "$libdir"; then
+ eval flag=\"$hardcode_libdir_flag_spec\"
+
+ compile_command="$compile_command $flag"
+ finalize_command="$finalize_command $flag"
+ fi
+ elif test -n "$runpath_var"; then
+ case "$perm_rpath " in
+ *" $libdir "*) ;;
+ *) perm_rpath="$perm_rpath $libdir" ;;
+ esac
+ fi
+ done
+ fi
+
+ # Substitute the hardcoded libdirs into the compile commands.
+ if test -n "$hardcode_libdir_separator"; then
+ compile_command=`$echo "X$compile_command" | $Xsed -e "s%@HARDCODE_LIBDIRS@%$hardcode_libdirs%g"`
+ finalize_command=`$echo "X$finalize_command" | $Xsed -e "s%@HARDCODE_LIBDIRS@%$hardcode_libdirs%g"`
+ fi
+
+ if test -n "$libobjs" && test "$build_old_libs" = yes; then
+ # Transform all the library objects into standard objects.
+ compile_command=`$echo "X$compile_command " | $Xsed -e 's/\.lo /.o /g' -e 's/ $//'`
+ finalize_command=`$echo "X$finalize_command " | $Xsed -e 's/\.lo /.o /g' -e 's/ $//'`
+ fi
+
+ if test "$export_dynamic" = yes && test -n "$NM" && test -n "$global_symbol_pipe"; then
+ dlsyms="${output}S.c"
+ else
+ dlsyms=
+ fi
+
+ if test -n "$dlsyms"; then
+ # Add our own program objects to the preloaded list.
+ dlprefiles=`$echo "X$objs$dlprefiles " | $Xsed -e 's/\.lo /.o /g' -e 's/ $//'`
+
+ # Discover the nlist of each of the dlfiles.
+ nlist="$objdir/${output}.nm"
+
+ if test -d $objdir; then
+ $show "$rm $nlist ${nlist}T"
+ $run $rm "$nlist" "${nlist}T"
+ else
+ $show "$mkdir $objdir"
+ $run $mkdir $objdir
+ status=$?
+ if test $status -ne 0 && test ! -d $objdir; then
+ exit $status
+ fi
+ fi
+
+ for arg in $dlprefiles; do
+ $show "extracting global C symbols from \`$arg'"
+ $run eval "$NM $arg | $global_symbol_pipe >> '$nlist'"
+ done
+
+ # Parse the name list into a source file.
+ $show "creating $objdir/$dlsyms"
+ if test -z "$run"; then
+ # Make sure we at least have an empty file.
+ test -f "$nlist" || : > "$nlist"
+
+ # Try sorting and uniquifying the output.
+ if sort "$nlist" | uniq > "$nlist"T; then
+ mv -f "$nlist"T "$nlist"
+ wcout=`wc "$nlist" 2>/dev/null`
+ count=`echo "X$wcout" | $Xsed -e 's/^[ ]*\([0-9][0-9]*\).*$/\1/'`
+ (test "$count" -ge 0) 2>/dev/null || count=-1
+ else
+ $rm "$nlist"T
+ count=-1
+ fi
+
+ case "$dlsyms" in
+ "") ;;
+ *.c)
+ $echo > "$objdir/$dlsyms" "\
+/* $dlsyms - symbol resolution table for \`$output' dlsym emulation. */
+/* Generated by $PROGRAM - GNU $PACKAGE $VERSION */
+
+#ifdef __cplusplus
+extern \"C\" {
+#endif
+
+/* Prevent the only kind of declaration conflicts we can make. */
+#define dld_preloaded_symbol_count some_other_symbol
+#define dld_preloaded_symbols some_other_symbol
+
+/* External symbol declarations for the compiler. */\
+"
+
+ if test -f "$nlist"; then
+ sed -e 's/^.* \(.*\)$/extern char \1;/' < "$nlist" >> "$objdir/$dlsyms"
+ else
+ echo '/* NONE */' >> "$objdir/$dlsyms"
+ fi
+
+ $echo >> "$objdir/$dlsyms" "\
+
+#undef dld_preloaded_symbol_count
+#undef dld_preloaded_symbols
+
+#if defined (__STDC__) && __STDC__
+# define __ptr_t void *
+#else
+# define __ptr_t char *
+#endif
+
+/* The number of symbols in dld_preloaded_symbols, -1 if unsorted. */
+int dld_preloaded_symbol_count = $count;
+
+/* The mapping between symbol names and symbols. */
+struct {
+ char *name;
+ __ptr_t address;
+}
+dld_preloaded_symbols[] =
+{\
+"
+
+ if test -f "$nlist"; then
+ sed 's/^\(.*\) \(.*\)$/ {"\1", (__ptr_t) \&\2},/' < "$nlist" >> "$objdir/$dlsyms"
+ fi
+
+ $echo >> "$objdir/$dlsyms" "\
+ {0, (__ptr_t) 0}
+};
+
+#ifdef __cplusplus
+}
+#endif\
+"
+ ;;
+
+ *)
+ $echo "$modename: unknown suffix for \`$dlsyms'" 1>&2
+ exit 1
+ ;;
+ esac
+ fi
+
+ # Now compile the dynamic symbol file.
+ $show "(cd $objdir && $CC -c$no_builtin_flag \"$dlsyms\")"
+ $run eval '(cd $objdir && $CC -c$no_builtin_flag "$dlsyms")' || exit $?
+
+ # Transform the symbol file into the correct name.
+ compile_command=`$echo "X$compile_command" | $Xsed -e "s%@SYMFILE@%$objdir/${output}S.o%"`
+ finalize_command=`$echo "X$finalize_command" | $Xsed -e "s%@SYMFILE@%$objdir/${output}S.o%"`
+ elif test "$export_dynamic" != yes; then
+ test -n "$dlfiles$dlprefiles" && $echo "$modename: warning: \`-dlopen' and \`-dlpreopen' are ignored without \`-export-dynamic'" 1>&2
+ else
+ # We keep going just in case the user didn't refer to
+ # dld_preloaded_symbols. The linker will fail if global_symbol_pipe
+ # really was required.
+ $echo "$modename: not configured to extract global symbols from dlpreopened files" 1>&2
+
+ # Nullify the symbol file.
+ compile_command=`$echo "X$compile_command" | $Xsed -e "s% @SYMFILE@%%"`
+ finalize_command=`$echo "X$finalize_command" | $Xsed -e "s% @SYMFILE@%%"`
+ fi
+
+ if test -z "$link_against_libtool_libs" || test "$build_libtool_libs" != yes; then
+ # Replace the output file specification.
+ compile_command=`$echo "X$compile_command" | $Xsed -e 's%@OUTPUT@%'"$output"'%g'`
+ finalize_command=`$echo "X$finalize_command" | $Xsed -e 's%@OUTPUT@%'"$output"'%g'`
+
+ # We have no uninstalled library dependencies, so finalize right now.
+ $show "$compile_command"
+ $run eval "$compile_command"
+ exit $?
+ fi
+
+ # Replace the output file specification.
+ compile_command=`$echo "X$compile_command" | $Xsed -e 's%@OUTPUT@%'"$objdir/$output"'%g'`
+ finalize_command=`$echo "X$finalize_command" | $Xsed -e 's%@OUTPUT@%'"$objdir/$output"'T%g'`
+
+ # Create the binary in the object directory, then wrap it.
+ if test ! -d $objdir; then
+ $show "$mkdir $objdir"
+ $run $mkdir $objdir
+ status=$?
+ if test $status -ne 0 && test ! -d $objdir; then
+ exit $status
+ fi
+ fi
+
+ if test -n "$shlibpath_var"; then
+ # We should set the shlibpath_var
+ rpath=
+ for dir in $temp_rpath; do
+ case "$dir" in
+ /* | [A-Za-z]:[/\\]*)
+ # Absolute path.
+ rpath="$rpath$dir:"
+ ;;
+ *)
+ # Relative path: add a thisdir entry.
+ rpath="$rpath\$thisdir/$dir:"
+ ;;
+ esac
+ done
+ temp_rpath="$rpath"
+ fi
+
+ # Delete the old output file.
+ $run $rm $output
+
+ if test -n "$compile_shlibpath"; then
+ compile_command="$shlibpath_var=\"$compile_shlibpath\$$shlibpath_var\" $compile_command"
+ fi
+ if test -n "$finalize_shlibpath"; then
+ finalize_command="$shlibpath_var=\"$finalize_shlibpath\$$shlibpath_var\" $finalize_command"
+ fi
+
+ if test -n "$runpath_var" && test -n "$perm_rpath"; then
+ # We should set the runpath_var.
+ rpath=
+ for dir in $perm_rpath; do
+ rpath="$rpath$dir:"
+ done
+ compile_command="$runpath_var=\"$rpath\$$runpath_var\" $compile_command"
+ finalize_command="$runpath_var=\"$rpath\$$runpath_var\" $finalize_command"
+ fi
+
+ if test "$hardcode_action" = relink; then
+ # AGH! Flame the AIX and HP-UX people for me, will ya?
+ $echo "$modename: warning: using a buggy system linker" 1>&2
+ $echo "$modename: relinking will be required before \`$output' can be installed" 1>&2
+ fi
+
+ $show "$compile_command"
+ $run eval "$compile_command" || exit $?
+
+ # Now create the wrapper script.
+ $show "creating $output"
+
+ # Quote the finalize command for shipping.
+ finalize_command=`$echo "X$finalize_command" | $Xsed -e "$sed_quote_subst"`
+
+ # Quote $echo for shipping.
+ qecho=`$echo "X$echo" | $Xsed -e "$sed_quote_subst"`
+
+ # Only actually do things if our run command is non-null.
+ if test -z "$run"; then
+ $rm $output
+ trap "$rm $output; exit 1" 1 2 15
+
+ $echo > $output "\
+#! $SHELL
+
+# $output - temporary wrapper script for $objdir/$output
+# Generated by $PROGRAM - GNU $PACKAGE $VERSION
+#
+# The $output program cannot be directly executed until all the libtool
+# libraries that it depends on are installed.
+#
+# This wrapper script should never be moved out of \``pwd`'.
+# If it is, it will not operate correctly.
+
+# Sed substitution that helps us do robust quoting. It backslashifies
+# metacharacters that are still active within double-quoted strings.
+Xsed='sed -e s/^X//'
+sed_quote_subst='$sed_quote_subst'
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+if test \"\${CDPATH+set}\" = set; then CDPATH=; export CDPATH; fi
+
+# This environment variable determines our operation mode.
+if test \"\$libtool_install_magic\" = \"$magic\"; then
+ # install mode needs the following variables:
+ link_against_libtool_libs='$link_against_libtool_libs'
+ finalize_command=\"$finalize_command\"
+else
+ # When we are sourced in execute mode, \$file and \$echo are already set.
+ if test \"\$libtool_execute_magic\" != \"$magic\"; then
+ echo=\"$qecho\"
+ file=\"\$0\"
+ # Make sure echo works.
+ if test \"X\$1\" = X--no-reexec; then
+ # Discard the --no-reexec flag, and continue.
+ shift
+ elif test \"X\`(\$echo '\t') 2>/dev/null\`\" = 'X\t'; then
+ # Yippee, \$echo works!
+ :
+ else
+ # Restart under the correct shell, and then maybe \$echo will work.
+ exec $SHELL \"\$0\" --no-reexec \${1+\"\$@\"}
+ fi
+ fi\
+"
+ $echo >> $output "\
+
+ # Find the directory that this script lives in.
+ thisdir=\`\$echo \"X\$file\" | \$Xsed -e 's%/[^/]*$%%'\`
+ test \"x\$thisdir\" = \"x\$file\" && thisdir=.
+
+ # Follow symbolic links until we get to the real thisdir.
+ file=\`ls -ld \"\$file\" | sed -n 's/.*-> //p'\`
+ while test -n \"\$file\"; do
+ destdir=\`\$echo \"X\$file\" | \$Xsed -e 's%/[^/]*\$%%'\`
+
+ # If there was a directory component, then change thisdir.
+ if test \"x\$destdir\" != \"x\$file\"; then
+ case \"\$destdir\" in
+ /* | [A-Za-z]:[/\\]*) thisdir=\"\$destdir\" ;;
+ *) thisdir=\"\$thisdir/\$destdir\" ;;
+ esac
+ fi
+
+ file=\`\$echo \"X\$file\" | \$Xsed -e 's%^.*/%%'\`
+ file=\`ls -ld \"\$thisdir/\$file\" | sed -n 's/.*-> //p'\`
+ done
+
+ # Try to get the absolute directory name.
+ absdir=\`cd \"\$thisdir\" && pwd\`
+ test -n \"\$absdir\" && thisdir=\"\$absdir\"
+
+ progdir=\"\$thisdir/$objdir\"
+ program='$output'
+
+ if test -f \"\$progdir/\$program\"; then"
+
+ # Export our shlibpath_var if we have one.
+ if test -n "$shlibpath_var" && test -n "$temp_rpath"; then
+ $echo >> $output "\
+ # Add our own library path to $shlibpath_var
+ $shlibpath_var=\"$temp_rpath\$$shlibpath_var\"
+
+ # Some systems cannot cope with colon-terminated $shlibpath_var
+ $shlibpath_var=\`\$echo \"X\$$shlibpath_var\" | \$Xsed -e 's/:*\$//'\`
+
+ export $shlibpath_var
+"
+ fi
+
+ $echo >> $output "\
+ if test \"\$libtool_execute_magic\" != \"$magic\"; then
+ # Run the actual program with our arguments.
+
+ # Export the path to the program.
+ PATH=\"\$progdir:\$PATH\"
+ export PATH
+
+ exec \$program \${1+\"\$@\"}
+
+ \$echo \"\$0: cannot exec \$program \${1+\"\$@\"}\"
+ exit 1
+ fi
+ else
+ # The program doesn't exist.
+ \$echo \"\$0: error: \$progdir/\$program does not exist\" 1>&2
+ \$echo \"This script is just a wrapper for \$program.\" 1>&2
+ echo \"See the $PACKAGE documentation for more information.\" 1>&2
+ exit 1
+ fi
+fi\
+"
+ chmod +x $output
+ fi
+ exit 0
+ ;;
+ esac
+
+ # See if we need to build an old-fashioned archive.
+ for oldlib in $oldlibs; do
+
+ if test "$build_libtool_libs" = convenience; then
+ oldobjs="$libobjs"
+ addlibs="$convenience"
+ build_libtool_libs=no
+ else
+ addlibs="$old_convenience"
+ fi
+
+ # Add in members from convenience archives.
+ for xlib in $addlibs; do
+ # Extract the objects.
+ xdir="$xlib"x
+ generated="$generated $xdir"
+ xlib=`echo "$xlib" | $Xsed -e 's%^.*/%%'`
+
+ $show "${rm}r $xdir"
+ $run ${rm}r "$xdir"
+ $show "mkdir $xdir"
+ $run mkdir "$xdir"
+ status=$?
+ if test $status -ne 0 && test ! -d "$xdir"; then
+ exit $status
+ fi
+ $show "(cd $xdir && $AR x ../$xlib)"
+ $run eval "(cd \$xdir && $AR x ../\$xlib)" || exit $?
+
+ oldobjs="$oldobjs `echo $xdir/*`"
+ done
+
+ # Do each command in the archive commands.
+ if test -n "$old_archive_from_new_cmds" && test "$build_libtool_libs" = yes; then
+ eval cmds=\"$old_archive_from_new_cmds\"
+ else
+ eval cmds=\"$old_archive_cmds\"
+ fi
+ IFS="${IFS= }"; save_ifs="$IFS"; IFS=';'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ $show "$cmd"
+ $run eval "$cmd" || exit $?
+ done
+ IFS="$save_ifs"
+ done
+
+ if test -n "$generated"; then
+ $show "${rm}r$generated"
+ $run ${rm}r$generated
+ fi
+
+ # Now create the libtool archive.
+ case "$output" in
+ *.la)
+ old_library=
+ test "$build_old_libs" = yes && old_library="$libname.a"
+ $show "creating $output"
+
+ # Only create the output if not a dry run.
+ if test -z "$run"; then
+ $echo > $output "\
+# $output - a libtool library file
+# Generated by $PROGRAM - GNU $PACKAGE $VERSION
+
+# The name that we can dlopen(3).
+dlname='$dlname'
+
+# Names of this library.
+library_names='$library_names'
+
+# The name of the static archive.
+old_library='$old_library'
+
+# Libraries that this one depends upon.
+dependency_libs='$dependency_libs'
+
+# Version information for $libname.
+current=$current
+age=$age
+revision=$revision
+
+# Directory that this library needs to be installed in:
+libdir='$install_libdir'\
+"
+ fi
+
+ # Do a symbolic link so that the libtool archive can be found in
+ # LD_LIBRARY_PATH before the program is installed.
+ $show "(cd $objdir && $LN_S ../$output $output)"
+ $run eval "(cd $objdir && $LN_S ../$output $output)" || exit $?
+ ;;
+ esac
+ exit 0
+ ;;
+
+ # libtool install mode
+ install)
+ modename="$modename: install"
+
+ # There may be an optional sh(1) argument at the beginning of
+ # install_prog (especially on Windows NT).
+ if test "$nonopt" = "$SHELL"; then
+ # Aesthetically quote it.
+ arg=`$echo "X$nonopt" | $Xsed -e "$sed_quote_subst"`
+ case "$arg" in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*)
+ arg="\"$arg\""
+ ;;
+ esac
+ install_prog="$arg "
+ arg="$1"
+ shift
+ else
+ install_prog=
+ arg="$nonopt"
+ fi
+
+ # The real first argument should be the name of the installation program.
+ # Aesthetically quote it.
+ arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"`
+ case "$arg" in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*)
+ arg="\"$arg\""
+ ;;
+ esac
+ install_prog="$install_prog$arg"
+
+ # We need to accept at least all the BSD install flags.
+ dest=
+ files=
+ opts=
+ prev=
+ install_type=
+ isdir=no
+ stripme=
+ for arg
+ do
+ if test -n "$dest"; then
+ files="$files $dest"
+ dest="$arg"
+ continue
+ fi
+
+ case "$arg" in
+ -d) isdir=yes ;;
+ -f) prev="-f" ;;
+ -g) prev="-g" ;;
+ -m) prev="-m" ;;
+ -o) prev="-o" ;;
+ -s)
+ stripme=" -s"
+ continue
+ ;;
+ -*) ;;
+
+ *)
+ # If the previous option needed an argument, then skip it.
+ if test -n "$prev"; then
+ prev=
+ else
+ dest="$arg"
+ continue
+ fi
+ ;;
+ esac
+
+ # Aesthetically quote the argument.
+ arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"`
+ case "$arg" in
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*)
+ arg="\"$arg\""
+ ;;
+ esac
+ install_prog="$install_prog $arg"
+ done
+
+ if test -z "$install_prog"; then
+ $echo "$modename: you must specify an install program" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ fi
+
+ if test -n "$prev"; then
+ $echo "$modename: the \`$prev' option requires an argument" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ fi
+
+ if test -z "$files"; then
+ if test -z "$dest"; then
+ $echo "$modename: no file or destination specified" 1>&2
+ else
+ $echo "$modename: you must specify a destination" 1>&2
+ fi
+ $echo "$help" 1>&2
+ exit 1
+ fi
+
+ # Strip any trailing slash from the destination.
+ dest=`$echo "X$dest" | $Xsed -e 's%/$%%'`
+
+ # Check to see that the destination is a directory.
+ test -d "$dest" && isdir=yes
+ if test "$isdir" = yes; then
+ destdir="$dest"
+ destname=
+ else
+ destdir=`$echo "X$dest" | $Xsed -e 's%/[^/]*$%%'`
+ test "X$destdir" = "X$dest" && destdir=.
+ destname=`$echo "X$dest" | $Xsed -e 's%^.*/%%'`
+
+ # Not a directory, so check to see that there is only one file specified.
+ set dummy $files
+ if test $# -gt 2; then
+ $echo "$modename: \`$dest' is not a directory" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ fi
+ fi
+ case "$destdir" in
+ /* | [A-Za-z]:[/\\]*) ;;
+ *)
+ for file in $files; do
+ case "$file" in
+ *.lo) ;;
+ *)
+ $echo "$modename: \`$destdir' must be an absolute directory name" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ ;;
+ esac
+ done
+ ;;
+ esac
+
+ # This variable tells wrapper scripts just to set variables rather
+ # than running their programs.
+ libtool_install_magic="$magic"
+
+ staticlibs=
+ future_libdirs=
+ current_libdirs=
+ for file in $files; do
+
+ # Do each installation.
+ case "$file" in
+ *.a)
+ # Do the static libraries later.
+ staticlibs="$staticlibs $file"
+ ;;
+
+ *.la)
+ # Check to see that this really is a libtool archive.
+ if (sed -e '2q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then :
+ else
+ $echo "$modename: \`$file' is not a valid libtool archive" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ fi
+
+ library_names=
+ old_library=
+ # If there is no directory component, then add one.
+ case "$file" in
+ */* | *\\*) . $file ;;
+ *) . ./$file ;;
+ esac
+
+ # Add the libdir to current_libdirs if it is the destination.
+ if test "X$destdir" = "X$libdir"; then
+ case "$current_libdirs " in
+ *" $libdir "*) ;;
+ *) current_libdirs="$current_libdirs $libdir" ;;
+ esac
+ else
+ # Note the libdir as a future libdir.
+ case "$future_libdirs " in
+ *" $libdir "*) ;;
+ *) future_libdirs="$future_libdirs $libdir" ;;
+ esac
+ fi
+
+ dir="`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'`/"
+ test "X$dir" = "X$file/" && dir=
+ dir="$dir$objdir"
+
+ # See the names of the shared library.
+ set dummy $library_names
+ if test -n "$2"; then
+ realname="$2"
+ shift
+ shift
+
+ # Install the shared library and build the symlinks.
+ $show "$install_prog $dir/$realname $destdir/$realname"
+ $run eval "$install_prog $dir/$realname $destdir/$realname" || exit $?
+ test "X$dlname" = "X$realname" && dlname=
+
+ if test $# -gt 0; then
+ # Delete the old symlinks.
+ rmcmd="$rm"
+ for linkname
+ do
+ rmcmd="$rmcmd $destdir/$linkname"
+ done
+ $show "$rmcmd"
+ $run $rmcmd
+
+ # ... and create new ones.
+ for linkname
+ do
+ test "X$dlname" = "X$linkname" && dlname=
+ $show "(cd $destdir && $LN_S $realname $linkname)"
+ $run eval "(cd $destdir && $LN_S $realname $linkname)"
+ done
+ fi
+
+ if test -n "$dlname"; then
+ # Install the dynamically-loadable library.
+ $show "$install_prog $dir/$dlname $destdir/$dlname"
+ $run eval "$install_prog $dir/$dlname $destdir/$dlname" || exit $?
+ fi
+
+ # Do each command in the postinstall commands.
+ lib="$destdir/$realname"
+ eval cmds=\"$postinstall_cmds\"
+ IFS="${IFS= }"; save_ifs="$IFS"; IFS=';'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ $show "$cmd"
+ $run eval "$cmd" || exit $?
+ done
+ IFS="$save_ifs"
+ fi
+
+ # Install the pseudo-library for information purposes.
+ name=`$echo "X$file" | $Xsed -e 's%^.*/%%'`
+ $show "$install_prog $file $destdir/$name"
+ $run eval "$install_prog $file $destdir/$name" || exit $?
+
+ # Maybe install the static library, too.
+ test -n "$old_library" && staticlibs="$staticlibs $dir/$old_library"
+ ;;
+
+ *.lo)
+ # Install (i.e. copy) a libtool object.
+
+ # Figure out destination file name, if it wasn't already specified.
+ if test -n "$destname"; then
+ destfile="$destdir/$destname"
+ else
+ destfile=`$echo "X$file" | $Xsed -e 's%^.*/%%'`
+ destfile="$destdir/$destfile"
+ fi
+
+ # Deduce the name of the destination old-style object file.
+ case "$destfile" in
+ *.lo)
+ staticdest=`$echo "X$destfile" | $Xsed -e 's/\.lo$/.o/'`
+ ;;
+ *.o)
+ staticdest="$destfile"
+ destfile=
+ ;;
+ *)
+ $echo "$modename: cannot copy a libtool object to \`$destfile'" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ ;;
+ esac
+
+ # Install the libtool object if requested.
+ if test -n "$destfile"; then
+ $show "$install_prog $file $destfile"
+ $run eval "$install_prog $file $destfile" || exit $?
+ fi
+
+ # Install the old object if enabled.
+ if test "$build_old_libs" = yes; then
+ # Deduce the name of the old-style object file.
+ staticobj=`$echo "X$file" | $Xsed -e 's/\.lo$/.o/'`
+
+ $show "$install_prog $staticobj $staticdest"
+ $run eval "$install_prog \$staticobj \$staticdest" || exit $?
+ fi
+ exit 0
+ ;;
+
+ *)
+ # Figure out destination file name, if it wasn't already specified.
+ if test -n "$destname"; then
+ destfile="$destdir/$destname"
+ else
+ destfile=`$echo "X$file" | $Xsed -e 's%^.*/%%'`
+ destfile="$destdir/$destfile"
+ fi
+
+ # Do a test to see if this is really a libtool program.
+ if (sed -e '4q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then
+ link_against_libtool_libs=
+ finalize_command=
+
+ # If there is no directory component, then add one.
+ case "$file" in
+ */* | *\\*) . $file ;;
+ *) . ./$file ;;
+ esac
+
+ # Check the variables that should have been set.
+ if test -z "$link_against_libtool_libs" || test -z "$finalize_command"; then
+ $echo "$modename: invalid libtool wrapper script \`$file'" 1>&2
+ exit 1
+ fi
+
+ finalize=yes
+ for lib in $link_against_libtool_libs; do
+ # Check to see that each library is installed.
+ libdir=
+ if test -f "$lib"; then
+ # If there is no directory component, then add one.
+ case "$lib" in
+ */* | *\\*) . $lib ;;
+ *) . ./$lib ;;
+ esac
+ fi
+ libfile="$libdir/`$echo "X$lib" | $Xsed -e 's%^.*/%%g'`"
+ if test -n "$libdir" && test ! -f "$libfile"; then
+ $echo "$modename: warning: \`$lib' has not been installed in \`$libdir'" 1>&2
+ finalize=no
+ fi
+ done
+
+ if test "$hardcode_action" = relink; then
+ if test "$finalize" = yes; then
+ $echo "$modename: warning: relinking \`$file' on behalf of your buggy system linker" 1>&2
+ $show "$finalize_command"
+ if $run eval "$finalize_command"; then :
+ else
+ $echo "$modename: error: relink \`$file' with the above command before installing it" 1>&2
+ continue
+ fi
+ file="$objdir/$file"T
+ else
+ $echo "$modename: warning: cannot relink \`$file' on behalf of your buggy system linker" 1>&2
+ fi
+ else
+ # Install the binary that we compiled earlier.
+ file=`$echo "X$file" | $Xsed -e "s%\([^/]*\)$%$objdir/\1%"`
+ fi
+ fi
+
+ $show "$install_prog$stripme $file $destfile"
+ $run eval "$install_prog\$stripme \$file \$destfile" || exit $?
+ ;;
+ esac
+ done
+
+ for file in $staticlibs; do
+ name=`$echo "X$file" | $Xsed -e 's%^.*/%%'`
+
+ # Set up the ranlib parameters.
+ oldlib="$destdir/$name"
+
+ $show "$install_prog $file $oldlib"
+ $run eval "$install_prog \$file \$oldlib" || exit $?
+
+ # Do each command in the postinstall commands.
+ eval cmds=\"$old_postinstall_cmds\"
+ IFS="${IFS= }"; save_ifs="$IFS"; IFS=';'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ $show "$cmd"
+ $run eval "$cmd" || exit $?
+ done
+ IFS="$save_ifs"
+ done
+
+ if test -n "$future_libdirs"; then
+ $echo "$modename: warning: remember to run \`$progname --finish$future_libdirs'" 1>&2
+ fi
+
+ if test -n "$current_libdirs"; then
+ # Maybe just do a dry run.
+ test -n "$run" && current_libdirs=" -n$current_libdirs"
+ exec $SHELL $0 --finish$current_libdirs
+ exit 1
+ fi
+
+ exit 0
+ ;;
+
+ # libtool finish mode
+ finish)
+ modename="$modename: finish"
+ libdirs="$nonopt"
+ admincmds=
+
+ if test -n "$finish_cmds$finish_eval" && test -n "$libdirs"; then
+ for dir
+ do
+ libdirs="$libdirs $dir"
+ done
+
+ for libdir in $libdirs; do
+ if test -n "$finish_cmds"; then
+ # Do each command in the finish commands.
+ eval cmds=\"$finish_cmds\"
+ IFS="${IFS= }"; save_ifs="$IFS"; IFS=';'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ $show "$cmd"
+ $run eval "$cmd" || admincmds="$admincmds
+ $cmd"
+ done
+ IFS="$save_ifs"
+ fi
+ if test -n "$finish_eval"; then
+ # Do the single finish_eval.
+ eval cmds=\"$finish_eval\"
+ $run eval "$cmds" || admincmds="$admincmds
+ $cmds"
+ fi
+ done
+ fi
+
+ echo "----------------------------------------------------------------------"
+ echo "Libraries have been installed in:"
+ for libdir in $libdirs; do
+ echo " $libdir"
+ done
+ echo
+ echo "To link against installed libraries in a given directory, LIBDIR,"
+ echo "you must use the \`-LLIBDIR' flag during linking."
+ echo
+ echo " You will also need to do at least one of the following:"
+ if test -n "$shlibpath_var"; then
+ echo " - add LIBDIR to the \`$shlibpath_var' environment variable"
+ echo " during execution"
+ fi
+ if test -n "$runpath_var"; then
+ echo " - add LIBDIR to the \`$runpath_var' environment variable"
+ echo " during linking"
+ fi
+ if test -n "$hardcode_libdir_flag_spec"; then
+ libdir=LIBDIR
+ eval flag=\"$hardcode_libdir_flag_spec\"
+
+ echo " - use the \`$flag' linker flag"
+ fi
+ if test -n "$admincmds"; then
+ echo " - have your system administrator run these commands:$admincmds"
+ fi
+ if test -f /etc/ld.so.conf; then
+ echo " - have your system administrator add LIBDIR to \`/etc/ld.so.conf'"
+ fi
+ echo
+ echo "See any operating system documentation about shared libraries for"
+ echo "more information, such as the ld(1) and ld.so(8) manual pages."
+ echo "----------------------------------------------------------------------"
+ exit 0
+ ;;
+
+ # libtool execute mode
+ execute)
+ modename="$modename: execute"
+
+ # The first argument is the command name.
+ cmd="$nonopt"
+ if test -z "$cmd"; then
+ $echo "$modename: you must specify a COMMAND" 1>&2
+ $echo "$help"
+ exit 1
+ fi
+
+ # Handle -dlopen flags immediately.
+ for file in $execute_dlfiles; do
+ if test ! -f "$file"; then
+ $echo "$modename: \`$file' is not a file" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ fi
+
+ dir=
+ case "$file" in
+ *.la)
+ # Check to see that this really is a libtool archive.
+ if (sed -e '2q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then :
+ else
+ $echo "$modename: \`$lib' is not a valid libtool archive" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ fi
+
+ # Read the libtool library.
+ dlname=
+ library_names=
+
+ # If there is no directory component, then add one.
+ case "$file" in
+ */* | *\\*) . $file ;;
+ *) . ./$file ;;
+ esac
+
+ # Skip this library if it cannot be dlopened.
+ if test -z "$dlname"; then
+ # Warn if it was a shared library.
+ test -n "$library_names" && $echo "$modename: warning: \`$file' was not linked with \`-export-dynamic'"
+ continue
+ fi
+
+ dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'`
+ test "X$dir" = "X$file" && dir=.
+
+ if test -f "$dir/$objdir/$dlname"; then
+ dir="$dir/$objdir"
+ else
+ $echo "$modename: cannot find \`$dlname' in \`$dir' or \`$dir/$objdir'" 1>&2
+ exit 1
+ fi
+ ;;
+
+ *.lo)
+ # Just add the directory containing the .lo file.
+ dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'`
+ test "X$dir" = "X$file" && dir=.
+ ;;
+
+ *)
+ $echo "$modename: warning \`-dlopen' is ignored for non-libtool libraries and objects" 1>&2
+ continue
+ ;;
+ esac
+
+ # Get the absolute pathname.
+ absdir=`cd "$dir" && pwd`
+ test -n "$absdir" && dir="$absdir"
+
+ # Now add the directory to shlibpath_var.
+ if eval "test -z \"\$$shlibpath_var\""; then
+ eval "$shlibpath_var=\"\$dir\""
+ else
+ eval "$shlibpath_var=\"\$dir:\$$shlibpath_var\""
+ fi
+ done
+
+ # This variable tells wrapper scripts just to set shlibpath_var
+ # rather than running their programs.
+ libtool_execute_magic="$magic"
+
+ # Check if any of the arguments is a wrapper script.
+ args=
+ for file
+ do
+ case "$file" in
+ -*) ;;
+ *)
+ # Do a test to see if this is really a libtool program.
+ if (sed -e '4q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then
+ # If there is no directory component, then add one.
+ case "$file" in
+ */* | *\\*) . $file ;;
+ *) . ./$file ;;
+ esac
+
+ # Transform arg to wrapped name.
+ file="$progdir/$program"
+ fi
+ ;;
+ esac
+ # Quote arguments (to preserve shell metacharacters).
+ file=`$echo "X$file" | $Xsed -e "$sed_quote_subst"`
+ args="$args \"$file\""
+ done
+
+ if test -z "$run"; then
+ # Export the shlibpath_var.
+ eval "export $shlibpath_var"
+
+ # Restore saved enviroment variables
+ if test "${save_LC_ALL+set}" = set; then
+ LC_ALL="$save_LC_ALL"; export LC_ALL
+ fi
+ if test "${save_LANG+set}" = set; then
+ LANG="$save_LANG"; export LANG
+ fi
+
+ # Now actually exec the command.
+ eval "exec \$cmd$args"
+
+ $echo "$modename: cannot exec \$cmd$args"
+ exit 1
+ else
+ # Display what would be done.
+ eval "\$echo \"\$shlibpath_var=\$$shlibpath_var\""
+ $echo "export $shlibpath_var"
+ $echo "$cmd$args"
+ exit 0
+ fi
+ ;;
+
+ # libtool uninstall mode
+ uninstall)
+ modename="$modename: uninstall"
+ rm="$nonopt"
+ files=
+
+ for arg
+ do
+ case "$arg" in
+ -*) rm="$rm $arg" ;;
+ *) files="$files $arg" ;;
+ esac
+ done
+
+ if test -z "$rm"; then
+ $echo "$modename: you must specify an RM program" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ fi
+
+ for file in $files; do
+ dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'`
+ test "X$dir" = "X$file" && dir=.
+ name=`$echo "X$file" | $Xsed -e 's%^.*/%%'`
+
+ rmfiles="$file"
+
+ case "$name" in
+ *.la)
+ # Possibly a libtool archive, so verify it.
+ if (sed -e '2q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then
+ . $dir/$name
+
+ # Delete the libtool libraries and symlinks.
+ for n in $library_names; do
+ rmfiles="$rmfiles $dir/$n"
+ test "X$n" = "X$dlname" && dlname=
+ done
+ test -n "$dlname" && rmfiles="$rmfiles $dir/$dlname"
+ test -n "$old_library" && rmfiles="$rmfiles $dir/$old_library"
+
+ $show "$rm $rmfiles"
+ $run $rm $rmfiles
+
+ if test -n "$library_names"; then
+ # Do each command in the postuninstall commands.
+ eval cmds=\"$postuninstall_cmds\"
+ IFS="${IFS= }"; save_ifs="$IFS"; IFS=';'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ $show "$cmd"
+ $run eval "$cmd"
+ done
+ IFS="$save_ifs"
+ fi
+
+ if test -n "$old_library"; then
+ # Do each command in the old_postuninstall commands.
+ eval cmds=\"$old_postuninstall_cmds\"
+ IFS="${IFS= }"; save_ifs="$IFS"; IFS=';'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ $show "$cmd"
+ $run eval "$cmd"
+ done
+ IFS="$save_ifs"
+ fi
+
+ # FIXME: should reinstall the best remaining shared library.
+ fi
+ ;;
+
+ *.lo)
+ if test "$build_old_libs" = yes; then
+ oldobj=`$echo "X$name" | $Xsed -e 's/\.lo$/.o/'`
+ rmfiles="$rmfiles $dir/$oldobj"
+ fi
+ $show "$rm $rmfiles"
+ $run $rm $rmfiles
+ ;;
+
+ *)
+ $show "$rm $rmfiles"
+ $run $rm $rmfiles
+ ;;
+ esac
+ done
+ exit 0
+ ;;
+
+ "")
+ $echo "$modename: you must specify a MODE" 1>&2
+ $echo "$generic_help" 1>&2
+ exit 1
+ ;;
+ esac
+
+ $echo "$modename: invalid operation mode \`$mode'" 1>&2
+ $echo "$generic_help" 1>&2
+ exit 1
+fi # test -z "$show_help"
+
+# We need to display help for each of the modes.
+case "$mode" in
+"") $echo \
+"Usage: $modename [OPTION]... [MODE-ARG]...
+
+Provide generalized library-building support services.
+
+ --config show all configuration variables
+ --debug enable verbose shell tracing
+-n, --dry-run display commands without modifying any files
+ --features display basic configuration information and exit
+ --finish same as \`--mode=finish'
+ --help display this help message and exit
+ --mode=MODE use operation mode MODE [default=inferred from MODE-ARGS]
+ --quiet same as \`--silent'
+ --silent don't print informational messages
+ --version print version information
+
+MODE must be one of the following:
+
+ compile compile a source file into a libtool object
+ execute automatically set library path, then run a program
+ finish complete the installation of libtool libraries
+ install install libraries or executables
+ link create a library or an executable
+ uninstall remove libraries from an installed directory
+
+MODE-ARGS vary depending on the MODE. Try \`$modename --help --mode=MODE' for
+a more detailed description of MODE."
+ exit 0
+ ;;
+
+compile)
+ $echo \
+"Usage: $modename [OPTION]... --mode=compile COMPILE-COMMAND... SOURCEFILE
+
+Compile a source file into a libtool library object.
+
+This mode accepts the following additional options:
+
+ -static always build a \`.o' file suitable for static linking
+
+COMPILE-COMMAND is a command to be used in creating a \`standard' object file
+from the given SOURCEFILE.
+
+The output file name is determined by removing the directory component from
+SOURCEFILE, then substituting the C source code suffix \`.c' with the
+library object suffix, \`.lo'."
+ ;;
+
+execute)
+ $echo \
+"Usage: $modename [OPTION]... --mode=execute COMMAND [ARGS]...
+
+Automatically set library path, then run a program.
+
+This mode accepts the following additional options:
+
+ -dlopen FILE add the directory containing FILE to the library path
+
+This mode sets the library path environment variable according to \`-dlopen'
+flags.
+
+If any of the ARGS are libtool executable wrappers, then they are translated
+into their corresponding uninstalled binary, and any of their required library
+directories are added to the library path.
+
+Then, COMMAND is executed, with ARGS as arguments."
+ ;;
+
+finish)
+ $echo \
+"Usage: $modename [OPTION]... --mode=finish [LIBDIR]...
+
+Complete the installation of libtool libraries.
+
+Each LIBDIR is a directory that contains libtool libraries.
+
+The commands that this mode executes may require superuser privileges. Use
+the \`--dry-run' option if you just want to see what would be executed."
+ ;;
+
+install)
+ $echo \
+"Usage: $modename [OPTION]... --mode=install INSTALL-COMMAND...
+
+Install executables or libraries.
+
+INSTALL-COMMAND is the installation command. The first component should be
+either the \`install' or \`cp' program.
+
+The rest of the components are interpreted as arguments to that command (only
+BSD-compatible install options are recognized)."
+ ;;
+
+link)
+ $echo \
+"Usage: $modename [OPTION]... --mode=link LINK-COMMAND...
+
+Link object files or libraries together to form another library, or to
+create an executable program.
+
+LINK-COMMAND is a command using the C compiler that you would use to create
+a program from several object files.
+
+The following components of LINK-COMMAND are treated specially:
+
+ -all-static do not do any dynamic linking at all
+ -dlopen FILE \`-dlpreopen' FILE if it cannot be dlopened at runtime
+ -dlpreopen FILE link in FILE and add its symbols to dld_preloaded_symbols
+ -export-dynamic allow symbols from OUTPUT-FILE to be resolved with dlsym(3)
+ -LLIBDIR search LIBDIR for required installed libraries
+ -lNAME OUTPUT-FILE requires the installed library libNAME
+ -no-undefined declare that a library does not refer to external symbols
+ -o OUTPUT-FILE create OUTPUT-FILE from the specified objects
+ -release RELEASE specify package release information
+ -rpath LIBDIR the created library will eventually be installed in LIBDIR
+ -static do not do any dynamic linking of libtool libraries
+ -version-info CURRENT[:REVISION[:AGE]]
+ specify library version info [each variable defaults to 0]
+
+All other options (arguments beginning with \`-') are ignored.
+
+Every other argument is treated as a filename. Files ending in \`.la' are
+treated as uninstalled libtool libraries, other files are standard or library
+object files.
+
+If the OUTPUT-FILE ends in \`.la', then a libtool library is created, only
+library objects (\`.lo' files) may be specified, and \`-rpath' is required.
+
+If OUTPUT-FILE ends in \`.a', then a standard library is created using \`ar'
+and \`ranlib'.
+
+If OUTPUT-FILE ends in \`.lo' or \`.o', then a reloadable object file is
+created, otherwise an executable program is created."
+ ;;
+
+uninstall)
+ $echo
+"Usage: $modename [OPTION]... --mode=uninstall RM [RM-OPTION]... FILE...
+
+Remove libraries from an installation directory.
+
+RM is the name of the program to use to delete files associated with each FILE
+(typically \`/bin/rm'). RM-OPTIONS are options (such as \`-f') to be passed
+to RM.
+
+If FILE is a libtool library, all the files associated with it are deleted.
+Otherwise, only FILE itself is deleted using RM."
+ ;;
+
+*)
+ $echo "$modename: invalid operation mode \`$mode'" 1>&2
+ $echo "$help" 1>&2
+ exit 1
+ ;;
+esac
+
+echo
+$echo "Try \`$modename --help' for more information about other modes."
+
+exit 0
+
+# Local Variables:
+# mode:shell-script
+# sh-indentation:2
+# End:
--- /dev/null
+#! /bin/sh
+# Common stub for a few missing GNU programs while installing.
+# Copyright (C) 1996, 1997 Free Software Foundation, Inc.
+# Franc,ois Pinard <pinard@iro.umontreal.ca>, 1996.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2, or (at your option)
+# any later version.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA
+# 02111-1307, USA.
+
+if test $# -eq 0; then
+ echo 1>&2 "Try \`$0 --help' for more information"
+ exit 1
+fi
+
+case "$1" in
+
+ -h|--h|--he|--hel|--help)
+ echo "\
+$0 [OPTION]... PROGRAM [ARGUMENT]...
+
+Handle \`PROGRAM [ARGUMENT]...' for when PROGRAM is missing, or return an
+error status if there is no known handling for PROGRAM.
+
+Options:
+ -h, --help display this help and exit
+ -v, --version output version information and exit
+
+Supported PROGRAM values:
+ aclocal touch file \`aclocal.m4'
+ autoconf touch file \`configure'
+ autoheader touch file \`config.h.in'
+ automake touch all \`Makefile.in' files
+ bison create \`y.tab.[ch]', if possible, from existing .[ch]
+ flex create \`lex.yy.c', if possible, from existing .c
+ lex create \`lex.yy.c', if possible, from existing .c
+ makeinfo touch the output file
+ yacc create \`y.tab.[ch]', if possible, from existing .[ch]"
+ ;;
+
+ -v|--v|--ve|--ver|--vers|--versi|--versio|--version)
+ echo "missing - GNU libit 0.0"
+ ;;
+
+ -*)
+ echo 1>&2 "$0: Unknown \`$1' option"
+ echo 1>&2 "Try \`$0 --help' for more information"
+ exit 1
+ ;;
+
+ aclocal)
+ echo 1>&2 "\
+WARNING: \`$1' is missing on your system. You should only need it if
+ you modified \`acinclude.m4' or \`configure.in'. You might want
+ to install the \`Automake' and \`Perl' packages. Grab them from
+ any GNU archive site."
+ touch aclocal.m4
+ ;;
+
+ autoconf)
+ echo 1>&2 "\
+WARNING: \`$1' is missing on your system. You should only need it if
+ you modified \`configure.in'. You might want to install the
+ \`Autoconf' and \`GNU m4' packages. Grab them from any GNU
+ archive site."
+ touch configure
+ ;;
+
+ autoheader)
+ echo 1>&2 "\
+WARNING: \`$1' is missing on your system. You should only need it if
+ you modified \`acconfig.h' or \`configure.in'. You might want
+ to install the \`Autoconf' and \`GNU m4' packages. Grab them
+ from any GNU archive site."
+ files=`sed -n 's/^[ ]*A[CM]_CONFIG_HEADER([^):]*:\([^)]*\)).*/\1/p' configure.in`
+ if test -z "$files"; then
+ files=`sed -n 's/^[ ]*A[CM]_CONFIG_HEADER(\([^):]*\)).*/\1/p' configure.in`
+ test -z "$files" || files="$files.in"
+ else
+ files=`echo "$files" | sed -e 's/:/ /g'`
+ fi
+ test -z "$files" && files="config.h.in"
+ touch $files
+ ;;
+
+ automake)
+ echo 1>&2 "\
+WARNING: \`$1' is missing on your system. You should only need it if
+ you modified \`Makefile.am', \`acinclude.m4' or \`configure.in'.
+ You might want to install the \`Automake' and \`Perl' packages.
+ Grab them from any GNU archive site."
+ find . -type f -name Makefile.am -print \
+ | sed 's/^\(.*\).am$/touch \1.in/' \
+ | sh
+ ;;
+
+ bison|yacc)
+ echo 1>&2 "\
+WARNING: \`$1' is missing on your system. You should only need it if
+ you modified a \`.y' file. You may need the \`Bison' package
+ in order for those modifications to take effect. You can get
+ \`Bison' from any GNU archive site."
+ rm -f y.tab.c y.tab.h
+ if [ $# -ne 1 ]; then
+ eval LASTARG="\${$#}"
+ case "$LASTARG" in
+ *.y)
+ SRCFILE=`echo "$LASTARG" | sed 's/y$/c/'`
+ if [ -f "$SRCFILE" ]; then
+ cp "$SRCFILE" y.tab.c
+ fi
+ SRCFILE=`echo "$LASTARG" | sed 's/y$/h/'`
+ if [ -f "$SRCFILE" ]; then
+ cp "$SRCFILE" y.tab.h
+ fi
+ ;;
+ esac
+ fi
+ if [ ! -f y.tab.h ]; then
+ echo >y.tab.h
+ fi
+ if [ ! -f y.tab.c ]; then
+ echo 'main() { return 0; }' >y.tab.c
+ fi
+ ;;
+
+ lex|flex)
+ echo 1>&2 "\
+WARNING: \`$1' is missing on your system. You should only need it if
+ you modified a \`.l' file. You may need the \`Flex' package
+ in order for those modifications to take effect. You can get
+ \`Flex' from any GNU archive site."
+ rm -f lex.yy.c
+ if [ $# -ne 1 ]; then
+ eval LASTARG="\${$#}"
+ case "$LASTARG" in
+ *.l)
+ SRCFILE=`echo "$LASTARG" | sed 's/l$/c/'`
+ if [ -f "$SRCFILE" ]; then
+ cp "$SRCFILE" lex.yy.c
+ fi
+ ;;
+ esac
+ fi
+ if [ ! -f lex.yy.c ]; then
+ echo 'main() { return 0; }' >lex.yy.c
+ fi
+ ;;
+
+ makeinfo)
+ echo 1>&2 "\
+WARNING: \`$1' is missing on your system. You should only need it if
+ you modified a \`.texi' or \`.texinfo' file, or any other file
+ indirectly affecting the aspect of the manual. The spurious
+ call might also be the consequence of using a buggy \`make' (AIX,
+ DU, IRIX). You might want to install the \`Texinfo' package or
+ the \`GNU make' package. Grab either from any GNU archive site."
+ file=`echo "$*" | sed -n 's/.*-o \([^ ]*\).*/\1/p'`
+ if test -z "$file"; then
+ file=`echo "$*" | sed 's/.* \([^ ]*\) *$/\1/'`
+ file=`sed -n '/^@setfilename/ { s/.* \([^ ]*\) *$/\1/; p; q; }' $file`
+ fi
+ touch $file
+ ;;
+
+ *)
+ echo 1>&2 "\
+WARNING: \`$1' is needed, and you do not seem to have it handy on your
+ system. You might have modified some files without having the
+ proper tools for further handling them. Check the \`README' file,
+ it often tells you about the needed prerequirements for installing
+ this package. You may also peek at any GNU archive site, in case
+ some other package would contain this missing \`$1' program."
+ exit 1
+ ;;
+esac
+
+exit 0
--- /dev/null
+#! /bin/sh
+# mkinstalldirs --- make directory hierarchy
+# Author: Noah Friedman <friedman@prep.ai.mit.edu>
+# Created: 1993-05-16
+# Public domain
+
+# $Id: mkinstalldirs,v 1.1 1998/11/18 20:42:13 chris Exp $
+
+errstatus=0
+
+for file
+do
+ set fnord `echo ":$file" | sed -ne 's/^:\//#/;s/^://;s/\// /g;s/^#/\//;p'`
+ shift
+
+ pathcomp=
+ for d
+ do
+ pathcomp="$pathcomp$d"
+ case "$pathcomp" in
+ -* ) pathcomp=./$pathcomp ;;
+ esac
+
+ if test ! -d "$pathcomp"; then
+ echo "mkdir $pathcomp" 1>&2
+
+ mkdir "$pathcomp" || lasterr=$?
+
+ if test ! -d "$pathcomp"; then
+ errstatus=$lasterr
+ fi
+ fi
+
+ pathcomp="$pathcomp/"
+ done
+done
+
+exit $errstatus
+
+# mkinstalldirs ends here
+++ /dev/null
-#
-# Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-include ../Makefile.conf
-
-TARGET=../lib/libasound.a
-STARGET=../lib/libasound.so
-STARGETX=../lib/libasound.so.$(SND_LIB_VERSION)
-STARGETO=../lib/libasound.so.$(SND_LIB_MAJOR)
-TARGETS=$(TARGET) $(STARGET)
-
-STATIC_LIBS= control/libcontrol.a \
- mixer/libmixer.a \
- pcm/libpcm.a \
- rawmidi/librawmidi.a
-DYNAMIC_LIBS= control/libcontrol.Sa \
- mixer/libmixer.Sa \
- pcm/libpcm.Sa \
- rawmidi/librawmidi.Sa
-
-OBJECTS=error.o
-SOBJECTS=error.So
-
-.SUFFIXES:
-.SUFFIXES: .c .s .S .o .So .a .Sa
-
-.c.o:
- $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $<
-.c.So:
- $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $<
-
-all: $(TARGETS)
-
-$(TARGET): .depend $(OBJECTS) $(STATIC_LIBS)
- rm -f ../lib/libasound.a
- $(LINKER) -r -o $(TARGET) $(STATIC_LIBS) $(OBJECTS)
-
-$(STARGET): .depend $(SOBJECTS) $(DYNAMIC_LIBS)
- rm -f ../lib/libasound*.so*
- $(CC) -shared -Wl,-soname,libasound.so.$(SND_LIB_MAJOR) $(DYNAMIC_LIBS) $(SOBJECTS) -o $(STARGETX)
- ln -s libasound.so.$(SND_LIB_VERSION) $(STARGET)
- ln -s libasound.so.$(SND_LIB_VERSION) $(STARGETO)
-
-control/libcontrol.a:
- $(MAKE) -C control
-control/libcontrol.sa:
- $(MAKE) -C control
-
-mixer/libmixer.a:
- $(MAKE) -C mixer
-mixer/libmixer.sa:
- $(MAKE) -C mixer
-
-pcm/libpcm.a:
- $(MAKE) -C pcm
-pcm/libpcm.sa:
- $(MAKE) -C pcm
-
-rawmidi/librawmidi.a:
- $(MAKE) -C rawmidi
-rawmidi/librawmidi.sa:
- $(MAKE) -C rawmidi
-
-clean:
- $(MAKE) -C control clean
- $(MAKE) -C pcm clean
- $(MAKE) -C mixer clean
- $(MAKE) -C rawmidi clean
- rm -f core .depend *.o *.So *.orig *~
- rm -f ../lib/libasound.*
-
-.depend:
- $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend
-
-#
-# include a dependency file if one exists
-#
-ifeq (.depend,$(wildcard .depend))
-include .depend
-endif
--- /dev/null
+SUBDIRS=control mixer pcm rawmidi
+
+lib_LTLIBRARIES = libasound.la
+libasound_la_SOURCES = error.c
+libasound_la_LIBADD = control/libcontrol.la mixer/libmixer.la pcm/libpcm.la \
+ rawmidi/librawmidi.la
+
+control/libcontrol.la:
+ $(MAKE) -C control libcontrol.la
+
+mixer/libmixer.la:
+ $(MAKE) -C mixer libmixer.la
+
+pcm/libpcm.la:
+ $(MAKE) -C pcm libpcm.la
+
+rawmidi/librawmidi.la:
+ $(MAKE) -C rawmidi librawmidi.la
+
+
+
+INCLUDES=-I$(top_srcdir)/include
--- /dev/null
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+SUBDIRS=control mixer pcm rawmidi
+
+lib_LTLIBRARIES = libasound.la
+libasound_la_SOURCES = error.c
+libasound_la_LIBADD = control/libcontrol.la mixer/libmixer.la pcm/libpcm.la \
+ rawmidi/librawmidi.la
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ../include/config.h
+CONFIG_CLEAN_FILES =
+LTLIBRARIES = $(lib_LTLIBRARIES)
+
+
+DEFS = @DEFS@ -I. -I$(srcdir) -I../include
+CPPFLAGS = @CPPFLAGS@
+LDFLAGS = @LDFLAGS@
+LIBS = @LIBS@
+libasound_la_LDFLAGS =
+libasound_la_DEPENDENCIES = control/libcontrol.la mixer/libmixer.la \
+pcm/libpcm.la rawmidi/librawmidi.la
+libasound_la_OBJECTS = error.lo
+CFLAGS = @CFLAGS@
+COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@
+DIST_COMMON = Makefile.am Makefile.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+SOURCES = $(libasound_la_SOURCES)
+OBJECTS = $(libasound_la_OBJECTS)
+
+all: all-recursive all-am
+
+.SUFFIXES:
+.SUFFIXES: .S .c .lo .o .s
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+ cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/Makefile
+
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ cd $(top_builddir) \
+ && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+
+mostlyclean-libLTLIBRARIES:
+
+clean-libLTLIBRARIES:
+ -test -z "$(lib_LTLIBRARIES)" || rm -f $(lib_LTLIBRARIES)
+
+distclean-libLTLIBRARIES:
+
+maintainer-clean-libLTLIBRARIES:
+
+install-libLTLIBRARIES: $(lib_LTLIBRARIES)
+ @$(NORMAL_INSTALL)
+ $(mkinstalldirs) $(DESTDIR)$(libdir)
+ @list='$(lib_LTLIBRARIES)'; for p in $$list; do \
+ if test -f $$p; then \
+ echo "$(LIBTOOL) --mode=install $(INSTALL_DATA) $$p $(DESTDIR)$(libdir)/$$p"; \
+ $(LIBTOOL) --mode=install $(INSTALL_DATA) $$p $(DESTDIR)$(libdir)/$$p; \
+ else :; fi; \
+ done
+
+uninstall-libLTLIBRARIES:
+ @$(NORMAL_UNINSTALL)
+ list='$(lib_LTLIBRARIES)'; for p in $$list; do \
+ $(LIBTOOL) --mode=uninstall rm -f $(DESTDIR)$(libdir)/$$p; \
+ done
+
+.c.o:
+ $(COMPILE) -c $<
+
+.s.o:
+ $(COMPILE) -c $<
+
+.S.o:
+ $(COMPILE) -c $<
+
+mostlyclean-compile:
+ -rm -f *.o core *.core
+
+clean-compile:
+
+distclean-compile:
+ -rm -f *.tab.c
+
+maintainer-clean-compile:
+
+.c.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.s.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.S.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+
+distclean-libtool:
+
+maintainer-clean-libtool:
+
+libasound.la: $(libasound_la_OBJECTS) $(libasound_la_DEPENDENCIES)
+ $(LINK) -rpath $(libdir) $(libasound_la_LDFLAGS) $(libasound_la_OBJECTS) $(libasound_la_LIBADD) $(LIBS)
+
+# This directory's subdirectories are mostly independent; you can cd
+# into them and run `make' without going through this Makefile.
+# To change the values of `make' variables: instead of editing Makefiles,
+# (1) if the variable is set in `config.status', edit `config.status'
+# (which will cause the Makefiles to be regenerated when you run `make');
+# (2) otherwise, pass the desired values on the `make' command line.
+
+@SET_MAKE@
+
+all-recursive install-data-recursive install-exec-recursive \
+installdirs-recursive install-recursive uninstall-recursive \
+check-recursive installcheck-recursive info-recursive dvi-recursive:
+ @set fnord $(MAKEFLAGS); amf=$$2; \
+ list='$(SUBDIRS)'; for subdir in $$list; do \
+ target=`echo $@ | sed s/-recursive//`; \
+ echo "Making $$target in $$subdir"; \
+ (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$target) \
+ || case "$$amf" in *=*) exit 1;; *k*) fail=yes;; *) exit 1;; esac; \
+ done && test -z "$$fail"
+
+mostlyclean-recursive clean-recursive distclean-recursive \
+maintainer-clean-recursive:
+ @set fnord $(MAKEFLAGS); amf=$$2; \
+ rev=''; list='$(SUBDIRS)'; for subdir in $$list; do \
+ rev="$$subdir $$rev"; \
+ done; \
+ for subdir in $$rev; do \
+ target=`echo $@ | sed s/-recursive//`; \
+ echo "Making $$target in $$subdir"; \
+ (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$target) \
+ || case "$$amf" in *=*) exit 1;; *k*) fail=yes;; *) exit 1;; esac; \
+ done && test -z "$$fail"
+tags-recursive:
+ list='$(SUBDIRS)'; for subdir in $$list; do \
+ (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) tags); \
+ done
+
+tags: TAGS
+
+ID: $(HEADERS) $(SOURCES) $(LISP)
+ here=`pwd` && cd $(srcdir) \
+ && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP)
+
+TAGS: tags-recursive $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP)
+ tags=; \
+ here=`pwd`; \
+ list='$(SUBDIRS)'; for subdir in $$list; do \
+ test -f $$subdir/TAGS && tags="$$tags -i $$here/$$subdir/TAGS"; \
+ done; \
+ list='$(SOURCES) $(HEADERS)'; \
+ unique=`for i in $$list; do echo $$i; done | \
+ awk ' { files[$$0] = 1; } \
+ END { for (i in files) print i; }'`; \
+ test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \
+ || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS)
+
+mostlyclean-tags:
+
+clean-tags:
+
+distclean-tags:
+ -rm -f TAGS ID
+
+maintainer-clean-tags:
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = src
+
+distdir: $(DISTFILES)
+ @for file in $(DISTFILES); do \
+ d=$(srcdir); \
+ test -f $(distdir)/$$file \
+ || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+ || cp -p $$d/$$file $(distdir)/$$file; \
+ done
+ for subdir in $(SUBDIRS); do \
+ test -d $(distdir)/$$subdir \
+ || mkdir $(distdir)/$$subdir \
+ || exit 1; \
+ chmod 777 $(distdir)/$$subdir; \
+ (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) top_distdir=../$(top_distdir) distdir=../$(distdir)/$$subdir distdir) \
+ || exit 1; \
+ done
+info: info-recursive
+dvi: dvi-recursive
+check: all-am
+ $(MAKE) $(AM_MAKEFLAGS) check-recursive
+installcheck: installcheck-recursive
+all-am: Makefile $(LTLIBRARIES)
+
+install-exec-am: install-libLTLIBRARIES
+
+uninstall-am: uninstall-libLTLIBRARIES
+
+install-exec: install-exec-recursive install-exec-am
+ @$(NORMAL_INSTALL)
+
+install-data: install-data-recursive
+ @$(NORMAL_INSTALL)
+
+install: install-recursive install-exec-am
+ @:
+
+uninstall: uninstall-recursive uninstall-am
+
+install-strip:
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs: installdirs-recursive
+ $(mkinstalldirs) $(DESTDIR)$(libdir)
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -rm -f Makefile $(CONFIG_CLEAN_FILES)
+ -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean-am: mostlyclean-libLTLIBRARIES mostlyclean-compile \
+ mostlyclean-libtool mostlyclean-tags \
+ mostlyclean-generic
+
+clean-am: clean-libLTLIBRARIES clean-compile clean-libtool clean-tags \
+ clean-generic mostlyclean-am
+
+distclean-am: distclean-libLTLIBRARIES distclean-compile \
+ distclean-libtool distclean-tags distclean-generic \
+ clean-am
+
+maintainer-clean-am: maintainer-clean-libLTLIBRARIES \
+ maintainer-clean-compile maintainer-clean-libtool \
+ maintainer-clean-tags maintainer-clean-generic \
+ distclean-am
+
+mostlyclean: mostlyclean-recursive mostlyclean-am
+
+clean: clean-recursive clean-am
+
+distclean: distclean-recursive distclean-am
+ -rm -f config.status
+ -rm -f libtool
+
+maintainer-clean: maintainer-clean-recursive maintainer-clean-am
+ @echo "This command is intended for maintainers to use;"
+ @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: mostlyclean-libLTLIBRARIES distclean-libLTLIBRARIES \
+clean-libLTLIBRARIES maintainer-clean-libLTLIBRARIES \
+uninstall-libLTLIBRARIES install-libLTLIBRARIES mostlyclean-compile \
+distclean-compile clean-compile maintainer-clean-compile \
+mostlyclean-libtool distclean-libtool clean-libtool \
+maintainer-clean-libtool install-data-recursive \
+uninstall-data-recursive install-exec-recursive \
+uninstall-exec-recursive installdirs-recursive uninstalldirs-recursive \
+all-recursive check-recursive installcheck-recursive info-recursive \
+dvi-recursive mostlyclean-recursive distclean-recursive clean-recursive \
+maintainer-clean-recursive tags tags-recursive mostlyclean-tags \
+distclean-tags clean-tags maintainer-clean-tags distdir info dvi \
+installcheck all-am install-exec-am uninstall-am install-exec \
+install-data install uninstall all installdirs mostlyclean-generic \
+distclean-generic clean-generic maintainer-clean-generic clean \
+mostlyclean distclean maintainer-clean
+
+
+control/libcontrol.la:
+ $(MAKE) -C control libcontrol.la
+
+mixer/libmixer.la:
+ $(MAKE) -C mixer libmixer.la
+
+pcm/libpcm.la:
+ $(MAKE) -C pcm libpcm.la
+
+rawmidi/librawmidi.la:
+ $(MAKE) -C rawmidi librawmidi.la
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
+++ /dev/null
-#
-# Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-include ../../Makefile.conf
-
-TARGET=libcontrol.a
-STARGET=libcontrol.Sa
-OBJECTS=cards.o control.o
-SOBJECTS=cards.So control.So
-TARGETS=$(TARGET) $(STARGET)
-
-.SUFFIXES:
-.SUFFIXES: .c .s .S .o .So .a .Sa
-
-.c.o:
- $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $<
-.c.So:
- $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $<
-
-
-all: $(TARGETS)
-
-$(TARGET): .depend $(OBJECTS)
- $(LINKER) -r -o $@ $(OBJECTS)
-
-$(STARGET): .depend $(SOBJECTS)
- $(LINKER) -r -o $@ $(SOBJECTS)
-
-clean:
- rm -f core .depend *.o *.So *.a *.Sa *.orig *~
-
-.depend:
- $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend
-
-#
-# include a dependency file if one exists
-#
-ifeq (.depend,$(wildcard .depend))
-include .depend
-endif
--- /dev/null
+EXTRA_LTLIBRARIES = libcontrol.la
+
+libcontrol_la_SOURCES = cards.c control.c
+
+all: libcontrol.la
+
+
+INCLUDES=-I$(top_srcdir)/include
--- /dev/null
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ../..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+EXTRA_LTLIBRARIES = libcontrol.la
+
+libcontrol_la_SOURCES = cards.c control.c
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ../../include/config.h
+CONFIG_CLEAN_FILES =
+
+DEFS = @DEFS@ -I. -I$(srcdir) -I../../include
+CPPFLAGS = @CPPFLAGS@
+LDFLAGS = @LDFLAGS@
+LIBS = @LIBS@
+libcontrol_la_LDFLAGS =
+libcontrol_la_LIBADD =
+libcontrol_la_OBJECTS = cards.lo control.lo
+CFLAGS = @CFLAGS@
+COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@
+DIST_COMMON = Makefile.am Makefile.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+SOURCES = $(libcontrol_la_SOURCES)
+OBJECTS = $(libcontrol_la_OBJECTS)
+
+all: Makefile
+
+.SUFFIXES:
+.SUFFIXES: .S .c .lo .o .s
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+ cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/control/Makefile
+
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ cd $(top_builddir) \
+ && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+
+.c.o:
+ $(COMPILE) -c $<
+
+.s.o:
+ $(COMPILE) -c $<
+
+.S.o:
+ $(COMPILE) -c $<
+
+mostlyclean-compile:
+ -rm -f *.o core *.core
+
+clean-compile:
+
+distclean-compile:
+ -rm -f *.tab.c
+
+maintainer-clean-compile:
+
+.c.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.s.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.S.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+
+distclean-libtool:
+
+maintainer-clean-libtool:
+
+libcontrol.la: $(libcontrol_la_OBJECTS) $(libcontrol_la_DEPENDENCIES)
+ $(LINK) $(libcontrol_la_LDFLAGS) $(libcontrol_la_OBJECTS) $(libcontrol_la_LIBADD) $(LIBS)
+
+tags: TAGS
+
+ID: $(HEADERS) $(SOURCES) $(LISP)
+ here=`pwd` && cd $(srcdir) \
+ && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP)
+
+TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP)
+ tags=; \
+ here=`pwd`; \
+ list='$(SOURCES) $(HEADERS)'; \
+ unique=`for i in $$list; do echo $$i; done | \
+ awk ' { files[$$0] = 1; } \
+ END { for (i in files) print i; }'`; \
+ test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \
+ || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS)
+
+mostlyclean-tags:
+
+clean-tags:
+
+distclean-tags:
+ -rm -f TAGS ID
+
+maintainer-clean-tags:
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = src/control
+
+distdir: $(DISTFILES)
+ @for file in $(DISTFILES); do \
+ d=$(srcdir); \
+ test -f $(distdir)/$$file \
+ || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+ || cp -p $$d/$$file $(distdir)/$$file; \
+ done
+info:
+dvi:
+check: all
+installcheck:
+install-exec:
+ @$(NORMAL_INSTALL)
+
+install-data:
+ @$(NORMAL_INSTALL)
+
+install: install-exec install-data all
+ @:
+
+uninstall:
+
+install-strip:
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs:
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -rm -f Makefile $(CONFIG_CLEAN_FILES)
+ -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean: mostlyclean-compile mostlyclean-libtool mostlyclean-tags \
+ mostlyclean-generic
+
+clean: clean-compile clean-libtool clean-tags clean-generic mostlyclean
+
+distclean: distclean-compile distclean-libtool distclean-tags \
+ distclean-generic clean
+ -rm -f config.status
+ -rm -f libtool
+
+maintainer-clean: maintainer-clean-compile maintainer-clean-libtool \
+ maintainer-clean-tags maintainer-clean-generic \
+ distclean
+ @echo "This command is intended for maintainers to use;"
+ @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: mostlyclean-compile distclean-compile clean-compile \
+maintainer-clean-compile mostlyclean-libtool distclean-libtool \
+clean-libtool maintainer-clean-libtool tags mostlyclean-tags \
+distclean-tags clean-tags maintainer-clean-tags distdir info dvi \
+installcheck install-exec install-data install uninstall all \
+installdirs mostlyclean-generic distclean-generic clean-generic \
+maintainer-clean-generic clean mostlyclean distclean maintainer-clean
+
+
+all: libcontrol.la
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
+++ /dev/null
-#
-# Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-include ../../Makefile.conf
-
-TARGET=libmixer.a
-STARGET=libmixer.Sa
-OBJECTS=mixer.o
-SOBJECTS=mixer.So
-TARGETS=$(TARGET) $(STARGET)
-
-.SUFFIXES:
-.SUFFIXES: .c .s .S .o .So .a .Sa
-
-.c.o:
- $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $<
-.c.So:
- $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $<
-
-all: $(TARGETS)
-
-$(TARGET): .depend $(OBJECTS)
- $(LINKER) -r -o $@ $(OBJECTS)
-
-$(STARGET): .depend $(SOBJECTS)
- $(LINKER) -r -o $@ $(SOBJECTS)
-
-clean:
- rm -f core .depend *.o *.So *.a *.Sa *.orig *~
-
-.depend:
- $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend
-
-#
-# include a dependency file if one exists
-#
-ifeq (.depend,$(wildcard .depend))
-include .depend
-endif
--- /dev/null
+EXTRA_LTLIBRARIES=libmixer.la
+
+libmixer_la_SOURCES = mixer.c
+
+all: libmixer.la
+
+
+INCLUDES=-I$(top_srcdir)/include
--- /dev/null
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ../..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+EXTRA_LTLIBRARIES=libmixer.la
+
+libmixer_la_SOURCES = mixer.c
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ../../include/config.h
+CONFIG_CLEAN_FILES =
+
+DEFS = @DEFS@ -I. -I$(srcdir) -I../../include
+CPPFLAGS = @CPPFLAGS@
+LDFLAGS = @LDFLAGS@
+LIBS = @LIBS@
+libmixer_la_LDFLAGS =
+libmixer_la_LIBADD =
+libmixer_la_OBJECTS = mixer.lo
+CFLAGS = @CFLAGS@
+COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@
+DIST_COMMON = Makefile.am Makefile.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+SOURCES = $(libmixer_la_SOURCES)
+OBJECTS = $(libmixer_la_OBJECTS)
+
+all: Makefile
+
+.SUFFIXES:
+.SUFFIXES: .S .c .lo .o .s
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+ cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/mixer/Makefile
+
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ cd $(top_builddir) \
+ && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+
+.c.o:
+ $(COMPILE) -c $<
+
+.s.o:
+ $(COMPILE) -c $<
+
+.S.o:
+ $(COMPILE) -c $<
+
+mostlyclean-compile:
+ -rm -f *.o core *.core
+
+clean-compile:
+
+distclean-compile:
+ -rm -f *.tab.c
+
+maintainer-clean-compile:
+
+.c.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.s.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.S.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+
+distclean-libtool:
+
+maintainer-clean-libtool:
+
+libmixer.la: $(libmixer_la_OBJECTS) $(libmixer_la_DEPENDENCIES)
+ $(LINK) $(libmixer_la_LDFLAGS) $(libmixer_la_OBJECTS) $(libmixer_la_LIBADD) $(LIBS)
+
+tags: TAGS
+
+ID: $(HEADERS) $(SOURCES) $(LISP)
+ here=`pwd` && cd $(srcdir) \
+ && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP)
+
+TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP)
+ tags=; \
+ here=`pwd`; \
+ list='$(SOURCES) $(HEADERS)'; \
+ unique=`for i in $$list; do echo $$i; done | \
+ awk ' { files[$$0] = 1; } \
+ END { for (i in files) print i; }'`; \
+ test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \
+ || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS)
+
+mostlyclean-tags:
+
+clean-tags:
+
+distclean-tags:
+ -rm -f TAGS ID
+
+maintainer-clean-tags:
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = src/mixer
+
+distdir: $(DISTFILES)
+ @for file in $(DISTFILES); do \
+ d=$(srcdir); \
+ test -f $(distdir)/$$file \
+ || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+ || cp -p $$d/$$file $(distdir)/$$file; \
+ done
+info:
+dvi:
+check: all
+installcheck:
+install-exec:
+ @$(NORMAL_INSTALL)
+
+install-data:
+ @$(NORMAL_INSTALL)
+
+install: install-exec install-data all
+ @:
+
+uninstall:
+
+install-strip:
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs:
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -rm -f Makefile $(CONFIG_CLEAN_FILES)
+ -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean: mostlyclean-compile mostlyclean-libtool mostlyclean-tags \
+ mostlyclean-generic
+
+clean: clean-compile clean-libtool clean-tags clean-generic mostlyclean
+
+distclean: distclean-compile distclean-libtool distclean-tags \
+ distclean-generic clean
+ -rm -f config.status
+ -rm -f libtool
+
+maintainer-clean: maintainer-clean-compile maintainer-clean-libtool \
+ maintainer-clean-tags maintainer-clean-generic \
+ distclean
+ @echo "This command is intended for maintainers to use;"
+ @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: mostlyclean-compile distclean-compile clean-compile \
+maintainer-clean-compile mostlyclean-libtool distclean-libtool \
+clean-libtool maintainer-clean-libtool tags mostlyclean-tags \
+distclean-tags clean-tags maintainer-clean-tags distdir info dvi \
+installcheck install-exec install-data install uninstall all \
+installdirs mostlyclean-generic distclean-generic clean-generic \
+maintainer-clean-generic clean mostlyclean distclean maintainer-clean
+
+
+all: libmixer.la
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
+++ /dev/null
-#
-# Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-include ../../Makefile.conf
-
-TARGET=libpcm.a
-STARGET=libpcm.Sa
-OBJECTS=pcm.o pcm_loopback.o
-SOBJECTS=pcm.So pcm_loopback.So
-TARGETS=$(TARGET) $(STARGET)
-
-.SUFFIXES: .c .s .S .o .So .a .Sa
-
-.c.o:
- $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $<
-.c.So:
- $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $<
-
-all: $(TARGETS)
-
-$(TARGET): .depend $(OBJECTS)
- $(LINKER) -r -o $@ $(OBJECTS)
-
-$(STARGET): .depend $(SOBJECTS)
- $(LINKER) -r -o $@ $(SOBJECTS)
-
-clean:
- rm -f core .depend *.o *.So *.a *.Sa *.orig *~
-
-.depend:
- $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend
-
-#
-# include a dependency file if one exists
-#
-ifeq (.depend,$(wildcard .depend))
-include .depend
-endif
--- /dev/null
+EXTRA_LTLIBRARIES=libpcm.la
+
+libpcm_la_SOURCES = pcm.c
+all: libpcm.la
+
+
+INCLUDES=-I$(top_srcdir)/include
--- /dev/null
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ../..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+EXTRA_LTLIBRARIES=libpcm.la
+
+libpcm_la_SOURCES = pcm.c
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ../../include/config.h
+CONFIG_CLEAN_FILES =
+
+DEFS = @DEFS@ -I. -I$(srcdir) -I../../include
+CPPFLAGS = @CPPFLAGS@
+LDFLAGS = @LDFLAGS@
+LIBS = @LIBS@
+libpcm_la_LDFLAGS =
+libpcm_la_LIBADD =
+libpcm_la_OBJECTS = pcm.lo
+CFLAGS = @CFLAGS@
+COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@
+DIST_COMMON = Makefile.am Makefile.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+SOURCES = $(libpcm_la_SOURCES)
+OBJECTS = $(libpcm_la_OBJECTS)
+
+all: Makefile
+
+.SUFFIXES:
+.SUFFIXES: .S .c .lo .o .s
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+ cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/pcm/Makefile
+
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ cd $(top_builddir) \
+ && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+
+.c.o:
+ $(COMPILE) -c $<
+
+.s.o:
+ $(COMPILE) -c $<
+
+.S.o:
+ $(COMPILE) -c $<
+
+mostlyclean-compile:
+ -rm -f *.o core *.core
+
+clean-compile:
+
+distclean-compile:
+ -rm -f *.tab.c
+
+maintainer-clean-compile:
+
+.c.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.s.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.S.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+
+distclean-libtool:
+
+maintainer-clean-libtool:
+
+libpcm.la: $(libpcm_la_OBJECTS) $(libpcm_la_DEPENDENCIES)
+ $(LINK) $(libpcm_la_LDFLAGS) $(libpcm_la_OBJECTS) $(libpcm_la_LIBADD) $(LIBS)
+
+tags: TAGS
+
+ID: $(HEADERS) $(SOURCES) $(LISP)
+ here=`pwd` && cd $(srcdir) \
+ && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP)
+
+TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP)
+ tags=; \
+ here=`pwd`; \
+ list='$(SOURCES) $(HEADERS)'; \
+ unique=`for i in $$list; do echo $$i; done | \
+ awk ' { files[$$0] = 1; } \
+ END { for (i in files) print i; }'`; \
+ test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \
+ || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS)
+
+mostlyclean-tags:
+
+clean-tags:
+
+distclean-tags:
+ -rm -f TAGS ID
+
+maintainer-clean-tags:
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = src/pcm
+
+distdir: $(DISTFILES)
+ @for file in $(DISTFILES); do \
+ d=$(srcdir); \
+ test -f $(distdir)/$$file \
+ || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+ || cp -p $$d/$$file $(distdir)/$$file; \
+ done
+info:
+dvi:
+check: all
+installcheck:
+install-exec:
+ @$(NORMAL_INSTALL)
+
+install-data:
+ @$(NORMAL_INSTALL)
+
+install: install-exec install-data all
+ @:
+
+uninstall:
+
+install-strip:
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs:
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -rm -f Makefile $(CONFIG_CLEAN_FILES)
+ -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean: mostlyclean-compile mostlyclean-libtool mostlyclean-tags \
+ mostlyclean-generic
+
+clean: clean-compile clean-libtool clean-tags clean-generic mostlyclean
+
+distclean: distclean-compile distclean-libtool distclean-tags \
+ distclean-generic clean
+ -rm -f config.status
+ -rm -f libtool
+
+maintainer-clean: maintainer-clean-compile maintainer-clean-libtool \
+ maintainer-clean-tags maintainer-clean-generic \
+ distclean
+ @echo "This command is intended for maintainers to use;"
+ @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: mostlyclean-compile distclean-compile clean-compile \
+maintainer-clean-compile mostlyclean-libtool distclean-libtool \
+clean-libtool maintainer-clean-libtool tags mostlyclean-tags \
+distclean-tags clean-tags maintainer-clean-tags distdir info dvi \
+installcheck install-exec install-data install uninstall all \
+installdirs mostlyclean-generic distclean-generic clean-generic \
+maintainer-clean-generic clean mostlyclean distclean maintainer-clean
+
+all: libpcm.la
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
+++ /dev/null
-#
-# Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-include ../../Makefile.conf
-
-TARGET=librawmidi.a
-STARGET=librawmidi.Sa
-OBJECTS=rawmidi.o
-SOBJECTS=rawmidi.So
-TARGETS=$(TARGET) $(STARGET)
-
-.SUFFIXES: .c .s .S .o .So .a .Sa
-
-.c.o:
- $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $<
-.c.So:
- $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $<
-
-all: $(TARGETS)
-
-$(TARGET): .depend $(OBJECTS)
- $(LINKER) -r -o $@ $(OBJECTS)
-
-$(STARGET): .depend $(SOBJECTS)
- $(LINKER) -r -o $@ $(SOBJECTS)
-
-clean:
- rm -f core .depend *.o *.So *.a *.Sa *.orig *~
-
-.depend:
- $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend
-
-#
-# include a dependency file if one exists
-#
-ifeq (.depend,$(wildcard .depend))
-include .depend
-endif
--- /dev/null
+EXTRA_LTLIBRARIES=librawmidi.la
+
+librawmidi_la_SOURCES = rawmidi.c
+all: librawmidi.la
+
+
+INCLUDES=-I$(top_srcdir)/include
--- /dev/null
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ../..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+EXTRA_LTLIBRARIES=librawmidi.la
+
+librawmidi_la_SOURCES = rawmidi.c
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ../../include/config.h
+CONFIG_CLEAN_FILES =
+
+DEFS = @DEFS@ -I. -I$(srcdir) -I../../include
+CPPFLAGS = @CPPFLAGS@
+LDFLAGS = @LDFLAGS@
+LIBS = @LIBS@
+librawmidi_la_LDFLAGS =
+librawmidi_la_LIBADD =
+librawmidi_la_OBJECTS = rawmidi.lo
+CFLAGS = @CFLAGS@
+COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@
+DIST_COMMON = Makefile.am Makefile.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+SOURCES = $(librawmidi_la_SOURCES)
+OBJECTS = $(librawmidi_la_OBJECTS)
+
+all: Makefile
+
+.SUFFIXES:
+.SUFFIXES: .S .c .lo .o .s
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+ cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/rawmidi/Makefile
+
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ cd $(top_builddir) \
+ && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+
+.c.o:
+ $(COMPILE) -c $<
+
+.s.o:
+ $(COMPILE) -c $<
+
+.S.o:
+ $(COMPILE) -c $<
+
+mostlyclean-compile:
+ -rm -f *.o core *.core
+
+clean-compile:
+
+distclean-compile:
+ -rm -f *.tab.c
+
+maintainer-clean-compile:
+
+.c.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.s.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.S.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+
+distclean-libtool:
+
+maintainer-clean-libtool:
+
+librawmidi.la: $(librawmidi_la_OBJECTS) $(librawmidi_la_DEPENDENCIES)
+ $(LINK) $(librawmidi_la_LDFLAGS) $(librawmidi_la_OBJECTS) $(librawmidi_la_LIBADD) $(LIBS)
+
+tags: TAGS
+
+ID: $(HEADERS) $(SOURCES) $(LISP)
+ here=`pwd` && cd $(srcdir) \
+ && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP)
+
+TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP)
+ tags=; \
+ here=`pwd`; \
+ list='$(SOURCES) $(HEADERS)'; \
+ unique=`for i in $$list; do echo $$i; done | \
+ awk ' { files[$$0] = 1; } \
+ END { for (i in files) print i; }'`; \
+ test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \
+ || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS)
+
+mostlyclean-tags:
+
+clean-tags:
+
+distclean-tags:
+ -rm -f TAGS ID
+
+maintainer-clean-tags:
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = src/rawmidi
+
+distdir: $(DISTFILES)
+ @for file in $(DISTFILES); do \
+ d=$(srcdir); \
+ test -f $(distdir)/$$file \
+ || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+ || cp -p $$d/$$file $(distdir)/$$file; \
+ done
+info:
+dvi:
+check: all
+installcheck:
+install-exec:
+ @$(NORMAL_INSTALL)
+
+install-data:
+ @$(NORMAL_INSTALL)
+
+install: install-exec install-data all
+ @:
+
+uninstall:
+
+install-strip:
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs:
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -rm -f Makefile $(CONFIG_CLEAN_FILES)
+ -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean: mostlyclean-compile mostlyclean-libtool mostlyclean-tags \
+ mostlyclean-generic
+
+clean: clean-compile clean-libtool clean-tags clean-generic mostlyclean
+
+distclean: distclean-compile distclean-libtool distclean-tags \
+ distclean-generic clean
+ -rm -f config.status
+ -rm -f libtool
+
+maintainer-clean: maintainer-clean-compile maintainer-clean-libtool \
+ maintainer-clean-tags maintainer-clean-generic \
+ distclean
+ @echo "This command is intended for maintainers to use;"
+ @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: mostlyclean-compile distclean-compile clean-compile \
+maintainer-clean-compile mostlyclean-libtool distclean-libtool \
+clean-libtool maintainer-clean-libtool tags mostlyclean-tags \
+distclean-tags clean-tags maintainer-clean-tags distdir info dvi \
+installcheck install-exec install-data install uninstall all \
+installdirs mostlyclean-generic distclean-generic clean-generic \
+maintainer-clean-generic clean mostlyclean distclean maintainer-clean
+
+all: librawmidi.la
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
+++ /dev/null
-CC = gcc
-CFLAGS = -static -O2 -g -Wall -pipe
-TARGETS = control mixer switches pause pcm
-LIB = -L../lib -lasound
-
-all: $(TARGETS)
-
-control: control.c
- $(CC) $(CFLAGS) $(LIB) -o control control.c
-
-mixer: mixer.c
- $(CC) $(CFLAGS) $(LIB) -o mixer mixer.c
-
-switches: switches.c
- $(CC) $(CFLAGS) $(LIB) -o switches switches.c
-
-pause: pause.c
- $(CC) $(CFLAGS) $(LIB) -o pause pause.c
-
-pcm: pcm.c
- $(CC) $(CFLAGS) $(LIB) -o pcm pcm.c
-
-clean:
- rm -f *.o $(TARGETS) *~
--- /dev/null
+check_PROGRAMS=control mixer switches pause pcm
+
+control_LDADD=../src/libasound.la
+mixer_LDADD=../src/libasound.la
+switches_LDADD=../src/libasound.la
+pause_LDADD=../src/libasound.la
+pcm_LDADD=../src/libasound.la
+
+
+INCLUDES=-I$(top_srcdir)/include
--- /dev/null
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+check_PROGRAMS=control mixer switches pause pcm
+
+control_LDADD=../src/libasound.la
+mixer_LDADD=../src/libasound.la
+switches_LDADD=../src/libasound.la
+pause_LDADD=../src/libasound.la
+pcm_LDADD=../src/libasound.la
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ../include/config.h
+CONFIG_CLEAN_FILES =
+
+DEFS = @DEFS@ -I. -I$(srcdir) -I../include
+CPPFLAGS = @CPPFLAGS@
+LDFLAGS = @LDFLAGS@
+LIBS = @LIBS@
+control_SOURCES = control.c
+control_OBJECTS = control.o
+control_DEPENDENCIES = ../src/libasound.la
+control_LDFLAGS =
+mixer_SOURCES = mixer.c
+mixer_OBJECTS = mixer.o
+mixer_DEPENDENCIES = ../src/libasound.la
+mixer_LDFLAGS =
+switches_SOURCES = switches.c
+switches_OBJECTS = switches.o
+switches_DEPENDENCIES = ../src/libasound.la
+switches_LDFLAGS =
+pause_SOURCES = pause.c
+pause_OBJECTS = pause.o
+pause_DEPENDENCIES = ../src/libasound.la
+pause_LDFLAGS =
+pcm_SOURCES = pcm.c
+pcm_OBJECTS = pcm.o
+pcm_DEPENDENCIES = ../src/libasound.la
+pcm_LDFLAGS =
+CFLAGS = @CFLAGS@
+COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@
+DIST_COMMON = Makefile.am Makefile.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+SOURCES = control.c mixer.c switches.c pause.c pcm.c
+OBJECTS = control.o mixer.o switches.o pause.o pcm.o
+
+all: Makefile
+
+.SUFFIXES:
+.SUFFIXES: .S .c .lo .o .s
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+ cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps test/Makefile
+
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ cd $(top_builddir) \
+ && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+
+mostlyclean-checkPROGRAMS:
+
+clean-checkPROGRAMS:
+ -test -z "$(check_PROGRAMS)" || rm -f $(check_PROGRAMS)
+
+distclean-checkPROGRAMS:
+
+maintainer-clean-checkPROGRAMS:
+
+.c.o:
+ $(COMPILE) -c $<
+
+.s.o:
+ $(COMPILE) -c $<
+
+.S.o:
+ $(COMPILE) -c $<
+
+mostlyclean-compile:
+ -rm -f *.o core *.core
+
+clean-compile:
+
+distclean-compile:
+ -rm -f *.tab.c
+
+maintainer-clean-compile:
+
+.c.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.s.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.S.lo:
+ $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+
+distclean-libtool:
+
+maintainer-clean-libtool:
+
+control: $(control_OBJECTS) $(control_DEPENDENCIES)
+ @rm -f control
+ $(LINK) $(control_LDFLAGS) $(control_OBJECTS) $(control_LDADD) $(LIBS)
+
+mixer: $(mixer_OBJECTS) $(mixer_DEPENDENCIES)
+ @rm -f mixer
+ $(LINK) $(mixer_LDFLAGS) $(mixer_OBJECTS) $(mixer_LDADD) $(LIBS)
+
+switches: $(switches_OBJECTS) $(switches_DEPENDENCIES)
+ @rm -f switches
+ $(LINK) $(switches_LDFLAGS) $(switches_OBJECTS) $(switches_LDADD) $(LIBS)
+
+pause: $(pause_OBJECTS) $(pause_DEPENDENCIES)
+ @rm -f pause
+ $(LINK) $(pause_LDFLAGS) $(pause_OBJECTS) $(pause_LDADD) $(LIBS)
+
+pcm: $(pcm_OBJECTS) $(pcm_DEPENDENCIES)
+ @rm -f pcm
+ $(LINK) $(pcm_LDFLAGS) $(pcm_OBJECTS) $(pcm_LDADD) $(LIBS)
+
+tags: TAGS
+
+ID: $(HEADERS) $(SOURCES) $(LISP)
+ here=`pwd` && cd $(srcdir) \
+ && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP)
+
+TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP)
+ tags=; \
+ here=`pwd`; \
+ list='$(SOURCES) $(HEADERS)'; \
+ unique=`for i in $$list; do echo $$i; done | \
+ awk ' { files[$$0] = 1; } \
+ END { for (i in files) print i; }'`; \
+ test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \
+ || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS)
+
+mostlyclean-tags:
+
+clean-tags:
+
+distclean-tags:
+ -rm -f TAGS ID
+
+maintainer-clean-tags:
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = test
+
+distdir: $(DISTFILES)
+ @for file in $(DISTFILES); do \
+ d=$(srcdir); \
+ test -f $(distdir)/$$file \
+ || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+ || cp -p $$d/$$file $(distdir)/$$file; \
+ done
+info:
+dvi:
+check: all $(check_PROGRAMS)
+installcheck:
+install-exec:
+ @$(NORMAL_INSTALL)
+
+install-data:
+ @$(NORMAL_INSTALL)
+
+install: install-exec install-data all
+ @:
+
+uninstall:
+
+install-strip:
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs:
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -rm -f Makefile $(CONFIG_CLEAN_FILES)
+ -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean: mostlyclean-checkPROGRAMS mostlyclean-compile \
+ mostlyclean-libtool mostlyclean-tags \
+ mostlyclean-generic
+
+clean: clean-checkPROGRAMS clean-compile clean-libtool clean-tags \
+ clean-generic mostlyclean
+
+distclean: distclean-checkPROGRAMS distclean-compile distclean-libtool \
+ distclean-tags distclean-generic clean
+ -rm -f config.status
+ -rm -f libtool
+
+maintainer-clean: maintainer-clean-checkPROGRAMS \
+ maintainer-clean-compile maintainer-clean-libtool \
+ maintainer-clean-tags maintainer-clean-generic \
+ distclean
+ @echo "This command is intended for maintainers to use;"
+ @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: mostlyclean-checkPROGRAMS distclean-checkPROGRAMS \
+clean-checkPROGRAMS maintainer-clean-checkPROGRAMS mostlyclean-compile \
+distclean-compile clean-compile maintainer-clean-compile \
+mostlyclean-libtool distclean-libtool clean-libtool \
+maintainer-clean-libtool tags mostlyclean-tags distclean-tags \
+clean-tags maintainer-clean-tags distdir info dvi installcheck \
+install-exec install-data install uninstall all installdirs \
+mostlyclean-generic distclean-generic clean-generic \
+maintainer-clean-generic clean mostlyclean distclean maintainer-clean
+
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
+++ /dev/null
-#
-# Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-include ../Makefile.conf
-
-clean:
- rm -f core .depend *.o *.orig *~
-
--- /dev/null
+rpm: buildrpm alsa-lib.spec
+ VERSION=$(VERSION) $(srcdir)/buildrpm
+
+INCLUDES=-I$(top_srcdir)/include
--- /dev/null
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ../include/config.h
+CONFIG_CLEAN_FILES = alsa-lib.spec
+DIST_COMMON = Makefile.am Makefile.in alsa-lib.spec.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+all: Makefile
+
+.SUFFIXES:
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+ cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps utils/Makefile
+
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ cd $(top_builddir) \
+ && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+alsa-lib.spec: $(top_builddir)/config.status alsa-lib.spec.in
+ cd $(top_builddir) && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+tags: TAGS
+TAGS:
+
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = utils
+
+distdir: $(DISTFILES)
+ @for file in $(DISTFILES); do \
+ d=$(srcdir); \
+ test -f $(distdir)/$$file \
+ || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+ || cp -p $$d/$$file $(distdir)/$$file; \
+ done
+info:
+dvi:
+check: all
+installcheck:
+install-exec:
+ @$(NORMAL_INSTALL)
+
+install-data:
+ @$(NORMAL_INSTALL)
+
+install: install-exec install-data all
+ @:
+
+uninstall:
+
+install-strip:
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs:
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -rm -f Makefile $(CONFIG_CLEAN_FILES)
+ -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean: mostlyclean-generic
+
+clean: clean-generic mostlyclean
+
+distclean: distclean-generic clean
+ -rm -f config.status
+ -rm -f libtool
+
+maintainer-clean: maintainer-clean-generic distclean
+ @echo "This command is intended for maintainers to use;"
+ @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: tags distdir info dvi installcheck install-exec install-data \
+install uninstall all installdirs mostlyclean-generic distclean-generic \
+clean-generic maintainer-clean-generic clean mostlyclean distclean \
+maintainer-clean
+
+
+rpm: buildrpm alsa-lib.spec
+ VERSION=$(VERSION) $(srcdir)/buildrpm
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
%doc doc/*.sgml
%doc doc/*.txt
-%{prefix}/usr/include/sys/asoundlib.h
+%{prefix}/usr/include/sys/soundlib.h
%{prefix}/usr/lib/lib*
-/usr/share/aclocal/alsa-lib.m4
#!/bin/bash
source=.
-version=`cat $source/../version`
-package=$source/../../alsa-lib-$version.tar.gz
+version=$VERSION
+package=$source/../alsa-lib-$version.tar.gz
if [ ! -r $package ]; then
echo "Error: wrong package: $package"
exit 1
fi
-make -C .. pack
+make -C .. dist
cp -fv $package /usr/src/redhat/SOURCES
OSDN Git Service
