* like adding comments, etc...
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: action.php,v 1.7 2007-03-27 22:00:12 kmorimatsu Exp $
- * $NucleusJP: action.php,v 1.6 2007/03/22 09:23:50 kimitake Exp $
+ * @version $Id: action.php,v 1.7.2.1 2008-01-29 07:05:04 kimitake Exp $
+ * $NucleusJP: action.php,v 1.8.2.1 2007/09/05 05:50:12 kimitake Exp $
*/
$CONF = array();
--- /dev/null
+<?php
+ require "./config.php";
+ include $DIR_LIBS."ACTION.php";
+
+ if (isset ($_POST['showform'])&&$_POST['showform']==1) {
+ $showform = 1;
+ }
+ else {
+ $showform = 0;
+ }
+?>
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="ja-JP" lang="ja-JP">
+<head>
+ <meta http-equiv="Content-Type" content="text/html; charset=<?php echo _CHARSET; ?>" />
+ <title>Create Member Account</title>
+ <style type="text/css">@import url(nucleus/styles/manual.css);</style>
+</head>
+<body>
+
+ <h1><?php echo _CREATE_ACCOUNT0?></h1>
+
+<?php
+ // show form only if Visitors are allowed to create a Member Account
+ if ($CONF['AllowMemberCreate']==1) {
+ // if the form is shown the first time no POST data
+ // will be added as value for the input fields
+ if ($showform==0) {
+?>
+
+ <form method="post" action="createaccount.php">
+
+ <div>
+ <input type="hidden" name="showform" value="1" />
+ <input type="hidden" name="action" value="createaccount" />
+
+ <?php echo _CREATE_ACCOUNT_LOGIN_NAME?>
+ <br />
+ <input name="name" size="20" /> <small>(only a-z, 0-9)</small>
+ <br />
+ <br />
+ <?php echo _CREATE_ACCOUNT_REAL_NAME?>
+ <br />
+ <input name="realname" size="40" />
+ <br />
+ <br />
+ <?php echo _CREATE_ACCOUNT_EMAIL?>
+ <br />
+ <input name="email" size="40" /> <small><?php echo _CREATE_ACCOUNT_EMAIL2?></small>
+ <br />
+ <br />
+ <?php echo _CREATE_ACCOUNT_URL?>
+ <br />
+ <input name="url" size="60" />
+ <br />
+ <?php
+ // add a Captcha challenge or something else
+ global $manager;
+ $manager->notify('FormExtra', array('type' => 'membermailform-notloggedin'));
+ ?>
+ <br />
+ <br />
+ <input type="submit" value="<?php echo _CREATE_ACCOUNT_SUBMIT?>" />
+ </div>
+
+ </form>
+<?php
+ } // close if showfrom ...
+ else {
+ // after the from is sent it will be validated
+ // POST data will be added as value to treat the user with care (;-))
+
+ $a = new ACTION();
+
+ // if createAccount fails it returns an error message
+ $message = $a->createAccount();
+
+ echo '<span style="font-weight:bold; color:red;">'.htmlspecialchars($message).'</span><br /><br />';
+?>
+
+ <form method="post" action="createaccount.php">
+
+ <div>
+ <input type="hidden" name="showform" value="1" />
+ <input type="hidden" name="action" value="createaccount" />
+
+ <?php echo _CREATE_ACCOUNT_LOGIN_NAME?>
+ <br />
+ <input name="name" size="20" <?php if(isset($_POST['name'])){echo 'value="'.htmlspecialchars($_POST['name']).'"';}?>/> <small>(only a-z, 0-9)</small>
+ <br />
+ <br />
+ <?php echo _CREATE_ACCOUNT_REAL_NAME?>
+ <br />
+ <input name="realname" size="40" <?php if(isset($_POST['realname'])){echo 'value="'.htmlspecialchars($_POST['realname']).'"';}?>/>
+ <br />
+ <br />
+ <?php echo _CREATE_ACCOUNT_EMAIL?>
+ <br />
+ <input name="email" size="40" <?php if(isset($_POST['email'])){echo 'value="'.htmlspecialchars($_POST['email']).'"';}?>/> <small><?php echo _CREATE_ACCOUNT_EMAIL2?></small>
+ <br />
+ <br />
+ <?php echo _CREATE_ACCOUNT_URL?>
+ <br />
+ <input name="url" size="60" <?php if(isset($_POST['url'])){echo 'value="'.htmlspecialchars($_POST['url']).'"';}?>/>
+ <br />
+ <?php
+ // add a Captcha challenge or something else
+ global $manager;
+ $manager->notify('FormExtra', array('type' => 'membermailform-notloggedin'));
+ ?>
+ <br />
+ <br />
+ <input type="submit" value="<?php echo _CREATE_ACCOUNT_SUBMIT?>" />
+
+
+ </form>
+<?php
+ } // close else showform ...
+
+}
+else {
+ echo _CREATE_ACCOUNT1;
+ echo _CREATE_ACCOUNT2;
+}
+?>
+
+
+</body>
+</html>
-<?php\r
-// This file will generate and return the main page of the site\r
-$CONF = array();\r
-$CONF['Self'] = 'index.php';\r
-\r
-include('./config.php');\r
-\r
-selector();\r
-\r
-?>\r
+<?php
+// This file will generate and return the main page of the site
+$CONF = array();
+$CONF['Self'] = 'index.php';
+include('./config.php');
+selector();
+?>
`ballowpast` tinyint(2) NOT NULL default '0',
`bincludesearch` tinyint(2) NOT NULL default '0',
`breqemail` TINYINT( 2 ) DEFAULT '0' NOT NULL,
+ `bfuturepost` TINYINT(2) DEFAULT '0' NOT NULL,
PRIMARY KEY (`bnumber`),
UNIQUE KEY `bnumber` (`bnumber`),
UNIQUE KEY `bshortname` (`bshortname`)
) TYPE=MyISAM;
-INSERT INTO `nucleus_blog` VALUES (1, 'My Nucleus CMS', 'mynucleuscms', '', 1, 0, 0.0, '', 'http://localhost:8080/nucleus/', '', 5, 1, 0, 1, 1, 1, 1, 0, 0);
+INSERT INTO `nucleus_blog` VALUES (1, 'My Nucleus CMS', 'mynucleuscms', '', 1, 0, 0.0, '', 'http://localhost:8080/nucleus/', '', 5, 1, 0, 1, 1, 1, 1, 0, 0, 0);
CREATE TABLE `nucleus_category` (
`catid` int(11) NOT NULL auto_increment,
`ikarmapos` int(11) NOT NULL default '0',
`icat` int(11) default NULL,
`ikarmaneg` int(11) NOT NULL default '0',
+ `iposted` tinyint(2) NOT NULL default '1',
PRIMARY KEY (`inumber`),
UNIQUE KEY `inumber` (`inumber`),
KEY `itime` (`itime`),
FULLTEXT KEY `ibody` (`ibody`,`ititle`,`imore`)
) TYPE=MyISAM PACK_KEYS=0;
-INSERT INTO `nucleus_item` VALUES (1, 'Nucleus CMS ¥Ð¡¼¥¸¥ç¥ó3.3¤Ø¤è¤¦¤³¤½',
-'¥¦¥§¥Ö¥Ú¡¼¥¸¤ÎºîÀ®¤òÊä½õ¤¹¤ëÀѤßÌÚ¤¬¤³¤³¤Ë¤¢¤ê¤Þ¤¹¡£¤½¤ì¤Ï¿´Ìö¤ëblog¤Ë¤Ê¤ë¤«¤â¤·¤ì¤Þ¤»¤ó¤·¡¢´Ñ¤ë¤â¤Î¤òϤޤ»¤ë²È²¤Î¥Ú¡¼¥¸¤Ë¤Ê¤ë¤«¤â¤·¤ì¤Þ¤»¤ó¤·¡¢¼Â¤ê¿¤¼ñÌ£¤Î¥µ¥¤¥È¤Ë¤Ê¤ë¤«¤â¤·¤ì¤Þ¤»¤ó¡£¤¢¤ë¤¤¤Ï¸½ºß¤Î¤¢¤Ê¤¿¤Ë¤ÏÁÛÁü¤¬¤Ä¤«¤Ê¤¤¤â¤Î¤Ë¤Ê¤ë¤³¤È¤À¤Ã¤Æ¤¢¤ë¤Ç¤·¤ç¤¦¡£<br />\r\n<br />\r\nÍÑÅÓ¤¬»×¤¤¤Ä¤¤Þ¤»¤ó¤Ç¤·¤¿¤«¡©¡¡¤½¤ì¤Ê¤é¤³¤³¤ØÍè¤ÆÀµ²ò¤Ç¤¹¡£¤Ê¤¼¤Ê¤é¤¢¤Ê¤¿Æ±Íͻ䤿¤Á¤Ë¤â¤ï¤«¤é¤Ê¤¤¤Î¤Ç¤¹¤«¤é¡£',
-'¤³¤ì¤Ï¥µ¥¤¥È¤Ë¤ª¤±¤ëºÇ½é¤Î¥¨¥ó¥È¥ê¡¼¤Ç¤¹¡£¥¹¥¿¡¼¥È¤òÀÚ¤ê¤ä¤¹¤¤¤è¤¦¤Ë¡¢¥ê¥ó¥¯¤È¾ðÊó¤òÆþ¤ì¤Æ¤ª¤¤Þ¤·¤¿¡£<br />\r\n<br />\r\n¤³¤Îµ»ö¤òºï½ü¤¹¤ë¤³¤È¤â¤Ç¤¤Þ¤¹¤¬¡¢¤É¤Á¤é¤Ë¤»¤èµ»ö¤òÄɲ䷤Ƥ¤¤¯¤³¤È¤Ë¤è¤Ã¤Æ¤ä¤¬¤Æ¥á¥¤¥ó¥Ú¡¼¥¸¤«¤é¤Ï¸«¤¨¤Ê¤¯¤Ê¤ê¤Þ¤¹¡£Nucleus¤ò°·¤¦¤¦¤Á¤ËÀ¸¤¸¤¿¥á¥â¤ò¥³¥á¥ó¥È¤È¤·¤ÆÄɲä·¡¢¾Í襢¥¯¥»¥¹¤Ç¤¤ë¤è¤¦¤Ë¤³¤Î¥Ú¡¼¥¸¤ò¥Ö¥Ã¥¯¥Þ¡¼¥¯¤·¤Æ¤ª¤¯¤Î¤â¼ê¤Ç¤¹¡£<br />\r\n<br />\r\n<b>¥ê¥ó¥¯</b><br />\r\n<br />\r\nNucleus CMS¤Î<a href="http://nucleuscms.org">ËܲÈ</a>¤È<a href="http://japan.nucleuscms.org">ÆüËܸì¸ø¼°</a>¥Ú¡¼¥¸¡£<br />\r\n<br />\r\nNucleus CMS¤ÎSourceForge<a href="http://sourceforge.net/projects/nucleuscms/">¥×¥í¥¸¥§¥¯¥È</a>¡Ê<a href="http://sourceforge.jp/projects/nucleus-jp/">ÆüËÜÈÇ</a>¡Ë¥Ú¡¼¥¸¡£<br />\r\n<br />\r\nNucleus CMS¤Î¥×¥é¥°¥¤¥ó<a href="http://wakka.xiffy.nl/Plugin/">ÁÒ¸Ë</a>¤È<a href="http://japan.nucleuscms.org/wiki/plugins">ÆüËܸì¤Î¥ê¥¹¥È</a>¥Ú¡¼¥¸¡£<br />\r\n<br />\r\n<b>¥É¥¥å¥á¥ó¥È - <a href="http://docs.nucleuscms.org/">docs.nucleuscms.org</a></b><br />\r\n<br />\r\nNucleus¤Î<a href="http://japan.nucleuscms.org/faq.php">FAQ¡Ê¤è¤¯¤¢¤ë¼ÁÌ佸¡Ë</a>¡Ê<a href="http://nucleuscms.org/faq.php">¸¶Ê¸</a>¡Ë¥Ú¡¼¥¸¡£<br />\r\n<br />\r\n¥¤¥ó¥¹¥È¡¼¥ëÊýË¡Åù¤Ï<a href="nucleus/documentation/">¥æ¡¼¥¶¡¼¸þ¤±</a>¤È<a href="nucleus/documentation/devdocs/">³«È¯¼Ô¸þ¤±</a>ʸ½ñ¤¬¥Õ¥¡¥¤¥ë¤Ë´Þ¤Þ¤ì¤Æ¤¤¤Þ¤¹¡£<br />\r\n<br />\r\n¥Ý¥Ã¥×¥¢¥Ã¥×<a href="./nucleus/documentation/help.html">¥Ø¥ë¥×</a>¤¬´ÉÍý¥¨¥ê¥¢¤Î¤¤¤¿¤ë¤È¤³¤í¤Ë¤¢¤ê¡¢¥µ¥¤¥È¤Î¥«¥¹¥¿¥Þ¥¤¥º¤ä¥Ç¥¶¥¤¥ó¤ò¼ê½õ¤±¤·¤Æ¤¯¤ì¤ë¤³¤È¤Ç¤·¤ç¤¦¡£<br />\r\n<br />\r\n°ìÅÙÍÑ°Õ¤µ¤ì¤Æ¤¤¤ë¥É¥¥å¥á¥ó¥È¤ËÌܤòÄ̤·¤¿¤é¡¢<a href="http://wiki.nucleuscms.org/">Wiki</a>¡Ê<a href="http://japan.nucleuscms.org/wiki/">ÆüËÜÈÇ</a>¡Ë¤òˬ¤ì¤Æ¤¯¤À¤µ¤¤¡£¥æ¡¼¥¶¡¼¤Î½ñ¤¤¤¿¥Ï¥¦¥Ä¡¼¤ä¾®µ»¤¬·ÇºÜ¤µ¤ì¤Æ¤¤¤Þ¤¹¡£<br />\r\n<br />\r\n<b>¥µ¥Ý¡¼¥È</b><br />\r\n<br />\r\n<a href="http://forum.nucleuscms.org/">forum.nucleuscms.org</a>¡ÊËܲȡË<br />\r\n<a href="http://japan.nucleuscms.org/bb/">japan.nucleuscms.org/bb/</a>¡ÊÆüËÜÈÇ¡Ë<br />\r\n<br />\r\n<a href="http://forum.nucleuscms.org/groupcp.php?g=3">moderators</a>¤È¥µ¥Ý¡¼¥È¥Õ¥©¡¼¥é¥à¤Ç³èÆ°¤¹¤ëÁ´¤Æ¤Î¥Ü¥é¥ó¥Æ¥£¥¢¤Ë´¶¼Õ¤·¤Þ¤¹¡£<br />\r\n<br />\r\n- <a href="http://edmondhui.homeip.net/blog/">admun</a> - Ottawa, ON, Canada <br />\r\n- <a href="http://www.tamizhan.com/">anand</a> - Bangalore, India<br />\r\n- <a href="http://hcgtv.com">hcgtv</a> - Miami, Florida, USA<br />\r\n- <a href="http://www.adrenalinsports.nl/">ikeizer</a> - Maastricht<br />\r\n- <a href="http://www.tipos.com.br/">moraes</a> - Brazil<br />\r\n- <a href="http://roelg.nl/">roel </a>- The Netherlands<br />\r\n- <a href="http://budts.be/weblog/">TeRanEX </a>- Ekeren, Antwerp, Belgium<br />\r\n- <a href="http://www.trentadams.com/">Trent </a>- Alberta, Canada<br />\r\n- <a href="http://xiffy.nl/weblog/">xiffy </a>- Deventer<br />\r\n<br />\r\n¤â¤·¼ê½õ¤±¤¬É¬Íפʤ顢1400¤òĶ¤¨¤ëÅÐÏ¿¥æ¡¼¥¶¡¼¤Î¤¤¤ë»ä¤¿¤Á¤Î¥Õ¥©¡¼¥é¥à¤Ë»²²Ã¤·¤Æ¤¯¤À¤µ¤¤¡£23,000¤òĶ¤¨¤ëÅê¹Æ¤µ¤ì¤¿µ»ö¤ò¸¡º÷¤Ç¤¤ë¤è¤¦¤Ë¤Ê¤Ã¤Æ¤ª¤ê¤Þ¤¹¤Î¤Ç¡¢µá¤á¤ëÅú¤¨¤Ë¿ô²ó¤Î¥¯¥ê¥Ã¥¯¤Ç¤¿¤É¤êÃ失¤ë¤«¤â¤·¤ì¤Þ¤»¤ó¡£<br />\r\n<br />\r\n<b>Personalization - <a href="http://skins.nucleuscms.org/">skins.nucleuscms.org</a></b><br />\r\n<br />\r\n¥Þ¥ë¥Á¥¦¥§¥Ö¥í¥°¤È¥¹¥¥ó/¥Æ¥ó¥×¥ì¡¼¥È¤ÎÁȤ߹ç¤ï¤»¤Ï¶¯ÎϤÊÁê¾è¸ú²Ì¤òÀ¸¤ß½Ð¤·¤Þ¤¹¡£¸Ä¿ÍŪ¤Ê¥µ¥¤¥ÈºîÀ®¡¢Í§¿Í¤ä¿ÆÀ̤¢¤ë¤¤¤Ï¥¯¥é¥¤¥¢¥ó¥È¤ËÂФ¹¤ë¥µ¥¤¥È¥Ç¥¶¥¤¥ó¤¤¤º¤ì¤ËÂФ·¤Æ¤â¤Ç¤¹¡£<br />\r\n<br />\r\n636¤ÎÅÐÏ¿¤µ¤ì¤¿<a href="http://nucleuscms.org/sites.php">Nucleus¤Ç±¿ÍѤµ¤ì¤Æ¤¤¤ë¥µ¥¤¥È</a>¡Ê<a href="http://japan.nucleuscms.org/sites.php">ÆüËÜÈÇ</a>¡Ë¤ÎÃ椫¤éÆÿ§¤¢¤ë¥µ¥¤¥È¤ò¥µ¥ó¥×¥ë¤È¤·¤Æ¤´¾Ò²ð¤·¤Þ¤¹¡£<br />\r\n<br />\r\nThe Zen of Nucleus<br />\r\n- <a href="http://beefcake.nl/">beefcake.nl</a> - Beefcake | Nuke the whales!<br />\r\n- <a href="http://www.leng-lui.com//">leng-lui.com</a> - Leng-Lui.com - v7.0: "Memento"<br />\r\n<br />\r\nPersonal blogs<br />\r\n- <a href="http://bloggard.com/">bloggard.com</a> - The Adventures of Bloggard<br />\r\n- <a href="http://battleangel.org/">battleangel.org</a> - Giving meaning to the meaningless<br />\r\n- <a href="http://www.yetanotherblog.de/">yetanotherblog.de</a> - Yet Another Blog<br />\r\n<br />\r\nMulti user blogs<br />\r\n- <a href="http://tipos.com.br/">tipos.com.br</a> - Blogging community<br />\r\n<br />\r\nHobby, Travel and News sites<br />\r\n- <a href="http://adrenalinsports.nl/">adrenalinsports.nl</a> - Extreme sports<br />\r\n- <a href="http://hsbluebird.com/">hsbluebird.com</a> - Hot Springs, Montana''s Online Resource <br />\r\n- <a href="http://groningen-info.de/">groningen-info.de</a> - Neues aus Groningen. Fr Leute aus Duitsland.<br />\r\n- <a href="http://www.americandaily.com/">americandaily.com</a> - American Daily - Home<br />\r\n<br />\r\n<b>Nucleus Developer Network - <a href="http://dev.nucleuscms.org/">dev.nucleuscms.org</a></b><br />\r\n<br />\r\nThe NUDN is a hub for developer sites and programming resources.<br />\r\n<br />\r\nNUDN satellite sites, handles, location and UTC offset:<br />\r\n- <a href="http://karma.nucleuscms.org/">karma</a> - Izegem +02<br />\r\n- <a href="http://hcgtv.net/">hcgtv</a> - Miami -05<br />\r\n- <a href="http://edmondhui.homeip.net/blog/nudn.php">admun</a> - Ottawa -04<br />\r\n- <a href="http://dev.budts.be/nucleus/">TeRanEX</a> - Ekeren +02<br />\r\n<br />\r\nSourceforge.net graciously hosts our <a href="http://sourceforge.net/projects/nucleuscms/">CVS repository</a>.<br />\r\n<br />\r\nWant to play around or test changes, visit our demo site at <a href="http://demo.nucleuscms.org/">demo.nucleuscms.org</a>.<br />\r\n<br />\r\nNot sure what plugins to use, visit the <a href="http://showcase.trentadams.com/">showcase site</a> where you can see plugins at play in their native habitat.<br />\r\n<br />\r\nThen visit the plugin repository at <a href="http://plugins.nucleuscms.org/">plugins.nucleuscms.org</a> for download and installation instructions.<br />\r\n<br />\r\n<b>´óÉÕ¼Ô°ìÍ÷</b><br />\r\n<br />\r\n°Ê²¼¤Î<a href="http://nucleuscms.org/donators.php">ÁÇÀ²¤é¤·¤¤¿Í¡¹</a>¤Ë¤è¤ë<a href="http://nucleuscms.org/donate.php">±ç½õ</a>´¶¼Õ¤òÊû¤²¤Þ¤¹¡£<em>¤¢¤ê¤¬¤È¤¦¡ª</em><br />\r\n<br />\r\n- <a href="http://reddustrec.net/">dkex</a><br />\r\n- <a href="http://www.uncoverthenet.com/">Uncover the Net</a><br />\r\n- <a href="http://www.webatlas.org/">Web Atlas</a><br />\r\n- <a href="http://www.ipnlighting.com/">IPN Lighting</a><br />\r\n- <a href="http://blog.datoka.jp/">Yu (blog.datoka.jp)</a><br />\r\n- <a href="http://www.thegadgetreview.com/">Sony Gadgets and Reviews</a><br />\r\n- <a href="http://sites.proliphus.com/blueZhift/blog/">Thomas McKibben</a><br />\r\n- <a href="http://cheapweb.us/">CheapWeb.us</a><br />\r\n- Robert Seyfriedsberger<br />\r\n- <a href="http://www.toxicologie.nl/">Toxicologie.nl</a><br />\r\n- Gordon Shum<br />\r\n- <a href="http://www.subsim.com/">Neal Stevens</a><br />\r\n- <a href="http://www.GamblingHelper.com/">GamblingHelper</a><br />\r\n- Oliver Kirstein<br />\r\n- <a href="http://www.dominiek.be/">Dominiek</a><br />\r\n- <a href="http://www.aardschok.net/">Aardschok</a><br />\r\n- <a href="http://www.nieuwevoordeur.be/">nieuwevoordeur.be</a><br />\r\n- <a href="http://www.scene24.net/">Scene24</a><br />\r\n- <a href="http://www.eug.be/">Eug''s Weblog</a><br />\r\n- <a href="http://www.bloggard.com/">The Adventures of Bloggard</a><br />\r\n- <a href="http://www.voltos.com/">Arthur Cronos from Voltos</a><br />\r\n- <a href="http://www.webmaster-toolkit.com/">Free Webmaster Tools and Resources</a><br />\r\n- <a href="http://www.domilog.be/">Domi''s Weblog</a><br />\r\n- Infodoma <br />\r\n- <a href="http://carvingcode.com/">carvingCode.com</a><br />\r\n- <a href="http://www.traweb.com/">Traweb</a><br />\r\n- <a href="http://gene.mm2u.com/">Gene''s MoBlog</a><br />\r\n- <a href="http://interfacethis.com/">InterfaceThis</a><br />\r\n- <a href="http://www.thefinsters.com/flog/">The Finster Log</a><br />\r\n- <a href="http://www.mrhop.com/">Hop Nguyen</a><br />\r\n- <a href="http://www.zwavel.com/~zwavelaars" title="Zwavelaars">Zwavelaars</a><br />\r\n- <a href="http://beefcake.nl/">Joaquin Scholten</a> <br />\r\n- <a href="http://www.roelgroeneveld.com/">Roel Groeneveld</a><br />\r\n- <a href="http://lvb.net/">LVBlog</a><br />\r\n- <a href="http://xandermol.com/">Xander Mol</a><br />\r\n- Danilo Massa<br />\r\n- <a href="http://01FTP.com/">01FTP.com</a><br />\r\n- <a href="http://www.adrenalinsports.nl/">Irmo Keizer</a><br />\r\n- <a href="http://www.jasonkrogh.com/">Jason Krogh</a><br />\r\n- <a href="http://www.higuchi.com/">Osamu Higuchi</a><br />\r\n- <a href="http://www.trentadams.com/">Trent Adams</a><br />\r\n- <a href="http://www.ppcw.net/">Arne Hess</a><br />\r\n- <a href="http://hsbluebird.com/">The Bluebird</a><br />\r\n- Rainer Bickel<br />\r\n- Fritz Elfers<br />\r\n- <a href="http://www.european-wall-tapestries.com/">European Wall Tapestries</a><br />\r\n- <a href="http://www.jamier.net/">Jamie R. Rytlewski</a><br />\r\n- Madolyn Piper<br />\r\n- <a href="http://www.batteryvalues.com/">Battery Values</a><br />\r\n- <a href="http://www.mixburnrip.de/">Janko Roettgers</a><br />\r\n- Lukas Loesche<br />\r\n- <a href="http://www.seobook.com/">SEO Book</a><br />\r\n- <a href="http://www.brandweerdematen.nl/">Brandweer de Maten</a><br />\r\n- Andy Fuchs<br />\r\n- <a href="http://www.sumoforce.com/">Sumoforce</a><br />\r\n- <a href="http://love.silverindigo.com/">Al''ky''mie</a><br />\r\n- <a href="http://www.pejo.us/">Peter Johnson</a><br />\r\n- <a href="http://www.triv.nl/">TriV Internet Solutions</a><br />\r\n- <a href="http://www.torontomusicians.org/nucleus/">Margaret Stowe</a><br />\r\n- <a href="http://www.zenkey.org/">zenkey dot org</a><br />\r\n- <a href="http://www.golb.org/">Blots of Info</a><br />\r\n- <a href="http://www.zonderpartij.be/">Rudi De Kerpel</a><br />\r\n- <a href="http://staylorx.com/">Steve Taylor</a><br />\r\n- <a href="http://lmhcave.com/">Malcolm Farnsworth</a><br />\r\n- Birgit Kellner<br />\r\n- <a href="http://www.tobiasly.com/">Toby Johnson</a><br />\r\n- <a href="http://www.kapingamarangi.be/">Kapingamarangi</a><br />\r\n- <a href="http://www.pallalink.net/">Pallalink</a><br />\r\n- <a href="http://publiustx.net/">PubliusTX Weblog</a><br />\r\n- <a href="http://www.reductioadabsurdum.net/">Reductio Ad Absurdum</a><br />\r\n- <a href="http://www.gagaweb.org/">GagaWeb</a><br />\r\n- <a href="http://www.videokid.be/">Videokid</a><br />\r\n- Jon Marr<br />\r\n- <a href="http://www.docblog.org/">Luigi Cristiano</a><br />\r\n- J Keith Lehman<br />\r\n- Bohemian Cachet<br />\r\n- Jesus Mourazos<br />\r\n- <a href="http://ltp-design.com/">Stephen Jones</a><br />\r\n- <a href="http://oha.nu/">One-Handed Apps</a><br />\r\n- Alwin Hawkins<br />\r\n- <a href="http://jstigall.bloomington.in.us">Justin Stigall</a><br />\r\n- <a href="http://www.itismylife.com/">It is my life</a><br />\r\n- Greg Morrill<br />\r\n- <a href="http://www.dutchsubmarines.com/">Dutch Submarines</a><br />\r\n- <a href="http://www.7thwatch.com/">Seventh Watch Design Studios</a> <br />\r\n- <a href="http://www.macnet2.com/">MacNetv2</a> <br />\r\n- Richard Noordhof<br />\r\n- <a href="http://www.jamier.net/">Jamie Rytlewski</a><br />\r\n<br />\r\nNucleus¤¬µ¤¤ËÆþ¤ê¤Þ¤·¤¿¤«¡©¡¡<a href="http://www.hotscripts.com/Detailed/13368.html?RID=nucleus@demuynck.org">HotScripts</a>¤ä<a href="http://www.opensourcecms.com/index.php?option=content&task=view&id=145">opensourceCMS</a>¤Ç¤ÎÅêɼ¤ò¤ª´ê¤¤¤·¤Þ¤¹¡£<br />\r\n<br />\r\n<b>¥é¥¤¥»¥ó¥¹</b><br />\r\n<br />\r\n»ä¤¿¤Á¤¬¥Õ¥ê¡¼¡¦¥½¥Õ¥È¥¦¥§¥¢¤Ë¤Ä¤¤¤Æ¸ý¤Ë¤¹¤ë¾ì¹ç¤Ï¼«Í³¤Î¤³¤È¤Ë¸ÀµÚ¤·¤Æ¤¤¤ë¤Î¤Ç¤¢¤Ã¤Æ¡¢²Á³Ê¤Î¤³¤È¤Ç¤Ï¤¢¤ê¤Þ¤»¤ó¡£»ä¤¿¤Á¤Î<a href="http://www.gnu.org/licenses/gpl.html">°ìÈ̸øÍ»ÈÍѵöÂú½ñ</a>¡Ê<a href="http://www.gnu.org/licenses/gpl.ja.html">ÆüËܸìÌõ</a>¤È<a href="http://www.atmarkit.co.jp/aig/03linux/gpl.html">³µÍ×</a>¡Ë¤Ï¡¢¥Õ¥ê¡¼¡¦¥½¥Õ¥È¥¦¥§¥¢¤ÎÊ£À½Êª¤ò¼«Í³¤ËÈÒÉۤǤ¤ë¤³¤È(¤½¤·¤Æ¡¢Ë¾¤à¤Ê¤é¤³¤Î¥µ¡¼¥Ó¥¹¤ËÂФ·¤ÆÂвÁ¤òÀÁµá¤Ç¤¤ë¤³¤È)¡¢¥½¡¼¥¹¡¦¥³¡¼¥É¤ò¼ÂºÝ¤Ë¼õ¤±¼è¤ë¤«´õ˾¤·¤µ¤¨¤¹¤ì¤ÐÆþ¼ê¤¹¤ë¤³¤È¤¬²Äǽ¤Ç¤¢¤ë¤³¤È¡¢Æþ¼ê¤·¤¿¥½¥Õ¥È¥¦¥§¥¢¤òÊѹ¹¤·¤¿¤ê¿·¤·¤¤¥Õ¥ê¡¼¡¦¥×¥í¥°¥é¥à¤Î°ìÉô¤È¤·¤Æ»ÈÍѤǤ¤ë¤³¤È¡¢°Ê¾å¤Î³ÆÆâÍƤò¹Ô¤Ê¤¦¤³¤È¤¬¤Ç¤¤ë¤È¤¤¤¦¤³¤È¤ò¥æ¡¼¥¶¼«¿È¤¬ÃΤäƤ¤¤ë¤³¤È¤ò¼Â¸½¤Ç¤¤ë¤è¤¦¤Ë¥Ç¥¶¥¤¥ó¤µ¤ì¤Æ¤¤¤Þ¤¹¡£', 1, 1, '2005-02-16 22:57:54', 0, 0, 0, 1, 0);
+INSERT INTO `nucleus_item` VALUES (1, 'Nucleus CMS ¥Ð¡¼¥¸¥ç¥ó3.31¤Ø¤è¤¦¤³¤½',
+'¥¦¥§¥Ö¥Ú¡¼¥¸¤ÎºîÀ®¤òÊä½õ¤¹¤ëÀѤßÌÚ¤¬¤³¤³¤Ë¤¢¤ê¤Þ¤¹¡£¤½¤ì¤Ï¿´Ìö¤ëblog¤Ë¤Ê¤ë¤«¤â¤·¤ì¤Þ¤»¤ó¤·¡¢´Ñ¤ë¤â¤Î¤òϤޤ»¤ë²È²¤Î¥Ú¡¼¥¸¤Ë¤Ê¤ë¤«¤â¤·¤ì¤Þ¤»¤ó¤·¡¢¼Â¤ê¿¤¼ñÌ£¤Î¥µ¥¤¥È¤Ë¤Ê¤ë¤«¤â¤·¤ì¤Þ¤»¤ó¡£¤¢¤ë¤¤¤Ï¸½ºß¤Î¤¢¤Ê¤¿¤Ë¤ÏÁÛÁü¤¬¤Ä¤«¤Ê¤¤¤â¤Î¤Ë¤Ê¤ë¤³¤È¤À¤Ã¤Æ¤¢¤ë¤Ç¤·¤ç¤¦¡£<br />
+<br />
+ÍÑÅÓ¤¬»×¤¤¤Ä¤¤Þ¤»¤ó¤Ç¤·¤¿¤«¡©¡¡¤½¤ì¤Ê¤é¤³¤³¤ØÍè¤ÆÀµ²ò¤Ç¤¹¡£¤Ê¤¼¤Ê¤é¤¢¤Ê¤¿Æ±Íͻ䤿¤Á¤Ë¤â¤ï¤«¤é¤Ê¤¤¤Î¤Ç¤¹¤«¤é¡£',
+'¤³¤ì¤Ï¥µ¥¤¥È¤Ë¤ª¤±¤ëºÇ½é¤Î¥¨¥ó¥È¥ê¡¼¤Ç¤¹¡£¥¹¥¿¡¼¥È¤òÀÚ¤ê¤ä¤¹¤¤¤è¤¦¤Ë¡¢¥ê¥ó¥¯¤È¾ðÊó¤òÆþ¤ì¤Æ¤ª¤¤Þ¤·¤¿¡£<br />
+<br />
+¤³¤Îµ»ö¤òºï½ü¤¹¤ë¤³¤È¤â¤Ç¤¤Þ¤¹¤¬¡¢¤É¤Á¤é¤Ë¤»¤èµ»ö¤òÄɲ䷤Ƥ¤¤¯¤³¤È¤Ë¤è¤Ã¤Æ¤ä¤¬¤Æ¥á¥¤¥ó¥Ú¡¼¥¸¤«¤é¤Ï¸«¤¨¤Ê¤¯¤Ê¤ê¤Þ¤¹¡£Nucleus¤ò°·¤¦¤¦¤Á¤ËÀ¸¤¸¤¿¥á¥â¤ò¥³¥á¥ó¥È¤È¤·¤ÆÄɲä·¡¢¾Í襢¥¯¥»¥¹¤Ç¤¤ë¤è¤¦¤Ë¤³¤Î¥Ú¡¼¥¸¤ò¥Ö¥Ã¥¯¥Þ¡¼¥¯¤·¤Æ¤ª¤¯¤Î¤â¼ê¤Ç¤¹¡£<br />
+<br />
+<b>¥ê¥ó¥¯</b><br />
+<br />
+Nucleus CMS¤Î<a href="http://nucleuscms.org">ËܲÈ</a>¤È<a href="http://japan.nucleuscms.org">ÆüËܸì¸ø¼°</a>¥Ú¡¼¥¸¡£<br />
+<br />
+Nucleus CMS¤ÎSourceForge<a href="http://sourceforge.net/projects/nucleuscms/">¥×¥í¥¸¥§¥¯¥È</a>¡Ê<a href="http://sourceforge.jp/projects/nucleus-jp/">ÆüËÜÈÇ</a>¡Ë¥Ú¡¼¥¸¡£<br />
+<br />
+Nucleus CMS¤Î¥×¥é¥°¥¤¥ó<a href="http://wakka.xiffy.nl/Plugin/">ÁÒ¸Ë</a>¤È<a href="http://japan.nucleuscms.org/wiki/plugins">ÆüËܸì¤Î¥ê¥¹¥È</a>¥Ú¡¼¥¸¡£<br />
+<br />
+<b>¥É¥¥å¥á¥ó¥È - <a href="http://docs.nucleuscms.org/">docs.nucleuscms.org</a></b><br />
+<br />
+Nucleus¤Î<a href="http://japan.nucleuscms.org/faq.php">FAQ¡Ê¤è¤¯¤¢¤ë¼ÁÌ佸¡Ë</a>¡Ê<a href="http://nucleuscms.org/faq.php">¸¶Ê¸</a>¡Ë¥Ú¡¼¥¸¡£<br />
+<br />
+¥¤¥ó¥¹¥È¡¼¥ëÊýË¡Åù¤Ï<a href="nucleus/documentation/">¥æ¡¼¥¶¡¼¸þ¤±</a>¤È<a href="nucleus/documentation/devdocs/">³«È¯¼Ô¸þ¤±</a>ʸ½ñ¤¬¥Õ¥¡¥¤¥ë¤Ë´Þ¤Þ¤ì¤Æ¤¤¤Þ¤¹¡£<br />
+<br />
+¥Ý¥Ã¥×¥¢¥Ã¥×<a href="./nucleus/documentation/help.html">¥Ø¥ë¥×</a>¤¬´ÉÍý¥¨¥ê¥¢¤Î¤¤¤¿¤ë¤È¤³¤í¤Ë¤¢¤ê¡¢¥µ¥¤¥È¤Î¥«¥¹¥¿¥Þ¥¤¥º¤ä¥Ç¥¶¥¤¥ó¤ò¼ê½õ¤±¤·¤Æ¤¯¤ì¤ë¤³¤È¤Ç¤·¤ç¤¦¡£<br />
+<br />
+°ìÅÙÍÑ°Õ¤µ¤ì¤Æ¤¤¤ë¥É¥¥å¥á¥ó¥È¤ËÌܤòÄ̤·¤¿¤é¡¢<a href="http://wiki.nucleuscms.org/">Wiki</a>¡Ê<a href="http://japan.nucleuscms.org/wiki/">ÆüËÜÈÇ</a>¡Ë¤òˬ¤ì¤Æ¤¯¤À¤µ¤¤¡£¥æ¡¼¥¶¡¼¤Î½ñ¤¤¤¿¥Ï¥¦¥Ä¡¼¤ä¾®µ»¤¬·ÇºÜ¤µ¤ì¤Æ¤¤¤Þ¤¹¡£<br />
+<br />
+<b>¥µ¥Ý¡¼¥È</b><br />
+<br />
+<a href="http://forum.nucleuscms.org/">forum.nucleuscms.org</a>¡ÊËܲȡË<br />
+<a href="http://japan.nucleuscms.org/bb/">japan.nucleuscms.org/bb/</a>¡ÊÆüËÜÈÇ¡Ë<br />
+<br />
+<a href="http://forum.nucleuscms.org/groupcp.php?g=3">moderators</a>¤È¥µ¥Ý¡¼¥È¥Õ¥©¡¼¥é¥à¤Ç³èÆ°¤¹¤ëÁ´¤Æ¤Î¥Ü¥é¥ó¥Æ¥£¥¢¤Ë´¶¼Õ¤·¤Þ¤¹¡£<br />
+<br />
+- <a href="http://edmondhui.homeip.net/blog/">admun</a> - Ottawa, ON, Canada <br />
+- <a href="http://www.tamizhan.com/">anand</a> - Bangalore, India<br />
+- <a href="http://hcgtv.com">hcgtv</a> - Miami, Florida, USA<br />
+- <a href="http://www.adrenalinsports.nl/">ikeizer</a> - Maastricht<br />
+- <a href="http://www.tipos.com.br/">moraes</a> - Brazil<br />
+- <a href="http://roelg.nl/">roel </a>- The Netherlands<br />
+- <a href="http://budts.be/weblog/">TeRanEX </a>- Ekeren, Antwerp, Belgium<br />
+- <a href="http://www.trentadams.com/">Trent </a>- Alberta, Canada<br />
+- <a href="http://xiffy.nl/weblog/">xiffy </a>- Deventer<br />
+<br />
+¤â¤·¼ê½õ¤±¤¬É¬Íפʤ顢1400¤òĶ¤¨¤ëÅÐÏ¿¥æ¡¼¥¶¡¼¤Î¤¤¤ë»ä¤¿¤Á¤Î¥Õ¥©¡¼¥é¥à¤Ë»²²Ã¤·¤Æ¤¯¤À¤µ¤¤¡£23,000¤òĶ¤¨¤ëÅê¹Æ¤µ¤ì¤¿µ»ö¤ò¸¡º÷¤Ç¤¤ë¤è¤¦¤Ë¤Ê¤Ã¤Æ¤ª¤ê¤Þ¤¹¤Î¤Ç¡¢µá¤á¤ëÅú¤¨¤Ë¿ô²ó¤Î¥¯¥ê¥Ã¥¯¤Ç¤¿¤É¤êÃ失¤ë¤«¤â¤·¤ì¤Þ¤»¤ó¡£<br />
+<br />
+<b>Personalization - <a href="http://skins.nucleuscms.org/">skins.nucleuscms.org</a></b><br />
+<br />
+¥Þ¥ë¥Á¥¦¥§¥Ö¥í¥°¤È¥¹¥¥ó/¥Æ¥ó¥×¥ì¡¼¥È¤ÎÁȤ߹ç¤ï¤»¤Ï¶¯ÎϤÊÁê¾è¸ú²Ì¤òÀ¸¤ß½Ð¤·¤Þ¤¹¡£¸Ä¿ÍŪ¤Ê¥µ¥¤¥ÈºîÀ®¡¢Í§¿Í¤ä¿ÆÀ̤¢¤ë¤¤¤Ï¥¯¥é¥¤¥¢¥ó¥È¤ËÂФ¹¤ë¥µ¥¤¥È¥Ç¥¶¥¤¥ó¤¤¤º¤ì¤ËÂФ·¤Æ¤â¤Ç¤¹¡£<br />
+<br />
+636¤ÎÅÐÏ¿¤µ¤ì¤¿<a href="http://nucleuscms.org/sites.php">Nucleus¤Ç±¿ÍѤµ¤ì¤Æ¤¤¤ë¥µ¥¤¥È</a>¡Ê<a href="http://japan.nucleuscms.org/sites.php">ÆüËÜÈÇ</a>¡Ë¤ÎÃ椫¤éÆÿ§¤¢¤ë¥µ¥¤¥È¤ò¥µ¥ó¥×¥ë¤È¤·¤Æ¤´¾Ò²ð¤·¤Þ¤¹¡£<br />
+<br />
+The Zen of Nucleus<br />
+- <a href="http://beefcake.nl/">beefcake.nl</a> - Beefcake | Nuke the whales!<br />
+- <a href="http://www.leng-lui.com//">leng-lui.com</a> - Leng-Lui.com - v7.0: "Memento"<br />
+<br />
+Personal blogs<br />
+- <a href="http://bloggard.com/">bloggard.com</a> - The Adventures of Bloggard<br />
+- <a href="http://battleangel.org/">battleangel.org</a> - Giving meaning to the meaningless<br />
+- <a href="http://www.yetanotherblog.de/">yetanotherblog.de</a> - Yet Another Blog<br />
+<br />
+Multi user blogs<br />
+- <a href="http://tipos.com.br/">tipos.com.br</a> - Blogging community<br />
+<br />
+Hobby, Travel and News sites<br />
+- <a href="http://adrenalinsports.nl/">adrenalinsports.nl</a> - Extreme sports<br />
+- <a href="http://hsbluebird.com/">hsbluebird.com</a> - Hot Springs, Montana''s Online Resource <br />
+- <a href="http://groningen-info.de/">groningen-info.de</a> - Neues aus Groningen. Fr Leute aus Duitsland.<br />
+- <a href="http://www.americandaily.com/">americandaily.com</a> - American Daily - Home<br />
+<br />
+<b>Nucleus Developer Network - <a href="http://dev.nucleuscms.org/">dev.nucleuscms.org</a></b><br />
+<br />
+The NUDN is a hub for developer sites and programming resources.<br />
+<br />
+NUDN satellite sites, handles, location and UTC offset:<br />
+- <a href="http://karma.nucleuscms.org/">karma</a> - Izegem +02<br />
+- <a href="http://hcgtv.net/">hcgtv</a> - Miami -05<br />
+- <a href="http://edmondhui.homeip.net/blog/nudn.php">admun</a> - Ottawa -04<br />
+- <a href="http://dev.budts.be/nucleus/">TeRanEX</a> - Ekeren +02<br />
+<br />
+Sourceforge.net graciously hosts our <a href="http://sourceforge.net/projects/nucleuscms/">CVS repository</a>.<br />
+<br />
+Want to play around or test changes, visit our demo site at <a href="http://demo.nucleuscms.org/">demo.nucleuscms.org</a>.<br />
+<br />
+Not sure what plugins to use, visit the <a href="http://showcase.trentadams.com/">showcase site</a> where you can see plugins at play in their native habitat.<br />
+<br />
+Then visit the plugin repository at <a href="http://plugins.nucleuscms.org/">plugins.nucleuscms.org</a> for download and installation instructions.<br />
+<br />
+<b>´óÉÕ¼Ô°ìÍ÷</b><br />
+<br />
+°Ê²¼¤Î<a href="http://nucleuscms.org/donators.php">ÁÇÀ²¤é¤·¤¤¿Í¡¹</a>¤Ë¤è¤ë<a href="http://nucleuscms.org/donate.php">±ç½õ</a>´¶¼Õ¤òÊû¤²¤Þ¤¹¡£<em>¤¢¤ê¤¬¤È¤¦¡ª</em><br />
+<br />
+- <a href="http://reddustrec.net/">dkex</a><br />
+- <a href="http://www.uncoverthenet.com/">Uncover the Net</a><br />
+- <a href="http://www.webatlas.org/">Web Atlas</a><br />
+- <a href="http://www.ipnlighting.com/">IPN Lighting</a><br />
+- <a href="http://blog.datoka.jp/">Yu (blog.datoka.jp)</a><br />
+- <a href="http://www.thegadgetreview.com/">Sony Gadgets and Reviews</a><br />
+- <a href="http://sites.proliphus.com/blueZhift/blog/">Thomas McKibben</a><br />
+- <a href="http://cheapweb.us/">CheapWeb.us</a><br />
+- Robert Seyfriedsberger<br />
+- <a href="http://www.toxicologie.nl/">Toxicologie.nl</a><br />
+- Gordon Shum<br />
+- <a href="http://www.subsim.com/">Neal Stevens</a><br />
+- <a href="http://www.GamblingHelper.com/">GamblingHelper</a><br />
+- Oliver Kirstein<br />
+- <a href="http://www.dominiek.be/">Dominiek</a><br />
+- <a href="http://www.aardschok.net/">Aardschok</a><br />
+- <a href="http://www.nieuwevoordeur.be/">nieuwevoordeur.be</a><br />
+- <a href="http://www.scene24.net/">Scene24</a><br />
+- <a href="http://www.eug.be/">Eug''s Weblog</a><br />
+- <a href="http://www.bloggard.com/">The Adventures of Bloggard</a><br />
+- <a href="http://www.voltos.com/">Arthur Cronos from Voltos</a><br />
+- <a href="http://www.webmaster-toolkit.com/">Free Webmaster Tools and Resources</a><br />
+- <a href="http://www.domilog.be/">Domi''s Weblog</a><br />
+- Infodoma <br />
+- <a href="http://carvingcode.com/">carvingCode.com</a><br />
+- <a href="http://www.traweb.com/">Traweb</a><br />
+- <a href="http://gene.mm2u.com/">Gene''s MoBlog</a><br />
+- <a href="http://interfacethis.com/">InterfaceThis</a><br />
+- <a href="http://www.thefinsters.com/flog/">The Finster Log</a><br />
+- <a href="http://www.mrhop.com/">Hop Nguyen</a><br />
+- <a href="http://www.zwavel.com/~zwavelaars" title="Zwavelaars">Zwavelaars</a><br />
+- <a href="http://beefcake.nl/">Joaquin Scholten</a> <br />
+- <a href="http://www.roelgroeneveld.com/">Roel Groeneveld</a><br />
+- <a href="http://lvb.net/">LVBlog</a><br />
+- <a href="http://xandermol.com/">Xander Mol</a><br />
+- Danilo Massa<br />
+- <a href="http://01FTP.com/">01FTP.com</a><br />
+- <a href="http://www.adrenalinsports.nl/">Irmo Keizer</a><br />
+- <a href="http://www.jasonkrogh.com/">Jason Krogh</a><br />
+- <a href="http://www.higuchi.com/">Osamu Higuchi</a><br />
+- <a href="http://www.trentadams.com/">Trent Adams</a><br />
+- <a href="http://www.ppcw.net/">Arne Hess</a><br />
+- <a href="http://hsbluebird.com/">The Bluebird</a><br />
+- Rainer Bickel<br />
+- Fritz Elfers<br />
+- <a href="http://www.european-wall-tapestries.com/">European Wall Tapestries</a><br />
+- <a href="http://www.jamier.net/">Jamie R. Rytlewski</a><br />
+- Madolyn Piper<br />
+- <a href="http://www.batteryvalues.com/">Battery Values</a><br />
+- <a href="http://www.mixburnrip.de/">Janko Roettgers</a><br />
+- Lukas Loesche<br />
+- <a href="http://www.seobook.com/">SEO Book</a><br />
+- <a href="http://www.brandweerdematen.nl/">Brandweer de Maten</a><br />
+- Andy Fuchs<br />
+- <a href="http://www.sumoforce.com/">Sumoforce</a><br />
+- <a href="http://love.silverindigo.com/">Al''ky''mie</a><br />
+- <a href="http://www.pejo.us/">Peter Johnson</a><br />
+- <a href="http://www.triv.nl/">TriV Internet Solutions</a><br />
+- <a href="http://www.torontomusicians.org/nucleus/">Margaret Stowe</a><br />
+- <a href="http://www.zenkey.org/">zenkey dot org</a><br />
+- <a href="http://www.golb.org/">Blots of Info</a><br />
+- <a href="http://www.zonderpartij.be/">Rudi De Kerpel</a><br />
+- <a href="http://staylorx.com/">Steve Taylor</a><br />
+- <a href="http://lmhcave.com/">Malcolm Farnsworth</a><br />
+- Birgit Kellner<br />
+- <a href="http://www.tobiasly.com/">Toby Johnson</a><br />
+- <a href="http://www.kapingamarangi.be/">Kapingamarangi</a><br />
+- <a href="http://www.pallalink.net/">Pallalink</a><br />
+- <a href="http://publiustx.net/">PubliusTX Weblog</a><br />
+- <a href="http://www.reductioadabsurdum.net/">Reductio Ad Absurdum</a><br />
+- <a href="http://www.gagaweb.org/">GagaWeb</a><br />
+- <a href="http://www.videokid.be/">Videokid</a><br />
+- Jon Marr<br />
+- <a href="http://www.docblog.org/">Luigi Cristiano</a><br />
+- J Keith Lehman<br />
+- Bohemian Cachet<br />
+- Jesus Mourazos<br />
+- <a href="http://ltp-design.com/">Stephen Jones</a><br />
+- <a href="http://oha.nu/">One-Handed Apps</a><br />
+- Alwin Hawkins<br />
+- <a href="http://jstigall.bloomington.in.us">Justin Stigall</a><br />
+- <a href="http://www.itismylife.com/">It is my life</a><br />
+- Greg Morrill<br />
+- <a href="http://www.dutchsubmarines.com/">Dutch Submarines</a><br />
+- <a href="http://www.7thwatch.com/">Seventh Watch Design Studios</a> <br />
+- <a href="http://www.macnet2.com/">MacNetv2</a> <br />
+- Richard Noordhof<br />
+- <a href="http://www.jamier.net/">Jamie Rytlewski</a><br />
+<br />
+Nucleus¤¬µ¤¤ËÆþ¤ê¤Þ¤·¤¿¤«¡©¡¡<a href="http://www.hotscripts.com/Detailed/13368.html?RID=nucleus@demuynck.org">HotScripts</a>¤ä<a href="http://www.opensourcecms.com/index.php?option=content&task=view&id=145">opensourceCMS</a>¤Ç¤ÎÅêɼ¤ò¤ª´ê¤¤¤·¤Þ¤¹¡£<br />
+<br />
+<b>¥é¥¤¥»¥ó¥¹</b><br />
+<br />
+»ä¤¿¤Á¤¬¥Õ¥ê¡¼¡¦¥½¥Õ¥È¥¦¥§¥¢¤Ë¤Ä¤¤¤Æ¸ý¤Ë¤¹¤ë¾ì¹ç¤Ï¼«Í³¤Î¤³¤È¤Ë¸ÀµÚ¤·¤Æ¤¤¤ë¤Î¤Ç¤¢¤Ã¤Æ¡¢²Á³Ê¤Î¤³¤È¤Ç¤Ï¤¢¤ê¤Þ¤»¤ó¡£»ä¤¿¤Á¤Î<a href="http://www.gnu.org/licenses/gpl.html">°ìÈ̸øÍ»ÈÍѵöÂú½ñ</a>¡Ê<a href="http://www.gnu.org/licenses/gpl.ja.html">ÆüËܸìÌõ</a>¤È<a href="http://www.atmarkit.co.jp/aig/03linux/gpl.html">³µÍ×</a>¡Ë¤Ï¡¢¥Õ¥ê¡¼¡¦¥½¥Õ¥È¥¦¥§¥¢¤ÎÊ£À½Êª¤ò¼«Í³¤ËÈÒÉۤǤ¤ë¤³¤È(¤½¤·¤Æ¡¢Ë¾¤à¤Ê¤é¤³¤Î¥µ¡¼¥Ó¥¹¤ËÂФ·¤ÆÂвÁ¤òÀÁµá¤Ç¤¤ë¤³¤È)¡¢¥½¡¼¥¹¡¦¥³¡¼¥É¤ò¼ÂºÝ¤Ë¼õ¤±¼è¤ë¤«´õ˾¤·¤µ¤¨¤¹¤ì¤ÐÆþ¼ê¤¹¤ë¤³¤È¤¬²Äǽ¤Ç¤¢¤ë¤³¤È¡¢Æþ¼ê¤·¤¿¥½¥Õ¥È¥¦¥§¥¢¤òÊѹ¹¤·¤¿¤ê¿·¤·¤¤¥Õ¥ê¡¼¡¦¥×¥í¥°¥é¥à¤Î°ìÉô¤È¤·¤Æ»ÈÍѤǤ¤ë¤³¤È¡¢°Ê¾å¤Î³ÆÆâÍƤò¹Ô¤Ê¤¦¤³¤È¤¬¤Ç¤¤ë¤È¤¤¤¦¤³¤È¤ò¥æ¡¼¥¶¼«¿È¤¬ÃΤäƤ¤¤ë¤³¤È¤ò¼Â¸½¤Ç¤¤ë¤è¤¦¤Ë¥Ç¥¶¥¤¥ó¤µ¤ì¤Æ¤¤¤Þ¤¹¡£',
+1, 1, '2005-02-16 22:57:54', 0, 0, 0, 1, 0, 1);
CREATE TABLE `nucleus_karma` (
`itemid` int(11) NOT NULL default '0',
- GNU GENERAL PUBLIC LICENSE\r
- Version 2, June 1991\r
-\r
- Copyright (C) 1989, 1991 Free Software Foundation, Inc.\r
- 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA\r
- Everyone is permitted to copy and distribute verbatim copies\r
- of this license document, but changing it is not allowed.\r
-\r
- Preamble\r
-\r
- The licenses for most software are designed to take away your\r
-freedom to share and change it. By contrast, the GNU General Public\r
-License is intended to guarantee your freedom to share and change free\r
-software--to make sure the software is free for all its users. This\r
-General Public License applies to most of the Free Software\r
-Foundation's software and to any other program whose authors commit to\r
-using it. (Some other Free Software Foundation software is covered by\r
-the GNU Library General Public License instead.) You can apply it to\r
-your programs, too.\r
-\r
- When we speak of free software, we are referring to freedom, not\r
-price. Our General Public Licenses are designed to make sure that you\r
-have the freedom to distribute copies of free software (and charge for\r
-this service if you wish), that you receive source code or can get it\r
-if you want it, that you can change the software or use pieces of it\r
-in new free programs; and that you know you can do these things.\r
-\r
- To protect your rights, we need to make restrictions that forbid\r
-anyone to deny you these rights or to ask you to surrender the rights.\r
-These restrictions translate to certain responsibilities for you if you\r
-distribute copies of the software, or if you modify it.\r
-\r
- For example, if you distribute copies of such a program, whether\r
-gratis or for a fee, you must give the recipients all the rights that\r
-you have. You must make sure that they, too, receive or can get the\r
-source code. And you must show them these terms so they know their\r
-rights.\r
-\r
- We protect your rights with two steps: (1) copyright the software, and\r
-(2) offer you this license which gives you legal permission to copy,\r
-distribute and/or modify the software.\r
-\r
- Also, for each author's protection and ours, we want to make certain\r
-that everyone understands that there is no warranty for this free\r
-software. If the software is modified by someone else and passed on, we\r
-want its recipients to know that what they have is not the original, so\r
-that any problems introduced by others will not reflect on the original\r
-authors' reputations.\r
-\r
- Finally, any free program is threatened constantly by software\r
-patents. We wish to avoid the danger that redistributors of a free\r
-program will individually obtain patent licenses, in effect making the\r
-program proprietary. To prevent this, we have made it clear that any\r
-patent must be licensed for everyone's free use or not licensed at all.\r
-\r
- The precise terms and conditions for copying, distribution and\r
-modification follow.\r
-\r
- GNU GENERAL PUBLIC LICENSE\r
- TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION\r
-\r
- 0. This License applies to any program or other work which contains\r
-a notice placed by the copyright holder saying it may be distributed\r
-under the terms of this General Public License. The "Program", below,\r
-refers to any such program or work, and a "work based on the Program"\r
-means either the Program or any derivative work under copyright law:\r
-that is to say, a work containing the Program or a portion of it,\r
-either verbatim or with modifications and/or translated into another\r
-language. (Hereinafter, translation is included without limitation in\r
-the term "modification".) Each licensee is addressed as "you".\r
-\r
-Activities other than copying, distribution and modification are not\r
-covered by this License; they are outside its scope. The act of\r
-running the Program is not restricted, and the output from the Program\r
-is covered only if its contents constitute a work based on the\r
-Program (independent of having been made by running the Program).\r
-Whether that is true depends on what the Program does.\r
-\r
- 1. You may copy and distribute verbatim copies of the Program's\r
-source code as you receive it, in any medium, provided that you\r
-conspicuously and appropriately publish on each copy an appropriate\r
-copyright notice and disclaimer of warranty; keep intact all the\r
-notices that refer to this License and to the absence of any warranty;\r
-and give any other recipients of the Program a copy of this License\r
-along with the Program.\r
-\r
-You may charge a fee for the physical act of transferring a copy, and\r
-you may at your option offer warranty protection in exchange for a fee.\r
-\r
- 2. You may modify your copy or copies of the Program or any portion\r
-of it, thus forming a work based on the Program, and copy and\r
-distribute such modifications or work under the terms of Section 1\r
-above, provided that you also meet all of these conditions:\r
-\r
- a) You must cause the modified files to carry prominent notices\r
- stating that you changed the files and the date of any change.\r
-\r
- b) You must cause any work that you distribute or publish, that in\r
- whole or in part contains or is derived from the Program or any\r
- part thereof, to be licensed as a whole at no charge to all third\r
- parties under the terms of this License.\r
-\r
- c) If the modified program normally reads commands interactively\r
- when run, you must cause it, when started running for such\r
- interactive use in the most ordinary way, to print or display an\r
- announcement including an appropriate copyright notice and a\r
- notice that there is no warranty (or else, saying that you provide\r
- a warranty) and that users may redistribute the program under\r
- these conditions, and telling the user how to view a copy of this\r
- License. (Exception: if the Program itself is interactive but\r
- does not normally print such an announcement, your work based on\r
- the Program is not required to print an announcement.)\r
-\r
-These requirements apply to the modified work as a whole. If\r
-identifiable sections of that work are not derived from the Program,\r
-and can be reasonably considered independent and separate works in\r
-themselves, then this License, and its terms, do not apply to those\r
-sections when you distribute them as separate works. But when you\r
-distribute the same sections as part of a whole which is a work based\r
-on the Program, the distribution of the whole must be on the terms of\r
-this License, whose permissions for other licensees extend to the\r
-entire whole, and thus to each and every part regardless of who wrote it.\r
-\r
-Thus, it is not the intent of this section to claim rights or contest\r
-your rights to work written entirely by you; rather, the intent is to\r
-exercise the right to control the distribution of derivative or\r
-collective works based on the Program.\r
-\r
-In addition, mere aggregation of another work not based on the Program\r
-with the Program (or with a work based on the Program) on a volume of\r
-a storage or distribution medium does not bring the other work under\r
-the scope of this License.\r
-\r
- 3. You may copy and distribute the Program (or a work based on it,\r
-under Section 2) in object code or executable form under the terms of\r
-Sections 1 and 2 above provided that you also do one of the following:\r
-\r
- a) Accompany it with the complete corresponding machine-readable\r
- source code, which must be distributed under the terms of Sections\r
- 1 and 2 above on a medium customarily used for software interchange; or,\r
-\r
- b) Accompany it with a written offer, valid for at least three\r
- years, to give any third party, for a charge no more than your\r
- cost of physically performing source distribution, a complete\r
- machine-readable copy of the corresponding source code, to be\r
- distributed under the terms of Sections 1 and 2 above on a medium\r
- customarily used for software interchange; or,\r
-\r
- c) Accompany it with the information you received as to the offer\r
- to distribute corresponding source code. (This alternative is\r
- allowed only for noncommercial distribution and only if you\r
- received the program in object code or executable form with such\r
- an offer, in accord with Subsection b above.)\r
-\r
-The source code for a work means the preferred form of the work for\r
-making modifications to it. For an executable work, complete source\r
-code means all the source code for all modules it contains, plus any\r
-associated interface definition files, plus the scripts used to\r
-control compilation and installation of the executable. However, as a\r
-special exception, the source code distributed need not include\r
-anything that is normally distributed (in either source or binary\r
-form) with the major components (compiler, kernel, and so on) of the\r
-operating system on which the executable runs, unless that component\r
-itself accompanies the executable.\r
-\r
-If distribution of executable or object code is made by offering\r
-access to copy from a designated place, then offering equivalent\r
-access to copy the source code from the same place counts as\r
-distribution of the source code, even though third parties are not\r
-compelled to copy the source along with the object code.\r
-\r
- 4. You may not copy, modify, sublicense, or distribute the Program\r
-except as expressly provided under this License. Any attempt\r
-otherwise to copy, modify, sublicense or distribute the Program is\r
-void, and will automatically terminate your rights under this License.\r
-However, parties who have received copies, or rights, from you under\r
-this License will not have their licenses terminated so long as such\r
-parties remain in full compliance.\r
-\r
- 5. You are not required to accept this License, since you have not\r
-signed it. However, nothing else grants you permission to modify or\r
-distribute the Program or its derivative works. These actions are\r
-prohibited by law if you do not accept this License. Therefore, by\r
-modifying or distributing the Program (or any work based on the\r
-Program), you indicate your acceptance of this License to do so, and\r
-all its terms and conditions for copying, distributing or modifying\r
-the Program or works based on it.\r
-\r
- 6. Each time you redistribute the Program (or any work based on the\r
-Program), the recipient automatically receives a license from the\r
-original licensor to copy, distribute or modify the Program subject to\r
-these terms and conditions. You may not impose any further\r
-restrictions on the recipients' exercise of the rights granted herein.\r
-You are not responsible for enforcing compliance by third parties to\r
-this License.\r
-\r
- 7. If, as a consequence of a court judgment or allegation of patent\r
-infringement or for any other reason (not limited to patent issues),\r
-conditions are imposed on you (whether by court order, agreement or\r
-otherwise) that contradict the conditions of this License, they do not\r
-excuse you from the conditions of this License. If you cannot\r
-distribute so as to satisfy simultaneously your obligations under this\r
-License and any other pertinent obligations, then as a consequence you\r
-may not distribute the Program at all. For example, if a patent\r
-license would not permit royalty-free redistribution of the Program by\r
-all those who receive copies directly or indirectly through you, then\r
-the only way you could satisfy both it and this License would be to\r
-refrain entirely from distribution of the Program.\r
-\r
-If any portion of this section is held invalid or unenforceable under\r
-any particular circumstance, the balance of the section is intended to\r
-apply and the section as a whole is intended to apply in other\r
-circumstances.\r
-\r
-It is not the purpose of this section to induce you to infringe any\r
-patents or other property right claims or to contest validity of any\r
-such claims; this section has the sole purpose of protecting the\r
-integrity of the free software distribution system, which is\r
-implemented by public license practices. Many people have made\r
-generous contributions to the wide range of software distributed\r
-through that system in reliance on consistent application of that\r
-system; it is up to the author/donor to decide if he or she is willing\r
-to distribute software through any other system and a licensee cannot\r
-impose that choice.\r
-\r
-This section is intended to make thoroughly clear what is believed to\r
-be a consequence of the rest of this License.\r
-\r
- 8. If the distribution and/or use of the Program is restricted in\r
-certain countries either by patents or by copyrighted interfaces, the\r
-original copyright holder who places the Program under this License\r
-may add an explicit geographical distribution limitation excluding\r
-those countries, so that distribution is permitted only in or among\r
-countries not thus excluded. In such case, this License incorporates\r
-the limitation as if written in the body of this License.\r
-\r
- 9. The Free Software Foundation may publish revised and/or new versions\r
-of the General Public License from time to time. Such new versions will\r
-be similar in spirit to the present version, but may differ in detail to\r
-address new problems or concerns.\r
-\r
-Each version is given a distinguishing version number. If the Program\r
-specifies a version number of this License which applies to it and "any\r
-later version", you have the option of following the terms and conditions\r
-either of that version or of any later version published by the Free\r
-Software Foundation. If the Program does not specify a version number of\r
-this License, you may choose any version ever published by the Free Software\r
-Foundation.\r
-\r
- 10. If you wish to incorporate parts of the Program into other free\r
-programs whose distribution conditions are different, write to the author\r
-to ask for permission. For software which is copyrighted by the Free\r
-Software Foundation, write to the Free Software Foundation; we sometimes\r
-make exceptions for this. Our decision will be guided by the two goals\r
-of preserving the free status of all derivatives of our free software and\r
-of promoting the sharing and reuse of software generally.\r
-\r
- NO WARRANTY\r
-\r
- 11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY\r
-FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN\r
-OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES\r
-PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED\r
-OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF\r
-MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS\r
-TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE\r
-PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,\r
-REPAIR OR CORRECTION.\r
-\r
- 12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING\r
-WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR\r
-REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,\r
-INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING\r
-OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED\r
-TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY\r
-YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER\r
-PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE\r
-POSSIBILITY OF SUCH DAMAGES.\r
-\r
- END OF TERMS AND CONDITIONS\r
-\r
- How to Apply These Terms to Your New Programs\r
-\r
- If you develop a new program, and you want it to be of the greatest\r
-possible use to the public, the best way to achieve this is to make it\r
-free software which everyone can redistribute and change under these terms.\r
-\r
- To do so, attach the following notices to the program. It is safest\r
-to attach them to the start of each source file to most effectively\r
-convey the exclusion of warranty; and each file should have at least\r
-the "copyright" line and a pointer to where the full notice is found.\r
-\r
- <one line to give the program's name and a brief idea of what it does.>\r
- Copyright (C) <year> <name of author>\r
-\r
- This program is free software; you can redistribute it and/or modify\r
- it under the terms of the GNU General Public License as published by\r
- the Free Software Foundation; either version 2 of the License, or\r
- (at your option) any later version.\r
-\r
- This program is distributed in the hope that it will be useful,\r
- but WITHOUT ANY WARRANTY; without even the implied warranty of\r
- MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\r
- GNU General Public License for more details.\r
-\r
- You should have received a copy of the GNU General Public License\r
- along with this program; if not, write to the Free Software\r
- Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA\r
-\r
-\r
-Also add information on how to contact you by electronic and paper mail.\r
-\r
-If the program is interactive, make it output a short notice like this\r
-when it starts in an interactive mode:\r
-\r
- Gnomovision version 69, Copyright (C) year name of author\r
- Gnomovision comes with ABSOLUTELY NO WARRANTY; for details type `show w'.\r
- This is free software, and you are welcome to redistribute it\r
- under certain conditions; type `show c' for details.\r
-\r
-The hypothetical commands `show w' and `show c' should show the appropriate\r
-parts of the General Public License. Of course, the commands you use may\r
-be called something other than `show w' and `show c'; they could even be\r
-mouse-clicks or menu items--whatever suits your program.\r
-\r
-You should also get your employer (if you work as a programmer) or your\r
-school, if any, to sign a "copyright disclaimer" for the program, if\r
-necessary. Here is a sample; alter the names:\r
-\r
- Yoyodyne, Inc., hereby disclaims all copyright interest in the program\r
- `Gnomovision' (which makes passes at compilers) written by James Hacker.\r
-\r
- <signature of Ty Coon>, 1 April 1989\r
- Ty Coon, President of Vice\r
-\r
-This General Public License does not permit incorporating your program into\r
-proprietary programs. If your program is a subroutine library, you may\r
-consider it more useful to permit linking proprietary applications with the\r
-library. If this is what you want to do, use the GNU Library General\r
-Public License instead of this License.\r
+ GNU GENERAL PUBLIC LICENSE
+ Version 2, June 1991
+
+ Copyright (C) 1989, 1991 Free Software Foundation, Inc.
+ 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+ Preamble
+
+ The licenses for most software are designed to take away your
+freedom to share and change it. By contrast, the GNU General Public
+License is intended to guarantee your freedom to share and change free
+software--to make sure the software is free for all its users. This
+General Public License applies to most of the Free Software
+Foundation's software and to any other program whose authors commit to
+using it. (Some other Free Software Foundation software is covered by
+the GNU Library General Public License instead.) You can apply it to
+your programs, too.
+
+ When we speak of free software, we are referring to freedom, not
+price. Our General Public Licenses are designed to make sure that you
+have the freedom to distribute copies of free software (and charge for
+this service if you wish), that you receive source code or can get it
+if you want it, that you can change the software or use pieces of it
+in new free programs; and that you know you can do these things.
+
+ To protect your rights, we need to make restrictions that forbid
+anyone to deny you these rights or to ask you to surrender the rights.
+These restrictions translate to certain responsibilities for you if you
+distribute copies of the software, or if you modify it.
+
+ For example, if you distribute copies of such a program, whether
+gratis or for a fee, you must give the recipients all the rights that
+you have. You must make sure that they, too, receive or can get the
+source code. And you must show them these terms so they know their
+rights.
+
+ We protect your rights with two steps: (1) copyright the software, and
+(2) offer you this license which gives you legal permission to copy,
+distribute and/or modify the software.
+
+ Also, for each author's protection and ours, we want to make certain
+that everyone understands that there is no warranty for this free
+software. If the software is modified by someone else and passed on, we
+want its recipients to know that what they have is not the original, so
+that any problems introduced by others will not reflect on the original
+authors' reputations.
+
+ Finally, any free program is threatened constantly by software
+patents. We wish to avoid the danger that redistributors of a free
+program will individually obtain patent licenses, in effect making the
+program proprietary. To prevent this, we have made it clear that any
+patent must be licensed for everyone's free use or not licensed at all.
+
+ The precise terms and conditions for copying, distribution and
+modification follow.
+
+ GNU GENERAL PUBLIC LICENSE
+ TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
+
+ 0. This License applies to any program or other work which contains
+a notice placed by the copyright holder saying it may be distributed
+under the terms of this General Public License. The "Program", below,
+refers to any such program or work, and a "work based on the Program"
+means either the Program or any derivative work under copyright law:
+that is to say, a work containing the Program or a portion of it,
+either verbatim or with modifications and/or translated into another
+language. (Hereinafter, translation is included without limitation in
+the term "modification".) Each licensee is addressed as "you".
+
+Activities other than copying, distribution and modification are not
+covered by this License; they are outside its scope. The act of
+running the Program is not restricted, and the output from the Program
+is covered only if its contents constitute a work based on the
+Program (independent of having been made by running the Program).
+Whether that is true depends on what the Program does.
+
+ 1. You may copy and distribute verbatim copies of the Program's
+source code as you receive it, in any medium, provided that you
+conspicuously and appropriately publish on each copy an appropriate
+copyright notice and disclaimer of warranty; keep intact all the
+notices that refer to this License and to the absence of any warranty;
+and give any other recipients of the Program a copy of this License
+along with the Program.
+
+You may charge a fee for the physical act of transferring a copy, and
+you may at your option offer warranty protection in exchange for a fee.
+
+ 2. You may modify your copy or copies of the Program or any portion
+of it, thus forming a work based on the Program, and copy and
+distribute such modifications or work under the terms of Section 1
+above, provided that you also meet all of these conditions:
+
+ a) You must cause the modified files to carry prominent notices
+ stating that you changed the files and the date of any change.
+
+ b) You must cause any work that you distribute or publish, that in
+ whole or in part contains or is derived from the Program or any
+ part thereof, to be licensed as a whole at no charge to all third
+ parties under the terms of this License.
+
+ c) If the modified program normally reads commands interactively
+ when run, you must cause it, when started running for such
+ interactive use in the most ordinary way, to print or display an
+ announcement including an appropriate copyright notice and a
+ notice that there is no warranty (or else, saying that you provide
+ a warranty) and that users may redistribute the program under
+ these conditions, and telling the user how to view a copy of this
+ License. (Exception: if the Program itself is interactive but
+ does not normally print such an announcement, your work based on
+ the Program is not required to print an announcement.)
+
+These requirements apply to the modified work as a whole. If
+identifiable sections of that work are not derived from the Program,
+and can be reasonably considered independent and separate works in
+themselves, then this License, and its terms, do not apply to those
+sections when you distribute them as separate works. But when you
+distribute the same sections as part of a whole which is a work based
+on the Program, the distribution of the whole must be on the terms of
+this License, whose permissions for other licensees extend to the
+entire whole, and thus to each and every part regardless of who wrote it.
+
+Thus, it is not the intent of this section to claim rights or contest
+your rights to work written entirely by you; rather, the intent is to
+exercise the right to control the distribution of derivative or
+collective works based on the Program.
+
+In addition, mere aggregation of another work not based on the Program
+with the Program (or with a work based on the Program) on a volume of
+a storage or distribution medium does not bring the other work under
+the scope of this License.
+
+ 3. You may copy and distribute the Program (or a work based on it,
+under Section 2) in object code or executable form under the terms of
+Sections 1 and 2 above provided that you also do one of the following:
+
+ a) Accompany it with the complete corresponding machine-readable
+ source code, which must be distributed under the terms of Sections
+ 1 and 2 above on a medium customarily used for software interchange; or,
+
+ b) Accompany it with a written offer, valid for at least three
+ years, to give any third party, for a charge no more than your
+ cost of physically performing source distribution, a complete
+ machine-readable copy of the corresponding source code, to be
+ distributed under the terms of Sections 1 and 2 above on a medium
+ customarily used for software interchange; or,
+
+ c) Accompany it with the information you received as to the offer
+ to distribute corresponding source code. (This alternative is
+ allowed only for noncommercial distribution and only if you
+ received the program in object code or executable form with such
+ an offer, in accord with Subsection b above.)
+
+The source code for a work means the preferred form of the work for
+making modifications to it. For an executable work, complete source
+code means all the source code for all modules it contains, plus any
+associated interface definition files, plus the scripts used to
+control compilation and installation of the executable. However, as a
+special exception, the source code distributed need not include
+anything that is normally distributed (in either source or binary
+form) with the major components (compiler, kernel, and so on) of the
+operating system on which the executable runs, unless that component
+itself accompanies the executable.
+
+If distribution of executable or object code is made by offering
+access to copy from a designated place, then offering equivalent
+access to copy the source code from the same place counts as
+distribution of the source code, even though third parties are not
+compelled to copy the source along with the object code.
+
+ 4. You may not copy, modify, sublicense, or distribute the Program
+except as expressly provided under this License. Any attempt
+otherwise to copy, modify, sublicense or distribute the Program is
+void, and will automatically terminate your rights under this License.
+However, parties who have received copies, or rights, from you under
+this License will not have their licenses terminated so long as such
+parties remain in full compliance.
+
+ 5. You are not required to accept this License, since you have not
+signed it. However, nothing else grants you permission to modify or
+distribute the Program or its derivative works. These actions are
+prohibited by law if you do not accept this License. Therefore, by
+modifying or distributing the Program (or any work based on the
+Program), you indicate your acceptance of this License to do so, and
+all its terms and conditions for copying, distributing or modifying
+the Program or works based on it.
+
+ 6. Each time you redistribute the Program (or any work based on the
+Program), the recipient automatically receives a license from the
+original licensor to copy, distribute or modify the Program subject to
+these terms and conditions. You may not impose any further
+restrictions on the recipients' exercise of the rights granted herein.
+You are not responsible for enforcing compliance by third parties to
+this License.
+
+ 7. If, as a consequence of a court judgment or allegation of patent
+infringement or for any other reason (not limited to patent issues),
+conditions are imposed on you (whether by court order, agreement or
+otherwise) that contradict the conditions of this License, they do not
+excuse you from the conditions of this License. If you cannot
+distribute so as to satisfy simultaneously your obligations under this
+License and any other pertinent obligations, then as a consequence you
+may not distribute the Program at all. For example, if a patent
+license would not permit royalty-free redistribution of the Program by
+all those who receive copies directly or indirectly through you, then
+the only way you could satisfy both it and this License would be to
+refrain entirely from distribution of the Program.
+
+If any portion of this section is held invalid or unenforceable under
+any particular circumstance, the balance of the section is intended to
+apply and the section as a whole is intended to apply in other
+circumstances.
+
+It is not the purpose of this section to induce you to infringe any
+patents or other property right claims or to contest validity of any
+such claims; this section has the sole purpose of protecting the
+integrity of the free software distribution system, which is
+implemented by public license practices. Many people have made
+generous contributions to the wide range of software distributed
+through that system in reliance on consistent application of that
+system; it is up to the author/donor to decide if he or she is willing
+to distribute software through any other system and a licensee cannot
+impose that choice.
+
+This section is intended to make thoroughly clear what is believed to
+be a consequence of the rest of this License.
+
+ 8. If the distribution and/or use of the Program is restricted in
+certain countries either by patents or by copyrighted interfaces, the
+original copyright holder who places the Program under this License
+may add an explicit geographical distribution limitation excluding
+those countries, so that distribution is permitted only in or among
+countries not thus excluded. In such case, this License incorporates
+the limitation as if written in the body of this License.
+
+ 9. The Free Software Foundation may publish revised and/or new versions
+of the General Public License from time to time. Such new versions will
+be similar in spirit to the present version, but may differ in detail to
+address new problems or concerns.
+
+Each version is given a distinguishing version number. If the Program
+specifies a version number of this License which applies to it and "any
+later version", you have the option of following the terms and conditions
+either of that version or of any later version published by the Free
+Software Foundation. If the Program does not specify a version number of
+this License, you may choose any version ever published by the Free Software
+Foundation.
+
+ 10. If you wish to incorporate parts of the Program into other free
+programs whose distribution conditions are different, write to the author
+to ask for permission. For software which is copyrighted by the Free
+Software Foundation, write to the Free Software Foundation; we sometimes
+make exceptions for this. Our decision will be guided by the two goals
+of preserving the free status of all derivatives of our free software and
+of promoting the sharing and reuse of software generally.
+
+ NO WARRANTY
+
+ 11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
+FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN
+OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
+PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
+OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS
+TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE
+PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
+REPAIR OR CORRECTION.
+
+ 12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
+WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
+REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
+INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
+OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
+TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
+YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
+PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
+POSSIBILITY OF SUCH DAMAGES.
+
+ END OF TERMS AND CONDITIONS
+
+ How to Apply These Terms to Your New Programs
+
+ If you develop a new program, and you want it to be of the greatest
+possible use to the public, the best way to achieve this is to make it
+free software which everyone can redistribute and change under these terms.
+
+ To do so, attach the following notices to the program. It is safest
+to attach them to the start of each source file to most effectively
+convey the exclusion of warranty; and each file should have at least
+the "copyright" line and a pointer to where the full notice is found.
+
+ <one line to give the program's name and a brief idea of what it does.>
+ Copyright (C) <year> <name of author>
+
+ This program is free software; you can redistribute it and/or modify
+ it under the terms of the GNU General Public License as published by
+ the Free Software Foundation; either version 2 of the License, or
+ (at your option) any later version.
+
+ This program is distributed in the hope that it will be useful,
+ but WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License
+ along with this program; if not, write to the Free Software
+ Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+
+
+Also add information on how to contact you by electronic and paper mail.
+
+If the program is interactive, make it output a short notice like this
+when it starts in an interactive mode:
+
+ Gnomovision version 69, Copyright (C) year name of author
+ Gnomovision comes with ABSOLUTELY NO WARRANTY; for details type `show w'.
+ This is free software, and you are welcome to redistribute it
+ under certain conditions; type `show c' for details.
+
+The hypothetical commands `show w' and `show c' should show the appropriate
+parts of the General Public License. Of course, the commands you use may
+be called something other than `show w' and `show c'; they could even be
+mouse-clicks or menu items--whatever suits your program.
+
+You should also get your employer (if you work as a programmer) or your
+school, if any, to sign a "copyright disclaimer" for the program, if
+necessary. Here is a sample; alter the names:
+
+ Yoyodyne, Inc., hereby disclaims all copyright interest in the program
+ `Gnomovision' (which makes passes at compilers) written by James Hacker.
+
+ <signature of Ty Coon>, 1 April 1989
+ Ty Coon, President of Vice
+
+This General Public License does not permit incorporating your program into
+proprietary programs. If your program is a subroutine library, you may
+consider it more useful to permit linking proprietary applications with the
+library. If this is what you want to do, use the GNU Library General
+Public License instead of this License.
-Nucleus Media Directory\r
------------------------\r
-\r
-Uploaded images will end up in the media directory.\r
-\r
-Subdirectories work as follows:\r
-\r
-* numeric (e.g. /media/1/)\r
-\r
-Media files for a certain member (directory name is the memberid)\r
-\r
-* other directories (e.g. /media/common/)\r
-\r
-Global media collections that can be used by any member that is on a team. In order to create a new collection, simply create a new directory and assure write access is enabled for it.\r
-\r
+Nucleus Media Directory
+-----------------------
+
+Uploaded images will end up in the media directory.
+
+Subdirectories work as follows:
+
+* numeric (e.g. /media/1/)
+
+Media files for a certain member (directory name is the memberid)
+
+* other directories (e.g. /media/common/)
+
+Global media collections that can be used by any member that is on a team. In order to create a new collection, simply create a new directory and assure write access is enabled for it.
+
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: bookmarklet.php,v 1.4 2007-03-27 12:13:47 kimitake Exp $
- * $NucleusJP: bookmarklet.php,v 1.9 2007/02/04 06:28:45 kimitake Exp $
+ * @version $Id: bookmarklet.php,v 1.4.2.1 2008-01-29 07:05:05 kimitake Exp $
+ * $NucleusJP: bookmarklet.php,v 1.9.2.1 2007/09/07 07:16:39 kimitake Exp $
*/
// bookmarklet is part of admin area (might need XML-RPC)
if ($result['status'] == 'newcategory') {
$message = '¥¢¥¤¥Æ¥à¤ÏÄɲ䵤졢¿·¤·¤¤¥«¥Æ¥´¥ê¡¼¤¬ºîÀ®¤µ¤ì¤Þ¤·¤¿¡£ <a href="index.php?action=categoryedit&blogid='.$blogid.'&catid='.$result['catid'].'" onclick="if (event && event.preventDefault) event.preventDefault(); window.open(this.href); return false;" title="Opens in new window">¤³¤³¤ò¥¯¥ê¥Ã¥¯¤·¤Æ¥«¥Æ¥´¥ê¡¼¤Î̾Á°¤ÈÀâÌÀ¤òÊÔ½¸¤·¤Æ¤¯¤À¤µ¤¤¡£</a>';
$extrahead = '';
- } elseif ((postVar('actiontype') == 'addnow') && $blog->pingUserland()) {
+ } elseif ( (postVar('actiontype') == 'addnow') && $blog->sendPing() ) {
$message = '¥¢¥¤¥Æ¥à¤ÎÄɲäËÀ®¸ù¤·¤Þ¤·¤¿¡£¸½ºßweblogs.com¤Ëping¤òÁ÷¤Ã¤Æ¤¤¤Þ¤¹¡£¤·¤Ð¤é¤¯¤Î´Ö¤ªÂÔ¤Á¤¯¤À¤µ¤¤...';
- $pingUrl = $manager->addTicketToUrl($CONF['AdminURL'] . 'index.php?action=sendping&blogid=' . intval($blogid));
- $extrahead = '<meta http-equiv="refresh" content="1; url=' . htmlspecialchars($pingUrl). '" />';
+ $pingUrl = $manager->addTicketToUrl($CONF['AdminURL'] . 'index.php?action=sendping&blogid=' . intval($blogid) );
+ $extrahead = '<meta http-equiv="refresh" content="1; url=' . htmlspecialchars($pingUrl) . '" />';
} else {
$message = _ITEM_ADDED;
$extrahead = '';
$log_text = uniDecode($log_text,_CHARSET);
$log_linktitle = uniDecode($log_linktitle,_CHARSET);
- if (!BLOG::existsID($blogid))
+ if (!BLOG::existsID($blogid) ) {
bm_doError(_ERROR_NOSUCHBLOG);
+ }
if (!$member->isTeamMember($blogid) ) {
bm_doError(_ERROR_NOTONTEAM);
<html xmlns="http://www.w3.org/1999/xhtml">
<head>
<meta http-equiv="Content-Type" content="text/html; charset=<?php echo _CHARSET ?>" />
- <title><?php echo $title ?></title>
+ <title><?php echo $title ?></title>
<?php bm_style(); ?>
<?php echo $extrahead; ?>
</head>
<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
<html xmlns="http://www.w3.org/1999/xhtml">
<head>
- <!-- $Id: forgotpassword.html,v 1.7 2007-03-27 12:13:47 kimitake Exp $ -->
- <!-- $NucleusJP: forgotpassword.html,v 1.6 2005/03/16 08:04:14 kimitake Exp $ -->
+ <!-- $Id: forgotpassword.html,v 1.7.2.1 2008-01-29 07:05:05 kimitake Exp $ -->
+ <!-- $NucleusJP: forgotpassword.html,v 1.10.2.1 2007/09/07 07:34:18 kimitake Exp $ -->
<meta http-equiv="content-type" content="application/xhtml+xml; charset=EUC-JP" />
<title>Nucleus - ¥Ñ¥¹¥ï¡¼¥É¤Îʶ¼º</title>
<style type="text/css">
</style>
</head>
<body>
- <div class="header">
- <h1>Nucleus CMS</h1>
- </div>
- <div id="content">
+ <div class="header">
+ <h1>Nucleus CMS</h1>
+ </div>
+
+ <div id="content">
+
+ <h2>¥Ñ¥¹¥ï¡¼¥É¤ò˺¤ì¤Þ¤·¤¿¤«¡©</h2>
- <h2>¥Ñ¥¹¥ï¡¼¥É¤ò˺¤ì¤Þ¤·¤¿¤«¡©</h2>
+ <p>°Ê²¼¤Ë¥æ¡¼¥¶¡¼Ì¾¤È¥á¡¼¥ë¥¢¥É¥ì¥¹¤òÆþÎϤ·¤Æ¤¯¤À¤µ¤¤¡£¿·¤·¤¤¥Ñ¥¹¥ï¡¼¥É¤òÀßÄꤹ¤ë¥Ú¡¼¥¸¤Ø¤Î¥ê¥ó¥¯¤ÎÆþ¤Ã¤¿¥á¡¼¥ë¤¬Á÷¿®¤µ¤ì¤Þ¤¹¡£</p>
+ <form method="post" action="../action.php">
<p>
- °Ê²¼¤Ë¥æ¡¼¥¶¡¼Ì¾¤È¥á¡¼¥ë¥¢¥É¥ì¥¹¤òÆþÎϤ·¤Æ¤¯¤À¤µ¤¤¡£¿·¤·¤¤¥Ñ¥¹¥ï¡¼¥É¤òÁªÂò¤¹¤ë¥Ú¡¼¥¸¤Ø¤Î¥ê¥ó¥¯¤ÎÆþ¤Ã¤¿¥á¡¼¥ë¤¬Á÷¿®¤µ¤ì¤Þ¤¹¡£
- </p>
+ <label for="nucleus_pf_username">¥æ¡¼¥¶¡¼Ì¾¡§</label><br />
+ <input type="text" name="name" id="nucleus_pf_username" /><br />
- <form method="post" action="../action.php"><p>
- <input name="action" value="forgotpassword" type="hidden" />
- ¥æ¡¼¥¶¡¼Ì¾¡§
- <br />
- <input name="name" />
+ <label for="nucleus_pf_email">¥á¡¼¥ë¥¢¥É¥ì¥¹¡§</label><br />
+ <input type="text" name="email" id="nucleus_pf_email" /><br />
<br />
- ¥á¡¼¥ë¥¢¥É¥ì¥¹¡§
- <br />
- <input name="email" />
- <br />
- <br />
- <input type="submit" value="¥Ñ¥¹¥ï¡¼¥É¥á¡¼¥ë¤ÎÁ÷¿®" class="transparent" />
- </p></form>
- <p>
- ¤â¤·¥æ¡¼¥¶¡¼Ì¾¤ò¤ªËº¤ì¤Ê¤é¡¢¤¢¤Ê¤¿¤ÎNucleus¥µ¥¤¥È´ÉÍý¼Ô¤ËÏ¢Íí¤·¤Æ¤¯¤À¤µ¤¤¡£
+ <input type="hidden" name="action" value="forgotpassword" />
+ <input type="submit" value="ǧ¾ÚÍÑ¥ê¥ó¥¯¤ÎÁ÷¿®" class="transparent" />
</p>
+ </form>
+ <p>¤â¤·¥æ¡¼¥¶¡¼Ì¾¤ò¤ªËº¤ì¤Ê¤é¡¢¤¢¤Ê¤¿¤ÎNucleus¥µ¥¤¥È´ÉÍý¼Ô¤ËÏ¢Íí¤·¤Æ¤¯¤À¤µ¤¤¡£</p>
- <div class="foot">
- <a href="http://nucleuscms.org/">Nucleus © 2001-2007 The Nucleus Group</a>
- </div>
+ <div class="foot">
+ <a href="http://nucleuscms.org/">Nucleus © 2001-2007 The Nucleus Group</a>
+ </div>
- </div><!-- content -->
+ </div>
</body>
</html>
-<div class="commentform"><%text(_ERROR_ITEMCLOSED)%></div>\r
+<div class="commentform"><%text(_ERROR_ITEMCLOSED)%></div>
/**
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: index.php,v 1.4 2007-03-27 12:13:47 kimitake Exp $
- * $NucleusJP: index.php,v 1.8 2007/02/04 06:28:45 kimitake Exp $
+ * @version $Id: index.php,v 1.4.2.1 2008-01-29 07:05:05 kimitake Exp $
+ * $NucleusJP: index.php,v 1.8.2.1 2007/09/07 07:36:09 kimitake Exp $
*/
// we are using admin stuff:
$CONF = array();
$action = 'showlogin';
}
- sendContentType('application/xhtml+xml', 'admin-' . $action);
+ sendContentType('text/html', 'admin-' . $action);
$admin = new ADMIN();
$admin->action($action);
*
* Some JavaScript code for the admin area
*
- * $Id: admin.js,v 1.4 2007-03-22 08:31:55 kimitake Exp $
- * $NucleusJP: admin.js,v 1.5 2007/02/04 06:28:45 kimitake Exp $
+ * $Id: admin.js,v 1.4.2.1 2008-01-29 07:05:05 kimitake Exp $
+ * $NucleusJP: admin.js,v 1.6.2.1 2007/09/05 05:58:56 kimitake Exp $
*/
function help(url) {
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">\r
-<html xmlns="http://www.w3.org/1999/xhtml">\r
-<head>\r
- <title>Nothing Here</title>\r
-</head>\r
-<body>\r
-\r
-<h1>Nothing to see here</h1>\r
-\r
-</body>\r
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml">
+<head>
+ <title>Nothing Here</title>
+</head>
+<body>
+
+<h1>Nothing to see here</h1>
+
+</body>
</html>
\ No newline at end of file
// Fully translated language file can be sent to us and will be made
// available for download (with proper credit to the author, of course)
+// START changed/added after 3.31 START
+define('_CREATE_ACCOUNT0', 'Create Account');
+define('_CREATE_ACCOUNT1', 'Visitors are not allowed to create a Member Account.<br /><br />');
+define('_CREATE_ACCOUNT2', 'Please contact the website administrator for more information.');
+define('_CREATE_ACCOUNT_LOGIN_NAME', 'Login Name (required):');
+define('_CREATE_ACCOUNT_REAL_NAME', 'Real Name (required):');
+define('_CREATE_ACCOUNT_EMAIL', 'Email (required):');
+define('_CREATE_ACCOUNT_EMAIL2', '(must be valid, because an activation link will be sent over there)');
+define('_CREATE_ACCOUNT_URL', 'URL:');
+define('_CREATE_ACCOUNT_SUBMIT', 'Create Account');
+
+
// START changed/added after 3.3 START
define('_AUTOSAVEDRAFT', 'Auto save draft');
define('_AUTOSAVEDRAFT_LASTSAVED', 'Last saved: ');
define('_EBLOG_NOTIFY_COMMENT', 'New comments');
define('_EBLOG_NOTIFY_KARMA', 'New karma votes');
define('_EBLOG_NOTIFY_ITEM', 'New weblog items');
-define('_EBLOG_PING', 'Ping Weblogs.com on update?');
+define('_EBLOG_PING', 'Ping weblog listing service on update?');
define('_EBLOG_MAXCOMMENTS', 'Max Amount of comments');
define('_EBLOG_UPDATE', 'Update file');
define('_EBLOG_OFFSET', 'Time Offset');
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">\r
-<html xmlns="http://www.w3.org/1999/xhtml">\r
-<head>\r
- <title>Nothing Here</title>\r
-</head>\r
-<body>\r
-\r
-<h1>Nothing to see here</h1>\r
-\r
-</body>\r
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml">
+<head>
+ <title>Nothing Here</title>
+</head>
+<body>
+
+<h1>Nothing to see here</h1>
+
+</body>
</html>
\ No newline at end of file
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: ACTION.php,v 1.6 2007-03-22 08:32:11 kimitake Exp $
- * $NucleusJP: ACTION.php,v 1.8 2007/03/13 05:19:04 shizuki Exp $
+ * @version $Id: ACTION.php,v 1.6.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * $NucleusJP: ACTION.php,v 1.8.2.4 2007/12/05 01:27:36 kmorimatsu Exp $
*/
class ACTION
{
if (!$CONF['AllowMemberCreate'])
doError(_ERROR_MEMBERCREATEDISABLED);
- // even though the member can not log in, set some random initial password. One never knows.
- srand((double)microtime()*1000000);
- $initialPwd = md5(uniqid(rand(), true));
+ // evaluate content from FormExtra
+ $result = 1;
+ $manager->notify('ValidateForm', array('type' => 'membermail', 'error' => &$result));
- // create member (non admin/can not login/no notes/random string as password)
- $r = MEMBER::create(postVar('name'), postVar('realname'), $initialPwd, postVar('email'), postVar('url'), 0, 0, '');
+ if ($result!=1) {
+ return $result;
+ }
+ else {
- if ($r != 1)
- doError($r);
+ // even though the member can not log in, set some random initial password. One never knows.
+ srand((double)microtime()*1000000);
+ $initialPwd = md5(uniqid(rand(), true));
- // send message containing password.
- $newmem = new MEMBER();
- $newmem->readFromName(postVar('name'));
- $newmem->sendActivationLink('register');
+ // create member (non admin/can not login/no notes/random string as password)
+ $r = MEMBER::create(postVar('name'), postVar('realname'), $initialPwd, postVar('email'), postVar('url'), 0, 0, '');
- $manager->notify('PostRegister',array('member' => &$newmem));
+ if ($r != 1) {
+ return $r;
+ }
- if (postVar('desturl')) {
- redirect(postVar('desturl'));
- } else {
- header ("Content-Type: text/html; charset="._CHARSET);
- echo _MSG_ACTIVATION_SENT;
+ // send message containing password.
+ $newmem = new MEMBER();
+ $newmem->readFromName(postVar('name'));
+ $newmem->sendActivationLink('register');
+
+ $manager->notify('PostRegister',array('member' => &$newmem));
+
+ if (postVar('desturl')) {
+ redirect(postVar('desturl'));
+ } else {
+ // header has been already sent, so deleted the line below
+ //header ("Content-Type: text/html; charset="._CHARSET);
+ echo _MSG_ACTIVATION_SENT;
+ }
+ exit;
}
- exit;
}
/**
}
/**
- * Checks if an IP or IP range is banned
- */
+ * Checks if an IP or IP range is banned
+ */
function checkban($blogid) {
// check if banned
$ban = BAN::isBanned($blogid, serverVar('REMOTE_ADDR'));
}
-?>
\ No newline at end of file
+?>
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: ACTIONS.php,v 1.3 2007-04-20 08:27:13 kimitake Exp $
- * @version $NucleusJP: ACTIONS.php,v 1.2 2007/03/22 09:23:58 kimitake Exp $
+ * @version $Id: ACTIONS.php,v 1.3.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * @version $NucleusJP: ACTIONS.php,v 1.8.2.1 2007/08/08 05:17:54 kimitake Exp $
*/
class ACTIONS extends BaseActions {
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: ADMIN.php,v 1.11 2007-04-27 19:07:04 kimitake Exp $
- * @version $NucleusJP: ADMIN.php,v 1.10 2007/04/04 07:52:08 kimitake Exp $
+ * @version $Id: ADMIN.php,v 1.11.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * @version $NucleusJP: ADMIN.php,v 1.21.2.4 2007/10/30 19:04:24 kmorimatsu Exp $
*/
if ( !function_exists('requestVar') ) exit;
// edit the item for real
ITEM::update($itemid, $catid, $title, $body, $more, $closed, $wasdraft, $publish, $timestamp);
- if ($draftid > 0) {
+ $blogid = getBlogIDFromItemID($itemid);
+ $blog =& $manager->getBlog($blogid);
+
+ $isFuture = 0;
+ if ($timestamp > $blog->getCorrectTime(time())) {
+ $isFuture = 1;
+ }
+
+ $this->updateFuturePosted($blogid);
+
+ if ($draftid > 0 && $member->canAlterItem($draftid)) {
ITEM::delete($draftid);
}
- $blogid = getBlogIDFromItemID($itemid);
- $blog =& $manager->getBlog($blogid);
- if (!$closed && $publish && $wasdraft && $blog->pingUserland()) {
+ if (!$closed && $publish && $wasdraft && $blog->sendPing() && numberOfEventSubscriber('SendPing') > 0 && !$isFuture) {
$this->action_sendping($blogid);
return;
}
if (!$member->canAlterItem($itemid))
return _ERROR_DISALLOWED;
+ // need to get blogid before the item is deleted
+ $blogid = getBlogIDFromItemId($itemid);
+
$manager->loadClass('ITEM');
ITEM::delete($itemid);
+
+ // update blog's futureposted
+ $this->updateFuturePosted($blogid);
+ }
+
+ /**
+ * Update a blog's future posted flag
+ * @param int $blogid
+ */
+ function updateFuturePosted($blogid) {
+ global $manager;
+
+ $blog =& $manager->getBlog($blogid);
+ $currenttime = $blog->getCorrectTime(time());
+ $result = sql_query("SELECT * FROM ".sql_table('item').
+ " WHERE iblog='".$blogid."' AND iposted=0 AND itime>".mysqldate($currenttime));
+ if (mysql_num_rows($result) > 0) {
+ $blog->setFuturePost();
+ }
+ else {
+ $blog->clearFuturePost();
+ }
}
/**
// only allow if user is allowed to alter item
$member->canUpdateItem($itemid, $catid) or $this->disallow();
+ $old_blogid = getBlogIDFromItemId($itemid);
+
ITEM::move($itemid, $catid);
+ // set the futurePosted flag on the blog
+ $this->updateFuturePosted(getBlogIDFromItemId($itemid));
+
+ // reset the futurePosted in case the item is moved from one blog to another
+ $this->updateFuturePosted($old_blogid);
+
if ($catid != intRequestVar('catid'))
$this->action_categoryedit($catid, $blog->getID());
else
$this->action_categoryedit(
$result['catid'],
$blogid,
- $blog->pingUserland() ? $pingUrl : ''
+ $blog->sendPing() && numberOfEventSubscriber('SendPing') > 0 ? $pingUrl : ''
);
- elseif ((postVar('actiontype') == 'addnow') && $blog->pingUserland())
+ elseif ((postVar('actiontype') == 'addnow') && $blog->sendPing() && numberOfEventSubscriber('SendPing') > 0)
$this->action_sendping($blogid);
else
$this->action_itemlist($blogid);
}
/**
- * Shows a window that says we're about to ping weblogs.com.
+ * Shows a window that says we're about to ping.
* immediately refresh to the real pinging page, which will
* show an error, or redirect to the blog.
*
$this->pagehead('<meta http-equiv="refresh" content="1; url='.htmlspecialchars($rawPingUrl).'" />');
?>
- <h2>Site Updated, Now pinging weblogs.com</h2>
+ <h2>Site Updated, Now pinging various weblog listing services...</h2>
<p>
- Pinging weblogs.com! This can a while...
- <br />
- When the ping is complete (and successfull), your weblog will show up in the weblogs.com updates list.
+ This can take a while...
</p>
<p>
}
/**
- * Ping to Weblogs.com
* Sends the real ping (can take up to 10 seconds!)
*/
function action_rawping() {
$blogid = intRequestVar('blogid');
$blog =& $manager->getBlog($blogid);
- $result = $blog->sendUserlandPing();
-
$this->pagehead();
?>
- <h2>Ping Results</h2>
+ <h2>Pinging services, please wait...</h2>
+ <div class='note'>
+ <?php
- <p>The following message was returned by weblogs.com:</p>
+ // send sendPing event
+ $manager->notify('SendPing', array('blogid' => $blogid));
- <div class='note'><?php echo $result ?></div>
+ ?>
+ </div>
<ul>
<li><a href="index.php?action=itemlist&blogid=<?php echo $blog->getID()?>">View list of recent items for <?php echo htmlspecialchars($blog->getName())?></a></li>
// check if: - there remains at least one blog admin
// - (there remains at least one team member)
- $tmem = MEMBER::createFromID($memberid);
+ $mem = MEMBER::createFromID($memberid);
$manager->notify('PreDeleteTeamMember', array('member' => &$mem, 'blogid' => $blogid));
- if ($tmem->isBlogAdmin($blogid)) {
+ if ($mem->isBlogAdmin($blogid)) {
// check if there are more blog members left and at least one admin
// (check for at least two admins before deletion)
$query = 'SELECT * FROM '.sql_table('team') . ' WHERE tblog='.$blogid.' and tadmin=1';
/><label for="notifyNewItem"><?php echo _EBLOG_NOTIFY_ITEM?></label>
</td>
</tr><tr>
- <td><?php echo _EBLOG_PING?> <?php help('pinguserland'); ?></td>
- <td><?php $this->input_yesno('pinguserland',$blog->pingUserland(),85); ?></td>
+ <?php
+ if (numberOfEventSubscriber('SendPing') > 0) {
+ ?>
+ <td><?php echo _EBLOG_PING?> <?php help('sendping'); ?></td>
+ <td><?php $this->input_yesno('sendping',$blog->sendPing(),85); ?></td>
</tr><tr>
+ <?php
+ }
+ ?>
<td><?php echo _EBLOG_MAXCOMMENTS?> <?php help('blogmaxcomments'); ?></td>
<td><input name="maxcomments" tabindex="90" size="3" value="<?php echo htmlspecialchars($blog->getMaxComments()); ?>" /></td>
</tr><tr>
$blog->setDefaultSkin(intPostVar('defskin'));
$blog->setDescription(trim(postVar('desc')));
$blog->setPublic(postVar('public'));
- $blog->setPingUserland(postVar('pinguserland'));
+ $blog->setPingUserland(postVar('sendping'));
$blog->setConvertBreaks(intPostVar('convertbreaks'));
$blog->setAllowPastPosting(intPostVar('allowpastposting'));
$blog->setDefaultCategory(intPostVar('defcat'));
'name' => &$bname,
'shortname' => &$bshortname,
'timeoffset' => &$btimeoffset,
- 'description' => &$bdescription,
+ 'description' => &$bdesc,
'defaultskin' => &$bdefskin
)
);
sql_query('UPDATE '.sql_table('plugin').' SET porder='.$oldOrder.' WHERE porder='.$newOrder);
sql_query('UPDATE '.sql_table('plugin').' SET porder='.$newOrder.' WHERE pid='.$plugid);
- $this->action_pluginlist();
+ //$this->action_pluginlist();
+ // To avoid showing ticket in the URL, redirect to pluginlist, instead.
+ redirect('?action=pluginlist');
}
/**
sql_query('UPDATE '.sql_table('plugin').' SET porder='.$oldOrder.' WHERE porder='.$newOrder);
sql_query('UPDATE '.sql_table('plugin').' SET porder='.$newOrder.' WHERE pid='.$plugid);
- $this->action_pluginlist();
+ //$this->action_pluginlist();
+ // To avoid showing ticket in the URL, redirect to pluginlist, instead.
+ redirect('?action=pluginlist');
}
/**
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: BLOG.php,v 1.5.2.1 2007-05-01 08:38:53 kimitake Exp $
- * $NucleusJP: BLOG.php,v 1.5 2007/04/20 08:20:31 kimitake Exp $
+ * @version $Id: BLOG.php,v 1.5.2.2 2008-01-29 07:05:06 kimitake Exp $
+ * $NucleusJP: BLOG.php,v 1.12.2.2 2007/08/08 05:26:22 kimitake Exp $
*/
if ( !function_exists('requestVar') ) exit;
/**
* Adds an item to this blog
*/
- function additem($catid, $title, $body, $more, $blogid, $authorid, $timestamp, $closed, $draft) {
+ function additem($catid, $title, $body, $more, $blogid, $authorid, $timestamp, $closed, $draft, $posted='1') {
global $manager;
$blogid = intval($blogid);
$more = addBreaks($more);
}
- if ($closed != '1') $closed = '0';
+ if ($closed != '1') $closed = '0';
if ($draft != '0') $draft = '1';
if (!$this->isValidCategory($catid))
$body = addslashes($body);
$more = addslashes($more);
- $query = 'INSERT INTO '.sql_table('item').' (ITITLE, IBODY, IMORE, IBLOG, IAUTHOR, ITIME, ICLOSED, IDRAFT, ICAT) '
- . "VALUES ('$title', '$body', '$more', $blogid, $authorid, '$timestamp', $closed, $draft, $catid)";
+ $query = 'INSERT INTO '.sql_table('item').' (ITITLE, IBODY, IMORE, IBLOG, IAUTHOR, ITIME, ICLOSED, IDRAFT, ICAT, IPOSTED) '
+ . "VALUES ('$title', '$body', '$more', $blogid, $authorid, '$timestamp', $closed, $draft, $catid, $posted)";
sql_query($query);
$itemid = mysql_insert_id();
. " btimeoffset=" . $offset . ","
. " bpublic=" . intval($this->isPublic()) . ","
. " breqemail=" . intval($this->emailRequired()) . ","
- . " bsendping=" . intval($this->pingUserland()) . ","
+ . " bsendping=" . intval($this->sendPing()) . ","
. " bconvertbreaks=" . intval($this->convertBreaks()) . ","
. " ballowpast=" . intval($this->allowPastPosting()) . ","
. " bnotify='" . addslashes($this->getNotifyAddress()) . "',"
}
- /**
- * Sends a XML-RPC ping message to Userland, so the weblog can
- * show up in the weblogs.com updates-list
- */
- function sendUserlandPing() {
- global $php_errormsg;
-
- if ($this->pingUserland()) {
- // testmessage for adding an item
- $message = new xmlrpcmsg('weblogUpdates.ping',array(
- new xmlrpcval($this->getName(),'string'),
- new xmlrpcval($this->getURL(),'string')
- ));
-
- $c = new xmlrpc_client('/RPC2', 'rpc.weblogs.com', 80);
-
- // $c->setDebug(1);
-
- $r = $c->send($message,15); // 15 seconds timeout...
-
- if (($r == 0) && ($r->errno || $r->errstring)) {
- return 'Error ' . $r->errno . ' : ' . $r->errstring;
- } elseif (($r == 0) && ($php_errormsg)) {
- return 'PHP Error: ' . $php_errormsg;
- } elseif ($r == 0) {
- return 'Error while trying to send ping. Sorry about that.';
- } elseif ($r->faultCode() != 0) {
- return 'Error: ' . $r->faultString();
- } else {
- $r = $r->value(); // get response struct
- // get values
- $flerror = $r->structmem('flerror');
- $flerror = $flerror->scalarval();
-
-
- $message = $r->structmem('message');
- $message = $message->scalarval();
-
- if ($flerror != 0)
- return 'Error (flerror=1): ' . $message;
- else
- return 'Success: ' . $message;
- }
- }
- }
-
function isValidCategory($catid) {
$query = 'SELECT * FROM '.sql_table('category').' WHERE cblog=' . $this->getID() . ' and catid=' . intval($catid);
- $res = mysql_query($query);
+ $res = sql_query($query);
return (mysql_num_rows($res) != 0);
}
function getCategoryName($catid) {
- $res = mysql_query('SELECT cname FROM '.sql_table('category').' WHERE cblog='.$this->getID().' and catid=' . intval($catid));
+ $res = sql_query('SELECT cname FROM '.sql_table('category').' WHERE cblog='.$this->getID().' and catid=' . intval($catid));
$o = mysql_fetch_object($res);
return $o->cname;
}
function getCategoryDesc($catid) {
- $res = mysql_query('SELECT cdesc FROM '.sql_table('category').' WHERE cblog='.$this->getID().' and catid=' . intval($catid));
+ $res = sql_query('SELECT cdesc FROM '.sql_table('category').' WHERE cblog='.$this->getID().' and catid=' . intval($catid));
$o = mysql_fetch_object($res);
return $o->cdesc;
}
function getCategoryIdFromName($name) {
- $res = mysql_query('SELECT catid FROM '.sql_table('category').' WHERE cblog='.$this->getID().' and cname="' . addslashes($name) . '"');
+ $res = sql_query('SELECT catid FROM '.sql_table('category').' WHERE cblog='.$this->getID().' and cname="' . addslashes($name) . '"');
if (mysql_num_rows($res) > 0) {
$o = mysql_fetch_object($res);
return $o->catid;
}
}
- function pingUserland() {
+ function sendPing() {
return $this->getSetting('bsendping');
}
return (mysql_num_rows($r) != 0);
}
+ // flag there is a future post pending
+ function setFuturePost() {
+ $query = 'UPDATE '.sql_table('blog')
+ . " SET bfuturepost='1' WHERE bnumber=" . $this->getID();
+ sql_query($query);
+ }
+
+ // clear there is a future post pending
+ function clearFuturePost() {
+ $query = 'UPDATE '.sql_table('blog')
+ . " SET bfuturepost='0' WHERE bnumber=" . $this->getID();
+ sql_query($query);
+ }
+
+ // check if we should throw justPosted event
+ function checkJustPosted() {
+ global $manager;
+
+ if ($this->settings['bfuturepost'] == 1) {
+ $blogid = $this->getID();
+ $result = sql_query("SELECT * FROM " . sql_table('item')
+ . " WHERE iposted=0 AND iblog=" . $blogid . " AND itime<NOW()");
+ if (mysql_num_rows($result) > 0) {
+ // This $pinged is allow a plugin to tell other hook to the event that a ping is sent already
+ // Note that the plugins's calling order is subject to thri order in the plugin list
+ $pinged = false;
+ $manager->notify(
+ 'JustPosted',
+ array('blogid' => $blogid,
+ 'pinged' => &$pinged
+ )
+ );
+
+ // clear all expired future posts
+ sql_query("UPDATE " . sql_table('item') . " SET iposted='1' WHERE iblog=" . $blogid . " AND itime<NOW()");
+
+ // check to see any pending future post, clear the flag is none
+ $result = sql_query("SELECT * FROM " . sql_table('item')
+ . " WHERE iposted=0 AND iblog=" . $blogid);
+ if (mysql_num_rows($result) == 0) {
+ $this->clearFuturePost();
+ }
+ }
+ }
+ }
}
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: BODYACTIONS.php,v 1.2 2007-04-20 08:27:13 kimitake Exp $
- * @version $NucleusJP: BODYACTIONS.php,v 1.6 2007/04/19 06:13:50 kimitake Exp $
+ * @version $Id: BODYACTIONS.php,v 1.2.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * @version $NucleusJP: BODYACTIONS.php,v 1.6.2.1 2007/08/08 05:27:14 kimitake Exp $
*/
class BODYACTIONS extends BaseActions {
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: COMMENTACTIONS.php,v 1.2 2007-04-20 08:45:05 kimitake Exp $
- * @version $NucleusJP: COMMENTACTIONS.php,v 1.1 2007/04/04 07:52:08 kimitake Exp $
+ * @version $Id: COMMENTACTIONS.php,v 1.2.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * @version $NucleusJP: COMMENTACTIONS.php,v 1.5.2.1 2007/08/08 05:31:31 kimitake Exp $
*/
class COMMENTACTIONS extends BaseActions {
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: COMMENTS.php,v 1.5 2007-04-04 07:52:08 kimitake Exp $
- * $NucleusJP: COMMENTS.php,v 1.4 2007/03/27 12:13:56 kimitake Exp $
+ * @version $Id: COMMENTS.php,v 1.5.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * $NucleusJP: COMMENTS.php,v 1.9.2.1 2007/08/08 05:32:21 kimitake Exp $
*/
if ( !function_exists('requestVar') ) exit;
}
-?>
\ No newline at end of file
+?>
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: ENCAPSULATE.php,v 1.1 2007-04-04 07:52:08 kimitake Exp $
- * @version $NucleusJP: ENCAPSULATE.php,v 1.4 2007/03/22 03:30:14 kmorimatsu Exp $
+ * @version $Id: ENCAPSULATE.php,v 1.1.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * @version $NucleusJP: ENCAPSULATE.php,v 1.4.2.1 2007/08/08 05:32:54 kimitake Exp $
*/
class ENCAPSULATE {
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: ITEM.php,v 1.4 2007-03-27 12:13:56 kimitake Exp $
- * $NucleusJP: ITEM.php,v 1.7 2007/02/04 06:28:46 kimitake Exp $
+ * @version $Id: ITEM.php,v 1.4.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * $NucleusJP: ITEM.php,v 1.7.2.1 2007/09/05 06:21:17 kimitake Exp $
*/
class ITEM {
$posttime = $i_draft ? 0 : $blog->getCorrectTime();
}
- $itemid = $blog->additem($i_catid, $i_title,$i_body,$i_more,$i_blogid,$i_author,$posttime,$i_closed,$i_draft);
+ if ($posttime > $blog->getCorrectTime()) {
+ $posted = 0;
+ $blog->setFuturePost();
+ }
+ else {
+ $posted = 1;
+ }
+
+ $itemid = $blog->additem($i_catid, $i_title,$i_body,$i_more,$i_blogid,$i_author,$posttime,$i_closed,$i_draft,$posted);
//Setting the itemOptions
$aOptions = requestArray('plugoption');
if ( (!$blog->allowPastPosting()) && ($timestamp < $blog->getCorrectTime()))
$timestamp = 0;
- if ($wasdraft && $publish) {
- $query .= ', idraft=0';
+ if ($timestamp > $blog->getCorrectTime(time())) {
+ $isFuture = 1;
+ $query .= ', iposted=0';
+ }
+ else {
+ $isFuture = 0;
+ $query .= ', iposted=1';
+ }
+ if ($wasdraft && $publish) {
// set timestamp to current date only if it's not a future item
// draft items have timestamp == 0
// don't allow timestamps in the past (unless otherwise defined in blogsettings)
- if ($timestamp > $blog->getCorrectTime())
- $isFuture = 1;
+ $query .= ', idraft=0';
if ($timestamp == 0)
$timestamp = $blog->getCorrectTime();
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: ITEMACTIONS.php,v 1.1 2007-04-04 07:52:08 kimitake Exp $
- * @version $NucleusJP: ITEMACTIONS.php,v 1.5 2007/03/22 03:30:14 kmorimatsu Exp $
+ * @version $Id: ITEMACTIONS.php,v 1.1.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * @version $NucleusJP: ITEMACTIONS.php,v 1.5.2.3 2007/10/30 19:05:20 kmorimatsu Exp $
*/
class ITEMACTIONS extends BaseActions {
}
function parse_title($format = '') {
+ if (is_array($this->currentItem)) {
+ $itemtitle = $this->currentItem['title'];
+ } elseif (is_object($this->currentItem)) {
+ $itemtitle = $this->currentItem->title;
+ }
switch ($format) {
case 'xml':
- echo stringToXML ($this->currentItem->title);
+// echo stringToXML ($this->currentItem->title);
+ echo stringToXML ($itemtitle);
break;
case 'attribute':
- echo stringToAttribute ($this->currentItem->title);
+// echo stringToAttribute ($this->currentItem->title);
+ echo stringToAttribute ($itemtitle);
break;
case 'raw':
- echo $this->currentItem->title;
+// echo $this->currentItem->title;
+ echo $itemtitle;
break;
default:
- $this->highlightAndParse($this->currentItem->title);
+// $this->highlightAndParse($this->currentItem->title);
+ $this->highlightAndParse($itemtitle);
break;
}
}
echo $this->template['NEW'];
}
+
function parse_daylink() {
echo createArchiveLink($this->blog->getID(), strftime('%Y-%m-%d',$this->currentItem->timestamp), $this->linkparams);
}
}
function parse_editpopupcode() {
- echo "if (event && event.preventDefault) event.preventDefault();winbm=window.open(this.href,'nucleusbm','scrollbars=yes,width=600,height=500,left=10,top=10,status=yes,resizable=yes');winbm.focus();return false;";
+ echo "if (event && event.preventDefault) event.preventDefault();winbm=window.open(this.href,'nucleusbm','scrollbars=yes,width=600,height=550,left=10,top=10,status=yes,resizable=yes');winbm.focus();return false;";
}
// helper functions
$this->parser->actions = $this->getDefinedActions();
}
*/
+
}
+
+
-?>
\ No newline at end of file
+?>
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: MANAGER.php,v 1.5 2007-04-06 19:37:07 kmorimatsu Exp $
- * $NucleusJP: MANAGER.php,v 1.4 2007/03/27 12:13:56 kimitake Exp $
+ * @version $Id: MANAGER.php,v 1.5.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * $NucleusJP: MANAGER.php,v 1.8.2.1 2007/09/05 07:00:18 kimitake Exp $
*/
class MANAGER {
/**
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: PAGEFACTORY.php,v 1.4 2007-03-27 12:13:56 kimitake Exp $
- * $NucleusJP: PAGEFACTORY.php,v 1.8 2007/03/22 03:30:14 kmorimatsu Exp $
+ * @version $Id: PAGEFACTORY.php,v 1.4.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * $NucleusJP: PAGEFACTORY.php,v 1.8.2.2 2007/10/30 16:12:27 shizuki Exp $
*/
/**
}
function parse_bloglink() {
- echo '<a href="'.htmlspecialchars($this->blog->getURL()).'">'.$this->blog->getName().'</a>';
+ echo '<a href="'.htmlspecialchars($this->blog->getURL()).'">'.htmlspecialchars($this->blog->getName()).'</a>';
}
function parse_authorname() {
case "2":
echo '<div class="jsbuttonbar">';
- $this->_jsbutton('bold',"boldThis()",'');
- $this->_jsbutton('italic',"italicThis()",'');
- $this->_jsbutton('link',"ahrefThis()",'');
+ $this->_jsbutton('bold',"boldThis()",_ADD_BOLD_TT);
+ $this->_jsbutton('italic',"italicThis()",_ADD_ITALIC_TT);
+ $this->_jsbutton('link',"ahrefThis()",_ADD_HREF_TT);
$this->_jsbuttonspacer();
$this->_jsbutton('alignleft',"alignleftThis()",_ADD_ALIGNLEFT_TT);
$this->_jsbutton('alignright',"alignrightThis()",_ADD_ALIGNRIGHT_TT);
/**
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: PARSER.php,v 1.4 2007-03-27 12:13:56 kimitake Exp $
- * $NucleusJP: PARSER.php,v 1.7 2007/03/20 19:31:29 kmorimatsu Exp $
+ * @version $Id: PARSER.php,v 1.4.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * $NucleusJP: PARSER.php,v 1.7.2.1 2007/09/05 07:35:59 kimitake Exp $
*/
if ( !function_exists('requestVar') ) exit;
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: PLUGIN.php,v 1.8 2007-04-20 08:45:28 kimitake Exp $
- * $NucleusJP: PLUGIN.php,v 1.7 2007/04/06 19:37:07 kmorimatsu Exp $
+ * @version $Id: PLUGIN.php,v 1.8.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * $NucleusJP: PLUGIN.php,v 1.12.2.3 2007/12/03 02:22:42 kmorimatsu Exp $
*/
class NucleusPlugin {
/**
* Retrieves the current value for an option
*/
- function getOption($name){
- return $this->_getOption('global', 0, $name);
+ function getOption($name)
+ {
+ // only request the options the very first time. On subsequent requests
+ // the static collection is used to save SQL queries.
+ if ($this->plugin_options == 0)
+ {
+ $this->plugin_options = array();
+ $query = sql_query(
+ 'SELECT d.oname as name, o.ovalue as value '.
+ 'FROM '.
+ sql_table('plugin_option').' o, '.
+ sql_table('plugin_option_desc').' d '.
+ 'WHERE d.opid='. intval($this->getID()).' AND d.oid=o.oid'
+ );
+ while ($row = mysql_fetch_object($query))
+ $this->plugin_options[strtolower($row->name)] = $row->value;
+ }
+ if (isset($this->plugin_options[strtolower($name)]))
+ return $this->plugin_options[strtolower($name)];
+ else
+ return $this->_getOption('global', 0, $name);
}
+
function getBlogOption($blogid, $name) {
return $this->_getOption('blog', $blogid, $name);
}
// retrieve the data and return
$q = 'SELECT otype, oextra FROM '.sql_table('plugin_option_desc').' WHERE oid = '.$oid;
- $query = mysql_query($q);
+ $query = sql_query($q);
$o = mysql_fetch_array($query);
$orderby = 'ovalue';
}
$q = 'SELECT ovalue value, ocontextid id FROM '.sql_table('plugin_option').' WHERE oid = '.$oid.' ORDER BY '.$orderby.' '.$sort.' LIMIT 0,'.intval($amount);
- $query = mysql_query($q);
+ $query = sql_query($q);
// create the array
$i = 0;
// update plugin_option
sql_query('DELETE FROM ' . sql_table('plugin_option') . ' WHERE oid='.intval($oid) . ' and ocontextid='. intval($contextid));
- @mysql_query('INSERT INTO ' . sql_table('plugin_option') . ' (ovalue, oid, ocontextid) VALUES (\''.addslashes($value).'\', '. intval($oid) . ', ' . intval($contextid) . ')');
+ sql_query('INSERT INTO ' . sql_table('plugin_option') . ' (ovalue, oid, ocontextid) VALUES (\''.addslashes($value).'\', '. intval($oid) . ', ' . intval($contextid) . ')');
// update cache
$this->_aOptionValues[$oid . '_' . $contextid] = $value;
*/
function _getOID($context, $name) {
$key = $context . '_' . $name;
- $info = $this->_aOptionToInfo[$key];
+ $info = @$this->_aOptionToInfo[$key];
if (is_array($info)) return $info['oid'];
// load all OIDs for this plugin from the database
}
mysql_free_result($res);
- return $this->_aOptionToInfo[$key]['oid'];
+ return @$this->_aOptionToInfo[$key]['oid'];
}
function _getDefVal($context, $name) {
$key = $context . '_' . $name;
$meta = NucleusPlugin::getOptionMeta($o->oextra);
// if the option is readonly or hidden it may not be saved
- if (($meta['access'] != 'readonly') && ($meta['access'] != 'hidden')) {
+ if ((@$meta['access'] != 'readonly') && (@$meta['access'] != 'hidden')) {
$value = undoMagic($value); // value comes from request
}
// check the validity of numerical options
- if (($meta['datatype'] == 'numerical') && (!is_numeric($value))) {
+ if ((@$meta['datatype'] == 'numerical') && (!is_numeric($value))) {
//the option must be numeric, but the it isn't
//use the default for this option
$value = $o->odef;
// delete the old value for the option
sql_query('DELETE FROM '.sql_table('plugin_option').' WHERE oid='.intval($oid).' AND ocontextid='.intval($contextid));
- @mysql_query('INSERT INTO '.sql_table('plugin_option')." (oid, ocontextid, ovalue) VALUES (".intval($oid).",".intval($contextid).",'" . addslashes($value) . "')");
+ sql_query('INSERT INTO '.sql_table('plugin_option')." (oid, ocontextid, ovalue) VALUES (".intval($oid).",".intval($contextid).",'" . addslashes($value) . "')");
}
}
}
- }
- // clear option value cache if the plugin object is already loaded
- if (is_object($o)) {
- $plugin=& $manager->pidLoaded($o->opid);
- if ($plugin) $plugin->clearOptionValueCache();
+ // clear option value cache if the plugin object is already loaded
+ if (is_object($o)) {
+ $plugin=& $manager->pidLoaded($o->opid);
+ if ($plugin) $plugin->clearOptionValueCache();
+ }
}
}
-
}
?>
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: PLUGINADMIN.php,v 1.4 2007-03-27 12:13:56 kimitake Exp $
- * $NucleusJP: PLUGINADMIN.php,v 1.8 2007/03/22 03:30:14 kmorimatsu Exp $
+ * @version $Id: PLUGINADMIN.php,v 1.4.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * $NucleusJP: PLUGINADMIN.php,v 1.8.2.2 2007/10/23 22:48:56 kmorimatsu Exp $
*/
global $HTTP_GET_VARS, $HTTP_POST_VARS, $HTTP_COOKIE_VARS, $HTTP_ENV_VARS, $HTTP_POST_FILES, $HTTP_SESSION_VARS;
else document.forms[i].action+='&'+'ticket=<?php echo $ticket; ?>';
continue;
}
- document.write('<p><b>Error occured druing automatic addition of tickets.</b></p>');
+ document.write('<p><b>Error occured during automatic addition of tickets.</b></p>');
j=document.forms[i].outerHTML;
while (j!=j.replace('<','<')) j=j.replace('<','<');
document.write('<p>'+j+'</p>');
* of the License, or (at your option) any later version.
* (see nucleus/documentation/index.html#license for more info)
*/
-
/**
* Class representing a skin
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: SKIN.php,v 1.6 2007-03-22 09:23:58 kimitake Exp $
- * @version $NucleusJP: SKIN.php,v 1.8 2007/03/20 19:31:29 kmorimatsu Exp $
+ * @version $Id: SKIN.php,v 1.6.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * @version $NucleusJP: SKIN.php,v 1.8.2.1 2007/09/05 07:45:01 kimitake Exp $
*/
if ( !function_exists('requestVar') ) exit;
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: backup.php,v 1.5 2007-03-22 08:32:11 kimitake Exp $
- * $NucleusJP: backup.php,v 1.8 2007/02/19 22:27:59 kmorimatsu Exp $
+ * @version $Id: backup.php,v 1.5.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * $NucleusJP: backup.php,v 1.8.2.1 2007/08/08 05:23:31 kimitake Exp $
*/
*/
function _backup_get_field_names($result, $num_fields) {
- if (function_exists('mysqli_fetch_fields') ) {
+/* if (function_exists('mysqli_fetch_fields') ) {
$fields = mysqli_fetch_fields($result);
for ($j = 0; $j < $num_fields; $j++)
$fields[$j] = $fields[$j]->name;
- } else {
+ } else {*/
$fields = array();
for ($j = 0; $j < $num_fields; $j++) {
$fields[] = mysql_field_name($result, $j);
}
- }
+/* }*/
return '(' . implode(', ', $fields) . ')';
}
/**
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: globalfunctions.php,v 1.13 2007-04-09 23:20:52 kmorimatsu Exp $
- * $NucleusJP: globalfunctions.php,v 1.12 2007/04/06 22:08:56 kmorimatsu Exp $
+ * @version $Id: globalfunctions.php,v 1.13.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * $NucleusJP: globalfunctions.php,v 1.23.2.5 2007/12/05 01:28:41 kmorimatsu Exp $
*/
// needed if we include globalfunctions from install.php
global $nucleus, $CONF, $DIR_LIBS, $DIR_LANG, $manager, $member;
-//$nucleus['version'] = 'v3.3SVN';
-//$nucleus['codename'] = 'Lithium';
-$nucleus['version'] = 'v3.3';
+$nucleus['version'] = 'v3.31';
$nucleus['codename'] = '';
checkVars(array('nucleus', 'CONF', 'DIR_LIBS', 'MYSQL_HOST', 'MYSQL_USER', 'MYSQL_PASSWORD', 'MYSQL_DATABASE', 'DIR_LANG', 'DIR_PLUGINS', 'HTTP_GET_VARS', 'HTTP_POST_VARS', 'HTTP_COOKIE_VARS', 'HTTP_ENV_VARS', 'HTTP_SESSION_VARS', 'HTTP_POST_FILES', 'HTTP_SERVER_VARS', 'GLOBALS', 'argv', 'argc', '_GET', '_POST', '_COOKIE', '_ENV', '_SESSION', '_SERVER', '_FILES'));
$login = postVar('login');
$pw = postVar('password');
$shared = intPostVar('shared'); // shared computer or not
-
+
$pw=substr($pw,0,40); // avoid md5 collision by using a long key
if ($member->login($login, $pw) ) {
* returns the currently used version (100 = 1.00, 101 = 1.01, etc...)
*/
function getNucleusVersion() {
- return 330;
+ return 331;
}
/**
// get next and prev month links ...
global $archivenext, $archiveprev, $archivetype, $archivenextexists, $archiveprevexists;
-
+
// sql queries for the timestamp of the first and the last published item
- $query = "SELECT UNIX_TIMESTAMP(itime) as result FROM ".sql_table('item')." WHERE idraft=0 ORDER BY itime ASC";
- $first_timestamp=quickQuery ($query);
- $query = "SELECT UNIX_TIMESTAMP(itime) as result FROM ".sql_table('item')." WHERE idraft=0 ORDER BY itime DESC";
- $last_timestamp=quickQuery ($query);
+ $query = "SELECT UNIX_TIMESTAMP(itime) as result FROM ".sql_table('item')." WHERE idraft=0 AND iblog=".(int)($blogid ? $blogid : $CONF['DefaultBlog'])." ORDER BY itime ASC";
+ $first_timestamp=quickQuery ($query);
+ $query = "SELECT UNIX_TIMESTAMP(itime) as result FROM ".sql_table('item')." WHERE idraft=0 AND iblog=".(int)($blogid ? $blogid : $CONF['DefaultBlog'])." ORDER BY itime DESC";
+ $last_timestamp=quickQuery ($query);
sscanf($archive, '%d-%d-%d', $y, $m, $d);
if ($d != 0) {
$archivetype = _ARCHIVETYPE_DAY;
$t = mktime(0, 0, 0, $m, $d, $y);
-
- $archiveprev = strftime('%Y-%m-%d', $t - (24 * 60 * 60) );
+ // one day has 24 * 60 * 60 = 86400 seconds
+ $archiveprev = strftime('%Y-%m-%d', $t - 86400 );
// check for published items
if ($t > $first_timestamp) {
$archiveprevexists = true;
else {
$archiveprevexists = false;
}
-
+
// one day later
-// $t += 86400;
-// $archivenext = strftime('%Y-%m-%d', $t);
- $archivenext = strftime('%Y-%m-%d', $t + (24 * 60 * 60) );
- if ($t + (24 * 60 * 60) < $last_timestamp) {
+ $t += 86400;
+ $archivenext = strftime('%Y-%m-%d', $t);
+ if ($t < $last_timestamp) {
$archivenextexists = true;
}
else {
$archivenextexists = false;
}
-
+
} else {
$archivetype = _ARCHIVETYPE_MONTH;
$t = mktime(0, 0, 0, $m, 1, $y);
-
- $archiveprev = strftime('%Y-%m', $t - (1 * 24 * 60 * 60) );
+ // one day before is in the previous month
+ $archiveprev = strftime('%Y-%m', $t - 86400);
if ($t > $first_timestamp) {
$archiveprevexists = true;
}
else {
$archiveprevexists = false;
}
-
-// $archivenext = strftime('%Y-%m', $t + (32 * 24 * 60 * 60) );
+
// timestamp for the next month
$t = mktime(0, 0, 0, $m+1, 1, $y);
$archivenext = strftime('%Y-%m', $t);
// parse the skin
$skin->parse($type);
+
+ // check to see we should throw JustPosted event
+ $blog->checkJustPosted();
}
/**
if (!in_array($key, $excludeListForSanitization)) {
// check value
- list($val, $tmp) = explode('\\', $val);
+ @list($val, $tmp) = explode('\\', $val);
// remove control code etc.
$val = strtr($val, "\0\r\n<>'\"", " ");
$document = 'document';
$bookmarkletline = "javascript:Q='';x=".$document.";y=window;if(x.selection){Q=x.selection.createRange().text;}else if(y.getSelection){Q=y.getSelection();}else if(x.getSelection){Q=x.getSelection();}wingm=window.open('";
$bookmarkletline .= $CONF['AdminURL'] . "bookmarklet.php?blogid=$blogid";
- $bookmarkletline .="&logtext='+escape(Q)+'&loglink='+escape(x.location.href)+'&loglinktitle='+escape(x.title),'nucleusbm','scrollbars=yes,width=600,height=500,left=10,top=10,status=yes,resizable=yes');wingm.focus();";
+ $bookmarkletline .="&logtext='+escape(Q)+'&loglink='+escape(x.location.href)+'&loglinktitle='+escape(x.title),'nucleusbm','scrollbars=yes,width=600,height=550,left=10,top=10,status=yes,resizable=yes');wingm.focus();";
return $bookmarkletline;
}
return null;
}
-?>
\ No newline at end of file
+/**
+ * Returns number of subscriber to an event
+ *
+ * @param event
+ * @return number of subscriber(s)
+ */
+function numberOfEventSubscriber($event) {
+ $query = 'SELECT COUNT(*) as count FROM ' . sql_table('plugin_event') . ' WHERE event=\'' . $event . '\'';
+ $res = sql_query($query);
+ $obj = mysql_fetch_object($res);
+ return $obj->count;
+}
+
+?>
-<!DOCTYPE html\r
-PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN"\r
-"http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">\r
-<html xmlns="http://www.w3.org/1999/xhtml">\r
-<head>\r
- <title>Nothing Here</title>\r
-</head>\r
-<body>\r
-\r
-<h1>Nothing to see here</h1>\r
-\r
-</body>\r
+<!DOCTYPE html
+PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN"
+"http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml">
+<head>
+ <title>Nothing Here</title>
+</head>
+<body>
+
+<h1>Nothing to see here</h1>
+
+</body>
</html>
\ No newline at end of file
-README for the libs/include directory\r
--------------------------------------\r
-\r
-This directory contains templates used by the admin-area. \r
-They're not really intended to be edited by the people using Nucleus (i.e. there's \r
-no documentation and little support). But if you really can't stop yourself,\r
+README for the libs/include directory
+-------------------------------------
+
+This directory contains templates used by the admin-area.
+They're not really intended to be edited by the people using Nucleus (i.e. there's
+no documentation and little support). But if you really can't stop yourself,
go ahead :)
\ No newline at end of file
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">\r
-<html xmlns="http://www.w3.org/1999/xhtml">\r
-<head>\r
- <title>Nothing Here</title>\r
-</head>\r
-<body>\r
-\r
-<h1>Nothing to see here</h1>\r
-\r
-</body>\r
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml">
+<head>
+ <title>Nothing Here</title>
+</head>
+<body>
+
+<h1>Nothing to see here</h1>
+
+</body>
</html>
\ No newline at end of file
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: showlist.php,v 1.2 2007-04-20 08:27:13 kimitake Exp $
- * @version $NucleusJP: showlist.php,v 1.1 2007/04/04 07:52:08 kimitake Exp $
+ * @version $Id: showlist.php,v 1.2.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * @version $NucleusJP: showlist.php,v 1.7.2.3 2007/12/03 00:01:48 kmorimatsu Exp $
*/
$meta = NucleusPlugin::getOptionMeta($current['typeinfo']);
// only if it is not a hidden option write the controls to the page
- if ($meta['access'] != 'hidden') {
+ if (@$meta['access'] != 'hidden') {
echo '<td>',htmlspecialchars($current['description']?$current['description']:$current['name']),'</td>';
echo '<td>';
switch($current['type']) {
case 'textarea':
//$meta = NucleusPlugin::getOptionMeta($current['typeinfo']);
echo '<textarea class="pluginoption" cols="30" rows="5" name="',htmlspecialchars($varname),'"';
- if ($meta['access'] == 'readonly') {
+ if (@$meta['access'] == 'readonly') {
echo ' readonly="readonly"';
}
echo '>',htmlspecialchars($current['value']),'</textarea>';
//$meta = NucleusPlugin::getOptionMeta($current['typeinfo']);
echo '<input type="text" size="40" maxlength="128" name="',htmlspecialchars($varname),'" value="',htmlspecialchars($current['value']),'"';
- if ($meta['datatype'] == 'numerical') {
+ if (@$meta['datatype'] == 'numerical') {
echo ' onkeyup="checkNumeric(this)" onblur="checkNumeric(this)"';
}
- if ($meta['access'] == 'readonly') {
+ if (@$meta['access'] == 'readonly') {
echo ' readonly="readonly"';
}
echo ' />';
}
- echo $current['extra'];
+ echo @$current['extra'];
echo '</td>';
}
}
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: skinie.php,v 1.5 2007-04-20 08:45:28 kimitake Exp $
- * @version $NucleusJP: skinie.php,v 1.4 2007/03/22 09:23:58 kimitake Exp $
+ * @version $Id: skinie.php,v 1.5.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * @version $NucleusJP: skinie.php,v 1.9.2.1 2007/09/05 07:46:30 kimitake Exp $
*/
class SKINIMPORT {
/**
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: vars4.0.6.php,v 1.6 2007-03-22 09:23:58 kimitake Exp $
- * @version $NucleusJP: vars4.0.6.php,v 1.10 2007/02/04 06:28:46 kimitake Exp $
+ * @version $Id: vars4.0.6.php,v 1.6.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * @version $NucleusJP: vars4.0.6.php,v 1.10.2.1 2007/09/05 07:46:30 kimitake Exp $
*/
/**
/**
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: vars4.1.0.php,v 1.6 2007-03-22 09:23:58 kimitake Exp $
- * @version $NucleusJP: vars4.1.0.php,v 1.10 2007/02/04 06:28:46 kimitake Exp $
+ * @version $Id: vars4.1.0.php,v 1.6.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * @version $NucleusJP: vars4.1.0.php,v 1.10.2.2 2007/10/30 19:01:33 kmorimatsu Exp $
*/
+
+// Remove $_COOKIE keys in $_REQUEST
+// This is for maintaining the compatibility with PHP 4.0.6
+// and also for avoiding bugs of plugins due to cookie keys
+if (isset($_REQUEST) and isset($_COOKIE)) {
+ foreach($_COOKIE as $key=>$value) {
+ if (isset($_REQUEST[$key])) unset($_REQUEST[$key]);
+ }
+}
+
function getVar($name) {
if (!isset($_GET[$name])) {
return;
-<?php // -*-c++-*-
+<?php
// by Edd Dumbill (C) 1999-2002
// <edd@usefulinc.com>
-// $Id: xmlrpc.inc.php,v 1.7 2007-03-22 09:23:58 kimitake Exp $
-// $NucleusJP: xmlrpc.inc.php,v 1.6 2006/07/12 07:11:47 kimitake Exp $
+// $Original: xmlrpc.inc,v 1.158 2007/03/01 21:21:02 ggiunta Exp $
+// $Id: xmlrpc.inc.php,v 1.7.2.1 2008-01-29 07:05:06 kimitake Exp $
+// $NucleusJP: xmlrpc.inc.php,v 1.6.2.2 2007/09/07 07:04:24 kimitake Exp $
// Copyright (c) 1999,2000,2002 Edd Dumbill.
// ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
// OF THE POSSIBILITY OF SUCH DAMAGE.
- if (!function_exists('xml_parser_create'))
+ if(!function_exists('xml_parser_create'))
{
- // Win 32 fix. From: 'Leo West' <lwest@imaginet.fr>
- if($WINDIR)
+ // For PHP 4 onward, XML functionality is always compiled-in on windows:
+ // no more need to dl-open it. It might have been compiled out on *nix...
+ if(strtoupper(substr(PHP_OS, 0, 3) != 'WIN'))
{
- dl('php3_xml.dll');
+ dl('xml.so');
}
- else
+ }
+
+ // Try to be backward compat with php < 4.2 (are we not being nice ?)
+ $phpversion = phpversion();
+ if($phpversion[0] == '4' && $phpversion[2] < 2)
+ {
+ // give an opportunity to user to specify where to include other files from
+ if(!defined('PHP_XMLRPC_COMPAT_DIR'))
{
- dl('xml.so');
+ define('PHP_XMLRPC_COMPAT_DIR',dirname(__FILE__).'/compat/');
+ }
+ if($phpversion[2] == '0')
+ {
+ if($phpversion[4] < 6)
+ {
+ include(PHP_XMLRPC_COMPAT_DIR.'is_callable.php');
+ }
+ include(PHP_XMLRPC_COMPAT_DIR.'is_scalar.php');
+ include(PHP_XMLRPC_COMPAT_DIR.'array_key_exists.php');
+ include(PHP_XMLRPC_COMPAT_DIR.'version_compare.php');
}
+ include(PHP_XMLRPC_COMPAT_DIR.'var_export.php');
+ include(PHP_XMLRPC_COMPAT_DIR.'is_a.php');
}
// G. Giunta 2005/01/29: declare global these variables,
// so that xmlrpc.inc will work even if included from within a function
- // NB: it will give warnings in PHP3, so we comment it out
- // Milosch: Next round, maybe we should explicitly request these via $GLOBALS where used.
- if (phpversion() >= '4')
- {
- global $xmlrpcI4;
- global $xmlrpcInt;
- global $xmlrpcDouble;
- global $xmlrpcBoolean;
- global $xmlrpcString;
- global $xmlrpcDateTime;
- global $xmlrpcBase64;
- global $xmlrpcArray;
- global $xmlrpcStruct;
-
- global $xmlrpcTypes;
- global $xmlEntities;
- global $xmlrpcerr;
- global $xmlrpcstr;
- global $xmlrpc_defencoding;
- global $xmlrpc_internalencoding;
- global $xmlrpcName;
- global $xmlrpcVersion;
- global $xmlrpcerruser;
- global $xmlrpcerrxml;
- global $xmlrpc_backslash;
- global $_xh;
- }
- $xmlrpcI4='i4';
- $xmlrpcInt='int';
- $xmlrpcBoolean='boolean';
- $xmlrpcDouble='double';
- $xmlrpcString='string';
- $xmlrpcDateTime='dateTime.iso8601';
- $xmlrpcBase64='base64';
- $xmlrpcArray='array';
- $xmlrpcStruct='struct';
-
- $xmlrpcTypes=array(
- $xmlrpcI4 => 1,
- $xmlrpcInt => 1,
- $xmlrpcBoolean => 1,
- $xmlrpcString => 1,
- $xmlrpcDouble => 1,
- $xmlrpcDateTime => 1,
- $xmlrpcBase64 => 1,
- $xmlrpcArray => 2,
- $xmlrpcStruct => 3
+ // Milosch: 2005/08/07 - explicitly request these via $GLOBALS where used.
+ $GLOBALS['xmlrpcI4']='i4';
+ $GLOBALS['xmlrpcInt']='int';
+ $GLOBALS['xmlrpcBoolean']='boolean';
+ $GLOBALS['xmlrpcDouble']='double';
+ $GLOBALS['xmlrpcString']='string';
+ $GLOBALS['xmlrpcDateTime']='dateTime.iso8601';
+ $GLOBALS['xmlrpcBase64']='base64';
+ $GLOBALS['xmlrpcArray']='array';
+ $GLOBALS['xmlrpcStruct']='struct';
+ $GLOBALS['xmlrpcValue']='undefined';
+
+ $GLOBALS['xmlrpcTypes']=array(
+ $GLOBALS['xmlrpcI4'] => 1,
+ $GLOBALS['xmlrpcInt'] => 1,
+ $GLOBALS['xmlrpcBoolean'] => 1,
+ $GLOBALS['xmlrpcString'] => 1,
+ $GLOBALS['xmlrpcDouble'] => 1,
+ $GLOBALS['xmlrpcDateTime'] => 1,
+ $GLOBALS['xmlrpcBase64'] => 1,
+ $GLOBALS['xmlrpcArray'] => 2,
+ $GLOBALS['xmlrpcStruct'] => 3
);
- $xmlrpc_valid_parents = array(
- 'BOOLEAN' => array('VALUE' => 'VALUE'),
- 'I4' => array('VALUE' => 'VALUE'),
- 'INT' => array('VALUE' => 'VALUE'),
- 'STRING' => array('VALUE' => 'VALUE'),
- 'DOUBLE' => array('VALUE' => 'VALUE'),
- 'DATETIME.ISO8601' => array('VALUE' => 'VALUE'),
- 'BASE64' => array('VALUE' => 'VALUE'),
- 'ARRAY' => array('VALUE' => 'VALUE'),
- 'STRUCT' => array('VALUE' => 'VALUE'),
- 'PARAM' => array('PARAMS' => 'PARAMS'),
- 'METHODNAME' => array('METHODCALL' => 'METHODCALL'),
- 'PARAMS' => array('METHODCALL' => 'METHODCALL', 'METHODRESPONSE' => 'METHODRESPONSE'),
- 'MEMBER' => array('STRUCT' => 'STRUCT'),
- 'NAME' => array('MEMBER' => 'MEMBER'),
- 'DATA' => array('ARRAY' => 'ARRAY'),
- 'FAULT' => array('METHODRESPONSE' => 'METHODRESPONSE'),
- 'VALUE' => array('MEMBER' => 'MEMBER', 'DATA' => 'DATA', 'PARAM' => 'PARAM', 'FAULT' => 'FAULT')
+ $GLOBALS['xmlrpc_valid_parents'] = array(
+ 'VALUE' => array('MEMBER', 'DATA', 'PARAM', 'FAULT'),
+ 'BOOLEAN' => array('VALUE'),
+ 'I4' => array('VALUE'),
+ 'INT' => array('VALUE'),
+ 'STRING' => array('VALUE'),
+ 'DOUBLE' => array('VALUE'),
+ 'DATETIME.ISO8601' => array('VALUE'),
+ 'BASE64' => array('VALUE'),
+ 'MEMBER' => array('STRUCT'),
+ 'NAME' => array('MEMBER'),
+ 'DATA' => array('ARRAY'),
+ 'ARRAY' => array('VALUE'),
+ 'STRUCT' => array('VALUE'),
+ 'PARAM' => array('PARAMS'),
+ 'METHODNAME' => array('METHODCALL'),
+ 'PARAMS' => array('METHODCALL', 'METHODRESPONSE'),
+ 'FAULT' => array('METHODRESPONSE'),
+ 'NIL' => array('VALUE') // only used when extension activated
);
- $xmlEntities=array(
+ // define extra types for supporting NULL (useful for json or <NIL/>)
+ $GLOBALS['xmlrpcNull']='null';
+ $GLOBALS['xmlrpcTypes']['null']=1;
+
+ // Not in use anymore since 2.0. Shall we remove it?
+ /// @deprecated
+ $GLOBALS['xmlEntities']=array(
'amp' => '&',
'quot' => '"',
'lt' => '<',
'apos' => "'"
);
- $xmlrpcerr['unknown_method']=1;
- $xmlrpcstr['unknown_method']='Unknown method';
- $xmlrpcerr['invalid_return']=2;
- $xmlrpcstr['invalid_return']='Invalid return payload: enable debugging to examine incoming payload';
- $xmlrpcerr['incorrect_params']=3;
- $xmlrpcstr['incorrect_params']='Incorrect parameters passed to method';
- $xmlrpcerr['introspect_unknown']=4;
- $xmlrpcstr['introspect_unknown']="Can't introspect: method unknown";
- $xmlrpcerr['http_error']=5;
- $xmlrpcstr['http_error']="Didn't receive 200 OK from remote server.";
- $xmlrpcerr['no_data']=6;
- $xmlrpcstr['no_data']='No data received from server.';
- $xmlrpcerr['no_ssl']=7;
- $xmlrpcstr['no_ssl']='No SSL support compiled in.';
- $xmlrpcerr['curl_fail']=8;
- $xmlrpcstr['curl_fail']='CURL error';
- $xmlrpcerr['invalid_request']=15;
- $xmlrpcstr['invalid_request']='Invalid request payload';
-
- $xmlrpcerr['multicall_notstruct'] = 9;
- $xmlrpcstr['multicall_notstruct'] = 'system.multicall expected struct';
- $xmlrpcerr['multicall_nomethod'] = 10;
- $xmlrpcstr['multicall_nomethod'] = 'missing methodName';
- $xmlrpcerr['multicall_notstring'] = 11;
- $xmlrpcstr['multicall_notstring'] = 'methodName is not a string';
- $xmlrpcerr['multicall_recursion'] = 12;
- $xmlrpcstr['multicall_recursion'] = 'recursive system.multicall forbidden';
- $xmlrpcerr['multicall_noparams'] = 13;
- $xmlrpcstr['multicall_noparams'] = 'missing params';
- $xmlrpcerr['multicall_notarray'] = 14;
- $xmlrpcstr['multicall_notarray'] = 'params is not an array';
-
- // The charset encoding expected by the server for received messages and
- // by the client for received responses
- $xmlrpc_defencoding='UTF-8';
- // The encoding used by PHP.
- // String values received will be converted to this.
- $xmlrpc_internalencoding='ISO-8859-1';
-
- $xmlrpcName='XML-RPC for PHP';
- $xmlrpcVersion='1.2.1';
+ // tables used for transcoding different charsets into us-ascii xml
+
+ $GLOBALS['xml_iso88591_Entities']=array();
+ $GLOBALS['xml_iso88591_Entities']['in'] = array();
+ $GLOBALS['xml_iso88591_Entities']['out'] = array();
+ for ($i = 0; $i < 32; $i++)
+ {
+ $GLOBALS['xml_iso88591_Entities']['in'][] = chr($i);
+ $GLOBALS['xml_iso88591_Entities']['out'][] = '&#'.$i.';';
+ }
+ for ($i = 160; $i < 256; $i++)
+ {
+ $GLOBALS['xml_iso88591_Entities']['in'][] = chr($i);
+ $GLOBALS['xml_iso88591_Entities']['out'][] = '&#'.$i.';';
+ }
+
+ /// @todo add to iso table the characters from cp_1252 range, i.e. 128 to 159.
+ /// These will NOT be present in true ISO-8859-1, but will save the unwary
+ /// windows user from sending junk.
+/*
+$cp1252_to_xmlent =
+ array(
+ '\x80'=>'€', '\x81'=>'?', '\x82'=>'‚', '\x83'=>'ƒ',
+ '\x84'=>'„', '\x85'=>'…', '\x86'=>'†', \x87'=>'‡',
+ '\x88'=>'ˆ', '\x89'=>'‰', '\x8A'=>'Š', '\x8B'=>'‹',
+ '\x8C'=>'Œ', '\x8D'=>'?', '\x8E'=>'Ž', '\x8F'=>'?',
+ '\x90'=>'?', '\x91'=>'‘', '\x92'=>'’', '\x93'=>'“',
+ '\x94'=>'”', '\x95'=>'•', '\x96'=>'–', '\x97'=>'—',
+ '\x98'=>'˜', '\x99'=>'™', '\x9A'=>'š', '\x9B'=>'›',
+ '\x9C'=>'œ', '\x9D'=>'?', '\x9E'=>'ž', '\x9F'=>'Ÿ'
+ );
+*/
+
+ $GLOBALS['xmlrpcerr']['unknown_method']=1;
+ $GLOBALS['xmlrpcstr']['unknown_method']='Unknown method';
+ $GLOBALS['xmlrpcerr']['invalid_return']=2;
+ $GLOBALS['xmlrpcstr']['invalid_return']='Invalid return payload: enable debugging to examine incoming payload';
+ $GLOBALS['xmlrpcerr']['incorrect_params']=3;
+ $GLOBALS['xmlrpcstr']['incorrect_params']='Incorrect parameters passed to method';
+ $GLOBALS['xmlrpcerr']['introspect_unknown']=4;
+ $GLOBALS['xmlrpcstr']['introspect_unknown']="Can't introspect: method unknown";
+ $GLOBALS['xmlrpcerr']['http_error']=5;
+ $GLOBALS['xmlrpcstr']['http_error']="Didn't receive 200 OK from remote server.";
+ $GLOBALS['xmlrpcerr']['no_data']=6;
+ $GLOBALS['xmlrpcstr']['no_data']='No data received from server.';
+ $GLOBALS['xmlrpcerr']['no_ssl']=7;
+ $GLOBALS['xmlrpcstr']['no_ssl']='No SSL support compiled in.';
+ $GLOBALS['xmlrpcerr']['curl_fail']=8;
+ $GLOBALS['xmlrpcstr']['curl_fail']='CURL error';
+ $GLOBALS['xmlrpcerr']['invalid_request']=15;
+ $GLOBALS['xmlrpcstr']['invalid_request']='Invalid request payload';
+ $GLOBALS['xmlrpcerr']['no_curl']=16;
+ $GLOBALS['xmlrpcstr']['no_curl']='No CURL support compiled in.';
+ $GLOBALS['xmlrpcerr']['server_error']=17;
+ $GLOBALS['xmlrpcstr']['server_error']='Internal server error';
+ $GLOBALS['xmlrpcerr']['multicall_error']=18;
+ $GLOBALS['xmlrpcstr']['multicall_error']='Received from server invalid multicall response';
+
+ $GLOBALS['xmlrpcerr']['multicall_notstruct'] = 9;
+ $GLOBALS['xmlrpcstr']['multicall_notstruct'] = 'system.multicall expected struct';
+ $GLOBALS['xmlrpcerr']['multicall_nomethod'] = 10;
+ $GLOBALS['xmlrpcstr']['multicall_nomethod'] = 'missing methodName';
+ $GLOBALS['xmlrpcerr']['multicall_notstring'] = 11;
+ $GLOBALS['xmlrpcstr']['multicall_notstring'] = 'methodName is not a string';
+ $GLOBALS['xmlrpcerr']['multicall_recursion'] = 12;
+ $GLOBALS['xmlrpcstr']['multicall_recursion'] = 'recursive system.multicall forbidden';
+ $GLOBALS['xmlrpcerr']['multicall_noparams'] = 13;
+ $GLOBALS['xmlrpcstr']['multicall_noparams'] = 'missing params';
+ $GLOBALS['xmlrpcerr']['multicall_notarray'] = 14;
+ $GLOBALS['xmlrpcstr']['multicall_notarray'] = 'params is not an array';
+
+ $GLOBALS['xmlrpcerr']['cannot_decompress']=103;
+ $GLOBALS['xmlrpcstr']['cannot_decompress']='Received from server compressed HTTP and cannot decompress';
+ $GLOBALS['xmlrpcerr']['decompress_fail']=104;
+ $GLOBALS['xmlrpcstr']['decompress_fail']='Received from server invalid compressed HTTP';
+ $GLOBALS['xmlrpcerr']['dechunk_fail']=105;
+ $GLOBALS['xmlrpcstr']['dechunk_fail']='Received from server invalid chunked HTTP';
+ $GLOBALS['xmlrpcerr']['server_cannot_decompress']=106;
+ $GLOBALS['xmlrpcstr']['server_cannot_decompress']='Received from client compressed HTTP request and cannot decompress';
+ $GLOBALS['xmlrpcerr']['server_decompress_fail']=107;
+ $GLOBALS['xmlrpcstr']['server_decompress_fail']='Received from client invalid compressed HTTP request';
+
+ // The charset encoding used by the server for received messages and
+ // by the client for received responses when received charset cannot be determined
+ // or is not supported
+ $GLOBALS['xmlrpc_defencoding']='UTF-8';
+
+ // The encoding used internally by PHP.
+ // String values received as xml will be converted to this, and php strings will be converted to xml
+ // as if having been coded with this
+ $GLOBALS['xmlrpc_internalencoding']='ISO-8859-1';
+
+ $GLOBALS['xmlrpcName']='XML-RPC for PHP';
+ $GLOBALS['xmlrpcVersion']='2.2';
// let user errors start at 800
- $xmlrpcerruser=800;
+ $GLOBALS['xmlrpcerruser']=800;
// let XML parse errors start at 100
- $xmlrpcerrxml=100;
+ $GLOBALS['xmlrpcerrxml']=100;
// formulate backslashes for escaping regexp
- $xmlrpc_backslash=chr(92).chr(92);
+ // Not in use anymore since 2.0. Shall we remove it?
+ /// @deprecated
+ $GLOBALS['xmlrpc_backslash']=chr(92).chr(92);
+
+ // set to TRUE to enable correct decoding of <NIL/> values
+ $GLOBALS['xmlrpc_null_extension']=false;
// used to store state during parsing
// quick explanation of components:
// ac - used to accumulate values
- // isf - used to indicate a fault
+ // isf - used to indicate a parsing fault (2) or xmlrpcresp fault (1)
+ // isf_reason - used for storing xmlrpcresp fault string
// lv - used to indicate "looking for a value": implements
// the logic to allow values with no types to be strings
// params - used to store parameters in method calls
// method - used to store method name
// stack - array with genealogy of xml elements names:
// used to validate nesting of xmlrpc elements
-
- $_xh=array();
+ $GLOBALS['_xh']=null;
/**
+ * Convert a string to the correct XML representation in a target charset
* To help correct communication of non-ascii chars inside strings, regardless
* of the charset used when sending requests, parsing them, sending responses
- * and parsing responses, convert all non-ascii chars present in the message
+ * and parsing responses, an option is to convert all non-ascii chars present in the message
* into their equivalent 'charset entity'. Charset entities enumerated this way
* are independent of the charset encoding used to transmit them, and all XML
* parsers are bound to understand them.
+ * Note that in the std case we are not sending a charset encoding mime type
+ * along with http headers, so we are bound by RFC 3023 to emit strict us-ascii.
+ *
+ * @todo do a bit of basic benchmarking (strtr vs. str_replace)
+ * @todo make usage of iconv() or recode_string() or mb_string() where available
*/
- function xmlrpc_entity_decode($string)
+ function xmlrpc_encode_entitites($data, $src_encoding='', $dest_encoding='')
{
- $top=split('&', $string);
- $op='';
- $i=0;
- while($i<sizeof($top))
+ if ($src_encoding == '')
{
- if (ereg("^([#a-zA-Z0-9]+);", $top[$i], $regs))
- {
- $op.=ereg_replace("^[#a-zA-Z0-9]+;",
- xmlrpc_lookup_entity($regs[1]),
- $top[$i]);
- }
- else
- {
- if ($i==0)
- {
- $op=$top[$i];
- }
- else
- {
- $op.='&' . $top[$i];
- }
- }
- $i++;
+ // lame, but we know no better...
+ $src_encoding = $GLOBALS['xmlrpc_internalencoding'];
}
- return $op;
- }
- function xmlrpc_lookup_entity($ent)
- {
- global $xmlEntities;
-
- if (isset($xmlEntities[strtolower($ent)]))
- {
- return $xmlEntities[strtolower($ent)];
- }
- if (ereg("^#([0-9]+)$", $ent, $regs))
+ switch(strtoupper($src_encoding.'_'.$dest_encoding))
{
- return chr($regs[1]);
- }
- return '?';
- }
-
- /**
- * These entities originate from HTML specs (1.1, proposed 2.0, etc),
- * and are taken directly from php-4.3.1/ext/mbstring/html_entities.c.
- * Until php provides functionality to translate these entities in its
- * core library, use this function.
- */
- function xmlrpc_html_entity_xlate($data = '')
- {
- $entities = array(
- " " => " ",
- "¡" => "¡",
- "¢" => "¢",
- "£" => "£",
- "¤" => "¤",
- "¥" => "¥",
- "¦" => "¦",
- "§" => "§",
- "¨" => "¨",
- "©" => "©",
- "ª" => "ª",
- "«" => "«",
- "¬" => "¬",
- "­" => "­",
- "®" => "®",
- "¯" => "¯",
- "°" => "°",
- "±" => "±",
- "²" => "²",
- "³" => "³",
- "´" => "´",
- "µ" => "µ",
- "¶" => "¶",
- "·" => "·",
- "¸" => "¸",
- "¹" => "¹",
- "º" => "º",
- "»" => "»",
- "¼" => "¼",
- "½" => "½",
- "¾" => "¾",
- "¿" => "¿",
- "À" => "À",
- "Á" => "Á",
- "Â" => "Â",
- "Ã" => "Ã",
- "Ä" => "Ä",
- "Å" => "Å",
- "Æ" => "Æ",
- "Ç" => "Ç",
- "È" => "È",
- "É" => "É",
- "Ê" => "Ê",
- "Ë" => "Ë",
- "Ì" => "Ì",
- "Í" => "Í",
- "Î" => "Î",
- "Ï" => "Ï",
- "Ð" => "Ð",
- "Ñ" => "Ñ",
- "Ò" => "Ò",
- "Ó" => "Ó",
- "Ô" => "Ô",
- "Õ" => "Õ",
- "Ö" => "Ö",
- "×" => "×",
- "Ø" => "Ø",
- "Ù" => "Ù",
- "Ú" => "Ú",
- "Û" => "Û",
- "Ü" => "Ü",
- "Ý" => "Ý",
- "Þ" => "Þ",
- "ß" => "ß",
- "à" => "à",
- "á" => "á",
- "â" => "â",
- "ã" => "ã",
- "ä" => "ä",
- "å" => "å",
- "æ" => "æ",
- "ç" => "ç",
- "è" => "è",
- "é" => "é",
- "ê" => "ê",
- "ë" => "ë",
- "ì" => "ì",
- "í" => "í",
- "î" => "î",
- "ï" => "ï",
- "ð" => "ð",
- "ñ" => "ñ",
- "ò" => "ò",
- "ó" => "ó",
- "ô" => "ô",
- "õ" => "õ",
- "ö" => "ö",
- "÷" => "÷",
- "ø" => "ø",
- "ù" => "ù",
- "ú" => "ú",
- "û" => "û",
- "ü" => "ü",
- "ý" => "ý",
- "þ" => "þ",
- "ÿ" => "ÿ",
- "Œ" => "Œ",
- "œ" => "œ",
- "Š" => "Š",
- "š" => "š",
- "Ÿ" => "Ÿ",
- "ƒ" => "ƒ",
- "ˆ" => "ˆ",
- "˜" => "˜",
- "Α" => "Α",
- "Β" => "Β",
- "Γ" => "Γ",
- "Δ" => "Δ",
- "Ε" => "Ε",
- "Ζ" => "Ζ",
- "Η" => "Η",
- "Θ" => "Θ",
- "Ι" => "Ι",
- "Κ" => "Κ",
- "Λ" => "Λ",
- "Μ" => "Μ",
- "Ν" => "Ν",
- "Ξ" => "Ξ",
- "Ο" => "Ο",
- "Π" => "Π",
- "Ρ" => "Ρ",
- "Σ" => "Σ",
- "Τ" => "Τ",
- "Υ" => "Υ",
- "Φ" => "Φ",
- "Χ" => "Χ",
- "Ψ" => "Ψ",
- "Ω" => "Ω",
- "β" => "β",
- "γ" => "γ",
- "δ" => "δ",
- "ε" => "ε",
- "ζ" => "ζ",
- "η" => "η",
- "θ" => "θ",
- "ι" => "ι",
- "κ" => "κ",
- "λ" => "λ",
- "μ" => "μ",
- "ν" => "ν",
- "ξ" => "ξ",
- "ο" => "ο",
- "π" => "π",
- "ρ" => "ρ",
- "ς" => "ς",
- "σ" => "σ",
- "τ" => "τ",
- "υ" => "υ",
- "φ" => "φ",
- "χ" => "χ",
- "ψ" => "ψ",
- "ω" => "ω",
- "ϑ" => "ϑ",
- "ϒ" => "ϒ",
- "ϖ" => "ϖ",
- " " => " ",
- " " => " ",
- " " => " ",
- "‌" => "‌",
- "‍" => "‍",
- "‎" => "‎",
- "‏" => "‏",
- "–" => "–",
- "—" => "—",
- "‘" => "‘",
- "’" => "’",
- "‚" => "‚",
- "“" => "“",
- "”" => "”",
- "„" => "„",
- "†" => "†",
- "‡" => "‡",
- "•" => "•",
- "…" => "…",
- "‰" => "‰",
- "′" => "′",
- "″" => "″",
- "‹" => "‹",
- "›" => "›",
- "‾" => "‾",
- "⁄" => "⁄",
- "€" => "€",
- "℘" => "℘",
- "ℑ" => "ℑ",
- "ℜ" => "ℜ",
- "™" => "™",
- "ℵ" => "ℵ",
- "←" => "←",
- "↑" => "↑",
- "→" => "→",
- "↓" => "↓",
- "↔" => "↔",
- "↵" => "↵",
- "⇐" => "⇐",
- "⇑" => "⇑",
- "⇒" => "⇒",
- "⇓" => "⇓",
- "⇔" => "⇔",
- "∀" => "∀",
- "∂" => "∂",
- "∃" => "∃",
- "∅" => "∅",
- "∇" => "∇",
- "∈" => "∈",
- "∉" => "∉",
- "∋" => "∋",
- "∏" => "∏",
- "∑" => "∑",
- "−" => "−",
- "∗" => "∗",
- "√" => "√",
- "∝" => "∝",
- "∞" => "∞",
- "∠" => "∠",
- "∧" => "∧",
- "∨" => "∨",
- "∩" => "∩",
- "∪" => "∪",
- "∫" => "∫",
- "∴" => "∴",
- "∼" => "∼",
- "≅" => "≅",
- "≈" => "≈",
- "≠" => "≠",
- "≡" => "≡",
- "≤" => "≤",
- "≥" => "≥",
- "⊂" => "⊂",
- "⊃" => "⊃",
- "⊄" => "⊄",
- "⊆" => "⊆",
- "⊇" => "⊇",
- "⊕" => "⊕",
- "⊗" => "⊗",
- "⊥" => "⊥",
- "⋅" => "⋅",
- "⌈" => "⌈",
- "⌉" => "⌉",
- "⌊" => "⌊",
- "⌋" => "⌋",
- "⟨" => "〈",
- "⟩" => "〉",
- "◊" => "◊",
- "♠" => "♠",
- "♣" => "♣",
- "♥" => "♥",
- "♦" => "♦");
- return strtr($data, $entities);
- }
-
- function xmlrpc_encode_entitites($data)
+ case 'ISO-8859-1_':
+ case 'ISO-8859-1_US-ASCII':
+ $escaped_data = str_replace(array('&', '"', "'", '<', '>'), array('&', '"', ''', '<', '>'), $data);
+ $escaped_data = str_replace($GLOBALS['xml_iso88591_Entities']['in'], $GLOBALS['xml_iso88591_Entities']['out'], $escaped_data);
+ break;
+ case 'ISO-8859-1_UTF-8':
+ $escaped_data = str_replace(array('&', '"', "'", '<', '>'), array('&', '"', ''', '<', '>'), $data);
+ $escaped_data = utf8_encode($escaped_data);
+ break;
+ case 'ISO-8859-1_ISO-8859-1':
+ case 'US-ASCII_US-ASCII':
+ case 'US-ASCII_UTF-8':
+ case 'US-ASCII_':
+ case 'US-ASCII_ISO-8859-1':
+ case 'UTF-8_UTF-8':
+ $escaped_data = str_replace(array('&', '"', "'", '<', '>'), array('&', '"', ''', '<', '>'), $data);
+ break;
+ case 'UTF-8_':
+ case 'UTF-8_US-ASCII':
+ case 'UTF-8_ISO-8859-1':
+ // NB: this will choke on invalid UTF-8, going most likely beyond EOF
+ $escaped_data = '';
+ // be kind to users creating string xmlrpcvals out of different php types
+ $data = (string) $data;
+ $ns = strlen ($data);
+ for ($nn = 0; $nn < $ns; $nn++)
{
- $length = strlen($data);
- $escapeddata = "";
- for($position = 0; $position < $length; $position++)
+ $ch = $data[$nn];
+ $ii = ord($ch);
+ //1 7 0bbbbbbb (127)
+ if ($ii < 128)
{
- $character = substr($data, $position, 1);
- $code = Ord($character);
- switch($code) {
+ /// @todo shall we replace this with a (supposedly) faster str_replace?
+ switch($ii){
case 34:
- $character = """;
- break;
+ $escaped_data .= '"';
+ break;
case 38:
- $character = "&";
- break;
+ $escaped_data .= '&';
+ break;
case 39:
- $character = "'";
- break;
+ $escaped_data .= ''';
+ break;
case 60:
- $character = "<";
- break;
+ $escaped_data .= '<';
+ break;
case 62:
- $character = ">";
- break;
+ $escaped_data .= '>';
+ break;
default:
- if ($code < 32 || $code > 159)
- $character = ("&#".strval($code).";");
+ $escaped_data .= $ch;
+ } // switch
+ }
+ //2 11 110bbbbb 10bbbbbb (2047)
+ else if ($ii>>5 == 6)
+ {
+ $b1 = ($ii & 31);
+ $ii = ord($data[$nn+1]);
+ $b2 = ($ii & 63);
+ $ii = ($b1 * 64) + $b2;
+ $ent = sprintf ('&#%d;', $ii);
+ $escaped_data .= $ent;
+ $nn += 1;
+ }
+ //3 16 1110bbbb 10bbbbbb 10bbbbbb
+ else if ($ii>>4 == 14)
+ {
+ $b1 = ($ii & 31);
+ $ii = ord($data[$nn+1]);
+ $b2 = ($ii & 63);
+ $ii = ord($data[$nn+2]);
+ $b3 = ($ii & 63);
+ $ii = ((($b1 * 64) + $b2) * 64) + $b3;
+ $ent = sprintf ('&#%d;', $ii);
+ $escaped_data .= $ent;
+ $nn += 2;
+ }
+ //4 21 11110bbb 10bbbbbb 10bbbbbb 10bbbbbb
+ else if ($ii>>3 == 30)
+ {
+ $b1 = ($ii & 31);
+ $ii = ord($data[$nn+1]);
+ $b2 = ($ii & 63);
+ $ii = ord($data[$nn+2]);
+ $b3 = ($ii & 63);
+ $ii = ord($data[$nn+3]);
+ $b4 = ($ii & 63);
+ $ii = ((((($b1 * 64) + $b2) * 64) + $b3) * 64) + $b4;
+ $ent = sprintf ('&#%d;', $ii);
+ $escaped_data .= $ent;
+ $nn += 3;
+ }
+ }
break;
- }
- $escapeddata .= $character;
+ default:
+ $escaped_data = '';
+ error_log("Converting from $src_encoding to $dest_encoding: not supported...");
}
- return $escapeddata;
+ return $escaped_data;
}
- function xmlrpc_se($parser, $name, $attrs)
+ /// xml parser handler function for opening element tags
+ function xmlrpc_se($parser, $name, $attrs, $accept_single_vals=false)
{
- global $_xh, $xmlrpcDateTime, $xmlrpcString, $xmlrpc_valid_parents;
-
// if invalid xmlrpc already detected, skip all processing
- if ($_xh[$parser]['isf'] < 2)
- {
-
- // check for correct element nesting
- // top level element can only be of 2 types
- if ($_xh[$parser]['sp'] == 0)
+ if ($GLOBALS['_xh']['isf'] < 2)
{
- if ($name != 'METHODRESPONSE' && $name != 'METHODCALL')
+ // check for correct element nesting
+ // top level element can only be of 2 types
+ /// @todo optimization creep: save this check into a bool variable, instead of using count() every time:
+ /// there is only a single top level element in xml anyway
+ if (count($GLOBALS['_xh']['stack']) == 0)
{
- $_xh[$parser]['isf'] = 2;
- $_xh[$parser]['isf_reason'] = 'missing top level xmlrpc element';
- return;
+ if ($name != 'METHODRESPONSE' && $name != 'METHODCALL' && (
+ $name != 'VALUE' && !$accept_single_vals))
+ {
+ $GLOBALS['_xh']['isf'] = 2;
+ $GLOBALS['_xh']['isf_reason'] = 'missing top level xmlrpc element';
+ return;
+ }
+ else
+ {
+ $GLOBALS['_xh']['rt'] = strtolower($name);
+ }
}
- }
- else
- {
- // not top level element: see if parent is OK
- $parent = $_xh[$parser]['stack'][$_xh[$parser]['sp']-1];
- if (!isset($xmlrpc_valid_parents[$name][$parent]))
+ else
{
- $_xh[$parser]['isf'] = 2;
- $_xh[$parser]['isf_reason'] = "xmlrpc element $name cannot be child of $parent";
- return;
- }
- }
-
- switch($name)
- {
- case 'STRUCT':
- case 'ARRAY':
- //$_xh[$parser]['st'].='array(';
- //$_xh[$parser]['cm']++;
- // this last line turns quoting off
- // this means if we get an empty array we'll
- // simply get a bit of whitespace in the eval
- //$_xh[$parser]['qt']=0;
-
- // create an empty array to hold child values, and push it onto appropriate stack
- $cur_val = array();
- $cur_val['values'] = array();
- $cur_val['type'] = $name;
- $_xh[$parser]['valuestack'][$_xh[$parser]['vsp']] = $cur_val;
- $_xh[$parser]['vsp']++;
- break;
- case 'METHODNAME':
- case 'NAME':
- //$_xh[$parser]['st'].='"';
- $_xh[$parser]['ac']='';
- break;
- case 'FAULT':
- $_xh[$parser]['isf']=1;
- break;
- case 'PARAM':
- //$_xh[$parser]['st']='';
- // clear value, so we can check later if no value will passed for this param/member
- $_xh[$parser]['value']='';
- break;
- case 'VALUE':
- //$_xh[$parser]['st'].='new xmlrpcval(';
- // look for a value: if this is still true by the
- // time we reach the end tag for value then the type is string
- // by implication
- $_xh[$parser]['vt']='value';
- $_xh[$parser]['ac']='';
- //$_xh[$parser]['qt']=0;
- $_xh[$parser]['lv']=1;
- break;
- case 'I4':
- case 'INT':
- case 'STRING':
- case 'BOOLEAN':
- case 'DOUBLE':
- case 'DATETIME.ISO8601':
- case 'BASE64':
- if ($_xh[$parser]['vt']!='value')
- {
- //two data elements inside a value: an error occurred!
- $_xh[$parser]['isf'] = 2;
- $_xh[$parser]['isf_reason'] = "$name element following a {$_xh[$parser]['vt']} element inside a single value";
+ // not top level element: see if parent is OK
+ $parent = end($GLOBALS['_xh']['stack']);
+ if (!array_key_exists($name, $GLOBALS['xmlrpc_valid_parents']) || !in_array($parent, $GLOBALS['xmlrpc_valid_parents'][$name]))
+ {
+ $GLOBALS['_xh']['isf'] = 2;
+ $GLOBALS['_xh']['isf_reason'] = "xmlrpc element $name cannot be child of $parent";
return;
}
+ }
- // reset the accumulator
- $_xh[$parser]['ac']='';
-
- /*if ($name=='DATETIME.ISO8601' || $name=='STRING')
- {
- $_xh[$parser]['qt']=1;
- if ($name=='DATETIME.ISO8601')
+ switch($name)
+ {
+ // optimize for speed switch cases: most common cases first
+ case 'VALUE':
+ /// @todo we could check for 2 VALUE elements inside a MEMBER or PARAM element
+ $GLOBALS['_xh']['vt']='value'; // indicator: no value found yet
+ $GLOBALS['_xh']['ac']='';
+ $GLOBALS['_xh']['lv']=1;
+ $GLOBALS['_xh']['php_class']=null;
+ break;
+ case 'I4':
+ case 'INT':
+ case 'STRING':
+ case 'BOOLEAN':
+ case 'DOUBLE':
+ case 'DATETIME.ISO8601':
+ case 'BASE64':
+ if ($GLOBALS['_xh']['vt']!='value')
{
- $_xh[$parser]['vt']=$xmlrpcDateTime;
+ //two data elements inside a value: an error occurred!
+ $GLOBALS['_xh']['isf'] = 2;
+ $GLOBALS['_xh']['isf_reason'] = "$name element following a {$GLOBALS['_xh']['vt']} element inside a single value";
+ return;
}
- }
- elseif ($name=='BASE64')
- {
- $_xh[$parser]['qt']=2;
- }
- else
- {
- // No quoting is required here -- but
- // at the end of the element we must check
- // for data format errors.
- $_xh[$parser]['qt']=0;
- }*/
- break;
- case 'MEMBER':
- //$_xh[$parser]['ac']='';
- // avoid warnings later on if no NAME is found before VALUE inside
- // a struct member predefining member name as NULL
- $_xh[$parser]['valuestack'][$_xh[$parser]['vsp']-1]['name'] = '';
- // clear value, so we can check later if no value will passed for this param/member
- $_xh[$parser]['value']='';
- break;
- case 'DATA':
- case 'METHODCALL':
- case 'METHODRESPONSE':
- case 'PARAMS':
- // valid elements that add little to processing
- break;
- default:
- /// INVALID ELEMENT: RAISE ISF so that it is later recognized!!!
- $_xh[$parser]['isf'] = 2;
- $_xh[$parser]['isf_reason'] = "found not-xmlrpc xml element $name";
- break;
- }
+ $GLOBALS['_xh']['ac']=''; // reset the accumulator
+ break;
+ case 'STRUCT':
+ case 'ARRAY':
+ if ($GLOBALS['_xh']['vt']!='value')
+ {
+ //two data elements inside a value: an error occurred!
+ $GLOBALS['_xh']['isf'] = 2;
+ $GLOBALS['_xh']['isf_reason'] = "$name element following a {$GLOBALS['_xh']['vt']} element inside a single value";
+ return;
+ }
+ // create an empty array to hold child values, and push it onto appropriate stack
+ $cur_val = array();
+ $cur_val['values'] = array();
+ $cur_val['type'] = $name;
+ // check for out-of-band information to rebuild php objs
+ // and in case it is found, save it
+ if (@isset($attrs['PHP_CLASS']))
+ {
+ $cur_val['php_class'] = $attrs['PHP_CLASS'];
+ }
+ $GLOBALS['_xh']['valuestack'][] = $cur_val;
+ $GLOBALS['_xh']['vt']='data'; // be prepared for a data element next
+ break;
+ case 'DATA':
+ if ($GLOBALS['_xh']['vt']!='data')
+ {
+ //two data elements inside a value: an error occurred!
+ $GLOBALS['_xh']['isf'] = 2;
+ $GLOBALS['_xh']['isf_reason'] = "found two data elements inside an array element";
+ return;
+ }
+ case 'METHODCALL':
+ case 'METHODRESPONSE':
+ case 'PARAMS':
+ // valid elements that add little to processing
+ break;
+ case 'METHODNAME':
+ case 'NAME':
+ /// @todo we could check for 2 NAME elements inside a MEMBER element
+ $GLOBALS['_xh']['ac']='';
+ break;
+ case 'FAULT':
+ $GLOBALS['_xh']['isf']=1;
+ break;
+ case 'MEMBER':
+ $GLOBALS['_xh']['valuestack'][count($GLOBALS['_xh']['valuestack'])-1]['name']=''; // set member name to null, in case we do not find in the xml later on
+ //$GLOBALS['_xh']['ac']='';
+ // Drop trough intentionally
+ case 'PARAM':
+ // clear value type, so we can check later if no value has been passed for this param/member
+ $GLOBALS['_xh']['vt']=null;
+ break;
+ case 'NIL':
+ if ($GLOBALS['xmlrpc_null_extension'])
+ {
+ if ($GLOBALS['_xh']['vt']!='value')
+ {
+ //two data elements inside a value: an error occurred!
+ $GLOBALS['_xh']['isf'] = 2;
+ $GLOBALS['_xh']['isf_reason'] = "$name element following a {$GLOBALS['_xh']['vt']} element inside a single value";
+ return;
+ }
+ $GLOBALS['_xh']['ac']=''; // reset the accumulator
+ break;
+ }
+ // we do not support the <NIL/> extension, so
+ // drop through intentionally
+ default:
+ /// INVALID ELEMENT: RAISE ISF so that it is later recognized!!!
+ $GLOBALS['_xh']['isf'] = 2;
+ $GLOBALS['_xh']['isf_reason'] = "found not-xmlrpc xml element $name";
+ break;
+ }
- // Save current element name to stack, to validate nesting
- $_xh[$parser]['stack'][$_xh[$parser]['sp']] = $name;
- $_xh[$parser]['sp']++;
+ // Save current element name to stack, to validate nesting
+ $GLOBALS['_xh']['stack'][] = $name;
- if ($name!='VALUE')
- {
- $_xh[$parser]['lv']=0;
+ /// @todo optimization creep: move this inside the big switch() above
+ if($name!='VALUE')
+ {
+ $GLOBALS['_xh']['lv']=0;
+ }
}
}
- }
- function xmlrpc_ee($parser, $name)
+ /// Used in decoding xml chunks that might represent single xmlrpc values
+ function xmlrpc_se_any($parser, $name, $attrs)
{
- global $_xh,$xmlrpcTypes,$xmlrpcString,$xmlrpcDateTime;
-
- if ($_xh[$parser]['isf'] < 2)
- {
+ xmlrpc_se($parser, $name, $attrs, true);
+ }
- // push this element name from stack
- // NB: if XML validates, correct opening/closing is guaranteed and
- // we do not have to check for $name == $curr_elem.
- // we also checked for proper nesting at start of elements...
- $_xh[$parser]['sp']--;
- $curr_elem = $_xh[$parser]['stack'][$_xh[$parser]['sp']];
- unset($_xh[$parser]['stack'][$_xh[$parser]['sp']]);
- switch($name)
+ /// xml parser handler function for close element tags
+ function xmlrpc_ee($parser, $name, $rebuild_xmlrpcvals = true)
+ {
+ if ($GLOBALS['_xh']['isf'] < 2)
{
- case 'STRUCT':
- case 'ARRAY':
- //if ($_xh[$parser]['cm'] && substr($_xh[$parser]['st'], -1) ==',')
- //{
- // $_xh[$parser]['st']=substr($_xh[$parser]['st'],0,-1);
- //}
- //$_xh[$parser]['st'].=')';
+ // push this element name from stack
+ // NB: if XML validates, correct opening/closing is guaranteed and
+ // we do not have to check for $name == $curr_elem.
+ // we also checked for proper nesting at start of elements...
+ $curr_elem = array_pop($GLOBALS['_xh']['stack']);
- // fetch out of stack array of values, and promote it to current value
- $_xh[$parser]['vsp']--;
- $cur_val = $_xh[$parser]['valuestack'][$_xh[$parser]['vsp']];
- unset($_xh[$parser]['valuestack'][$_xh[$parser]['vsp']]);
- $_xh[$parser]['value'] = $cur_val['values'];
-
- $_xh[$parser]['vt']=strtolower($name);
- //$_xh[$parser]['cm']--;
- break;
- case 'NAME':
- //$_xh[$parser]['st'].= $_xh[$parser]['ac'] . '" => ';
- $_xh[$parser]['valuestack'][$_xh[$parser]['vsp']-1]['name'] = $_xh[$parser]['ac'];
- break;
- case 'BOOLEAN':
- case 'I4':
- case 'INT':
- case 'STRING':
- case 'DOUBLE':
- case 'DATETIME.ISO8601':
- case 'BASE64':
- $_xh[$parser]['vt']=strtolower($name);
- //if ($_xh[$parser]['qt']==1)
- if ($name=='STRING')
- {
- // we use double quotes rather than single so backslashification works OK
- //$_xh[$parser]['st'].='"'. $_xh[$parser]['ac'] . '"';
- $_xh[$parser]['value']=$_xh[$parser]['ac'];
- }
- elseif ($name=='DATETIME.ISO8601')
- {
- $_xh[$parser]['vt']=$xmlrpcDateTime;
- $_xh[$parser]['value']=$_xh[$parser]['ac'];
- }
- elseif ($name=='BASE64')
- {
- //$_xh[$parser]['st'].='base64_decode("'. $_xh[$parser]['ac'] . '")';
-
- ///@todo check for failure of base64 decoding / catch warnings
- $_xh[$parser]['value']=base64_decode($_xh[$parser]['ac']);
- }
- elseif ($name=='BOOLEAN')
- {
- // special case here: we translate boolean 1 or 0 into PHP
- // constants true or false
- // NB: this simple checks helps a lot sanitizing input, ie no
- // security problems around here
+ switch($name)
+ {
+ case 'VALUE':
+ // This if() detects if no scalar was inside <VALUE></VALUE>
+ if ($GLOBALS['_xh']['vt']=='value')
+ {
+ $GLOBALS['_xh']['value']=$GLOBALS['_xh']['ac'];
+ $GLOBALS['_xh']['vt']=$GLOBALS['xmlrpcString'];
+ }
- // [MOD] S. Verberkt (Legolas) (13/02/2006 21:16): Also accept 'true' and 'false'
- if ($_xh[$parser]['ac']=='1' || strcasecmp($_xh[$parser]['ac'], 'true') == 0)
+ if ($rebuild_xmlrpcvals)
{
- //$_xh[$parser]['ac']='true';
- $_xh[$parser]['value']=true;
+ // build the xmlrpc val out of the data received, and substitute it
+ $temp =& new xmlrpcval($GLOBALS['_xh']['value'], $GLOBALS['_xh']['vt']);
+ // in case we got info about underlying php class, save it
+ // in the object we're rebuilding
+ if (isset($GLOBALS['_xh']['php_class']))
+ $temp->_php_class = $GLOBALS['_xh']['php_class'];
+ // check if we are inside an array or struct:
+ // if value just built is inside an array, let's move it into array on the stack
+ $vscount = count($GLOBALS['_xh']['valuestack']);
+ if ($vscount && $GLOBALS['_xh']['valuestack'][$vscount-1]['type']=='ARRAY')
+ {
+ $GLOBALS['_xh']['valuestack'][$vscount-1]['values'][] = $temp;
+ }
+ else
+ {
+ $GLOBALS['_xh']['value'] = $temp;
+ }
}
else
{
- //$_xh[$parser]['ac']='false';
- // log if receiveing something strange, even though we set the value to false anyway
- if ($_xh[$parser]['ac']!='0' && strcasecmp($_xh[$parser]['ac'], 'false') != 0)
- error_log('XML-RPC: invalid value received in BOOLEAN: '.$_xh[$parser]['ac']);
- $_xh[$parser]['value']=false;
- }
- // [/MOD]
+ /// @todo this needs to treat correctly php-serialized objects,
+ /// since std deserializing is done by php_xmlrpc_decode,
+ /// which we will not be calling...
+ if (isset($GLOBALS['_xh']['php_class']))
+ {
+ }
- //$_xh[$parser]['st'].=$_xh[$parser]['ac'];
- }
- elseif ($name=='DOUBLE')
- {
- // we have a DOUBLE
- // we must check that only 0123456789-.<space> are characters here
- if (!ereg("^[+-]?[eE0123456789 \\t\\.]+$", $_xh[$parser]['ac']))
+ // check if we are inside an array or struct:
+ // if value just built is inside an array, let's move it into array on the stack
+ $vscount = count($GLOBALS['_xh']['valuestack']);
+ if ($vscount && $GLOBALS['_xh']['valuestack'][$vscount-1]['type']=='ARRAY')
+ {
+ $GLOBALS['_xh']['valuestack'][$vscount-1]['values'][] = $GLOBALS['_xh']['value'];
+ }
+ }
+ break;
+ case 'BOOLEAN':
+ case 'I4':
+ case 'INT':
+ case 'STRING':
+ case 'DOUBLE':
+ case 'DATETIME.ISO8601':
+ case 'BASE64':
+ $GLOBALS['_xh']['vt']=strtolower($name);
+ /// @todo: optimization creep - remove the if/elseif cycle below
+ /// since the case() in which we are already did that
+ if ($name=='STRING')
+ {
+ $GLOBALS['_xh']['value']=$GLOBALS['_xh']['ac'];
+ }
+ elseif ($name=='DATETIME.ISO8601')
+ {
+ if (!preg_match('/^[0-9]{8}T[0-9]{2}:[0-9]{2}:[0-9]{2}$/', $GLOBALS['_xh']['ac']))
+ {
+ error_log('XML-RPC: invalid value received in DATETIME: '.$GLOBALS['_xh']['ac']);
+ }
+ $GLOBALS['_xh']['vt']=$GLOBALS['xmlrpcDateTime'];
+ $GLOBALS['_xh']['value']=$GLOBALS['_xh']['ac'];
+ }
+ elseif ($name=='BASE64')
+ {
+ /// @todo check for failure of base64 decoding / catch warnings
+ $GLOBALS['_xh']['value']=base64_decode($GLOBALS['_xh']['ac']);
+ }
+ elseif ($name=='BOOLEAN')
+ {
+ // special case here: we translate boolean 1 or 0 into PHP
+ // constants true or false.
+ // Strings 'true' and 'false' are accepted, even though the
+ // spec never mentions them (see eg. Blogger api docs)
+ // NB: this simple checks helps a lot sanitizing input, ie no
+ // security problems around here
+ if ($GLOBALS['_xh']['ac']=='1' || strcasecmp($GLOBALS['_xh']['ac'], 'true') == 0)
+ {
+ $GLOBALS['_xh']['value']=true;
+ }
+ else
+ {
+ // log if receiveing something strange, even though we set the value to false anyway
+ if ($GLOBALS['_xh']['ac']!='0' && strcasecmp($_xh[$parser]['ac'], 'false') != 0)
+ error_log('XML-RPC: invalid value received in BOOLEAN: '.$GLOBALS['_xh']['ac']);
+ $GLOBALS['_xh']['value']=false;
+ }
+ }
+ elseif ($name=='DOUBLE')
{
- // TODO: find a better way of throwing an error
- // than this!
- error_log('XML-RPC: non numeric value received in DOUBLE: '.$_xh[$parser]['ac']);
- //$_xh[$parser]['st'].="'ERROR_NON_NUMERIC_FOUND'";
- $_xh[$parser]['value']='ERROR_NON_NUMERIC_FOUND';
+ // we have a DOUBLE
+ // we must check that only 0123456789-.<space> are characters here
+ if (!preg_match('/^[+-]?[eE0123456789 \t.]+$/', $GLOBALS['_xh']['ac']))
+ {
+ /// @todo: find a better way of throwing an error
+ // than this!
+ error_log('XML-RPC: non numeric value received in DOUBLE: '.$GLOBALS['_xh']['ac']);
+ $GLOBALS['_xh']['value']='ERROR_NON_NUMERIC_FOUND';
+ }
+ else
+ {
+ // it's ok, add it on
+ $GLOBALS['_xh']['value']=(double)$GLOBALS['_xh']['ac'];
+ }
}
else
{
- // it's ok, add it on
- //$_xh[$parser]['st'].=(double)$_xh[$parser]['ac'];
- $_xh[$parser]['value']=(double)$_xh[$parser]['ac'];
+ // we have an I4/INT
+ // we must check that only 0123456789-<space> are characters here
+ if (!preg_match('/^[+-]?[0123456789 \t]+$/', $GLOBALS['_xh']['ac']))
+ {
+ /// @todo find a better way of throwing an error
+ // than this!
+ error_log('XML-RPC: non numeric value received in INT: '.$GLOBALS['_xh']['ac']);
+ $GLOBALS['_xh']['value']='ERROR_NON_NUMERIC_FOUND';
+ }
+ else
+ {
+ // it's ok, add it on
+ $GLOBALS['_xh']['value']=(int)$GLOBALS['_xh']['ac'];
+ }
}
- }
- else
- {
- // we have an I4/INT
- // we must check that only 0123456789-<space> are characters here
- if (!ereg("^[+-]?[0123456789 \\t]+$", $_xh[$parser]['ac']))
+ //$GLOBALS['_xh']['ac']=''; // is this necessary?
+ $GLOBALS['_xh']['lv']=3; // indicate we've found a value
+ break;
+ case 'NAME':
+ $GLOBALS['_xh']['valuestack'][count($GLOBALS['_xh']['valuestack'])-1]['name'] = $GLOBALS['_xh']['ac'];
+ break;
+ case 'MEMBER':
+ //$GLOBALS['_xh']['ac']=''; // is this necessary?
+ // add to array in the stack the last element built,
+ // unless no VALUE was found
+ if ($GLOBALS['_xh']['vt'])
+ {
+ $vscount = count($GLOBALS['_xh']['valuestack']);
+ $GLOBALS['_xh']['valuestack'][$vscount-1]['values'][$GLOBALS['_xh']['valuestack'][$vscount-1]['name']] = $GLOBALS['_xh']['value'];
+ } else
+ error_log('XML-RPC: missing VALUE inside STRUCT in received xml');
+ break;
+ case 'DATA':
+ //$GLOBALS['_xh']['ac']=''; // is this necessary?
+ $GLOBALS['_xh']['vt']=null; // reset this to check for 2 data elements in a row - even if they're empty
+ break;
+ case 'STRUCT':
+ case 'ARRAY':
+ // fetch out of stack array of values, and promote it to current value
+ $curr_val = array_pop($GLOBALS['_xh']['valuestack']);
+ $GLOBALS['_xh']['value'] = $curr_val['values'];
+ $GLOBALS['_xh']['vt']=strtolower($name);
+ if (isset($curr_val['php_class']))
{
- // TODO: find a better way of throwing an error
- // than this!
- error_log('XML-RPC: non numeric value received in INT: '.$_xh[$parser]['ac']);
- //$_xh[$parser]['st'].="'ERROR_NON_NUMERIC_FOUND'";
- $_xh[$parser]['value']='ERROR_NON_NUMERIC_FOUND';
+ $GLOBALS['_xh']['php_class'] = $curr_val['php_class'];
+ }
+ break;
+ case 'PARAM':
+ // add to array of params the current value,
+ // unless no VALUE was found
+ if ($GLOBALS['_xh']['vt'])
+ {
+ $GLOBALS['_xh']['params'][]=$GLOBALS['_xh']['value'];
+ $GLOBALS['_xh']['pt'][]=$GLOBALS['_xh']['vt'];
}
else
+ error_log('XML-RPC: missing VALUE inside PARAM in received xml');
+ break;
+ case 'METHODNAME':
+ $GLOBALS['_xh']['method']=preg_replace('/^[\n\r\t ]+/', '', $GLOBALS['_xh']['ac']);
+ break;
+ case 'NIL':
+ if ($GLOBALS['xmlrpc_null_extension'])
{
- // it's ok, add it on
- //$_xh[$parser]['st'].=(int)$_xh[$parser]['ac'];
- $_xh[$parser]['value']=(int)$_xh[$parser]['ac'];
+ $GLOBALS['_xh']['vt']='null';
+ $GLOBALS['_xh']['value']=null;
+ $GLOBALS['_xh']['lv']=3;
+ break;
}
- }
- $_xh[$parser]['ac']='';
- //$_xh[$parser]['qt']=0;
- $_xh[$parser]['lv']=3; // indicate we've found a value
- break;
- case 'VALUE':
- // This if() detects if no scalar was inside <VALUE></VALUE>
- if ($_xh[$parser]['vt']=='value')
- {
- $_xh[$parser]['value']=$_xh[$parser]['ac'];
- $_xh[$parser]['vt']=$xmlrpcString;
- }
- /*if (strlen($_xh[$parser]['ac'])>0 &&
- $_xh[$parser]['vt']==$xmlrpcString)
- {
- $_xh[$parser]['st'].='"'. $_xh[$parser]['ac'] . '"';
- }
- // This if() detects if no scalar was inside <VALUE></VALUE>
- // and pads an empty ''.
- if($_xh[$parser]['st'][strlen($_xh[$parser]['st'])-1] == '(')
- {
- $_xh[$parser]['st'].= '""';
- }
- // G. Giunta 2005/03/12 save some chars in the reconstruction of string vals...
- if ($_xh[$parser]['vt'] != $xmlrpcString)
- $_xh[$parser]['st'].=", '" . $_xh[$parser]['vt'] . "')";
- else
- $_xh[$parser]['st'].=")";
- if ($_xh[$parser]['cm'])
- {
- $_xh[$parser]['st'].=',';
- }*/
-
- // build the xmlrpc val out of the data received, and substitute it
- $temp = new xmlrpcval($_xh[$parser]['value'], $_xh[$parser]['vt']);
- // check if we are inside an array or struct:
- // if value just built is inside an array, let's move it into array on the stack
- if ($_xh[$parser]['vsp'] && $_xh[$parser]['valuestack'][$_xh[$parser]['vsp']-1]['type']=='ARRAY')
- {
- $_xh[$parser]['valuestack'][$_xh[$parser]['vsp']-1]['values'][] = $temp;
- }
- else
- {
- $_xh[$parser]['value'] = $temp;
- }
- break;
- case 'MEMBER':
- $_xh[$parser]['ac']='';
- //$_xh[$parser]['qt']=0;
- // add to array in the stack the last element built
- // unless no VALUE was found
- if ($_xh[$parser]['value'])
- {
- $_xh[$parser]['valuestack'][$_xh[$parser]['vsp']-1]['values'][$_xh[$parser]['valuestack'][$_xh[$parser]['vsp']-1]['name']] = $_xh[$parser]['value'];
- }
- else
- error_log('XML-RPC: missing VALUE inside STRUCT in received xml');
- break;
- case 'DATA':
- $_xh[$parser]['ac']='';
- //$_xh[$parser]['qt']=0;
- break;
- case 'PARAM':
- //$_xh[$parser]['params'][]=$_xh[$parser]['st'];
- if ($_xh[$parser]['value'])
- $_xh[$parser]['params'][]=$_xh[$parser]['value'];
- else
- error_log('XML-RPC: missing VALUE inside PARAM in received xml');
- break;
- case 'METHODNAME':
- $_xh[$parser]['method']=ereg_replace("^[\n\r\t ]+", '', $_xh[$parser]['ac']);
- break;
- case 'PARAMS':
- case 'FAULT':
- case 'METHODCALL':
- case 'METHORESPONSE':
- break;
- default:
- // End of INVALID ELEMENT!
- // shall we add an assert here for unreachable code???
- break;
+ // drop through intentionally if nil extension not enabled
+ case 'PARAMS':
+ case 'FAULT':
+ case 'METHODCALL':
+ case 'METHORESPONSE':
+ break;
+ default:
+ // End of INVALID ELEMENT!
+ // shall we add an assert here for unreachable code???
+ break;
+ }
}
- // if it's a valid type name, set the type
- /*if (isset($xmlrpcTypes[strtolower($name)]))
- {
- $_xh[$parser]['vt']=strtolower($name);
- }*/
+ }
- }
+ /// Used in decoding xmlrpc requests/responses without rebuilding xmlrpc values
+ function xmlrpc_ee_fast($parser, $name)
+ {
+ xmlrpc_ee($parser, $name, false);
}
+ /// xml parser handler function for character data
function xmlrpc_cd($parser, $data)
{
- global $_xh, $xmlrpc_backslash;
-
- //if (ereg("^[\n\r \t]+$", $data)) return;
- // print "adding [${data}]\n";
-
// skip processing if xml fault already detected
- if ($_xh[$parser]['isf'] < 2)
- {
- if ($_xh[$parser]['lv']!=3)
+ if ($GLOBALS['_xh']['isf'] < 2)
{
// "lookforvalue==3" means that we've found an entire value
// and should discard any further character data
- if ($_xh[$parser]['lv']==1)
- {
- // if we've found text and we're just in a <value> then
- // turn quoting on, as this will be a string
- //$_xh[$parser]['qt']=1;
- // and say we've found a value
- $_xh[$parser]['lv']=2;
- }
- if(!@isset($_xh[$parser]['ac']))
+ if($GLOBALS['_xh']['lv']!=3)
{
- $_xh[$parser]['ac'] = '';
- }
- //$_xh[$parser]['ac'].=str_replace('$', '\$', str_replace('"', '\"', str_replace(chr(92),$xmlrpc_backslash, $data)));
- $_xh[$parser]['ac'].=$data;
+ // G. Giunta 2006-08-23: useless change of 'lv' from 1 to 2
+ //if($GLOBALS['_xh']['lv']==1)
+ //{
+ // if we've found text and we're just in a <value> then
+ // say we've found a value
+ //$GLOBALS['_xh']['lv']=2;
+ //}
+ // we always initialize the accumulator before starting parsing, anyway...
+ //if(!@isset($GLOBALS['_xh']['ac']))
+ //{
+ // $GLOBALS['_xh']['ac'] = '';
+ //}
+ $GLOBALS['_xh']['ac'].=$data;
}
}
}
+ /// xml parser handler function for 'other stuff', ie. not char data or
+ /// element start/end tag. In fact it only gets called on unknown entities...
function xmlrpc_dh($parser, $data)
{
- global $_xh, $xmlrpc_backslash;
-
// skip processing if xml fault already detected
- if ($_xh[$parser]['isf'] < 2)
- {
- if (substr($data, 0, 1) == '&' && substr($data, -1, 1) == ';')
+ if ($GLOBALS['_xh']['isf'] < 2)
{
- if ($_xh[$parser]['lv']==1)
+ if(substr($data, 0, 1) == '&' && substr($data, -1, 1) == ';')
{
- //$_xh[$parser]['qt']=1;
- $_xh[$parser]['lv']=2;
- }
- //$_xh[$parser]['ac'].=str_replace('$', '\$', str_replace('"', '\"', str_replace(chr(92),$xmlrpc_backslash, $data)));
- $_xh[$parser]['ac'].=$data;
+ // G. Giunta 2006-08-25: useless change of 'lv' from 1 to 2
+ //if($GLOBALS['_xh']['lv']==1)
+ //{
+ // $GLOBALS['_xh']['lv']=2;
+ //}
+ $GLOBALS['_xh']['ac'].=$data;
}
}
+ return true;
}
class xmlrpc_client
{
var $path;
var $server;
- var $port;
+ var $port=0;
+ var $method='http';
var $errno;
var $errstr;
var $debug=0;
var $username='';
var $password='';
+ var $authtype=1;
var $cert='';
var $certpass='';
- var $verifypeer=1;
+ var $cacert='';
+ var $cacertdir='';
+ var $key='';
+ var $keypass='';
+ var $verifypeer=true;
var $verifyhost=1;
var $no_multicall=false;
-
- function xmlrpc_client($path, $server, $port=0)
- {
- $this->port=$port; $this->server=$server; $this->path=$path;
- }
-
- function setDebug($in)
- {
- if ($in)
+ var $proxy='';
+ var $proxyport=0;
+ var $proxy_user='';
+ var $proxy_pass='';
+ var $proxy_authtype=1;
+ var $cookies=array();
+ /**
+ * List of http compression methods accepted by the client for responses.
+ * NB: PHP supports deflate, gzip compressions out of the box if compiled w. zlib
+ *
+ * NNB: you can set it to any non-empty array for HTTP11 and HTTPS, since
+ * in those cases it will be up to CURL to decide the compression methods
+ * it supports. You might check for the presence of 'zlib' in the output of
+ * curl_version() to determine wheter compression is supported or not
+ */
+ var $accepted_compression = array();
+ /**
+ * Name of compression scheme to be used for sending requests.
+ * Either null, gzip or deflate
+ */
+ var $request_compression = '';
+ /**
+ * CURL handle: used for keep-alive connections (PHP 4.3.8 up, see:
+ * http://curl.haxx.se/docs/faq.html#7.3)
+ */
+ var $xmlrpc_curl_handle = null;
+ /// Wheter to use persistent connections for http 1.1 and https
+ var $keepalive = false;
+ /// Charset encodings that can be decoded without problems by the client
+ var $accepted_charset_encodings = array();
+ /// Charset encoding to be used in serializing request. NULL = use ASCII
+ var $request_charset_encoding = '';
+ /**
+ * Decides the content of xmlrpcresp objects returned by calls to send()
+ * valid strings are 'xmlrpcvals', 'phpvals' or 'xml'
+ */
+ var $return_type = 'xmlrpcvals';
+
+ /**
+ * @param string $path either the complete server URL or the PATH part of the xmlrc server URL, e.g. /xmlrpc/server.php
+ * @param string $server the server name / ip address
+ * @param integer $port the port the server is listening on, defaults to 80 or 443 depending on protocol used
+ * @param string $method the http protocol variant: defaults to 'http', 'https' and 'http11' can be used if CURL is installed
+ */
+ function xmlrpc_client($path, $server='', $port='', $method='')
+ {
+ // allow user to specify all params in $path
+ if($server == '' and $port == '' and $method == '')
+ {
+ $parts = parse_url($path);
+ $server = $parts['host'];
+ $path = $parts['path'];
+ if(isset($parts['query']))
+ {
+ $path .= '?'.$parts['query'];
+ }
+ if(isset($parts['fragment']))
+ {
+ $path .= '#'.$parts['fragment'];
+ }
+ if(isset($parts['port']))
+ {
+ $port = $parts['port'];
+ }
+ if(isset($parts['scheme']))
+ {
+ $method = $parts['scheme'];
+ }
+ if(isset($parts['user']))
+ {
+ $this->username = $parts['user'];
+ }
+ if(isset($parts['pass']))
+ {
+ $this->password = $parts['pass'];
+ }
+ }
+ if($path == '' || $path[0] != '/')
{
- $this->debug=1;
+ $this->path='/'.$path;
}
else
{
- $this->debug=0;
+ $this->path=$path;
+ }
+ $this->server=$server;
+ if($port != '')
+ {
+ $this->port=$port;
}
+ if($method != '')
+ {
+ $this->method=$method;
+ }
+
+ // if ZLIB is enabled, let the client by default accept compressed responses
+ if(function_exists('gzinflate') || (
+ function_exists('curl_init') && (($info = curl_version()) &&
+ ((is_string($info) && strpos($info, 'zlib') !== null) || isset($info['libz_version'])))
+ ))
+ {
+ $this->accepted_compression = array('gzip', 'deflate');
+ }
+
+ // keepalives: enabled by default ONLY for PHP >= 4.3.8
+ // (see http://curl.haxx.se/docs/faq.html#7.3)
+ if(version_compare(phpversion(), '4.3.8') >= 0)
+ {
+ $this->keepalive = true;
+ }
+
+ // by default the xml parser can support these 3 charset encodings
+ $this->accepted_charset_encodings = array('UTF-8', 'ISO-8859-1', 'US-ASCII');
}
- function setCredentials($u, $p)
+ /**
+ * Enables/disables the echoing to screen of the xmlrpc responses received
+ * @param integer $debug values 0, 1 and 2 are supported (2 = echo sent msg too, before received response)
+ * @access public
+ */
+ function setDebug($in)
+ {
+ $this->debug=$in;
+ }
+
+ /**
+ * Add some http BASIC AUTH credentials, used by the client to authenticate
+ * @param string $u username
+ * @param string $p password
+ * @param integer $t auth type. See curl_setopt man page for supported auth types. Defaults to CURLAUTH_BASIC (basic auth)
+ * @access public
+ */
+ function setCredentials($u, $p, $t=1)
{
$this->username=$u;
$this->password=$p;
+ $this->authtype=$t;
}
+ /**
+ * Add a client-side https certificate
+ * @param string $cert
+ * @param string $certpass
+ * @access public
+ */
function setCertificate($cert, $certpass)
{
$this->cert = $cert;
$this->certpass = $certpass;
}
+ /**
+ * Add a CA certificate to verify server with (see man page about
+ * CURLOPT_CAINFO for more details
+ * @param string $cacert certificate file name (or dir holding certificates)
+ * @param bool $is_dir set to true to indicate cacert is a dir. defaults to false
+ * @access public
+ */
+ function setCaCertificate($cacert, $is_dir=false)
+ {
+ if ($is_dir)
+ {
+ $this->cacert = $cacert;
+ }
+ else
+ {
+ $this->cacertdir = $cacert;
+ }
+ }
+
+ /**
+ * Set attributes for SSL communication: private SSL key
+ * @param string $key The name of a file containing a private SSL key
+ * @param string $keypass The secret password needed to use the private SSL key
+ * @access public
+ * NB: does not work in older php/curl installs
+ * Thanks to Daniel Convissor
+ */
+ function setKey($key, $keypass)
+ {
+ $this->key = $key;
+ $this->keypass = $keypass;
+ }
+
+ /**
+ * Set attributes for SSL communication: verify server certificate
+ * @param bool $i enable/disable verification of peer certificate
+ * @access public
+ */
function setSSLVerifyPeer($i)
{
$this->verifypeer = $i;
}
+ /**
+ * Set attributes for SSL communication: verify match of server cert w. hostname
+ * @param int $i
+ * @access public
+ */
function setSSLVerifyHost($i)
{
$this->verifyhost = $i;
}
- function send($msg, $timeout=0, $method='http')
+ /**
+ * Set proxy info
+ * @param string $proxyhost
+ * @param string $proxyport Defaults to 8080 for HTTP and 443 for HTTPS
+ * @param string $proxyusername Leave blank if proxy has public access
+ * @param string $proxypassword Leave blank if proxy has public access
+ * @param int $proxyauthtype set to constant CURLAUTH_NTLM to use NTLM auth with proxy
+ * @access public
+ */
+ function setProxy($proxyhost, $proxyport, $proxyusername = '', $proxypassword = '', $proxyauthtype = 1)
+ {
+ $this->proxy = $proxyhost;
+ $this->proxyport = $proxyport;
+ $this->proxy_user = $proxyusername;
+ $this->proxy_pass = $proxypassword;
+ $this->proxy_authtype = $proxyauthtype;
+ }
+
+ /**
+ * Enables/disables reception of compressed xmlrpc responses.
+ * Note that enabling reception of compressed responses merely adds some standard
+ * http headers to xmlrpc requests. It is up to the xmlrpc server to return
+ * compressed responses when receiving such requests.
+ * @param string $compmethod either 'gzip', 'deflate', 'any' or ''
+ * @access public
+ */
+ function setAcceptedCompression($compmethod)
+ {
+ if ($compmethod == 'any')
+ $this->accepted_compression = array('gzip', 'deflate');
+ else
+ $this->accepted_compression = array($compmethod);
+ }
+
+ /**
+ * Enables/disables http compression of xmlrpc request.
+ * Take care when sending compressed requests: servers might not support them
+ * (and automatic fallback to uncompressed requests is not yet implemented)
+ * @param string $compmethod either 'gzip', 'deflate' or ''
+ * @access public
+ */
+ function setRequestCompression($compmethod)
+ {
+ $this->request_compression = $compmethod;
+ }
+
+ /**
+ * Adds a cookie to list of cookies that will be sent to server.
+ * NB: setting any param but name and value will turn the cookie into a 'version 1' cookie:
+ * do not do it unless you know what you are doing
+ * @param string $name
+ * @param string $value
+ * @param string $path
+ * @param string $domain
+ * @param int $port
+ * @access public
+ *
+ * @todo check correctness of urlencoding cookie value (copied from php way of doing it...)
+ */
+ function setCookie($name, $value='', $path='', $domain='', $port=null)
+ {
+ $this->cookies[$name]['value'] = urlencode($value);
+ if ($path || $domain || $port)
+ {
+ $this->cookies[$name]['path'] = $path;
+ $this->cookies[$name]['domain'] = $domain;
+ $this->cookies[$name]['port'] = $port;
+ $this->cookies[$name]['version'] = 1;
+ }
+ else
+ {
+ $this->cookies[$name]['version'] = 0;
+ }
+ }
+
+ /**
+ * Send an xmlrpc request
+ * @param mixed $msg The message object, or an array of messages for using multicall, or the complete xml representation of a request
+ * @param integer $timeout Connection timeout, in seconds, If unspecified, a platform specific timeout will apply
+ * @param string $method if left unspecified, the http protocol chosen during creation of the object will be used
+ * @return xmlrpcresp
+ * @access public
+ */
+ function& send($msg, $timeout=0, $method='')
{
- if (is_array($msg))
+ // if user deos not specify http protocol, use native method of this client
+ // (i.e. method set during call to constructor)
+ if($method == '')
+ {
+ $method = $this->method;
+ }
+
+ if(is_array($msg))
{
// $msg is an array of xmlrpcmsg's
- return $this->multicall($msg, $timeout, $method);
+ $r = $this->multicall($msg, $timeout, $method);
+ return $r;
+ }
+ elseif(is_string($msg))
+ {
+ $n =& new xmlrpcmsg('');
+ $n->payload = $msg;
+ $msg = $n;
}
// where msg is an xmlrpcmsg
$msg->debug=$this->debug;
- if ($method == 'https')
- {
- return $this->sendPayloadHTTPS($msg,
- $this->server,
- $this->port, $timeout,
- $this->username, $this->password,
- $this->cert,
- $this->certpass);
+ if($method == 'https')
+ {
+ $r =& $this->sendPayloadHTTPS(
+ $msg,
+ $this->server,
+ $this->port,
+ $timeout,
+ $this->username,
+ $this->password,
+ $this->authtype,
+ $this->cert,
+ $this->certpass,
+ $this->cacert,
+ $this->cacertdir,
+ $this->proxy,
+ $this->proxyport,
+ $this->proxy_user,
+ $this->proxy_pass,
+ $this->proxy_authtype,
+ $this->keepalive,
+ $this->key,
+ $this->keypass
+ );
+ }
+ elseif($method == 'http11')
+ {
+ $r =& $this->sendPayloadCURL(
+ $msg,
+ $this->server,
+ $this->port,
+ $timeout,
+ $this->username,
+ $this->password,
+ $this->authtype,
+ null,
+ null,
+ null,
+ null,
+ $this->proxy,
+ $this->proxyport,
+ $this->proxy_user,
+ $this->proxy_pass,
+ $this->proxy_authtype,
+ 'http',
+ $this->keepalive
+ );
}
else
{
- return $this->sendPayloadHTTP10($msg, $this->server, $this->port,
- $timeout, $this->username,
- $this->password);
+ $r =& $this->sendPayloadHTTP10(
+ $msg,
+ $this->server,
+ $this->port,
+ $timeout,
+ $this->username,
+ $this->password,
+ $this->authtype,
+ $this->proxy,
+ $this->proxyport,
+ $this->proxy_user,
+ $this->proxy_pass,
+ $this->proxy_authtype
+ );
}
+
+ return $r;
}
- function sendPayloadHTTP10($msg, $server, $port, $timeout=0,$username='', $password='')
+ /**
+ * @access private
+ */
+ function &sendPayloadHTTP10($msg, $server, $port, $timeout=0,
+ $username='', $password='', $authtype=1, $proxyhost='',
+ $proxyport=0, $proxyusername='', $proxypassword='', $proxyauthtype=1)
{
- global $xmlrpcerr, $xmlrpcstr, $xmlrpcName, $xmlrpcVersion, $xmlrpc_defencoding;
- if ($port==0)
+ if($port==0)
{
$port=80;
}
- if($timeout>0)
+
+ // Only create the payload if it was not created previously
+ if(empty($msg->payload))
{
- $fp=@fsockopen($server, $port,$this->errno, $this->errstr, $timeout);
+ $msg->createPayload($this->request_charset_encoding);
+ }
+
+ $payload = $msg->payload;
+ // Deflate request body and set appropriate request headers
+ if(function_exists('gzdeflate') && ($this->request_compression == 'gzip' || $this->request_compression == 'deflate'))
+ {
+ if($this->request_compression == 'gzip')
+ {
+ $a = @gzencode($payload);
+ if($a)
+ {
+ $payload = $a;
+ $encoding_hdr = "Content-Encoding: gzip\r\n";
+ }
+ }
+ else
+ {
+ $a = @gzcompress($payload);
+ if($a)
+ {
+ $payload = $a;
+ $encoding_hdr = "Content-Encoding: deflate\r\n";
+ }
+ }
}
else
{
- $fp=@fsockopen($server, $port,$this->errno, $this->errstr);
+ $encoding_hdr = '';
}
- if ($fp)
+
+ // thanks to Grant Rauscher <grant7@firstworld.net> for this
+ $credentials='';
+ if($username!='')
{
- if ($timeout>0 && function_exists('stream_set_timeout'))
- stream_set_timeout($fp, $timeout);
+ $credentials='Authorization: Basic ' . base64_encode($username . ':' . $password) . "\r\n";
+ if ($authtype != 1)
+ {
+ error_log('XML-RPC: xmlrpc_client::send: warning. Only Basic auth is supported with HTTP 1.0');
+ }
+ }
+
+ $accepted_encoding = '';
+ if(is_array($this->accepted_compression) && count($this->accepted_compression))
+ {
+ $accepted_encoding = 'Accept-Encoding: ' . implode(', ', $this->accepted_compression) . "\r\n";
+ }
+
+ $proxy_credentials = '';
+ if($proxyhost)
+ {
+ if($proxyport == 0)
+ {
+ $proxyport = 8080;
+ }
+ $connectserver = $proxyhost;
+ $connectport = $proxyport;
+ $uri = 'http://'.$server.':'.$port.$this->path;
+ if($proxyusername != '')
+ {
+ if ($proxyauthtype != 1)
+ {
+ error_log('XML-RPC: xmlrpc_client::send: warning. Only Basic auth to proxy is supported with HTTP 1.0');
+ }
+ $proxy_credentials = 'Proxy-Authorization: Basic ' . base64_encode($proxyusername.':'.$proxypassword) . "\r\n";
+ }
}
else
{
- $this->errstr='Connect error';
- $r=new xmlrpcresp(0, $xmlrpcerr['http_error'],$xmlrpcstr['http_error']);
- return $r;
+ $connectserver = $server;
+ $connectport = $port;
+ $uri = $this->path;
}
- // Only create the payload if it was not created previously
- if(empty($msg->payload))
+
+ // Cookie generation, as per rfc2965 (version 1 cookies) or
+ // netscape's rules (version 0 cookies)
+ $cookieheader='';
+ foreach ($this->cookies as $name => $cookie)
{
- $msg->createPayload();
+ if ($cookie['version'])
+ {
+ $cookieheader .= 'Cookie: $Version="' . $cookie['version'] . '"; ';
+ $cookieheader .= $name . '="' . $cookie['value'] . '";';
+ if ($cookie['path'])
+ $cookieheader .= ' $Path="' . $cookie['path'] . '";';
+ if ($cookie['domain'])
+ $cookieheader .= ' $Domain="' . $cookie['domain'] . '";';
+ if ($cookie['port'])
+ $cookieheader .= ' $Port="' . $cookie['domain'] . '";';
+ $cookieheader = substr($cookieheader, 0, -1) . "\r\n";
+ }
+ else
+ {
+ $cookieheader .= 'Cookie: ' . $name . '=' . $cookie['value'] . "\r\n";
+ }
}
- // thanks to Grant Rauscher <grant7@firstworld.net>
- // for this
- $credentials='';
- if ($username!='')
+ $op= 'POST ' . $uri. " HTTP/1.0\r\n" .
+ 'User-Agent: ' . $GLOBALS['xmlrpcName'] . ' ' . $GLOBALS['xmlrpcVersion'] . "\r\n" .
+ 'Host: '. $server . ':' . $port . "\r\n" .
+ $credentials .
+ $proxy_credentials .
+ $accepted_encoding .
+ $encoding_hdr .
+ 'Accept-Charset: ' . implode(',', $this->accepted_charset_encodings) . "\r\n" .
+ $cookieheader .
+ 'Content-Type: ' . $msg->content_type . "\r\nContent-Length: " .
+ strlen($payload) . "\r\n\r\n" .
+ $payload;
+
+ if($this->debug > 1)
{
- $credentials='Authorization: Basic ' . base64_encode($username . ':' . $password) . "\r\n";
+ print "<PRE>\n---SENDING---\n" . htmlentities($op) . "\n---END---\n</PRE>";
+ // let the client see this now in case http times out...
+ flush();
}
- $op= "POST " . $this->path. " HTTP/1.0\r\n" .
- "User-Agent: " . $xmlrpcName . " " . $xmlrpcVersion . "\r\n" .
- "Host: ". $server . "\r\n" .
- $credentials .
- "Accept-Charset: " . $xmlrpc_defencoding . "\r\n" .
- "Content-Type: text/xml\r\nContent-Length: " .
- strlen($msg->payload) . "\r\n\r\n" .
- $msg->payload;
+ if($timeout>0)
+ {
+ $fp=@fsockopen($connectserver, $connectport, $this->errno, $this->errstr, $timeout);
+ }
+ else
+ {
+ $fp=@fsockopen($connectserver, $connectport, $this->errno, $this->errstr);
+ }
+ if($fp)
+ {
+ if($timeout>0 && function_exists('stream_set_timeout'))
+ {
+ stream_set_timeout($fp, $timeout);
+ }
+ }
+ else
+ {
+ $this->errstr='Connect error: '.$this->errstr;
+ $r=&new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['http_error'], $this->errstr . ' (' . $this->errno . ')');
+ return $r;
+ }
- if (!fputs($fp, $op, strlen($op)))
+ if(!fputs($fp, $op, strlen($op)))
{
$this->errstr='Write error';
- $r=new xmlrpcresp(0, $xmlrpcerr['http_error'], $xmlrpcstr['http_error']);
+ $r=&new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['http_error'], $this->errstr);
return $r;
}
- $resp=$msg->parseResponseFile($fp);
+ else
+ {
+ // reset errno and errstr on succesful socket connection
+ $this->errstr = '';
+ }
+ // G. Giunta 2005/10/24: close socket before parsing.
+ // should yeld slightly better execution times, and make easier recursive calls (e.g. to follow http redirects)
+ $ipd='';
+ while($data=fread($fp, 32768))
+ {
+ // shall we check for $data === FALSE?
+ // as per the manual, it signals an error
+ $ipd.=$data;
+ }
fclose($fp);
- return $resp;
+ $r =& $msg->parseResponse($ipd, false, $this->return_type);
+ return $r;
+
}
- // contributed by Justin Miller <justin@voxel.net>
- // requires curl to be built into PHP
- function sendPayloadHTTPS($msg, $server, $port, $timeout=0,$username='', $password='', $cert='',$certpass='')
- {
- global $xmlrpcerr, $xmlrpcstr, $xmlrpcVersion, $xmlrpc_internalencoding;
- if ($port == 0)
+ /**
+ * @access private
+ */
+ function &sendPayloadHTTPS($msg, $server, $port, $timeout=0, $username='',
+ $password='', $authtype=1, $cert='',$certpass='', $cacert='', $cacertdir='',
+ $proxyhost='', $proxyport=0, $proxyusername='', $proxypassword='', $proxyauthtype=1,
+ $keepalive=false, $key='', $keypass='')
+ {
+ $r =& $this->sendPayloadCURL($msg, $server, $port, $timeout, $username,
+ $password, $authtype, $cert, $certpass, $cacert, $cacertdir, $proxyhost, $proxyport,
+ $proxyusername, $proxypassword, $proxyauthtype, 'https', $keepalive, $key, $keypass);
+ return $r;
+ }
+
+ /**
+ * Contributed by Justin Miller <justin@voxel.net>
+ * Requires curl to be built into PHP
+ * NB: CURL versions before 7.11.10 cannot use proxy to talk to https servers!
+ * @access private
+ */
+ function &sendPayloadCURL($msg, $server, $port, $timeout=0, $username='',
+ $password='', $authtype=1, $cert='', $certpass='', $cacert='', $cacertdir='',
+ $proxyhost='', $proxyport=0, $proxyusername='', $proxypassword='', $proxyauthtype=1, $method='https',
+ $keepalive=false, $key='', $keypass='')
+ {
+ if(!function_exists('curl_init'))
+ {
+ $this->errstr='CURL unavailable on this install';
+ $r=&new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['no_curl'], $GLOBALS['xmlrpcstr']['no_curl']);
+ return $r;
+ }
+ if($method == 'https')
{
- $port = 443;
+ if(($info = curl_version()) &&
+ ((is_string($info) && strpos($info, 'OpenSSL') === null) || (is_array($info) && !isset($info['ssl_version']))))
+ {
+ $this->errstr='SSL unavailable on this install';
+ $r=&new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['no_ssl'], $GLOBALS['xmlrpcstr']['no_ssl']);
+ return $r;
+ }
+ }
+
+ if($port == 0)
+ {
+ if($method == 'http')
+ {
+ $port = 80;
+ }
+ else
+ {
+ $port = 443;
+ }
}
// Only create the payload if it was not created previously
if(empty($msg->payload))
{
- $msg->createPayload();
+ $msg->createPayload($this->request_charset_encoding);
}
- if (!function_exists('curl_init'))
+ // Deflate request body and set appropriate request headers
+ $payload = $msg->payload;
+ if(function_exists('gzdeflate') && ($this->request_compression == 'gzip' || $this->request_compression == 'deflate'))
{
- $this->errstr='SSL unavailable on this install';
- $r=new xmlrpcresp(0, $xmlrpcerr['no_ssl'], $xmlrpcstr['no_ssl']);
- return $r;
+ if($this->request_compression == 'gzip')
+ {
+ $a = @gzencode($payload);
+ if($a)
+ {
+ $payload = $a;
+ $encoding_hdr = 'Content-Encoding: gzip';
+ }
+ }
+ else
+ {
+ $a = @gzcompress($payload);
+ if($a)
+ {
+ $payload = $a;
+ $encoding_hdr = 'Content-Encoding: deflate';
+ }
+ }
+ }
+ else
+ {
+ $encoding_hdr = '';
}
- $curl = curl_init('https://' . $server . ':' . $port . $this->path);
+ if($this->debug > 1)
+ {
+ print "<PRE>\n---SENDING---\n" . htmlentities($payload) . "\n---END---\n</PRE>";
+ // let the client see this now in case http times out...
+ flush();
+ }
+
+ if(!$keepalive || !$this->xmlrpc_curl_handle)
+ {
+ $curl = curl_init($method . '://' . $server . ':' . $port . $this->path);
+ if($keepalive)
+ {
+ $this->xmlrpc_curl_handle = $curl;
+ }
+ }
+ else
+ {
+ $curl = $this->xmlrpc_curl_handle;
+ }
- curl_setopt($curl, CURLOPT_RETURNTRANSFER, 1);
// results into variable
- if ($this->debug)
+ curl_setopt($curl, CURLOPT_RETURNTRANSFER, 1);
+
+ if($this->debug)
{
curl_setopt($curl, CURLOPT_VERBOSE, 1);
}
- curl_setopt($curl, CURLOPT_USERAGENT, 'PHP XMLRPC '.$xmlrpcVersion);
- // required for XMLRPC
+ curl_setopt($curl, CURLOPT_USERAGENT, $GLOBALS['xmlrpcName'].' '.$GLOBALS['xmlrpcVersion']);
+ // required for XMLRPC: post the data
curl_setopt($curl, CURLOPT_POST, 1);
- // post the data
- curl_setopt($curl, CURLOPT_POSTFIELDS, $msg->payload);
// the data
- curl_setopt($curl, CURLOPT_HEADER, 1);
+ curl_setopt($curl, CURLOPT_POSTFIELDS, $payload);
+
// return the header too
- curl_setopt($curl, CURLOPT_HTTPHEADER, array('Content-Type: text/xml', 'Accept-Charset: '.$xmlrpc_internalencoding));
- // whether to verify remote host's cert
- curl_setopt($curl, CURLOPT_SSL_VERIFYPEER, $this->verifypeer);
- // whether to verify cert's common name (CN); 0 for no, 1 to verify that it exists, and 2 to verify that it matches the hostname used
- curl_setopt($curl, CURLOPT_SSL_VERIFYHOST, $this->verifyhost);
- // required for XMLRPC
- if ($timeout)
+ curl_setopt($curl, CURLOPT_HEADER, 1);
+
+ // will only work with PHP >= 5.0
+ // NB: if we set an empty string, CURL will add http header indicating
+ // ALL methods it is supporting. This is possibly a better option than
+ // letting the user tell what curl can / cannot do...
+ if(is_array($this->accepted_compression) && count($this->accepted_compression))
+ {
+ //curl_setopt($curl, CURLOPT_ENCODING, implode(',', $this->accepted_compression));
+ // empty string means 'any supported by CURL' (shall we catch errors in case CURLOPT_SSLKEY undefined ?)
+ if (count($this->accepted_compression) == 1)
+ {
+ curl_setopt($curl, CURLOPT_ENCODING, $this->accepted_compression[0]);
+ }
+ else
+ curl_setopt($curl, CURLOPT_ENCODING, '');
+ }
+ // extra headers
+ $headers = array('Content-Type: ' . $msg->content_type , 'Accept-Charset: ' . implode(',', $this->accepted_charset_encodings));
+ // if no keepalive is wanted, let the server know it in advance
+ if(!$keepalive)
+ {
+ $headers[] = 'Connection: close';
+ }
+ // request compression header
+ if($encoding_hdr)
+ {
+ $headers[] = $encoding_hdr;
+ }
+
+ curl_setopt($curl, CURLOPT_HTTPHEADER, $headers);
+ // timeout is borked
+ if($timeout)
{
curl_setopt($curl, CURLOPT_TIMEOUT, $timeout == 1 ? 1 : $timeout - 1);
}
- // timeout is borked
- if ($username && $password)
+
+ if($username && $password)
+ {
+ curl_setopt($curl, CURLOPT_USERPWD, $username.':'.$password);
+ if (defined('CURLOPT_HTTPAUTH'))
+ {
+ curl_setopt($curl, CURLOPT_HTTPAUTH, $authtype);
+ }
+ else if ($authtype != 1)
+ {
+ error_log('XML-RPC: xmlrpc_client::send: warning. Only Basic auth is supported by the current PHP/curl install');
+ }
+ }
+
+ if($method == 'https')
{
- curl_setopt($curl, CURLOPT_USERPWD,"$username:$password");
+ // set cert file
+ if($cert)
+ {
+ curl_setopt($curl, CURLOPT_SSLCERT, $cert);
+ }
+ // set cert password
+ if($certpass)
+ {
+ curl_setopt($curl, CURLOPT_SSLCERTPASSWD, $certpass);
+ }
+ // whether to verify remote host's cert
+ curl_setopt($curl, CURLOPT_SSL_VERIFYPEER, $this->verifypeer);
+ // set ca certificates file/dir
+ if($cacert)
+ {
+ curl_setopt($curl, CURLOPT_CAINFO, $cacert);
+ }
+ if($cacertdir)
+ {
+ curl_setopt($curl, CURLOPT_CAPATH, $cacertdir);
+ }
+ // set key file (shall we catch errors in case CURLOPT_SSLKEY undefined ?)
+ if($key)
+ {
+ curl_setopt($curl, CURLOPT_SSLKEY, $key);
+ }
+ // set key password (shall we catch errors in case CURLOPT_SSLKEY undefined ?)
+ if($keypass)
+ {
+ curl_setopt($curl, CURLOPT_SSLKEYPASSWD, $keypass);
+ }
+ // whether to verify cert's common name (CN); 0 for no, 1 to verify that it exists, and 2 to verify that it matches the hostname used
+ curl_setopt($curl, CURLOPT_SSL_VERIFYHOST, $this->verifyhost);
}
- // set auth stuff
- if ($cert)
+
+ // proxy info
+ if($proxyhost)
{
- curl_setopt($curl, CURLOPT_SSLCERT, $cert);
+ if($proxyport == 0)
+ {
+ $proxyport = 8080; // NB: even for HTTPS, local connection is on port 8080
+ }
+ curl_setopt($curl, CURLOPT_PROXY,$proxyhost.':'.$proxyport);
+ //curl_setopt($curl, CURLOPT_PROXYPORT,$proxyport);
+ if($proxyusername)
+ {
+ curl_setopt($curl, CURLOPT_PROXYUSERPWD, $proxyusername.':'.$proxypassword);
+ if (defined('CURLOPT_PROXYAUTH'))
+ {
+ curl_setopt($curl, CURLOPT_PROXYAUTH, $proxyauthtype);
+ }
+ else if ($proxyauthtype != 1)
+ {
+ error_log('XML-RPC: xmlrpc_client::send: warning. Only Basic auth to proxy is supported by the current PHP/curl install');
+ }
+ }
}
- // set cert file
- if ($certpass)
+
+ // NB: should we build cookie http headers by hand rather than let CURL do it?
+ // the following code does not honour 'expires', 'path' and 'domain' cookie attributes
+ // set to clint obj the the user...
+ if (count($this->cookies))
{
- curl_setopt($curl, CURLOPT_SSLCERTPASSWD,$certpass);
+ $cookieheader = '';
+ foreach ($this->cookies as $name => $cookie)
+ {
+ $cookieheader .= $name . '=' . $cookie['value'] . ', ';
+ }
+ curl_setopt($curl, CURLOPT_COOKIE, substr($cookieheader, 0, -2));
}
- // set cert password
$result = curl_exec($curl);
- if (!$result)
+ if(!$result)
{
$this->errstr='no response';
- $resp=new xmlrpcresp(0, $xmlrpcerr['curl_fail'], $xmlrpcstr['curl_fail']. ': '. curl_error($curl));
- curl_close($curl);
+ $resp=&new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['curl_fail'], $GLOBALS['xmlrpcstr']['curl_fail']. ': '. curl_error($curl));
+ if(!$keepalive)
+ {
+ curl_close($curl);
+ }
}
else
{
- curl_close($curl);
- $resp = $msg->parseResponse($result);
+ if(!$keepalive)
+ {
+ curl_close($curl);
+ }
+ $resp =& $msg->parseResponse($result, true, $this->return_type);
}
return $resp;
}
- function multicall($msgs, $timeout=0, $method='http')
- {
- $results = false;
-
- if (! $this->no_multicall)
+ /**
+ * Send an array of request messages and return an array of responses.
+ * Unless $this->no_multicall has been set to true, it will try first
+ * to use one single xmlrpc call to server method system.multicall, and
+ * revert to sending many successive calls in case of failure.
+ * This failure is also stored in $this->no_multicall for subsequent calls.
+ * Unfortunately, there is no server error code universally used to denote
+ * the fact that multicall is unsupported, so there is no way to reliably
+ * distinguish between that and a temporary failure.
+ * If you are sure that server supports multicall and do not want to
+ * fallback to using many single calls, set the fourth parameter to FALSE.
+ *
+ * NB: trying to shoehorn extra functionality into existing syntax has resulted
+ * in pretty much convoluted code...
+ *
+ * @param array $msgs an array of xmlrpcmsg objects
+ * @param integer $timeout connection timeout (in seconds)
+ * @param string $method the http protocol variant to be used
+ * @param boolean fallback When true, upon receiveing an error during multicall, multiple single calls will be attempted
+ * @return array
+ * @access public
+ */
+ function multicall($msgs, $timeout=0, $method='', $fallback=true)
+ {
+ if ($method == '')
+ {
+ $method = $this->method;
+ }
+ if(!$this->no_multicall)
{
$results = $this->_try_multicall($msgs, $timeout, $method);
- /* TODO - this is not php3-friendly */
- // if($results !== false)
if(is_array($results))
{
- // Either the system.multicall succeeded, or the send
- // failed (e.g. due to HTTP timeout). In either case,
- // we're done for now.
+ // System.multicall succeeded
return $results;
}
else
{
- // system.multicall unsupported by server,
- // don't try it next time...
- $this->no_multicall = true;
+ // either system.multicall is unsupported by server,
+ // or call failed for some other reason.
+ if ($fallback)
+ {
+ // Don't try it next time...
+ $this->no_multicall = true;
+ }
+ else
+ {
+ if (is_a($results, 'xmlrpcresp'))
+ {
+ $result = $results;
+ }
+ else
+ {
+ $result =& new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['multicall_error'], $GLOBALS['xmlrpcstr']['multicall_error']);
+ }
+ }
}
}
+ else
+ {
+ // override fallback, in case careless user tries to do two
+ // opposite things at the same time
+ $fallback = true;
+ }
- // system.multicall is unupported by server:
- // Emulate multicall via multiple requests
$results = array();
- //foreach($msgs as $msg)
- @reset($msgs);
- while(list(,$msg) = @each($msgs))
+ if ($fallback)
+ {
+ // system.multicall is (probably) unsupported by server:
+ // emulate multicall via multiple requests
+ foreach($msgs as $msg)
+ {
+ $results[] =& $this->send($msg, $timeout, $method);
+ }
+ }
+ else
{
- $results[] = $this->send($msg, $timeout, $method);
+ // user does NOT want to fallback on many single calls:
+ // since we should always return an array of responses,
+ // return an array with the same error repeated n times
+ foreach($msgs as $msg)
+ {
+ $results[] = $result;
+ }
}
return $results;
}
- // Attempt to boxcar $msgs via system.multicall.
+ /**
+ * Attempt to boxcar $msgs via system.multicall.
+ * Returns either an array of xmlrpcreponses, an xmlrpc error response
+ * or false (when received response does not respect valid multicall syntax)
+ * @access private
+ */
function _try_multicall($msgs, $timeout, $method)
{
// Construct multicall message
$calls = array();
- //foreach($msgs as $msg)
- @reset($msgs);
- while(list(,$msg) = @each($msgs))
+ foreach($msgs as $msg)
{
- $call['methodName'] = new xmlrpcval($msg->method(),'string');
+ $call['methodName'] =& new xmlrpcval($msg->method(),'string');
$numParams = $msg->getNumParams();
$params = array();
- for ($i = 0; $i < $numParams; $i++)
+ for($i = 0; $i < $numParams; $i++)
{
$params[$i] = $msg->getParam($i);
}
- $call['params'] = new xmlrpcval($params, 'array');
- $calls[] = new xmlrpcval($call, 'struct');
+ $call['params'] =& new xmlrpcval($params, 'array');
+ $calls[] =& new xmlrpcval($call, 'struct');
}
- $multicall = new xmlrpcmsg('system.multicall');
+ $multicall =& new xmlrpcmsg('system.multicall');
$multicall->addParam(new xmlrpcval($calls, 'array'));
// Attempt RPC call
- $result = $this->send($multicall, $timeout, $method);
- if(!is_object($result))
- {
- return ($result || 0); // transport failed
- }
+ $result =& $this->send($multicall, $timeout, $method);
if($result->faultCode() != 0)
{
- return false; // system.multicall failed
+ // call to system.multicall failed
+ return $result;
}
// Unpack responses.
$rets = $result->value();
- if($rets->kindOf() != 'array')
+
+ if ($this->return_type == 'xml')
{
- return false; // bad return type from system.multicall
+ return $rets;
}
- $numRets = $rets->arraysize();
- if($numRets != count($msgs))
+ else if ($this->return_type == 'phpvals')
{
- return false; // wrong number of return values.
- }
+ ///@todo test this code branch...
+ $rets = $result->value();
+ if(!is_array($rets))
+ {
+ return false; // bad return type from system.multicall
+ }
+ $numRets = count($rets);
+ if($numRets != count($msgs))
+ {
+ return false; // wrong number of return values.
+ }
- $response = array();
- for ($i = 0; $i < $numRets; $i++)
- {
- $val = $rets->arraymem($i);
- switch ($val->kindOf())
+ $response = array();
+ for($i = 0; $i < $numRets; $i++)
{
- case 'array':
- if($val->arraysize() != 1)
- {
- return false; // Bad value
+ $val = $rets[$i];
+ if (!is_array($val)) {
+ return false;
}
- // Normal return value
- $response[$i] = new xmlrpcresp($val->arraymem(0));
- break;
- case 'struct':
- $code = $val->structmem('faultCode');
- if($code->kindOf() != 'scalar' || $code->scalartyp() != 'int')
+ switch(count($val))
{
- return false;
+ case 1:
+ if(!isset($val[0]))
+ {
+ return false; // Bad value
+ }
+ // Normal return value
+ $response[$i] =& new xmlrpcresp($val[0], 0, '', 'phpvals');
+ break;
+ case 2:
+ /// @todo remove usage of @: it is apparently quite slow
+ $code = @$val['faultCode'];
+ if(!is_int($code))
+ {
+ return false;
+ }
+ $str = @$val['faultString'];
+ if(!is_string($str))
+ {
+ return false;
+ }
+ $response[$i] =& new xmlrpcresp(0, $code, $str);
+ break;
+ default:
+ return false;
}
- $str = $val->structmem('faultString');
- if($str->kindOf() != 'scalar' || $str->scalartyp() != 'string')
+ }
+ return $response;
+ }
+ else // return type == 'xmlrpcvals'
+ {
+ $rets = $result->value();
+ if($rets->kindOf() != 'array')
+ {
+ return false; // bad return type from system.multicall
+ }
+ $numRets = $rets->arraysize();
+ if($numRets != count($msgs))
+ {
+ return false; // wrong number of return values.
+ }
+
+ $response = array();
+ for($i = 0; $i < $numRets; $i++)
+ {
+ $val = $rets->arraymem($i);
+ switch($val->kindOf())
{
- return false;
+ case 'array':
+ if($val->arraysize() != 1)
+ {
+ return false; // Bad value
+ }
+ // Normal return value
+ $response[$i] =& new xmlrpcresp($val->arraymem(0));
+ break;
+ case 'struct':
+ $code = $val->structmem('faultCode');
+ if($code->kindOf() != 'scalar' || $code->scalartyp() != 'int')
+ {
+ return false;
+ }
+ $str = $val->structmem('faultString');
+ if($str->kindOf() != 'scalar' || $str->scalartyp() != 'string')
+ {
+ return false;
+ }
+ $response[$i] =& new xmlrpcresp(0, $code->scalarval(), $str->scalarval());
+ break;
+ default:
+ return false;
}
- $response[$i] = new xmlrpcresp(0, $code->scalarval(), $str->scalarval());
- break;
- default:
- return false;
}
+ return $response;
}
- return $response;
}
} // end class xmlrpc_client
class xmlrpcresp
{
var $val = 0;
+ var $valtyp;
var $errno = 0;
var $errstr = '';
+ var $payload;
var $hdrs = array();
-
- function xmlrpcresp($val, $fcode = 0, $fstr = '')
- {
- if ($fcode != 0)
- {
- // error
+ var $_cookies = array();
+ var $content_type = 'text/xml';
+ var $raw_data = '';
+
+ /**
+ * @param mixed $val either an xmlrpcval obj, a php value or the xml serialization of an xmlrpcval (a string)
+ * @param integer $fcode set it to anything but 0 to create an error response
+ * @param string $fstr the error string, in case of an error response
+ * @param string $valtyp either 'xmlrpcvals', 'phpvals' or 'xml'
+ *
+ * @todo add check that $val / $fcode / $fstr is of correct type???
+ * NB: as of now we do not do it, since it might be either an xmlrpcval or a plain
+ * php val, or a complete xml chunk, depending on usage of xmlrpc_client::send() inside which creator is called...
+ */
+ function xmlrpcresp($val, $fcode = 0, $fstr = '', $valtyp='')
+ {
+ if($fcode != 0)
+ {
+ // error response
$this->errno = $fcode;
$this->errstr = $fstr;
//$this->errstr = htmlspecialchars($fstr); // XXX: encoding probably shouldn't be done here; fix later.
}
- elseif (!is_object($val))
- {
- // programmer error
- error_log("Invalid type '" . gettype($val) . "' (value: $val) passed to xmlrpcresp. Defaulting to empty value.");
- $this->val = new xmlrpcval();
- }
else
{
- // success
+ // successful response
$this->val = $val;
+ if ($valtyp == '')
+ {
+ // user did not declare type of response value: try to guess it
+ if (is_object($this->val) && is_a($this->val, 'xmlrpcval'))
+ {
+ $this->valtyp = 'xmlrpcvals';
+ }
+ else if (is_string($this->val))
+ {
+ $this->valtyp = 'xml';
+
+ }
+ else
+ {
+ $this->valtyp = 'phpvals';
+ }
+ }
+ else
+ {
+ // user declares type of resp value: believe him
+ $this->valtyp = $valtyp;
+ }
}
}
+ /**
+ * Returns the error code of the response.
+ * @return integer the error code of this response (0 for not-error responses)
+ * @access public
+ */
function faultCode()
{
return $this->errno;
}
+ /**
+ * Returns the error code of the response.
+ * @return string the error string of this response ('' for not-error responses)
+ * @access public
+ */
function faultString()
{
return $this->errstr;
}
+ /**
+ * Returns the value received by the server.
+ * @return mixed the xmlrpcval object returned by the server. Might be an xml string or php value if the response has been created by specially configured xmlrpc_client objects
+ * @access public
+ */
function value()
{
return $this->val;
}
- function serialize()
+ /**
+ * Returns an array with the cookies received from the server.
+ * Array has the form: $cookiename => array ('value' => $val, $attr1 => $val1, $attr2 = $val2, ...)
+ * with attributes being e.g. 'expires', 'path', domain'.
+ * NB: cookies sent as 'expired' by the server (i.e. with an expiry date in the past)
+ * are still present in the array. It is up to the user-defined code to decide
+ * how to use the received cookies, and wheter they have to be sent back with the next
+ * request to the server (using xmlrpc_client::setCookie) or not
+ * @return array array of cookies received from the server
+ * @access public
+ */
+ function cookies()
+ {
+ return $this->_cookies;
+ }
+
+ /**
+ * Returns xml representation of the response. XML prologue not included
+ * @param string $charset_encoding the charset to be used for serialization. if null, US-ASCII is assumed
+ * @return string the xml representation of the response
+ * @access public
+ */
+ function serialize($charset_encoding='')
{
+ if ($charset_encoding != '')
+ $this->content_type = 'text/xml; charset=' . $charset_encoding;
+ else
+ $this->content_type = 'text/xml';
$result = "<methodResponse>\n";
- if ($this->errno)
+ if($this->errno)
{
// G. Giunta 2005/2/13: let non-ASCII response messages be tolerated by clients
- $result .= '<fault>
-<value>
-<struct>
-<member>
-<name>faultCode</name>
-<value><int>' . $this->errno . '</int></value>
-</member>
-<member>
-<name>faultString</name>
-<value><string>' . xmlrpc_encode_entitites($this->errstr) . '</string></value>
-</member>
-</struct>
-</value>
-</fault>';
+ // by xml-encoding non ascii chars
+ $result .= "<fault>\n" .
+"<value>\n<struct><member><name>faultCode</name>\n<value><int>" . $this->errno .
+"</int></value>\n</member>\n<member>\n<name>faultString</name>\n<value><string>" .
+xmlrpc_encode_entitites($this->errstr, $GLOBALS['xmlrpc_internalencoding'], $charset_encoding) . "</string></value>\n</member>\n" .
+"</struct>\n</value>\n</fault>";
}
else
{
- $result .= "<params>\n<param>\n" .
- $this->val->serialize() .
- "</param>\n</params>";
+ if(!is_object($this->val) || !is_a($this->val, 'xmlrpcval'))
+ {
+ if (is_string($this->val) && $this->valtyp == 'xml')
+ {
+ $result .= "<params>\n<param>\n" .
+ $this->val .
+ "</param>\n</params>";
+ }
+ else
+ {
+ /// @todo try to build something serializable?
+ die('cannot serialize xmlrpcresp objects whose content is native php values');
+ }
+ }
+ else
+ {
+ $result .= "<params>\n<param>\n" .
+ $this->val->serialize($charset_encoding) .
+ "</param>\n</params>";
+ }
}
$result .= "\n</methodResponse>";
+ $this->payload = $result;
return $result;
}
}
var $methodname;
var $params=array();
var $debug=0;
+ var $content_type = 'text/xml';
+ /**
+ * @param string $meth the name of the method to invoke
+ * @param array $pars array of parameters to be paased to the method (xmlrpcval objects)
+ */
function xmlrpcmsg($meth, $pars=0)
{
$this->methodname=$meth;
- if (is_array($pars) && sizeof($pars)>0)
+ if(is_array($pars) && count($pars)>0)
{
- for($i=0; $i<sizeof($pars); $i++)
+ for($i=0; $i<count($pars); $i++)
{
$this->addParam($pars[$i]);
}
}
}
- function xml_header()
+ /**
+ * @access private
+ */
+ function xml_header($charset_encoding='')
{
- return "<?xml version=\"1.0\"?" . ">\n<methodCall>\n";
+ if ($charset_encoding != '')
+ {
+ return "<?xml version=\"1.0\" encoding=\"$charset_encoding\" ?" . ">\n<methodCall>\n";
+ }
+ else
+ {
+ return "<?xml version=\"1.0\"?" . ">\n<methodCall>\n";
+ }
}
+ /**
+ * @access private
+ */
function xml_footer()
{
- return "</methodCall>\n";
+ return '</methodCall>';
}
- function createPayload()
+ /**
+ * @access private
+ */
+ function kindOf()
+ {
+ return 'msg';
+ }
+
+ /**
+ * @access private
+ */
+ function createPayload($charset_encoding='')
{
- $this->payload=$this->xml_header();
+ if ($charset_encoding != '')
+ $this->content_type = 'text/xml; charset=' . $charset_encoding;
+ else
+ $this->content_type = 'text/xml';
+ $this->payload=$this->xml_header($charset_encoding);
$this->payload.='<methodName>' . $this->methodname . "</methodName>\n";
- // if (sizeof($this->params)) {
$this->payload.="<params>\n";
- for($i=0; $i<sizeof($this->params); $i++)
+ for($i=0; $i<count($this->params); $i++)
{
$p=$this->params[$i];
- $this->payload.="<param>\n" . $p->serialize() .
+ $this->payload.="<param>\n" . $p->serialize($charset_encoding) .
"</param>\n";
}
$this->payload.="</params>\n";
- // }
$this->payload.=$this->xml_footer();
- //$this->payload=str_replace("\n", "\r\n", $this->payload);
}
+ /**
+ * Gets/sets the xmlrpc method to be invoked
+ * @param string $meth the method to be set (leave empty not to set it)
+ * @return string the method that will be invoked
+ * @access public
+ */
function method($meth='')
{
- if ($meth!='')
+ if($meth!='')
{
$this->methodname=$meth;
}
return $this->methodname;
}
- function serialize()
+ /**
+ * Returns xml representation of the message. XML prologue included
+ * @return string the xml representation of the message, xml prologue included
+ * @access public
+ */
+ function serialize($charset_encoding='')
{
- $this->createPayload();
+ $this->createPayload($charset_encoding);
return $this->payload;
}
- function addParam($par) { $this->params[]=$par; }
+ /**
+ * Add a parameter to the list of parameters to be used upon method invocation
+ * @param xmlrpcval $par
+ * @return boolean false on failure
+ * @access public
+ */
+ function addParam($par)
+ {
+ // add check: do not add to self params which are not xmlrpcvals
+ if(is_object($par) && is_a($par, 'xmlrpcval'))
+ {
+ $this->params[]=$par;
+ return true;
+ }
+ else
+ {
+ return false;
+ }
+ }
+
+ /**
+ * Returns the nth parameter in the message. The index zero-based.
+ * @param integer $i the index of the parameter to fetch (zero based)
+ * @return xmlrpcval the i-th parameter
+ * @access public
+ */
function getParam($i) { return $this->params[$i]; }
- function getNumParams() { return sizeof($this->params); }
- function parseResponseFile($fp)
+ /**
+ * Returns the number of parameters in the messge.
+ * @return integer the number of parameters currently set
+ * @access public
+ */
+ function getNumParams() { return count($this->params); }
+
+ /**
+ * Given an open file handle, read all data available and parse it as axmlrpc response.
+ * NB: the file handle is not closed by this function.
+ * @access public
+ * @return xmlrpcresp
+ * @todo add 2nd & 3rd param to be passed to ParseResponse() ???
+ */
+ function &parseResponseFile($fp)
{
$ipd='';
while($data=fread($fp, 32768))
{
$ipd.=$data;
}
- return $this->parseResponse($ipd);
+ //fclose($fp);
+ $r =& $this->parseResponse($ipd);
+ return $r;
}
- function parseResponse($data='')
+ /**
+ * Parses HTTP headers and separates them from data.
+ * @access private
+ */
+ function &parseResponseHeaders(&$data, $headers_processed=false)
{
- global $_xh,$xmlrpcerr,$xmlrpcstr;
- global $xmlrpc_defencoding, $xmlrpc_internalencoding;
-
- $hdrfnd = 0;
- if($this->debug)
- {
- //by maHo, replaced htmlspecialchars with htmlentities
- print "<PRE>---GOT---\n" . htmlentities($data) . "\n---END---\n</PRE>";
- }
+ // Support "web-proxy-tunelling" connections for https through proxies
+ if(preg_match('/^HTTP\/1\.[0-1] 200 Connection established/', $data))
+ {
+ // Look for CR/LF or simple LF as line separator,
+ // (even though it is not valid http)
+ $pos = strpos($data,"\r\n\r\n");
+ if($pos || is_int($pos))
+ {
+ $bd = $pos+4;
+ }
+ else
+ {
+ $pos = strpos($data,"\n\n");
+ if($pos || is_int($pos))
+ {
+ $bd = $pos+2;
+ }
+ else
+ {
+ // No separation between response headers and body: fault?
+ $bd = 0;
+ }
+ }
+ if ($bd)
+ {
+ // this filters out all http headers from proxy.
+ // maybe we could take them into account, too?
+ $data = substr($data, $bd);
+ }
+ else
+ {
+ error_log('XML-RPC: xmlrpcmsg::parseResponse: HTTPS via proxy error, tunnel connection possibly failed');
+ $r=&new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['http_error'], $GLOBALS['xmlrpcstr']['http_error']. ' (HTTPS via proxy error, tunnel connection possibly failed)');
+ return $r;
+ }
+ }
- if($data == '')
- {
- error_log('No response received from server.');
- $r = new xmlrpcresp(0, $xmlrpcerr['no_data'], $xmlrpcstr['no_data']);
- return $r;
- }
- // see if we got an HTTP 200 OK, else bomb
- // but only do this if we're using the HTTP protocol.
- if(ereg("^HTTP",$data))
- {
// Strip HTTP 1.1 100 Continue header if present
- while (ereg('^HTTP/1.1 1[0-9]{2}', $data))
+ while(preg_match('/^HTTP\/1\.1 1[0-9]{2} /', $data))
{
$pos = strpos($data, 'HTTP', 12);
// server sent a Continue header without any (valid) content following...
// give the client a chance to know it
- if (!$pos && !is_int($pos)) // works fine in php 3, 4 and 5
+ if(!$pos && !is_int($pos)) // works fine in php 3, 4 and 5
+ {
break;
+ }
$data = substr($data, $pos);
}
- if (!ereg("^HTTP/[0-9\\.]+ 200 ", $data))
+ if(!preg_match('/^HTTP\/[0-9.]+ 200 /', $data))
{
$errstr= substr($data, 0, strpos($data, "\n")-1);
- error_log('HTTP error, got response: ' .$errstr);
- $r=new xmlrpcresp(0, $xmlrpcerr['http_error'], $xmlrpcstr['http_error']. ' (' . $errstr . ')');
+ error_log('XML-RPC: xmlrpcmsg::parseResponse: HTTP error, got response: ' .$errstr);
+ $r=&new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['http_error'], $GLOBALS['xmlrpcstr']['http_error']. ' (' . $errstr . ')');
return $r;
}
- }
- $parser = xml_parser_create($xmlrpc_defencoding);
- // G. Giunta 2004/04/06
- // Clean up the accumulator, or it will grow indefinitely long
- // if making xmlrpc calls for a while
- $_xh=array();
- $_xh[$parser]=array();
- $_xh[$parser]['headers'] = array();
- $_xh[$parser]['stack'] = array();
- $_xh[$parser]['sp'] = 0;
- $_xh[$parser]['valuestack'] = array();
- $_xh[$parser]['vsp'] = 0;
+ $GLOBALS['_xh']['headers'] = array();
+ $GLOBALS['_xh']['cookies'] = array();
- // separate HTTP headers from data
- if (ereg("^HTTP", $data))
- {
// be tolerant to usage of \n instead of \r\n to separate headers and data
// (even though it is not valid http)
$pos = strpos($data,"\r\n\r\n");
if($pos || is_int($pos))
+ {
$bd = $pos+4;
+ }
else
{
$pos = strpos($data,"\n\n");
if($pos || is_int($pos))
+ {
$bd = $pos+2;
+ }
else
{
// No separation between response headers and body: fault?
+ // we could take some action here instead of going on...
$bd = 0;
}
}
// be tolerant to line endings, and extra empty lines
$ar = split("\r?\n", trim(substr($data, 0, $pos)));
- while (list(,$line) = @each($ar))
+ while(list(,$line) = @each($ar))
{
- // take care of multi-line headers
- $arr = explode(':',$line);
+ // take care of multi-line headers and cookies
+ $arr = explode(':',$line,2);
if(count($arr) > 1)
{
- $header_name = trim($arr[0]);
- // TO DO: some headers (the ones that allow a CSV list of values)
- // do allow many values to be passed using multiple header lines.
- // We should add content to $_xh[$parser]['headers'][$header_name]
- // instead of replacing it for those...
- $_xh[$parser]['headers'][$header_name] = $arr[1];
- for ($i = 2; $i < count($arr); $i++)
+ $header_name = strtolower(trim($arr[0]));
+ /// @todo some other headers (the ones that allow a CSV list of values)
+ /// do allow many values to be passed using multiple header lines.
+ /// We should add content to $GLOBALS['_xh']['headers'][$header_name]
+ /// instead of replacing it for those...
+ if ($header_name == 'set-cookie' || $header_name == 'set-cookie2')
{
- $_xh[$parser]['headers'][$header_name] .= ':'.$arr[$i];
- } // while
- $_xh[$parser]['headers'][$header_name] = trim($_xh[$parser]['headers'][$header_name]);
- } else if (isset($header_name))
+ if ($header_name == 'set-cookie2')
+ {
+ // version 2 cookies:
+ // there could be many cookies on one line, comma separated
+ $cookies = explode(',', $arr[1]);
+ }
+ else
+ {
+ $cookies = array($arr[1]);
+ }
+ foreach ($cookies as $cookie)
+ {
+ // glue together all received cookies, using a comma to separate them
+ // (same as php does with getallheaders())
+ if (isset($GLOBALS['_xh']['headers'][$header_name]))
+ $GLOBALS['_xh']['headers'][$header_name] .= ', ' . trim($cookie);
+ else
+ $GLOBALS['_xh']['headers'][$header_name] = trim($cookie);
+ // parse cookie attributes, in case user wants to correctly honour them
+ // feature creep: only allow rfc-compliant cookie attributes?
+ $cookie = explode(';', $cookie);
+ foreach ($cookie as $pos => $val)
+ {
+ $val = explode('=', $val, 2);
+ $tag = trim($val[0]);
+ $val = trim(@$val[1]);
+ /// @todo with version 1 cookies, we should strip leading and trailing " chars
+ if ($pos == 0)
+ {
+ $cookiename = $tag;
+ $GLOBALS['_xh']['cookies'][$tag] = array();
+ $GLOBALS['_xh']['cookies'][$cookiename]['value'] = urldecode($val);
+ }
+ else
+ {
+ $GLOBALS['_xh']['cookies'][$cookiename][$tag] = $val;
+ }
+ }
+ }
+ }
+ else
+ {
+ $GLOBALS['_xh']['headers'][$header_name] = trim($arr[1]);
+ }
+ }
+ elseif(isset($header_name))
{
- $_xh[$parser]['headers'][$header_name] .= ' ' . trim($line);
+ /// @todo version1 cookies might span multiple lines, thus breaking the parsing above
+ $GLOBALS['_xh']['headers'][$header_name] .= ' ' . trim($line);
}
}
+
$data = substr($data, $bd);
- if ($this->debug && count($_xh[$parser]['headers']))
+ if($this->debug && count($GLOBALS['_xh']['headers']))
{
print '<PRE>';
- //foreach ($_xh[$parser]['headers'] as $header)
- @reset($_xh[$parser]['headers']);
- while(list($header, $value) = @each($_xh[$parser]['headers']))
+ foreach($GLOBALS['_xh']['headers'] as $header => $value)
+ {
+ print htmlentities("HEADER: $header: $value\n");
+ }
+ foreach($GLOBALS['_xh']['cookies'] as $header => $value)
{
- print "HEADER: $header: $value\n";
+ print htmlentities("COOKIE: $header={$value['value']}\n");
}
print "</PRE>\n";
}
+
+ // if CURL was used for the call, http headers have been processed,
+ // and dechunking + reinflating have been carried out
+ if(!$headers_processed)
+ {
+ // Decode chunked encoding sent by http 1.1 servers
+ if(isset($GLOBALS['_xh']['headers']['transfer-encoding']) && $GLOBALS['_xh']['headers']['transfer-encoding'] == 'chunked')
+ {
+ if(!$data = decode_chunked($data))
+ {
+ error_log('XML-RPC: xmlrpcmsg::parseResponse: errors occurred when trying to rebuild the chunked data received from server');
+ $r =& new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['dechunk_fail'], $GLOBALS['xmlrpcstr']['dechunk_fail']);
+ return $r;
+ }
+ }
+
+ // Decode gzip-compressed stuff
+ // code shamelessly inspired from nusoap library by Dietrich Ayala
+ if(isset($GLOBALS['_xh']['headers']['content-encoding']))
+ {
+ $GLOBALS['_xh']['headers']['content-encoding'] = str_replace('x-', '', $GLOBALS['_xh']['headers']['content-encoding']);
+ if($GLOBALS['_xh']['headers']['content-encoding'] == 'deflate' || $GLOBALS['_xh']['headers']['content-encoding'] == 'gzip')
+ {
+ // if decoding works, use it. else assume data wasn't gzencoded
+ if(function_exists('gzinflate'))
+ {
+ if($GLOBALS['_xh']['headers']['content-encoding'] == 'deflate' && $degzdata = @gzuncompress($data))
+ {
+ $data = $degzdata;
+ if($this->debug)
+ print "<PRE>---INFLATED RESPONSE---[".strlen($data)." chars]---\n" . htmlentities($data) . "\n---END---</PRE>";
+ }
+ elseif($GLOBALS['_xh']['headers']['content-encoding'] == 'gzip' && $degzdata = @gzinflate(substr($data, 10)))
+ {
+ $data = $degzdata;
+ if($this->debug)
+ print "<PRE>---INFLATED RESPONSE---[".strlen($data)." chars]---\n" . htmlentities($data) . "\n---END---</PRE>";
+ }
+ else
+ {
+ error_log('XML-RPC: xmlrpcmsg::parseResponse: errors occurred when trying to decode the deflated data received from server');
+ $r =& new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['decompress_fail'], $GLOBALS['xmlrpcstr']['decompress_fail']);
+ return $r;
+ }
+ }
+ else
+ {
+ error_log('XML-RPC: xmlrpcmsg::parseResponse: the server sent deflated data. Your php install must have the Zlib extension compiled in to support this.');
+ $r =& new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['cannot_decompress'], $GLOBALS['xmlrpcstr']['cannot_decompress']);
+ return $r;
+ }
+ }
+ }
+ } // end of 'if needed, de-chunk, re-inflate response'
+
+ // real stupid hack to avoid PHP 4 complaining about returning NULL by ref
+ $r = null;
+ $r =& $r;
+ return $r;
+ }
+
+ /**
+ * Parse the xmlrpc response contained in the string $data and return an xmlrpcresp object.
+ * @param string $data the xmlrpc response, eventually including http headers
+ * @param bool $headers_processed when true prevents parsing HTTP headers for interpretation of content-encoding and consequent decoding
+ * @param string $return_type decides return type, i.e. content of response->value(). Either 'xmlrpcvals', 'xml' or 'phpvals'
+ * @return xmlrpcresp
+ * @access public
+ */
+ function &parseResponse($data='', $headers_processed=false, $return_type='xmlrpcvals')
+ {
+ if($this->debug)
+ {
+ //by maHo, replaced htmlspecialchars with htmlentities
+ print "<PRE>---GOT---\n" . htmlentities($data) . "\n---END---\n</PRE>";
+ }
+
+ if($data == '')
+ {
+ error_log('XML-RPC: xmlrpcmsg::parseResponse: no response received from server.');
+ $r =& new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['no_data'], $GLOBALS['xmlrpcstr']['no_data']);
+ return $r;
+ }
+
+ $GLOBALS['_xh']=array();
+
+ $raw_data = $data;
+ // parse the HTTP headers of the response, if present, and separate them from data
+ if(substr($data, 0, 4) == 'HTTP')
+ {
+ $r =& $this->parseResponseHeaders($data, $headers_processed);
+ if ($r)
+ {
+ // failed processing of HTTP response headers
+ // save into response obj the full payload received, for debugging
+ $r->raw_data = $data;
+ return $r;
+ }
+ }
+ else
+ {
+ $GLOBALS['_xh']['headers'] = array();
+ $GLOBALS['_xh']['cookies'] = array();
+ }
+
+ if($this->debug)
+ {
+ $start = strpos($data, '<!-- SERVER DEBUG INFO (BASE64 ENCODED):');
+ if ($start)
+ {
+ $start += strlen('<!-- SERVER DEBUG INFO (BASE64 ENCODED):');
+ $end = strpos($data, '-->', $start);
+ $comments = substr($data, $start, $end-$start);
+ print "<PRE>---SERVER DEBUG INFO (DECODED) ---\n\t".htmlentities(str_replace("\n", "\n\t", base64_decode($comments)))."\n---END---\n</PRE>";
+ }
}
// be tolerant of extra whitespace in response body
$data = trim($data);
- // be tolerant of junk after methodResponse (e.g. javascript automatically inserted by free hosts)
+ /// @todo return an error msg if $data=='' ?
+
+ // be tolerant of junk after methodResponse (e.g. javascript ads automatically inserted by free hosts)
// idea from Luca Mariano <luca.mariano@email.it> originally in PEARified version of the lib
$bd = false;
- $pos = strpos($data, "</methodResponse>");
- while ($pos || is_int($pos))
+ // Poor man's version of strrpos for php 4...
+ $pos = strpos($data, '</methodResponse>');
+ while($pos || is_int($pos))
{
$bd = $pos+17;
- $pos = strpos($data, "</methodResponse>", $bd);
+ $pos = strpos($data, '</methodResponse>', $bd);
}
- if ($bd)
+ if($bd)
+ {
$data = substr($data, 0, $bd);
+ }
+
+ // if user wants back raw xml, give it to him
+ if ($return_type == 'xml')
+ {
+ $r =& new xmlrpcresp($data, 0, '', 'xml');
+ $r->hdrs = $GLOBALS['_xh']['headers'];
+ $r->_cookies = $GLOBALS['_xh']['cookies'];
+ $r->raw_data = $raw_data;
+ return $r;
+ }
+
+ // try to 'guestimate' the character encoding of the received response
+ $resp_encoding = guess_encoding(@$GLOBALS['_xh']['headers']['content-type'], $data);
- //$_xh[$parser]['st']='';
- //$_xh[$parser]['cm']=0;
- $_xh[$parser]['isf']=0;
- $_xh[$parser]['isf_reason']=0;
- $_xh[$parser]['ac']='';
- //$_xh[$parser]['qt']='';
+ $GLOBALS['_xh']['ac']='';
+ //$GLOBALS['_xh']['qt']=''; //unused...
+ $GLOBALS['_xh']['stack'] = array();
+ $GLOBALS['_xh']['valuestack'] = array();
+ $GLOBALS['_xh']['isf']=0; // 0 = OK, 1 for xmlrpc fault responses, 2 = invalid xmlrpc
+ $GLOBALS['_xh']['isf_reason']='';
+ $GLOBALS['_xh']['rt']=''; // 'methodcall or 'methodresponse'
+ // if response charset encoding is not known / supported, try to use
+ // the default encoding and parse the xml anyway, but log a warning...
+ if (!in_array($resp_encoding, array('UTF-8', 'ISO-8859-1', 'US-ASCII')))
+ // the following code might be better for mb_string enabled installs, but
+ // makes the lib about 200% slower...
+ //if (!is_valid_charset($resp_encoding, array('UTF-8', 'ISO-8859-1', 'US-ASCII')))
+ {
+ error_log('XML-RPC: xmlrpcmsg::parseResponse: invalid charset encoding of received response: '.$resp_encoding);
+ $resp_encoding = $GLOBALS['xmlrpc_defencoding'];
+ }
+ $parser = xml_parser_create($resp_encoding);
xml_parser_set_option($parser, XML_OPTION_CASE_FOLDING, true);
// G. Giunta 2005/02/13: PHP internally uses ISO-8859-1, so we have to tell
// the xml parser to give us back data in the expected charset
- xml_parser_set_option($parser, XML_OPTION_TARGET_ENCODING, $xmlrpc_internalencoding);
+ xml_parser_set_option($parser, XML_OPTION_TARGET_ENCODING, $GLOBALS['xmlrpc_internalencoding']);
+
+ if ($return_type == 'phpvals')
+ {
+ xml_set_element_handler($parser, 'xmlrpc_se', 'xmlrpc_ee_fast');
+ }
+ else
+ {
+ xml_set_element_handler($parser, 'xmlrpc_se', 'xmlrpc_ee');
+ }
- xml_set_element_handler($parser, 'xmlrpc_se', 'xmlrpc_ee');
xml_set_character_data_handler($parser, 'xmlrpc_cd');
xml_set_default_handler($parser, 'xmlrpc_dh');
- //$xmlrpc_value=new xmlrpcval;
- if (!xml_parse($parser, $data, sizeof($data)))
+ // first error check: xml not well formed
+ if(!xml_parse($parser, $data, count($data)))
{
// thanks to Peter Kocks <peter.kocks@baygate.com>
if((xml_get_current_line_number($parser)) == 1)
}
else
{
- $errstr = sprintf('XML error: %s at line %d',
+ $errstr = sprintf('XML error: %s at line %d, column %d',
xml_error_string(xml_get_error_code($parser)),
- xml_get_current_line_number($parser));
+ xml_get_current_line_number($parser), xml_get_current_column_number($parser));
}
error_log($errstr);
- $r=new xmlrpcresp(0, $xmlrpcerr['invalid_return'], $xmlrpcstr['invalid_return'].' ('.$errstr.')');
+ $r=&new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['invalid_return'], $GLOBALS['xmlrpcstr']['invalid_return'].' ('.$errstr.')');
xml_parser_free($parser);
- if ($this->debug)
- echo $errstr;
- $r->hdrs = $_xh[$parser]['headers'];
+ if($this->debug)
+ {
+ print $errstr;
+ }
+ $r->hdrs = $GLOBALS['_xh']['headers'];
+ $r->_cookies = $GLOBALS['_xh']['cookies'];
+ $r->raw_data = $raw_data;
return $r;
}
xml_parser_free($parser);
-
- if ($_xh[$parser]['isf'] > 1)
+ // second error check: xml well formed but not xml-rpc compliant
+ if ($GLOBALS['_xh']['isf'] > 1)
{
- if ($this->debug)
- {
- ///@todo echo something for user?
+ if ($this->debug)
+ {
+ /// @todo echo something for user?
}
- $r = new xmlrpcresp(0, $xmlrpcerr['invalid_return'],
- $xmlrpcstr['invalid_return'] . ' ' . $_xh[$parser]['isf_reason']);
+ $r =& new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['invalid_return'],
+ $GLOBALS['xmlrpcstr']['invalid_return'] . ' ' . $GLOBALS['_xh']['isf_reason']);
}
- //else if (strlen($_xh[$parser]['st'])==0)
- else if (!is_object($_xh[$parser]['value']))
+ // third error check: parsing of the response has somehow gone boink.
+ // NB: shall we omit this check, since we trust the parsing code?
+ elseif ($return_type == 'xmlrpcvals' && !is_object($GLOBALS['_xh']['value']))
{
- // then something odd has happened
+ // something odd has happened
// and it's time to generate a client side error
// indicating something odd went on
- $r=new xmlrpcresp(0, $xmlrpcerr['invalid_return'],
- $xmlrpcstr['invalid_return']);
+ $r=&new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['invalid_return'],
+ $GLOBALS['xmlrpcstr']['invalid_return']);
}
else
{
-
if ($this->debug)
{
- //print "<PRE>---EVALING---[" .
- //strlen($_xh[$parser]['st']) . " chars]---\n" .
- //htmlspecialchars($_xh[$parser]['st']) . ";\n---END---</PRE>";
- print "<PRE>---PARSED---\n" ;
- var_dump($_xh[$parser]['value']);
+ print "<PRE>---PARSED---\n";
+ // somehow htmlentities chokes on var_export, and some full html string...
+ //print htmlentitites(var_export($GLOBALS['_xh']['value'], true));
+ print htmlspecialchars(var_export($GLOBALS['_xh']['value'], true));
print "\n---END---</PRE>";
}
- //$allOK=0;
- //@eval('$v=' . $_xh[$parser]['st'] . '; $allOK=1;');
- //if (!$allOK)
- //{
- // $r = new xmlrpcresp(0, $xmlrpcerr['invalid_return'], $xmlrpcstr['invalid_return']);
- //}
- //else
- $v = $_xh[$parser]['value'];
- if ($_xh[$parser]['isf'])
+ // note that using =& will raise an error if $GLOBALS['_xh']['st'] does not generate an object.
+ $v =& $GLOBALS['_xh']['value'];
+
+ if($GLOBALS['_xh']['isf'])
{
- $errno_v = $v->structmem('faultCode');
- $errstr_v = $v->structmem('faultString');
- $errno = $errno_v->scalarval();
+ /// @todo we should test here if server sent an int and a string,
+ /// and/or coerce them into such...
+ if ($return_type == 'xmlrpcvals')
+ {
+ $errno_v = $v->structmem('faultCode');
+ $errstr_v = $v->structmem('faultString');
+ $errno = $errno_v->scalarval();
+ $errstr = $errstr_v->scalarval();
+ }
+ else
+ {
+ $errno = $v['faultCode'];
+ $errstr = $v['faultString'];
+ }
- if ($errno == 0)
+ if($errno == 0)
{
// FAULT returned, errno needs to reflect that
$errno = -1;
}
- $r = new xmlrpcresp($v, $errno, $errstr_v->scalarval());
+ $r =& new xmlrpcresp(0, $errno, $errstr);
}
else
{
- $r=new xmlrpcresp($v);
+ $r=&new xmlrpcresp($v, 0, '', $return_type);
}
}
- $r->hdrs = $_xh[$parser]['headers'];
+ $r->hdrs = $GLOBALS['_xh']['headers'];
+ $r->_cookies = $GLOBALS['_xh']['cookies'];
+ $r->raw_data = $raw_data;
return $r;
}
}
{
var $me=array();
var $mytype=0;
+ var $_php_class=null;
+ /**
+ * @param mixed $val
+ * @param string $type any valid xmlrpc type name (lowercase). If null, 'string' is assumed
+ */
function xmlrpcval($val=-1, $type='')
{
- global $xmlrpcTypes;
- $this->me=array();
- $this->mytype=0;
- if ($val!=-1 || !is_int($val) || $type!='')
+ /// @todo: optimization creep - do not call addXX, do it all inline.
+ /// downside: booleans will not be coerced anymore
+ if($val!==-1 || $type!='')
{
- if ($type=='')
+ // optimization creep: inlined all work done by constructor
+ switch($type)
+ {
+ case '':
+ $this->mytype=1;
+ $this->me['string']=$val;
+ break;
+ case 'i4':
+ case 'int':
+ case 'double':
+ case 'string':
+ case 'boolean':
+ case 'dateTime.iso8601':
+ case 'base64':
+ case 'null':
+ $this->mytype=1;
+ $this->me[$type]=$val;
+ break;
+ case 'array':
+ $this->mytype=2;
+ $this->me['array']=$val;
+ break;
+ case 'struct':
+ $this->mytype=3;
+ $this->me['struct']=$val;
+ break;
+ default:
+ error_log("XML-RPC: xmlrpcval::xmlrpcval: not a known type ($type)");
+ }
+ /*if($type=='')
{
$type='string';
}
- if ($xmlrpcTypes[$type]==1)
+ if($GLOBALS['xmlrpcTypes'][$type]==1)
{
$this->addScalar($val,$type);
}
- elseif ($xmlrpcTypes[$type]==2)
+ elseif($GLOBALS['xmlrpcTypes'][$type]==2)
{
$this->addArray($val);
}
- elseif ($xmlrpcTypes[$type]==3)
+ elseif($GLOBALS['xmlrpcTypes'][$type]==3)
{
$this->addStruct($val);
- }
+ }*/
}
}
+ /**
+ * Add a single php value to an (unitialized) xmlrpcval
+ * @param mixed $val
+ * @param string $type
+ * @return int 1 or 0 on failure
+ */
function addScalar($val, $type='string')
{
- global $xmlrpcTypes, $xmlrpcBoolean;
-
- if ($this->mytype==1)
- {
- echo '<B>xmlrpcval</B>: scalar can have only one value<BR>';
- return 0;
- }
- $typeof=$xmlrpcTypes[$type];
- if ($typeof!=1)
+ $typeof=@$GLOBALS['xmlrpcTypes'][$type];
+ if($typeof!=1)
{
- echo '<B>xmlrpcval</B>: not a scalar type (${typeof})<BR>';
+ error_log("XML-RPC: xmlrpcval::addScalar: not a scalar type ($type)");
return 0;
}
- if ($type==$xmlrpcBoolean)
+ // coerce booleans into correct values
+ // NB: we should iether do it for datetimes, integers and doubles, too,
+ // or just plain remove this check, implemnted on booleans only...
+ if($type==$GLOBALS['xmlrpcBoolean'])
{
- if (strcasecmp($val,'true')==0 || $val==1 || ($val==true && strcasecmp($val,'false')))
+ if(strcasecmp($val,'true')==0 || $val==1 || ($val==true && strcasecmp($val,'false')))
{
- $val=1;
+ $val=true;
}
else
{
- $val=0;
+ $val=false;
}
}
- if ($this->mytype==2)
- {
- // we're adding to an array here
- $ar=$this->me['array'];
- $ar[]=new xmlrpcval($val, $type);
- $this->me['array']=$ar;
- }
- else
+ switch($this->mytype)
{
- // a scalar, so set the value and remember we're scalar
- $this->me[$type]=$val;
- $this->mytype=$typeof;
+ case 1:
+ error_log('XML-RPC: xmlrpcval::addScalar: scalar xmlrpcval can have only one value');
+ return 0;
+ case 3:
+ error_log('XML-RPC: xmlrpcval::addScalar: cannot add anonymous scalar to struct xmlrpcval');
+ return 0;
+ case 2:
+ // we're adding a scalar value to an array here
+ //$ar=$this->me['array'];
+ //$ar[]=&new xmlrpcval($val, $type);
+ //$this->me['array']=$ar;
+ // Faster (?) avoid all the costly array-copy-by-val done here...
+ $this->me['array'][]=&new xmlrpcval($val, $type);
+ return 1;
+ default:
+ // a scalar, so set the value and remember we're scalar
+ $this->me[$type]=$val;
+ $this->mytype=$typeof;
+ return 1;
}
- return 1;
}
+ /**
+ * Add an array of xmlrpcval objects to an xmlrpcval
+ * @param array $vals
+ * @return int 1 or 0 on failure
+ * @access public
+ *
+ * @todo add some checking for $vals to be an array of xmlrpcvals?
+ */
function addArray($vals)
{
- global $xmlrpcTypes;
- if ($this->mytype!=0)
+ if($this->mytype==0)
+ {
+ $this->mytype=$GLOBALS['xmlrpcTypes']['array'];
+ $this->me['array']=$vals;
+ return 1;
+ }
+ elseif($this->mytype==2)
+ {
+ // we're adding to an array here
+ $this->me['array'] = array_merge($this->me['array'], $vals);
+ return 1;
+ }
+ else
{
- echo '<B>xmlrpcval</B>: already initialized as a [' . $this->kindOf() . ']<BR>';
+ error_log('XML-RPC: xmlrpcval::addArray: already initialized as a [' . $this->kindOf() . ']');
return 0;
}
-
- $this->mytype=$xmlrpcTypes['array'];
- $this->me['array']=$vals;
- return 1;
}
+ /**
+ * Add an array of named xmlrpcval objects to an xmlrpcval
+ * @param array $vals
+ * @return int 1 or 0 on failure
+ * @access public
+ *
+ * @todo add some checking for $vals to be an array?
+ */
function addStruct($vals)
{
- global $xmlrpcTypes;
- if ($this->mytype!=0)
+ if($this->mytype==0)
{
- echo '<B>xmlrpcval</B>: already initialized as a [' . $this->kindOf() . ']<BR>';
+ $this->mytype=$GLOBALS['xmlrpcTypes']['struct'];
+ $this->me['struct']=$vals;
+ return 1;
+ }
+ elseif($this->mytype==3)
+ {
+ // we're adding to a struct here
+ $this->me['struct'] = array_merge($this->me['struct'], $vals);
+ return 1;
+ }
+ else
+ {
+ error_log('XML-RPC: xmlrpcval::addStruct: already initialized as a [' . $this->kindOf() . ']');
return 0;
}
- $this->mytype=$xmlrpcTypes['struct'];
- $this->me['struct']=$vals;
- return 1;
}
+ // poor man's version of print_r ???
+ // DEPRECATED!
function dump($ar)
{
- reset($ar);
- while ( list( $key, $val ) = each( $ar ) )
+ foreach($ar as $key => $val)
{
- echo "$key => $val<br>";
- if ($key == 'array')
+ echo "$key => $val<br />";
+ if($key == 'array')
{
- while ( list( $key2, $val2 ) = each( $val ) )
+ while(list($key2, $val2) = each($val))
{
- echo "-- $key2 => $val2<br>";
+ echo "-- $key2 => $val2<br />";
}
}
}
}
+ /**
+ * Returns a string containing "struct", "array" or "scalar" describing the base type of the value
+ * @return string
+ * @access public
+ */
function kindOf()
{
switch($this->mytype)
}
}
- function serializedata($typ, $val)
+ /**
+ * @access private
+ */
+ function serializedata($typ, $val, $charset_encoding='')
{
$rs='';
- global $xmlrpcTypes, $xmlrpcBase64, $xmlrpcString,
- $xmlrpcBoolean;
- switch(@$xmlrpcTypes[$typ])
+ switch(@$GLOBALS['xmlrpcTypes'][$typ])
{
+ case 1:
+ switch($typ)
+ {
+ case $GLOBALS['xmlrpcBase64']:
+ $rs.="<${typ}>" . base64_encode($val) . "</${typ}>";
+ break;
+ case $GLOBALS['xmlrpcBoolean']:
+ $rs.="<${typ}>" . ($val ? '1' : '0') . "</${typ}>";
+ break;
+ case $GLOBALS['xmlrpcString']:
+ // G. Giunta 2005/2/13: do NOT use htmlentities, since
+ // it will produce named html entities, which are invalid xml
+ $rs.="<${typ}>" . xmlrpc_encode_entitites($val, $GLOBALS['xmlrpc_internalencoding'], $charset_encoding). "</${typ}>";
+ break;
+ case $GLOBALS['xmlrpcInt']:
+ case $GLOBALS['xmlrpcI4']:
+ $rs.="<${typ}>".(int)$val."</${typ}>";
+ break;
+ case $GLOBALS['xmlrpcDouble']:
+ $rs.="<${typ}>".(double)$val."</${typ}>";
+ break;
+ case $GLOBALS['xmlrpcNull']:
+ $rs.="<nil/>";
+ break;
+ default:
+ // no standard type value should arrive here, but provide a possibility
+ // for xmlrpcvals of unknown type...
+ $rs.="<${typ}>${val}</${typ}>";
+ }
+ break;
case 3:
// struct
- $rs.="<struct>\n";
- reset($val);
- while(list($key2, $val2)=each($val))
+ if ($this->_php_class)
+ {
+ $rs.='<struct php_class="' . $this->_php_class . "\">\n";
+ }
+ else
{
- $rs.="<member><name>${key2}</name>\n";
- $rs.=$this->serializeval($val2);
+ $rs.="<struct>\n";
+ }
+ foreach($val as $key2 => $val2)
+ {
+ $rs.='<member><name>'.xmlrpc_encode_entitites($key2, $GLOBALS['xmlrpc_internalencoding'], $charset_encoding)."</name>\n";
+ //$rs.=$this->serializeval($val2);
+ $rs.=$val2->serialize($charset_encoding);
$rs.="</member>\n";
}
$rs.='</struct>';
case 2:
// array
$rs.="<array>\n<data>\n";
- for($i=0; $i<sizeof($val); $i++)
+ for($i=0; $i<count($val); $i++)
{
- $rs.=$this->serializeval($val[$i]);
+ //$rs.=$this->serializeval($val[$i]);
+ $rs.=$val[$i]->serialize($charset_encoding);
}
$rs.="</data>\n</array>";
break;
- case 1:
- switch ($typ)
- {
- case $xmlrpcBase64:
- $rs.="<${typ}>" . base64_encode($val) . "</${typ}>";
- break;
- case $xmlrpcBoolean:
- $rs.="<${typ}>" . ($val ? '1' : '0') . "</${typ}>";
- break;
- case $xmlrpcString:
- // G. Giunta 2005/2/13: do NOT use htmlentities, since
- // it will produce named html entities, which are invalid xml
- // $rs.="<${typ}>" . xmlrpc_encode_entitites($val). "</${typ}>";
- // $rs.="<${typ}>" . htmlentities($val). "</${typ}>";
-
- // N. Leenheer 2005/6/30: Use CDATA instead...
- $rs.="<${typ}><![CDATA[" . $val. "]]></${typ}>";
- break;
- default:
- $rs.="<${typ}>${val}</${typ}>";
- }
- break;
default:
break;
}
return $rs;
}
- function serialize()
- {
- return $this->serializeval($this);
+ /**
+ * Returns xml representation of the value. XML prologue not included
+ * @param string $charset_encoding the charset to be used for serialization. if null, US-ASCII is assumed
+ * @return string
+ * @access public
+ */
+ function serialize($charset_encoding='')
+ {
+ // add check? slower, but helps to avoid recursion in serializing broken xmlrpcvals...
+ //if (is_object($o) && (get_class($o) == 'xmlrpcval' || is_subclass_of($o, 'xmlrpcval')))
+ //{
+ reset($this->me);
+ list($typ, $val) = each($this->me);
+ return '<value>' . $this->serializedata($typ, $val, $charset_encoding) . "</value>\n";
+ //}
}
+ // DEPRECATED
function serializeval($o)
{
- //global $xmlrpcTypes;
- $rs='';
- $ar=$o->me;
- reset($ar);
- list($typ, $val) = each($ar);
- $rs.='<value>';
- $rs.=$this->serializedata($typ, $val);
- $rs.="</value>\n";
- return $rs;
+ // add check? slower, but helps to avoid recursion in serializing broken xmlrpcvals...
+ //if (is_object($o) && (get_class($o) == 'xmlrpcval' || is_subclass_of($o, 'xmlrpcval')))
+ //{
+ $ar=$o->me;
+ reset($ar);
+ list($typ, $val) = each($ar);
+ return '<value>' . $this->serializedata($typ, $val) . "</value>\n";
+ //}
+ }
+
+ /**
+ * Checks wheter a struct member with a given name is present.
+ * Works only on xmlrpcvals of type struct.
+ * @param string $m the name of the struct member to be looked up
+ * @return boolean
+ * @access public
+ */
+ function structmemexists($m)
+ {
+ return array_key_exists($m, $this->me['struct']);
}
+ /**
+ * Returns the value of a given struct member (an xmlrpcval object in itself).
+ * Will raise a php warning if struct member of given name does not exist
+ * @param string $m the name of the struct member to be looked up
+ * @return xmlrpcval
+ * @access public
+ */
function structmem($m)
{
- $nv=$this->me['struct'][$m];
- return $nv;
+ return $this->me['struct'][$m];
}
+ /**
+ * Reset internal pointer for xmlrpcvals of type struct.
+ * @access public
+ */
function structreset()
{
reset($this->me['struct']);
}
+ /**
+ * Return next member element for xmlrpcvals of type struct.
+ * @return xmlrpcval
+ * @access public
+ */
function structeach()
{
return each($this->me['struct']);
}
+ // DEPRECATED! this code looks like it is very fragile and has not been fixed
+ // for a long long time. Shall we remove it for 2.0?
function getval()
{
// UNSTABLE
- global $xmlrpcBoolean, $xmlrpcBase64;
reset($this->me);
list($a,$b)=each($this->me);
// contributed by I Sofer, 2001-03-24
// i've created a new method here, so as to
// preserve back compatibility
- if (is_array($b))
+ if(is_array($b))
{
@reset($b);
while(list($id,$cont) = @each($b))
}
// add support for structures directly encoding php objects
- if (is_object($b))
+ if(is_object($b))
{
$t = get_object_vars($b);
@reset($t);
@reset($t);
while(list($id,$cont) = @each($t))
{
- //eval('$b->'.$id.' = $cont;');
@$b->$id = $cont;
}
}
return $b;
}
+ /**
+ * Returns the value of a scalar xmlrpcval
+ * @return mixed
+ * @access public
+ */
function scalarval()
{
- //global $xmlrpcBoolean, $xmlrpcBase64;
reset($this->me);
- list($a,$b)=each($this->me);
+ list(,$b)=each($this->me);
return $b;
}
+ /**
+ * Returns the type of the xmlrpcval.
+ * For integers, 'int' is always returned in place of 'i4'
+ * @return string
+ * @access public
+ */
function scalartyp()
{
- global $xmlrpcI4, $xmlrpcInt;
reset($this->me);
- list($a,$b)=each($this->me);
- if ($a==$xmlrpcI4)
+ list($a,)=each($this->me);
+ if($a==$GLOBALS['xmlrpcI4'])
{
- $a=$xmlrpcInt;
+ $a=$GLOBALS['xmlrpcInt'];
}
return $a;
}
+ /**
+ * Returns the m-th member of an xmlrpcval of struct type
+ * @param integer $m the index of the value to be retrieved (zero based)
+ * @return xmlrpcval
+ * @access public
+ */
function arraymem($m)
{
- $nv=$this->me['array'][$m];
- return $nv;
+ return $this->me['array'][$m];
}
+ /**
+ * Returns the number of members in an xmlrpcval of array type
+ * @return integer
+ * @access public
+ */
function arraysize()
{
- reset($this->me);
- list($a,$b)=each($this->me);
- return sizeof($b);
+ return count($this->me['array']);
+ }
+
+ /**
+ * Returns the number of members in an xmlrpcval of struct type
+ * @return integer
+ * @access public
+ */
+ function structsize()
+ {
+ return count($this->me['struct']);
}
}
+
// date helpers
+
+ /**
+ * Given a timestamp, return the corresponding ISO8601 encoded string.
+ *
+ * Really, timezones ought to be supported
+ * but the XML-RPC spec says:
+ *
+ * "Don't assume a timezone. It should be specified by the server in its
+ * documentation what assumptions it makes about timezones."
+ *
+ * These routines always assume localtime unless
+ * $utc is set to 1, in which case UTC is assumed
+ * and an adjustment for locale is made when encoding
+ *
+ * @param int $timet (timestamp)
+ * @param int $utc (0 or 1)
+ * @return string
+ */
function iso8601_encode($timet, $utc=0)
{
- // return an ISO8601 encoded string
- // really, timezones ought to be supported
- // but the XML-RPC spec says:
- //
- // "Don't assume a timezone. It should be specified by the server in its
- // documentation what assumptions it makes about timezones."
- //
- // these routines always assume localtime unless
- // $utc is set to 1, in which case UTC is assumed
- // and an adjustment for locale is made when encoding
- if (!$utc)
+ if(!$utc)
{
$t=strftime("%Y%m%dT%H:%M:%S", $timet);
}
else
{
- if (function_exists('gmstrftime'))
+ if(function_exists('gmstrftime'))
{
// gmstrftime doesn't exist in some versions
// of PHP
return $t;
}
+ /**
+ * Given an ISO8601 date string, return a timet in the localtime, or UTC
+ * @param string $idate
+ * @param int $utc either 0 or 1
+ * @return int (datetime)
+ */
function iso8601_decode($idate, $utc=0)
{
- // return a timet in the localtime, or UTC
$t=0;
- if (ereg("([0-9]{4})([0-9]{2})([0-9]{2})T([0-9]{2}):([0-9]{2}):([0-9]{2})", $idate, $regs))
+ if(preg_match('/([0-9]{4})([0-9]{2})([0-9]{2})T([0-9]{2}):([0-9]{2}):([0-9]{2})/', $idate, $regs))
{
- if ($utc)
+ if($utc)
{
$t=gmmktime($regs[4], $regs[5], $regs[6], $regs[2], $regs[3], $regs[1]);
}
{
$t=mktime($regs[4], $regs[5], $regs[6], $regs[2], $regs[3], $regs[1]);
}
- }
- return $t;
- }
-
- /****************************************************************
- * xmlrpc_decode takes a message in PHP xmlrpc object format and *
- * tranlates it into native PHP types. *
- * *
- * author: Dan Libby (dan@libby.com) *
- ****************************************************************/
- function php_xmlrpc_decode($xmlrpc_val)
- {
- $kind = $xmlrpc_val->kindOf();
-
- if($kind == 'scalar')
- {
- return $xmlrpc_val->scalarval();
- }
- elseif($kind == 'array')
- {
- $size = $xmlrpc_val->arraysize();
- $arr = array();
-
- for($i = 0; $i < $size; $i++)
- {
- $arr[] = php_xmlrpc_decode($xmlrpc_val->arraymem($i));
- }
- return $arr;
- }
- elseif($kind == 'struct')
- {
- $xmlrpc_val->structreset();
- $arr = array();
-
- while(list($key,$value)=$xmlrpc_val->structeach())
- {
- $arr[$key] = php_xmlrpc_decode($value);
- }
- return $arr;
}
+ return $t;
}
- if(function_exists('xmlrpc_decode'))
- {
- define('XMLRPC_EPI_ENABLED','1');
- }
- else
+ /**
+ * Takes an xmlrpc value in PHP xmlrpcval object format and translates it into native PHP types.
+ *
+ * Works with xmlrpc message objects as input, too.
+ *
+ * Given proper options parameter, can rebuild generic php object instances
+ * (provided those have been encoded to xmlrpc format using a corresponding
+ * option in php_xmlrpc_encode())
+ * PLEASE NOTE that rebuilding php objects involves calling their constructor function.
+ * This means that the remote communication end can decide which php code will
+ * get executed on your server, leaving the door possibly open to 'php-injection'
+ * style of attacks (provided you have some classes defined on your server that
+ * might wreak havoc if instances are built outside an appropriate context).
+ * Make sure you trust the remote server/client before eanbling this!
+ *
+ * @author Dan Libby (dan@libby.com)
+ *
+ * @param xmlrpcval $xmlrpc_val
+ * @param array $options if 'decode_php_objs' is set in the options array, xmlrpc structs can be decoded into php objects
+ * @return mixed
+ */
+ function php_xmlrpc_decode($xmlrpc_val, $options=array())
{
- define('XMLRPC_EPI_ENABLED','0');
- function xmlrpc_decode($xmlrpc_val)
+ switch($xmlrpc_val->kindOf())
{
- $kind = $xmlrpc_val->kindOf();
-
- if($kind == 'scalar')
- {
+ case 'scalar':
+ if (in_array('extension_api', $options))
+ {
+ reset($xmlrpc_val->me);
+ list($typ,$val) = each($xmlrpc_val->me);
+ switch ($typ)
+ {
+ case 'dateTime.iso8601':
+ $xmlrpc_val->scalar = $val;
+ $xmlrpc_val->xmlrpc_type = 'datetime';
+ $xmlrpc_val->timestamp = iso8601_decode($val);
+ return $xmlrpc_val;
+ case 'base64':
+ $xmlrpc_val->scalar = $val;
+ $xmlrpc_val->type = $typ;
+ return $xmlrpc_val;
+ default:
+ return $xmlrpc_val->scalarval();
+ }
+ }
return $xmlrpc_val->scalarval();
- }
- elseif($kind == 'array')
- {
+ case 'array':
$size = $xmlrpc_val->arraysize();
$arr = array();
-
for($i = 0; $i < $size; $i++)
{
- $arr[]=xmlrpc_decode($xmlrpc_val->arraymem($i));
+ $arr[] = php_xmlrpc_decode($xmlrpc_val->arraymem($i), $options);
}
return $arr;
- }
- elseif($kind == 'struct')
- {
+ case 'struct':
$xmlrpc_val->structreset();
+ // If user said so, try to rebuild php objects for specific struct vals.
+ /// @todo should we raise a warning for class not found?
+ // shall we check for proper subclass of xmlrpcval instead of
+ // presence of _php_class to detect what we can do?
+ if (in_array('decode_php_objs', $options) && $xmlrpc_val->_php_class != ''
+ && class_exists($xmlrpc_val->_php_class))
+ {
+ $obj = @new $xmlrpc_val->_php_class;
+ while(list($key,$value)=$xmlrpc_val->structeach())
+ {
+ $obj->$key = php_xmlrpc_decode($value, $options);
+ }
+ return $obj;
+ }
+ else
+ {
+ $arr = array();
+ while(list($key,$value)=$xmlrpc_val->structeach())
+ {
+ $arr[$key] = php_xmlrpc_decode($value, $options);
+ }
+ return $arr;
+ }
+ case 'msg':
+ $paramcount = $xmlrpc_val->getNumParams();
$arr = array();
-
- while(list($key,$value)=$xmlrpc_val->structeach())
+ for($i = 0; $i < $paramcount; $i++)
{
- $arr[$key] = xmlrpc_decode($value);
+ $arr[] = php_xmlrpc_decode($xmlrpc_val->getParam($i));
}
return $arr;
}
- }
}
- /****************************************************************
- * xmlrpc_encode takes native php types and encodes them into *
- * xmlrpc PHP object format. *
- * BUG: All sequential arrays are turned into structs. I don't *
- * know of a good way to determine if an array is sequential *
- * only. *
- * *
- * feature creep -- could support more types via optional type *
- * argument. *
- * *
- * author: Dan Libby (dan@libby.com) *
- ****************************************************************/
- function php_xmlrpc_encode($php_val)
+ // This constant left here only for historical reasons...
+ // it was used to decide if we have to define xmlrpc_encode on our own, but
+ // we do not do it anymore
+ if(function_exists('xmlrpc_decode'))
+ {
+ define('XMLRPC_EPI_ENABLED','1');
+ }
+ else
{
- global $xmlrpcInt;
- global $xmlrpcDouble;
- global $xmlrpcString;
- global $xmlrpcArray;
- global $xmlrpcStruct;
- global $xmlrpcBoolean;
+ define('XMLRPC_EPI_ENABLED','0');
+ }
+ /**
+ * Takes native php types and encodes them into xmlrpc PHP object format.
+ * It will not re-encode xmlrpcval objects.
+ *
+ * Feature creep -- could support more types via optional type argument
+ * (string => datetime support has been added, ??? => base64 not yet)
+ *
+ * If given a proper options parameter, php object instances will be encoded
+ * into 'special' xmlrpc values, that can later be decoded into php objects
+ * by calling php_xmlrpc_decode() with a corresponding option
+ *
+ * @author Dan Libby (dan@libby.com)
+ *
+ * @param mixed $php_val the value to be converted into an xmlrpcval object
+ * @param array $options can include 'encode_php_objs', 'auto_dates', 'null_extension' or 'extension_api'
+ * @return xmlrpcval
+ */
+ function &php_xmlrpc_encode($php_val, $options=array())
+ {
$type = gettype($php_val);
- $xmlrpc_val = new xmlrpcval;
-
switch($type)
{
- case 'array':
- case 'object':
- $arr = array();
- while (list($k,$v) = each($php_val))
- {
- $arr[$k] = php_xmlrpc_encode($v);
- }
- $xmlrpc_val->addStruct($arr);
+ case 'string':
+ if (in_array('auto_dates', $options) && preg_match('/^[0-9]{8}T[0-9]{2}:[0-9]{2}:[0-9]{2}$/', $php_val))
+ $xmlrpc_val =& new xmlrpcval($php_val, $GLOBALS['xmlrpcDateTime']);
+ else
+ $xmlrpc_val =& new xmlrpcval($php_val, $GLOBALS['xmlrpcString']);
break;
case 'integer':
- $xmlrpc_val->addScalar($php_val, $xmlrpcInt);
+ $xmlrpc_val =& new xmlrpcval($php_val, $GLOBALS['xmlrpcInt']);
break;
case 'double':
- $xmlrpc_val->addScalar($php_val, $xmlrpcDouble);
- break;
- case 'string':
- $xmlrpc_val->addScalar($php_val, $xmlrpcString);
+ $xmlrpc_val =& new xmlrpcval($php_val, $GLOBALS['xmlrpcDouble']);
break;
// <G_Giunta_2001-02-29>
// Add support for encoding/decoding of booleans, since they are supported in PHP
case 'boolean':
- $xmlrpc_val->addScalar($php_val, $xmlrpcBoolean);
+ $xmlrpc_val =& new xmlrpcval($php_val, $GLOBALS['xmlrpcBoolean']);
break;
// </G_Giunta_2001-02-29>
- // catch "resource", "NULL", "user function", "unknown type"
- //case 'unknown type':
+ case 'array':
+ // PHP arrays can be encoded to either xmlrpc structs or arrays,
+ // depending on wheter they are hashes or plain 0..n integer indexed
+ // A shorter one-liner would be
+ // $tmp = array_diff(array_keys($php_val), range(0, count($php_val)-1));
+ // but execution time skyrockets!
+ $j = 0;
+ $arr = array();
+ $ko = false;
+ foreach($php_val as $key => $val)
+ {
+ $arr[$key] =& php_xmlrpc_encode($val, $options);
+ if(!$ko && $key !== $j)
+ {
+ $ko = true;
+ }
+ $j++;
+ }
+ if($ko)
+ {
+ $xmlrpc_val =& new xmlrpcval($arr, $GLOBALS['xmlrpcStruct']);
+ }
+ else
+ {
+ $xmlrpc_val =& new xmlrpcval($arr, $GLOBALS['xmlrpcArray']);
+ }
+ break;
+ case 'object':
+ if(is_a($php_val, 'xmlrpcval'))
+ {
+ $xmlrpc_val = $php_val;
+ }
+ else
+ {
+ $arr = array();
+ while(list($k,$v) = each($php_val))
+ {
+ $arr[$k] = php_xmlrpc_encode($v, $options);
+ }
+ $xmlrpc_val =& new xmlrpcval($arr, $GLOBALS['xmlrpcStruct']);
+ if (in_array('encode_php_objs', $options))
+ {
+ // let's save original class name into xmlrpcval:
+ // might be useful later on...
+ $xmlrpc_val->_php_class = get_class($php_val);
+ }
+ }
+ break;
+ case 'NULL':
+ if (in_array('extension_api', $options))
+ {
+ $xmlrpc_val =& new xmlrpcval('', $GLOBALS['xmlrpcString']);
+ }
+ if (in_array('null_extension', $options))
+ {
+ $xmlrpc_val =& new xmlrpcval('', $GLOBALS['xmlrpcNull']);
+ }
+ else
+ {
+ $xmlrpc_val =& new xmlrpcval();
+ }
+ break;
+ case 'resource':
+ if (in_array('extension_api', $options))
+ {
+ $xmlrpc_val =& new xmlrpcval((int)$php_val, $GLOBALS['xmlrpcInt']);
+ }
+ else
+ {
+ $xmlrpc_val =& new xmlrpcval();
+ }
+ // catch "user function", "unknown type"
default:
// giancarlo pinerolo <ping@alt.it>
- // it has to return
- // an empty object in case (which is already
- // at this point), not a boolean.
+ // it has to return
+ // an empty object in case, not a boolean.
+ $xmlrpc_val =& new xmlrpcval();
break;
}
return $xmlrpc_val;
}
- if(XMLRPC_EPI_ENABLED == '0')
+ /**
+ * Convert the xml representation of a method response, method request or single
+ * xmlrpc value into the appropriate object (a.k.a. deserialize)
+ * @param string $xml_val
+ * @param array $options
+ * @return mixed false on error, or an instance of either xmlrpcval, xmlrpcmsg or xmlrpcresp
+ */
+ function php_xmlrpc_decode_xml($xml_val, $options=array())
+ {
+ $GLOBALS['_xh'] = array();
+ $GLOBALS['_xh']['ac'] = '';
+ $GLOBALS['_xh']['stack'] = array();
+ $GLOBALS['_xh']['valuestack'] = array();
+ $GLOBALS['_xh']['params'] = array();
+ $GLOBALS['_xh']['pt'] = array();
+ $GLOBALS['_xh']['isf'] = 0;
+ $GLOBALS['_xh']['isf_reason'] = '';
+ $GLOBALS['_xh']['method'] = false;
+ $GLOBALS['_xh']['rt'] = '';
+ /// @todo 'guestimate' encoding
+ $parser = xml_parser_create();
+ xml_parser_set_option($parser, XML_OPTION_CASE_FOLDING, true);
+ xml_parser_set_option($parser, XML_OPTION_TARGET_ENCODING, $GLOBALS['xmlrpc_internalencoding']);
+ xml_set_element_handler($parser, 'xmlrpc_se_any', 'xmlrpc_ee');
+ xml_set_character_data_handler($parser, 'xmlrpc_cd');
+ xml_set_default_handler($parser, 'xmlrpc_dh');
+ if(!xml_parse($parser, $xml_val, 1))
+ {
+ $errstr = sprintf('XML error: %s at line %d, column %d',
+ xml_error_string(xml_get_error_code($parser)),
+ xml_get_current_line_number($parser), xml_get_current_column_number($parser));
+ error_log($errstr);
+ xml_parser_free($parser);
+ return false;
+ }
+ xml_parser_free($parser);
+ if ($GLOBALS['_xh']['isf'] > 1) // test that $GLOBALS['_xh']['value'] is an obj, too???
+ {
+ error_log($GLOBALS['_xh']['isf_reason']);
+ return false;
+ }
+ switch ($GLOBALS['_xh']['rt'])
+ {
+ case 'methodresponse':
+ $v =& $GLOBALS['_xh']['value'];
+ if ($GLOBALS['_xh']['isf'] == 1)
+ {
+ $vc = $v->structmem('faultCode');
+ $vs = $v->structmem('faultString');
+ $r =& new xmlrpcresp(0, $vc->scalarval(), $vs->scalarval());
+ }
+ else
+ {
+ $r =& new xmlrpcresp($v);
+ }
+ return $r;
+ case 'methodcall':
+ $m =& new xmlrpcmsg($GLOBALS['_xh']['method']);
+ for($i=0; $i < count($GLOBALS['_xh']['params']); $i++)
+ {
+ $m->addParam($GLOBALS['_xh']['params'][$i]);
+ }
+ return $m;
+ case 'value':
+ return $GLOBALS['_xh']['value'];
+ default:
+ return false;
+ }
+ }
+
+ /**
+ * decode a string that is encoded w/ "chunked" transfer encoding
+ * as defined in rfc2068 par. 19.4.6
+ * code shamelessly stolen from nusoap library by Dietrich Ayala
+ *
+ * @param string $buffer the string to be decoded
+ * @return string
+ */
+ function decode_chunked($buffer)
+ {
+ // length := 0
+ $length = 0;
+ $new = '';
+
+ // read chunk-size, chunk-extension (if any) and crlf
+ // get the position of the linebreak
+ $chunkend = strpos($buffer,"\r\n") + 2;
+ $temp = substr($buffer,0,$chunkend);
+ $chunk_size = hexdec( trim($temp) );
+ $chunkstart = $chunkend;
+ while($chunk_size > 0)
+ {
+ $chunkend = strpos($buffer, "\r\n", $chunkstart + $chunk_size);
+
+ // just in case we got a broken connection
+ if($chunkend == false)
+ {
+ $chunk = substr($buffer,$chunkstart);
+ // append chunk-data to entity-body
+ $new .= $chunk;
+ $length += strlen($chunk);
+ break;
+ }
+
+ // read chunk-data and crlf
+ $chunk = substr($buffer,$chunkstart,$chunkend-$chunkstart);
+ // append chunk-data to entity-body
+ $new .= $chunk;
+ // length := length + chunk-size
+ $length += strlen($chunk);
+ // read chunk-size and crlf
+ $chunkstart = $chunkend + 2;
+
+ $chunkend = strpos($buffer,"\r\n",$chunkstart)+2;
+ if($chunkend == false)
+ {
+ break; //just in case we got a broken connection
+ }
+ $temp = substr($buffer,$chunkstart,$chunkend-$chunkstart);
+ $chunk_size = hexdec( trim($temp) );
+ $chunkstart = $chunkend;
+ }
+ return $new;
+ }
+
+ /**
+ * xml charset encoding guessing helper function.
+ * Tries to determine the charset encoding of an XML chunk
+ * received over HTTP.
+ * NB: according to the spec (RFC 3023, if text/xml content-type is received over HTTP without a content-type,
+ * we SHOULD assume it is strictly US-ASCII. But we try to be more tolerant of unconforming (legacy?) clients/servers,
+ * which will be most probably using UTF-8 anyway...
+ *
+ * @param string $httpheaders the http Content-type header
+ * @param string $xmlchunk xml content buffer
+ * @param string $encoding_prefs comma separated list of character encodings to be used as default (when mb extension is enabled)
+ *
+ * @todo explore usage of mb_http_input(): does it detect http headers + post data? if so, use it instead of hand-detection!!!
+ */
+ function guess_encoding($httpheader='', $xmlchunk='', $encoding_prefs=null)
{
- function xmlrpc_encode($php_val)
+ // discussion: see http://www.yale.edu/pclt/encoding/
+ // 1 - test if encoding is specified in HTTP HEADERS
+
+ //Details:
+ // LWS: (\13\10)?( |\t)+
+ // token: (any char but excluded stuff)+
+ // header: Content-type = ...; charset=value(; ...)*
+ // where value is of type token, no LWS allowed between 'charset' and value
+ // Note: we do not check for invalid chars in VALUE:
+ // this had better be done using pure ereg as below
+
+ /// @todo this test will pass if ANY header has charset specification, not only Content-Type. Fix it?
+ $matches = array();
+ if(preg_match('/;\s*charset=([^;]+)/i', $httpheader, $matches))
+ {
+ return strtoupper(trim($matches[1]));
+ }
+
+ // 2 - scan the first bytes of the data for a UTF-16 (or other) BOM pattern
+ // (source: http://www.w3.org/TR/2000/REC-xml-20001006)
+ // NOTE: actually, according to the spec, even if we find the BOM and determine
+ // an encoding, we should check if there is an encoding specified
+ // in the xml declaration, and verify if they match.
+ /// @todo implement check as described above?
+ /// @todo implement check for first bytes of string even without a BOM? (It sure looks harder than for cases WITH a BOM)
+ if(preg_match('/^(\x00\x00\xFE\xFF|\xFF\xFE\x00\x00|\x00\x00\xFF\xFE|\xFE\xFF\x00\x00)/', $xmlchunk))
+ {
+ return 'UCS-4';
+ }
+ elseif(preg_match('/^(\xFE\xFF|\xFF\xFE)/', $xmlchunk))
+ {
+ return 'UTF-16';
+ }
+ elseif(preg_match('/^(\xEF\xBB\xBF)/', $xmlchunk))
{
- global $xmlrpcInt;
- global $xmlrpcDouble;
- global $xmlrpcString;
- global $xmlrpcArray;
- global $xmlrpcStruct;
- global $xmlrpcBoolean;
+ return 'UTF-8';
+ }
- $type = gettype($php_val);
- $xmlrpc_val = new xmlrpcval;
+ // 3 - test if encoding is specified in the xml declaration
+ // Details:
+ // SPACE: (#x20 | #x9 | #xD | #xA)+ === [ \x9\xD\xA]+
+ // EQ: SPACE?=SPACE? === [ \x9\xD\xA]*=[ \x9\xD\xA]*
+ if (preg_match('/^<\?xml\s+version\s*=\s*'. "((?:\"[a-zA-Z0-9_.:-]+\")|(?:'[a-zA-Z0-9_.:-]+'))".
+ '\s+encoding\s*=\s*' . "((?:\"[A-Za-z][A-Za-z0-9._-]*\")|(?:'[A-Za-z][A-Za-z0-9._-]*'))/",
+ $xmlchunk, $matches))
+ {
+ return strtoupper(substr($matches[2], 1, -1));
+ }
- switch($type)
+ // 4 - if mbstring is available, let it do the guesswork
+ // NB: we favour finding an encoding that is compatible with what we can process
+ if(extension_loaded('mbstring'))
+ {
+ if($encoding_prefs)
{
- case 'array':
- case 'object':
- $arr = array();
- while (list($k,$v) = each($php_val))
- {
- $arr[$k] = xmlrpc_encode($v);
- }
- $xmlrpc_val->addStruct($arr);
- break;
- case 'integer':
- $xmlrpc_val->addScalar($php_val, $xmlrpcInt);
- break;
- case 'double':
- $xmlrpc_val->addScalar($php_val, $xmlrpcDouble);
- break;
- case 'string':
- $xmlrpc_val->addScalar($php_val, $xmlrpcString);
- break;
- // <G_Giunta_2001-02-29>
- // Add support for encoding/decoding of booleans, since they are supported in PHP
- case 'boolean':
- $xmlrpc_val->addScalar($php_val, $xmlrpcBoolean);
- break;
- // </G_Giunta_2001-02-29>
- //case 'unknown type':
- default:
- // giancarlo pinerolo <ping@alt.it>
- // it has to return
- // an empty object in case (which is already
- // at this point), not a boolean.
- break;
+ $enc = mb_detect_encoding($xmlchunk, $encoding_prefs);
}
- return $xmlrpc_val;
+ else
+ {
+ $enc = mb_detect_encoding($xmlchunk);
+ }
+ // NB: mb_detect likes to call it ascii, xml parser likes to call it US_ASCII...
+ // IANA also likes better US-ASCII, so go with it
+ if($enc == 'ASCII')
+ {
+ $enc = 'US-'.$enc;
+ }
+ return $enc;
+ }
+ else
+ {
+ // no encoding specified: as per HTTP1.1 assume it is iso-8859-1?
+ // Both RFC 2616 (HTTP 1.1) and 1945(http 1.0) clearly state that for text/xxx content types
+ // this should be the standard. And we should be getting text/xml as request and response.
+ // BUT we have to be backward compatible with the lib, which always used UTF-8 as default...
+ return $GLOBALS['xmlrpc_defencoding'];
+ }
+ }
+
+ /**
+ * Checks if a given charset encoding is present in a list of encodings or
+ * if it is a valid subset of any encoding in the list
+ * @param string $encoding charset to be tested
+ * @param mixed $validlist comma separated list of valid charsets (or array of charsets)
+ */
+ function is_valid_charset($encoding, $validlist)
+ {
+ $charset_supersets = array(
+ 'US-ASCII' => array ('ISO-8859-1', 'ISO-8859-2', 'ISO-8859-3', 'ISO-8859-4',
+ 'ISO-8859-5', 'ISO-8859-6', 'ISO-8859-7', 'ISO-8859-8',
+ 'ISO-8859-9', 'ISO-8859-10', 'ISO-8859-11', 'ISO-8859-12',
+ 'ISO-8859-13', 'ISO-8859-14', 'ISO-8859-15', 'UTF-8',
+ 'EUC-JP', 'EUC-', 'EUC-KR', 'EUC-CN')
+ );
+ if (is_string($validlist))
+ $validlist = explode(',', $validlist);
+ if (@in_array(strtoupper($encoding), $validlist))
+ return true;
+ else
+ {
+ if (array_key_exists($encoding, $charset_supersets))
+ foreach ($validlist as $allowed)
+ if (in_array($allowed, $charset_supersets[$encoding]))
+ return true;
+ return false;
}
}
+
?>
<?php
// by Edd Dumbill (C) 1999-2002
// <edd@usefulinc.com>
-// $Id: xmlrpcs.inc.php,v 1.7 2007-03-22 09:23:58 kimitake Exp $
-// $NucleusJP: xmlrpcs.inc.php,v 1.9 2007/02/04 06:28:46 kimitake Exp $
+// $Original: xmlrpcs.inc,v 1.66 2006/09/17 21:25:06 ggiunta Exp $
+// $Id: xmlrpcs.inc.php,v 1.7.2.1 2008-01-29 07:05:06 kimitake Exp $
+// $NucleusJP: xmlrpcs.inc.php,v 1.9.2.2 2007/09/07 07:04:24 kimitake Exp $
// Copyright (c) 1999,2000,2002 Edd Dumbill.
// All rights reserved.
// XML RPC Server class
// requires: xmlrpc.inc
- // listMethods: either a string, or nothing
- $_xmlrpcs_listMethods_sig=array(array($xmlrpcArray, $xmlrpcString), array($xmlrpcArray));
+ $GLOBALS['xmlrpcs_capabilities'] = array(
+ // xmlrpc spec: always supported
+ 'xmlrpc' => new xmlrpcval(array(
+ 'specUrl' => new xmlrpcval('http://www.xmlrpc.com/spec', 'string'),
+ 'specVersion' => new xmlrpcval(1, 'int')
+ ), 'struct'),
+ // if we support system.xxx functions, we always support multicall, too...
+ // Note that, as of 2006/09/17, the following URL does not respond anymore
+ 'system.multicall' => new xmlrpcval(array(
+ 'specUrl' => new xmlrpcval('http://www.xmlrpc.com/discuss/msgReader$1208', 'string'),
+ 'specVersion' => new xmlrpcval(1, 'int')
+ ), 'struct'),
+ // introspection: version 2! we support 'mixed', too
+ 'introspection' => new xmlrpcval(array(
+ 'specUrl' => new xmlrpcval('http://phpxmlrpc.sourceforge.net/doc-2/ch10.html', 'string'),
+ 'specVersion' => new xmlrpcval(2, 'int')
+ ), 'struct')
+ );
+
+ /* Functions that implement system.XXX methods of xmlrpc servers */
+ $_xmlrpcs_getCapabilities_sig=array(array($GLOBALS['xmlrpcStruct']));
+ $_xmlrpcs_getCapabilities_doc='This method lists all the capabilites that the XML-RPC server has: the (more or less standard) extensions to the xmlrpc spec that it adheres to';
+ $_xmlrpcs_getCapabilities_sdoc=array(array('list of capabilities, described as structs with a version number and url for the spec'));
+ function _xmlrpcs_getCapabilities($server, $m=null)
+ {
+ $outAr = $GLOBALS['xmlrpcs_capabilities'];
+ // NIL extension
+ if ($GLOBALS['xmlrpc_null_extension']) {
+ $outAr['nil'] = new xmlrpcval(array(
+ 'specUrl' => new xmlrpcval('http://www.ontosys.com/xml-rpc/extensions.php', 'string'),
+ 'specVersion' => new xmlrpcval(1, 'int')
+ ), 'struct');
+ }
+ return new xmlrpcresp(new xmlrpcval($outAr, 'struct'));
+ }
+
+ // listMethods: signature was either a string, or nothing.
+ // The useless string variant has been removed
+ $_xmlrpcs_listMethods_sig=array(array($GLOBALS['xmlrpcArray']));
$_xmlrpcs_listMethods_doc='This method lists all the methods that the XML-RPC server knows how to dispatch';
- function _xmlrpcs_listMethods($server, $m)
+ $_xmlrpcs_listMethods_sdoc=array(array('list of method names'));
+ function _xmlrpcs_listMethods($server, $m=null) // if called in plain php values mode, second param is missing
{
- global $xmlrpcerr, $xmlrpcstr, $_xmlrpcs_dmap;
- $v=new xmlrpcval();
- $dmap=$server->dmap;
+
$outAr=array();
- for(reset($dmap); list($key, $val)=each($dmap); )
+ foreach($server->dmap as $key => $val)
{
- $outAr[]=new xmlrpcval($key, 'string');
+ $outAr[]=&new xmlrpcval($key, 'string');
}
- $dmap=$_xmlrpcs_dmap;
- for(reset($dmap); list($key, $val)=each($dmap); )
+ if($server->allow_system_funcs)
{
- $outAr[]=new xmlrpcval($key, 'string');
+ foreach($GLOBALS['_xmlrpcs_dmap'] as $key => $val)
+ {
+ $outAr[]=&new xmlrpcval($key, 'string');
+ }
}
- $v->addArray($outAr);
- return new xmlrpcresp($v);
+ return new xmlrpcresp(new xmlrpcval($outAr, 'array'));
}
- $_xmlrpcs_methodSignature_sig=array(array($xmlrpcArray, $xmlrpcString));
+ $_xmlrpcs_methodSignature_sig=array(array($GLOBALS['xmlrpcArray'], $GLOBALS['xmlrpcString']));
$_xmlrpcs_methodSignature_doc='Returns an array of known signatures (an array of arrays) for the method name passed. If no signatures are known, returns a none-array (test for type != array to detect missing signature)';
+ $_xmlrpcs_methodSignature_sdoc=array(array('list of known signatures, each sig being an array of xmlrpc type names', 'name of method to be described'));
function _xmlrpcs_methodSignature($server, $m)
{
- global $xmlrpcerr, $xmlrpcstr, $_xmlrpcs_dmap;
-
- $methName=$m->getParam(0);
- $methName=$methName->scalarval();
- if (ereg("^system\.", $methName))
+ // let accept as parameter both an xmlrpcval or string
+ if (is_object($m))
{
- $dmap=$_xmlrpcs_dmap; $sysCall=1;
+ $methName=$m->getParam(0);
+ $methName=$methName->scalarval();
+ }
+ else
+ {
+ $methName=$m;
+ }
+ if(strpos($methName, "system.") === 0)
+ {
+ $dmap=$GLOBALS['_xmlrpcs_dmap']; $sysCall=1;
}
else
{
$dmap=$server->dmap; $sysCall=0;
}
- // print "<!-- ${methName} -->\n";
- if (isset($dmap[$methName]))
+ if(isset($dmap[$methName]))
{
- if ($dmap[$methName]['signature'])
+ if(isset($dmap[$methName]['signature']))
{
$sigs=array();
- $thesigs=$dmap[$methName]['signature'];
- for($i=0; $i<sizeof($thesigs); $i++)
+ foreach($dmap[$methName]['signature'] as $inSig)
{
$cursig=array();
- $inSig=$thesigs[$i];
- for($j=0; $j<sizeof($inSig); $j++)
+ foreach($inSig as $sig)
{
- $cursig[]=new xmlrpcval($inSig[$j], 'string');
+ $cursig[]=&new xmlrpcval($sig, 'string');
}
- $sigs[]=new xmlrpcval($cursig, 'array');
+ $sigs[]=&new xmlrpcval($cursig, 'array');
}
- $r=new xmlrpcresp(new xmlrpcval($sigs, 'array'));
+ $r=&new xmlrpcresp(new xmlrpcval($sigs, 'array'));
}
else
{
- $r=new xmlrpcresp(new xmlrpcval('undef', 'string'));
+ // NB: according to the official docs, we should be returning a
+ // "none-array" here, which means not-an-array
+ $r=&new xmlrpcresp(new xmlrpcval('undef', 'string'));
}
}
else
{
- $r=new xmlrpcresp(0,$xmlrpcerr['introspect_unknown'], $xmlrpcstr['introspect_unknown']);
+ $r=&new xmlrpcresp(0,$GLOBALS['xmlrpcerr']['introspect_unknown'], $GLOBALS['xmlrpcstr']['introspect_unknown']);
}
return $r;
}
- $_xmlrpcs_methodHelp_sig=array(array($xmlrpcString, $xmlrpcString));
+ $_xmlrpcs_methodHelp_sig=array(array($GLOBALS['xmlrpcString'], $GLOBALS['xmlrpcString']));
$_xmlrpcs_methodHelp_doc='Returns help text if defined for the method passed, otherwise returns an empty string';
+ $_xmlrpcs_methodHelp_sdoc=array(array('method description', 'name of the method to be described'));
function _xmlrpcs_methodHelp($server, $m)
{
- global $xmlrpcerr, $xmlrpcstr, $_xmlrpcs_dmap;
-
- $methName=$m->getParam(0);
- $methName=$methName->scalarval();
- if (ereg("^system\.", $methName))
+ // let accept as parameter both an xmlrpcval or string
+ if (is_object($m))
+ {
+ $methName=$m->getParam(0);
+ $methName=$methName->scalarval();
+ }
+ else
+ {
+ $methName=$m;
+ }
+ if(strpos($methName, "system.") === 0)
{
- $dmap=$_xmlrpcs_dmap; $sysCall=1;
+ $dmap=$GLOBALS['_xmlrpcs_dmap']; $sysCall=1;
}
else
{
$dmap=$server->dmap; $sysCall=0;
}
- // print "<!-- ${methName} -->\n";
- if (isset($dmap[$methName]))
+ if(isset($dmap[$methName]))
{
- if ($dmap[$methName]['docstring'])
+ if(isset($dmap[$methName]['docstring']))
{
- $r=new xmlrpcresp(new xmlrpcval($dmap[$methName]['docstring']), 'string');
+ $r=&new xmlrpcresp(new xmlrpcval($dmap[$methName]['docstring']), 'string');
}
else
{
- $r=new xmlrpcresp(new xmlrpcval('', 'string'));
+ $r=&new xmlrpcresp(new xmlrpcval('', 'string'));
}
}
else
{
- $r=new xmlrpcresp(0, $xmlrpcerr['introspect_unknown'], $xmlrpcstr['introspect_unknown']);
+ $r=&new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['introspect_unknown'], $GLOBALS['xmlrpcstr']['introspect_unknown']);
}
return $r;
}
- $_xmlrpcs_multicall_sig = array(array($xmlrpcArray, $xmlrpcArray));
+ $_xmlrpcs_multicall_sig = array(array($GLOBALS['xmlrpcArray'], $GLOBALS['xmlrpcArray']));
$_xmlrpcs_multicall_doc = 'Boxcar multiple RPC calls in one request. See http://www.xmlrpc.com/discuss/msgReader$1208 for details';
-
+ $_xmlrpcs_multicall_sdoc = array(array('list of response structs, where each struct has the usual members', 'list of calls, with each call being represented as a struct, with members "methodname" and "params"'));
function _xmlrpcs_multicall_error($err)
{
- if (is_string($err))
+ if(is_string($err))
{
- global $xmlrpcerr, $xmlrpcstr;
- $str = $xmlrpcstr["multicall_${err}"];
- $code = $xmlrpcerr["multicall_${err}"];
+ $str = $GLOBALS['xmlrpcstr']["multicall_${err}"];
+ $code = $GLOBALS['xmlrpcerr']["multicall_${err}"];
}
else
{
$code = $err->faultCode();
$str = $err->faultString();
}
- $struct['faultCode'] = new xmlrpcval($code, 'int');
- $struct['faultString'] = new xmlrpcval($str, 'string');
+ $struct = array();
+ $struct['faultCode'] =& new xmlrpcval($code, 'int');
+ $struct['faultString'] =& new xmlrpcval($str, 'string');
return new xmlrpcval($struct, 'struct');
}
function _xmlrpcs_multicall_do_call($server, $call)
{
- if ($call->kindOf() != 'struct')
+ if($call->kindOf() != 'struct')
{
return _xmlrpcs_multicall_error('notstruct');
}
- $methName = $call->structmem('methodName');
- if (!$methName)
+ $methName = @$call->structmem('methodName');
+ if(!$methName)
{
return _xmlrpcs_multicall_error('nomethod');
}
- if ($methName->kindOf() != 'scalar' || $methName->scalartyp() != 'string')
+ if($methName->kindOf() != 'scalar' || $methName->scalartyp() != 'string')
{
return _xmlrpcs_multicall_error('notstring');
}
- if ($methName->scalarval() == 'system.multicall')
+ if($methName->scalarval() == 'system.multicall')
{
return _xmlrpcs_multicall_error('recursion');
}
- $params = $call->structmem('params');
- if (!$params)
+ $params = @$call->structmem('params');
+ if(!$params)
{
return _xmlrpcs_multicall_error('noparams');
}
- if ($params->kindOf() != 'array')
+ if($params->kindOf() != 'array')
{
return _xmlrpcs_multicall_error('notarray');
}
$numParams = $params->arraysize();
- $msg = new xmlrpcmsg($methName->scalarval());
- for ($i = 0; $i < $numParams; $i++)
+ $msg =& new xmlrpcmsg($methName->scalarval());
+ for($i = 0; $i < $numParams; $i++)
{
- $msg->addParam($params->arraymem($i));
+ if(!$msg->addParam($params->arraymem($i)))
+ {
+ $i++;
+ return _xmlrpcs_multicall_error(new xmlrpcresp(0,
+ $GLOBALS['xmlrpcerr']['incorrect_params'],
+ $GLOBALS['xmlrpcstr']['incorrect_params'] . ": probable xml error in param " . $i));
+ }
}
$result = $server->execute($msg);
- if ($result->faultCode() != 0)
+ if($result->faultCode() != 0)
+ {
+ return _xmlrpcs_multicall_error($result); // Method returned fault.
+ }
+
+ return new xmlrpcval(array($result->value()), 'array');
+ }
+
+ function _xmlrpcs_multicall_do_call_phpvals($server, $call)
+ {
+ if(!is_array($call))
+ {
+ return _xmlrpcs_multicall_error('notstruct');
+ }
+ if(!array_key_exists('methodName', $call))
+ {
+ return _xmlrpcs_multicall_error('nomethod');
+ }
+ if (!is_string($call['methodName']))
+ {
+ return _xmlrpcs_multicall_error('notstring');
+ }
+ if($call['methodName'] == 'system.multicall')
+ {
+ return _xmlrpcs_multicall_error('recursion');
+ }
+ if(!array_key_exists('params', $call))
+ {
+ return _xmlrpcs_multicall_error('noparams');
+ }
+ if(!is_array($call['params']))
+ {
+ return _xmlrpcs_multicall_error('notarray');
+ }
+
+ // this is a real dirty and simplistic hack, since we might have received a
+ // base64 or datetime values, but they will be listed as strings here...
+ $numParams = count($call['params']);
+ $pt = array();
+ foreach($call['params'] as $val)
+ $pt[] = php_2_xmlrpc_type(gettype($val));
+
+ $result = $server->execute($call['methodName'], $call['params'], $pt);
+
+ if($result->faultCode() != 0)
{
- return _xmlrpcs_multicall_error($result); // Method returned fault.
+ return _xmlrpcs_multicall_error($result); // Method returned fault.
}
return new xmlrpcval(array($result->value()), 'array');
function _xmlrpcs_multicall($server, $m)
{
- $calls = $m->getParam(0);
- $numCalls = $calls->arraysize();
$result = array();
-
- for ($i = 0; $i < $numCalls; $i++)
+ // let accept a plain list of php parameters, beside a single xmlrpc msg object
+ if (is_object($m))
+ {
+ $calls = $m->getParam(0);
+ $numCalls = $calls->arraysize();
+ for($i = 0; $i < $numCalls; $i++)
+ {
+ $call = $calls->arraymem($i);
+ $result[$i] = _xmlrpcs_multicall_do_call($server, $call);
+ }
+ }
+ else
{
- $call = $calls->arraymem($i);
- $result[$i] = _xmlrpcs_multicall_do_call($server, $call);
+ $numCalls=count($m);
+ for($i = 0; $i < $numCalls; $i++)
+ {
+ $result[$i] = _xmlrpcs_multicall_do_call_phpvals($server, $m[$i]);
+ }
}
return new xmlrpcresp(new xmlrpcval($result, 'array'));
}
- $_xmlrpcs_dmap=array(
+ $GLOBALS['_xmlrpcs_dmap']=array(
'system.listMethods' => array(
'function' => '_xmlrpcs_listMethods',
'signature' => $_xmlrpcs_listMethods_sig,
- 'docstring' => $_xmlrpcs_listMethods_doc),
+ 'docstring' => $_xmlrpcs_listMethods_doc,
+ 'signature_docs' => $_xmlrpcs_listMethods_sdoc),
'system.methodHelp' => array(
'function' => '_xmlrpcs_methodHelp',
'signature' => $_xmlrpcs_methodHelp_sig,
- 'docstring' => $_xmlrpcs_methodHelp_doc),
+ 'docstring' => $_xmlrpcs_methodHelp_doc,
+ 'signature_docs' => $_xmlrpcs_methodHelp_sdoc),
'system.methodSignature' => array(
'function' => '_xmlrpcs_methodSignature',
'signature' => $_xmlrpcs_methodSignature_sig,
- 'docstring' => $_xmlrpcs_methodSignature_doc),
+ 'docstring' => $_xmlrpcs_methodSignature_doc,
+ 'signature_docs' => $_xmlrpcs_methodSignature_sdoc),
'system.multicall' => array(
'function' => '_xmlrpcs_multicall',
'signature' => $_xmlrpcs_multicall_sig,
- 'docstring' => $_xmlrpcs_multicall_doc
- )
+ 'docstring' => $_xmlrpcs_multicall_doc,
+ 'signature_docs' => $_xmlrpcs_multicall_sdoc),
+ 'system.getCapabilities' => array(
+ 'function' => '_xmlrpcs_getCapabilities',
+ 'signature' => $_xmlrpcs_getCapabilities_sig,
+ 'docstring' => $_xmlrpcs_getCapabilities_doc,
+ 'signature_docs' => $_xmlrpcs_getCapabilities_sdoc)
);
- $_xmlrpc_debuginfo='';
+ $GLOBALS['_xmlrpcs_occurred_errors'] = '';
+ $GLOBALS['_xmlrpcs_prev_ehandler'] = '';
+ /**
+ * Error handler used to track errors that occur during server-side execution of PHP code.
+ * This allows to report back to the client whether an internal error has occurred or not
+ * using an xmlrpc response object, instead of letting the client deal with the html junk
+ * that a PHP execution error on the server generally entails.
+ *
+ * NB: in fact a user defined error handler can only handle WARNING, NOTICE and USER_* errors.
+ *
+ */
+ function _xmlrpcs_errorHandler($errcode, $errstring, $filename=null, $lineno=null, $context=null)
+ {
+ // obey the @ protocol
+ if (error_reporting() == 0)
+ return;
+
+ //if($errcode != E_NOTICE && $errcode != E_WARNING && $errcode != E_USER_NOTICE && $errcode != E_USER_WARNING)
+ if($errcode != 2048) // do not use E_STRICT by name, since on PHP 4 it will not be defined
+ {
+ $GLOBALS['_xmlrpcs_occurred_errors'] = $GLOBALS['_xmlrpcs_occurred_errors'] . $errstring . "\n";
+ }
+ // Try to avoid as much as possible disruption to the previous error handling
+ // mechanism in place
+ if($GLOBALS['_xmlrpcs_prev_ehandler'] == '')
+ {
+ // The previous error handler was the default: all we should do is log error
+ // to the default error log (if level high enough)
+ if(ini_get('log_errors') && (intval(ini_get('error_reporting')) & $errcode))
+ {
+ error_log($errstring);
+ }
+ }
+ else
+ {
+ // Pass control on to previous error handler, trying to avoid loops...
+ if($GLOBALS['_xmlrpcs_prev_ehandler'] != '_xmlrpcs_errorHandler')
+ {
+ // NB: this code will NOT work on php < 4.0.2: only 2 params were used for error handlers
+ if(is_array($GLOBALS['_xmlrpcs_prev_ehandler']))
+ {
+ $GLOBALS['_xmlrpcs_prev_ehandler'][0]->$GLOBALS['_xmlrpcs_prev_ehandler'][1]($errcode, $errstring, $filename, $lineno, $context);
+ }
+ else
+ {
+ $GLOBALS['_xmlrpcs_prev_ehandler']($errcode, $errstring, $filename, $lineno, $context);
+ }
+ }
+ }
+ }
+
+ $GLOBALS['_xmlrpc_debuginfo']='';
+
+ /**
+ * Add a string to the debug info that can be later seralized by the server
+ * as part of the response message.
+ * Note that for best compatbility, the debug string should be encoded using
+ * the $GLOBALS['xmlrpc_internalencoding'] character set.
+ * @param string $m
+ * @access public
+ */
function xmlrpc_debugmsg($m)
{
- global $_xmlrpc_debuginfo;
- $_xmlrpc_debuginfo=$_xmlrpc_debuginfo . $m . "\n";
+ $GLOBALS['_xmlrpc_debuginfo'] .= $m . "\n";
}
class xmlrpc_server
{
+ /// array defining php functions exposed as xmlrpc methods by this server
var $dmap=array();
+ /**
+ * Defines how functions in dmap will be invokde: either using an xmlrpc msg object
+ * or plain php values.
+ * valid strings are 'xmlrpcvals', 'phpvals' or 'epivals'
+ */
+ var $functions_parameters_type='xmlrpcvals';
+ /// controls wether the server is going to echo debugging messages back to the client as comments in response body. valid values: 0,1,2,3
+ var $debug = 1;
+ /**
+ * When set to true, it will enable HTTP compression of the response, in case
+ * the client has declared its support for compression in the request.
+ */
+ var $compress_response = false;
+ /**
+ * List of http compression methods accepted by the server for requests.
+ * NB: PHP supports deflate, gzip compressions out of the box if compiled w. zlib
+ */
+ var $accepted_compression = array();
+ /// shall we serve calls to system.* methods?
+ var $allow_system_funcs = true;
+ /// list of charset encodings natively accepted for requests
+ var $accepted_charset_encodings = array();
+ /**
+ * charset encoding to be used for response.
+ * NB: if we can, we will convert the generated response from internal_encoding to the intended one.
+ * can be: a supported xml encoding (only UTF-8 and ISO-8859-1 at present, unless mbstring is enabled),
+ * null (leave unspecified in response, convert output stream to US_ASCII),
+ * 'default' (use xmlrpc library default as specified in xmlrpc.inc, convert output stream if needed),
+ * or 'auto' (use client-specified charset encoding or same as request if request headers do not specify it (unless request is US-ASCII: then use library default anyway).
+ * NB: pretty dangerous if you accept every charset and do not have mbstring enabled)
+ */
+ var $response_charset_encoding = '';
+ /// storage for internal debug info
+ var $debug_info = '';
+ /// extra data passed at runtime to method handling functions. Used only by EPI layer
+ var $user_data = null;
- function xmlrpc_server($dispMap='', $serviceNow=1)
+ /**
+ * @param array $dispmap the dispatch map withd efinition of exposed services
+ * @param boolean $servicenow set to false to prevent the server from runnung upon construction
+ */
+ function xmlrpc_server($dispMap=null, $serviceNow=true)
{
- global $HTTP_RAW_POST_DATA;
+ // if ZLIB is enabled, let the server by default accept compressed requests,
+ // and compress responses sent to clients that support them
+ if(function_exists('gzinflate'))
+ {
+ $this->accepted_compression = array('gzip', 'deflate');
+ $this->compress_response = true;
+ }
+
+ // by default the xml parser can support these 3 charset encodings
+ $this->accepted_charset_encodings = array('UTF-8', 'ISO-8859-1', 'US-ASCII');
+
// dispMap is a dispatch array of methods
// mapped to function names and signatures
// if a method
}
}
- function serializeDebug()
+ /**
+ * Set debug level of server.
+ * @param integer $in debug lvl: determines info added to xmlrpc responses (as xml comments)
+ * 0 = no debug info,
+ * 1 = msgs set from user with debugmsg(),
+ * 2 = add complete xmlrpc request (headers and body),
+ * 3 = add also all processing warnings happened during method processing
+ * (NB: this involves setting a custom error handler, and might interfere
+ * with the standard processing of the php function exposed as method. In
+ * particular, triggering an USER_ERROR level error will not halt script
+ * execution anymore, but just end up logged in the xmlrpc response)
+ * Note that info added at elevel 2 and 3 will be base64 encoded
+ * @access public
+ */
+ function setDebug($in)
+ {
+ $this->debug=$in;
+ }
+
+ /**
+ * Return a string with the serialized representation of all debug info
+ * @param string $charset_encoding the target charset encoding for the serialization
+ * @return string an XML comment (or two)
+ */
+ function serializeDebug($charset_encoding='')
{
- global $_xmlrpc_debuginfo;
- if ($_xmlrpc_debuginfo!='')
+ // Tough encoding problem: which internal charset should we assume for debug info?
+ // It might contain a copy of raw data received from client, ie with unknown encoding,
+ // intermixed with php generated data and user generated data...
+ // so we split it: system debug is base 64 encoded,
+ // user debug info should be encoded by the end user using the INTERNAL_ENCODING
+ $out = '';
+ if ($this->debug_info != '')
{
- return "<!-- DEBUG INFO:\n\n" . xmlrpc_encode_entitites($_xmlrpc_debuginfo) . "\n-->\n";
+ $out .= "<!-- SERVER DEBUG INFO (BASE64 ENCODED):\n".base64_encode($this->debug_info)."\n-->\n";
}
- else
+ if($GLOBALS['_xmlrpc_debuginfo']!='')
{
- return '';
+
+ $out .= "<!-- DEBUG INFO:\n" . xmlrpc_encode_entitites(str_replace('--', '_-', $GLOBALS['_xmlrpc_debuginfo']), $GLOBALS['xmlrpc_internalencoding'], $charset_encoding) . "\n-->\n";
+ // NB: a better solution MIGHT be to use CDATA, but we need to insert it
+ // into return payload AFTER the beginning tag
+ //$out .= "<![CDATA[ DEBUG INFO:\n\n" . str_replace(']]>', ']_]_>', $GLOBALS['_xmlrpc_debuginfo']) . "\n]]>\n";
}
+ return $out;
}
- function service()
+ /**
+ * Execute the xmlrpc request, printing the response
+ * @param string $data the request body. If null, the http POST request will be examined
+ * @return xmlrpcresp the response object (usually not used by caller...)
+ * @access public
+ */
+ function service($data=null, $return_payload=false)
{
- //global $xmlrpc_defencoding;
+ if ($data === null)
+ {
+ $data = isset($GLOBALS['HTTP_RAW_POST_DATA']) ? $GLOBALS['HTTP_RAW_POST_DATA'] : '';
+ }
+ $raw_data = $data;
+
+ // reset internal debug info
+ $this->debug_info = '';
+
+ // Echo back what we received, before parsing it
+ if($this->debug > 1)
+ {
+ $this->debugmsg("+++GOT+++\n" . $data . "\n+++END+++");
+ }
+
+ $r = $this->parseRequestHeaders($data, $req_charset, $resp_charset, $resp_encoding);
+ if (!$r)
+ {
+ $r=$this->parseRequest($data, $req_charset);
+ }
+
+ // save full body of request into response, for more debugging usages
+ $r->raw_data = $raw_data;
+
+ if($this->debug > 2 && $GLOBALS['_xmlrpcs_occurred_errors'])
+ {
+ $this->debugmsg("+++PROCESSING ERRORS AND WARNINGS+++\n" .
+ $GLOBALS['_xmlrpcs_occurred_errors'] . "+++END+++");
+ }
+
+ $payload=$this->xml_header($resp_charset);
+ if($this->debug > 0)
+ {
+ $payload = $payload . $this->serializeDebug($resp_charset);
+ }
+
+ // G. Giunta 2006-01-27: do not create response serialization if it has
+ // already happened. Helps building json magic
+ if (empty($r->payload))
+ {
+ $r->serialize($resp_charset);
+ }
+ $payload = $payload . $r->payload;
+
+ if ($return_payload)
+ {
+ return $payload;
+ }
+
+ // if we get a warning/error that has output some text before here, then we cannot
+ // add a new header. We cannot say we are sending xml, either...
+ if(!headers_sent())
+ {
+ header('Content-Type: '.$r->content_type);
+ // we do not know if client actually told us an accepted charset, but if he did
+ // we have to tell him what we did
+ header("Vary: Accept-Charset");
+
+ // http compression of output: only
+ // if we can do it, and we want to do it, and client asked us to,
+ // and php ini settings do not force it already
+ $php_no_self_compress = ini_get('zlib.output_compression') == '' && (ini_get('output_handler') != 'ob_gzhandler');
+ if($this->compress_response && function_exists('gzencode') && $resp_encoding != ''
+ && $php_no_self_compress)
+ {
+ if(strpos($resp_encoding, 'gzip') !== false)
+ {
+ $payload = gzencode($payload);
+ header("Content-Encoding: gzip");
+ header("Vary: Accept-Encoding");
+ }
+ elseif (strpos($resp_encoding, 'deflate') !== false)
+ {
+ $payload = gzcompress($payload);
+ header("Content-Encoding: deflate");
+ header("Vary: Accept-Encoding");
+ }
+ }
+
+ // do not ouput content-length header if php is compressing output for us:
+ // it will mess up measurements
+ if($php_no_self_compress)
+ {
+ header('Content-Length: ' . (int)strlen($payload));
+ }
+ }
+ else
+ {
+ error_log('XML-RPC: xmlrpc_server::service: http headers already sent before response is fully generated. Check for php warning or error messages');
+ }
- $r=$this->parseRequest();
- //$payload='<?xml version="1.0" encoding="' . $xmlrpc_defencoding . '"?' . '>' . "\n"
- $payload='<?xml version="1.0" ?' . '>' . "\n"
- . $this->serializeDebug()
- . $r->serialize();
- header('Content-Type: text/xml');
- header('Content-Length: ' . (int)strlen($payload));
print $payload;
+
+ // return request, in case subclasses want it
+ return $r;
}
- /*
- add a method to the dispatch map
+ /**
+ * Add a method to the dispatch map
+ * @param string $methodname the name with which the method will be made available
+ * @param string $function the php function that will get invoked
+ * @param array $sig the array of valid method signatures
+ * @param string $doc method documentation
+ * @access public
*/
- function add_to_map($methodname,$function,$sig,$doc)
+ function add_to_map($methodname,$function,$sig=null,$doc='')
{
$this->dmap[$methodname] = array(
- 'function' => $function,
- 'signature' => $sig,
+ 'function' => $function,
'docstring' => $doc
);
+ if ($sig)
+ {
+ $this->dmap[$methodname]['signature'] = $sig;
+ }
}
+ /**
+ * Verify type and number of parameters received against a list of known signatures
+ * @param array $in array of either xmlrpcval objects or xmlrpc type definitions
+ * @param array $sig array of known signatures to match against
+ * @access private
+ */
function verifySignature($in, $sig)
{
- for($i=0; $i<sizeof($sig); $i++)
+ // check each possible signature in turn
+ if (is_object($in))
{
- // check each possible signature in turn
- $cursig=$sig[$i];
- if (sizeof($cursig)==$in->getNumParams()+1)
+ $numParams = $in->getNumParams();
+ }
+ else
+ {
+ $numParams = count($in);
+ }
+ foreach($sig as $cursig)
+ {
+ if(count($cursig)==$numParams+1)
{
$itsOK=1;
- for($n=0; $n<$in->getNumParams(); $n++)
+ for($n=0; $n<$numParams; $n++)
{
- $p=$in->getParam($n);
- // print "<!-- $p -->\n";
- if ($p->kindOf() == 'scalar')
+ if (is_object($in))
{
- $pt=$p->scalartyp();
+ $p=$in->getParam($n);
+ if($p->kindOf() == 'scalar')
+ {
+ $pt=$p->scalartyp();
+ }
+ else
+ {
+ $pt=$p->kindOf();
+ }
}
else
{
- $pt=$p->kindOf();
+ $pt= $in[$n] == 'i4' ? 'int' : $in[$n]; // dispatch maps never use i4...
}
- // $n+1 as first type of sig is return type
- if ($pt != $cursig[$n+1])
+
+ // param index is $n+1, as first member of sig is return type
+ if($pt != $cursig[$n+1] && $cursig[$n+1] != $GLOBALS['xmlrpcValue'])
{
$itsOK=0;
- $pno=$n+1; $wanted=$cursig[$n+1]; $got=$pt;
+ $pno=$n+1;
+ $wanted=$cursig[$n+1];
+ $got=$pt;
break;
}
}
- if ($itsOK)
+ if($itsOK)
{
return array(1,'');
}
}
}
- if (isset($wanted))
- return array(0, "Wanted ${wanted}, got ${got} at param ${pno})");
+ if(isset($wanted))
+ {
+ return array(0, "Wanted ${wanted}, got ${got} at param ${pno}");
+ }
else
+ {
return array(0, "No method signature matches number of parameters");
+ }
}
- function parseRequest($data='')
+ /**
+ * Parse http headers received along with xmlrpc request. If needed, inflate request
+ * @return null on success or an xmlrpcresp
+ * @access private
+ */
+ function parseRequestHeaders(&$data, &$req_encoding, &$resp_encoding, &$resp_compression)
{
- global $_xh,$HTTP_RAW_POST_DATA;
- global $xmlrpcerr, $xmlrpcstr, $xmlrpcerrxml, $xmlrpc_defencoding,
- $_xmlrpcs_dmap, $xmlrpc_internalencoding;
+ // Play nice to PHP 4.0.x: superglobals were not yet invented...
+ if(!isset($_SERVER))
+ {
+ $_SERVER = $GLOBALS['HTTP_SERVER_VARS'];
+ }
+
+ if($this->debug > 1)
+ {
+ if(function_exists('getallheaders'))
+ {
+ $this->debugmsg(''); // empty line
+ foreach(getallheaders() as $name => $val)
+ {
+ $this->debugmsg("HEADER: $name: $val");
+ }
+ }
+
+ }
+
+ if(isset($_SERVER['HTTP_CONTENT_ENCODING']))
+ {
+ $content_encoding = str_replace('x-', '', $_SERVER['HTTP_CONTENT_ENCODING']);
+ }
+ else
+ {
+ $content_encoding = '';
+ }
+
+ // check if request body has been compressed and decompress it
+ if($content_encoding != '' && strlen($data))
+ {
+ if($content_encoding == 'deflate' || $content_encoding == 'gzip')
+ {
+ // if decoding works, use it. else assume data wasn't gzencoded
+ if(function_exists('gzinflate') && in_array($content_encoding, $this->accepted_compression))
+ {
+ if($content_encoding == 'deflate' && $degzdata = @gzuncompress($data))
+ {
+ $data = $degzdata;
+ if($this->debug > 1)
+ {
+ $this->debugmsg("\n+++INFLATED REQUEST+++[".strlen($data)." chars]+++\n" . $data . "\n+++END+++");
+ }
+ }
+ elseif($content_encoding == 'gzip' && $degzdata = @gzinflate(substr($data, 10)))
+ {
+ $data = $degzdata;
+ if($this->debug > 1)
+ $this->debugmsg("+++INFLATED REQUEST+++[".strlen($data)." chars]+++\n" . $data . "\n+++END+++");
+ }
+ else
+ {
+ $r =& new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['server_decompress_fail'], $GLOBALS['xmlrpcstr']['server_decompress_fail']);
+ return $r;
+ }
+ }
+ else
+ {
+ //error_log('The server sent deflated data. Your php install must have the Zlib extension compiled in to support this.');
+ $r =& new xmlrpcresp(0, $GLOBALS['xmlrpcerr']['server_cannot_decompress'], $GLOBALS['xmlrpcstr']['server_cannot_decompress']);
+ return $r;
+ }
+ }
+ }
+
+ // check if client specified accepted charsets, and if we know how to fulfill
+ // the request
+ if ($this->response_charset_encoding == 'auto')
+ {
+ $resp_encoding = '';
+ if (isset($_SERVER['HTTP_ACCEPT_CHARSET']))
+ {
+ // here we should check if we can match the client-requested encoding
+ // with the encodings we know we can generate.
+ /// @todo we should parse q=0.x preferences instead of getting first charset specified...
+ $client_accepted_charsets = explode(',', strtoupper($_SERVER['HTTP_ACCEPT_CHARSET']));
+ // Give preference to internal encoding
+ $known_charsets = array($this->internal_encoding, 'UTF-8', 'ISO-8859-1', 'US-ASCII');
+ foreach ($known_charsets as $charset)
+ {
+ foreach ($client_accepted_charsets as $accepted)
+ if (strpos($accepted, $charset) === 0)
+ {
+ $resp_encoding = $charset;
+ break;
+ }
+ if ($resp_encoding)
+ break;
+ }
+ }
+ }
+ else
+ {
+ $resp_encoding = $this->response_charset_encoding;
+ }
- if ($data=='')
+ if (isset($_SERVER['HTTP_ACCEPT_ENCODING']))
{
- $data=$HTTP_RAW_POST_DATA;
+ $resp_compression = $_SERVER['HTTP_ACCEPT_ENCODING'];
}
- // G. Giunta 2005/02/13: we do NOT expect to receive html entities
- // so we do not try to convert them into xml character entities
+ else
+ {
+ $resp_compression = '';
+ }
+
+ // 'guestimate' request encoding
+ /// @todo check if mbstring is enabled and automagic input conversion is on: it might mingle with this check???
+ $req_encoding = guess_encoding(isset($_SERVER['CONTENT_TYPE']) ? $_SERVER['CONTENT_TYPE'] : '',
+ $data);
+
+ return null;
+ }
+
+ /**
+ * Parse an xml chunk containing an xmlrpc request and execute the corresponding
+ * php function registered with the server
+ * @param string $data the xml request
+ * @param string $req_encoding (optional) the charset encoding of the xml request
+ * @return xmlrpcresp
+ * @access private
+ */
+ function parseRequest($data, $req_encoding='')
+ {
+ // 2005/05/07 commented and moved into caller function code
+ //if($data=='')
+ //{
+ // $data=$GLOBALS['HTTP_RAW_POST_DATA'];
+ //}
+
+ // G. Giunta 2005/02/13: we do NOT expect to receive html entities
+ // so we do not try to convert them into xml character entities
//$data = xmlrpc_html_entity_xlate($data);
- $parser = xml_parser_create($xmlrpc_defencoding);
-
- $_xh[$parser]=array();
- //$_xh[$parser]['st']='';
- //$_xh[$parser]['cm']=0;
- $_xh[$parser]['isf']=0;
- $_xh[$parser]['isf_reason']='';
- $_xh[$parser]['params']=array();
- $_xh[$parser]['stack']=array();
- $_xh[$parser]['sp'] = 0;
- $_xh[$parser]['valuestack'] = array();
- $_xh[$parser]['vsp'] = 0;
- $_xh[$parser]['method']='';
+
+ $GLOBALS['_xh']=array();
+ $GLOBALS['_xh']['ac']='';
+ $GLOBALS['_xh']['stack']=array();
+ $GLOBALS['_xh']['valuestack'] = array();
+ $GLOBALS['_xh']['params']=array();
+ $GLOBALS['_xh']['pt']=array();
+ $GLOBALS['_xh']['isf']=0;
+ $GLOBALS['_xh']['isf_reason']='';
+ $GLOBALS['_xh']['method']=false; // so we can check later if we got a methodname or not
+ $GLOBALS['_xh']['rt']='';
// decompose incoming XML into request structure
+ if ($req_encoding != '')
+ {
+ if (!in_array($req_encoding, array('UTF-8', 'ISO-8859-1', 'US-ASCII')))
+ // the following code might be better for mb_string enabled installs, but
+ // makes the lib about 200% slower...
+ //if (!is_valid_charset($req_encoding, array('UTF-8', 'ISO-8859-1', 'US-ASCII')))
+ {
+ error_log('XML-RPC: xmlrpc_server::parseRequest: invalid charset encoding of received request: '.$req_encoding);
+ $req_encoding = $GLOBALS['xmlrpc_defencoding'];
+ }
+ /// @BUG this will fail on PHP 5 if charset is not specified in the xml prologue,
+ // the encoding is not UTF8 and there are non-ascii chars in the text...
+ $parser = xml_parser_create($req_encoding);
+ }
+ else
+ {
+ $parser = xml_parser_create();
+ }
xml_parser_set_option($parser, XML_OPTION_CASE_FOLDING, true);
- // G. Giunta 2005/02/13: PHP internally uses ISO-8859-1, so we have to tell
- // the xml parser to give us back data in the expected charset
- @xml_parser_set_option($parser, XML_OPTION_TARGET_ENCODING, $xmlrpc_internalencoding);
+ // G. Giunta 2005/02/13: PHP internally uses ISO-8859-1, so we have to tell
+ // the xml parser to give us back data in the expected charset
+ xml_parser_set_option($parser, XML_OPTION_TARGET_ENCODING, $GLOBALS['xmlrpc_internalencoding']);
- xml_set_element_handler($parser, 'xmlrpc_se', 'xmlrpc_ee');
+ if ($this->functions_parameters_type != 'xmlrpcvals')
+ xml_set_element_handler($parser, 'xmlrpc_se', 'xmlrpc_ee_fast');
+ else
+ xml_set_element_handler($parser, 'xmlrpc_se', 'xmlrpc_ee');
xml_set_character_data_handler($parser, 'xmlrpc_cd');
xml_set_default_handler($parser, 'xmlrpc_dh');
- if (!xml_parse($parser, $data, 1))
+ if(!xml_parse($parser, $data, 1))
{
// return XML error as a faultCode
- $r=new xmlrpcresp(0,
- $xmlrpcerrxml+xml_get_error_code($parser),
- sprintf('XML error: %s at line %d',
+ $r=&new xmlrpcresp(0,
+ $GLOBALS['xmlrpcerrxml']+xml_get_error_code($parser),
+ sprintf('XML error: %s at line %d, column %d',
xml_error_string(xml_get_error_code($parser)),
- xml_get_current_line_number($parser)));
+ xml_get_current_line_number($parser), xml_get_current_column_number($parser)));
xml_parser_free($parser);
}
- else
- if ($_xh[$parser]['isf'])
+ elseif ($GLOBALS['_xh']['isf'])
{
xml_parser_free($parser);
- $r=new xmlrpcresp(0,
- $xmlrpcerr['invalid_request'],
- $xmlrpcstr['invalid_request'] . ' ' . $_xh[$parser]['isf_reason']);
+ $r=&new xmlrpcresp(0,
+ $GLOBALS['xmlrpcerr']['invalid_request'],
+ $GLOBALS['xmlrpcstr']['invalid_request'] . ' ' . $GLOBALS['_xh']['isf_reason']);
}
else
{
xml_parser_free($parser);
-
- $m=new xmlrpcmsg($_xh[$parser]['method']);
- // now add parameters in
- $plist='';
- //$allOK = 1;
- for($i=0; $i<sizeof($_xh[$parser]['params']); $i++)
+ if ($this->functions_parameters_type != 'xmlrpcvals')
{
- //print "<!-- " . $_xh[$parser]['params'][$i]. "-->\n";
- $plist.="$i - " . $_xh[$parser]['params'][$i]. ";\n";
- //$allOK = 0;
- //@eval('$m->addParam(' . $_xh[$parser]['params'][$i]. '); $allOK=1;');
- @$m->addParam($_xh[$parser]['params'][$i]);
- //if (!$allOK)
- //{
- // break;
- //}
+ if($this->debug > 1)
+ {
+ $this->debugmsg("\n+++PARSED+++\n".var_export($GLOBALS['_xh']['params'], true)."\n+++END+++");
+ }
+ $r = $this->execute($GLOBALS['_xh']['method'], $GLOBALS['_xh']['params'], $GLOBALS['_xh']['pt']);
}
- // uncomment this to really see what the server's getting!
- // xmlrpc_debugmsg($plist);
- //if (!$allOK)
- //{
- // $r = new xmlrpcresp(0,
- // $xmlrpcerr['incorrect_params'],
- // $xmlrpcstr['incorrect_params'] . ": xml error in param " . $i);
- //}
- //else
- //{
+ else
+ {
+ // build an xmlrpcmsg object with data parsed from xml
+ $m=&new xmlrpcmsg($GLOBALS['_xh']['method']);
+ // now add parameters in
+ for($i=0; $i<count($GLOBALS['_xh']['params']); $i++)
+ {
+ $m->addParam($GLOBALS['_xh']['params'][$i]);
+ }
+
+ if($this->debug > 1)
+ {
+ $this->debugmsg("\n+++PARSED+++\n".var_export($m, true)."\n+++END+++");
+ }
+
$r = $this->execute($m);
- //}
+ }
}
return $r;
}
- function execute ($m)
+ /**
+ * Execute a method invoked by the client, checking parameters used
+ * @param mixed $m either an xmlrpcmsg obj or a method name
+ * @param array $params array with method parameters as php types (if m is method name only)
+ * @param array $paramtypes array with xmlrpc types of method parameters (if m is method name only)
+ * @return xmlrpcresp
+ * @access private
+ */
+ function execute($m, $params=null, $paramtypes=null)
{
- global $xmlrpcerr, $xmlrpcstr, $_xmlrpcs_dmap;
- // now to deal with the method
- $methName = $m->method();
- $sysCall = ereg("^system\.", $methName);
- $dmap = $sysCall ? $_xmlrpcs_dmap : $this->dmap;
+ if (is_object($m))
+ {
+ $methName = $m->method();
+ }
+ else
+ {
+ $methName = $m;
+ }
+ $sysCall = $this->allow_system_funcs && (strpos($methName, "system.") === 0);
+ $dmap = $sysCall ? $GLOBALS['_xmlrpcs_dmap'] : $this->dmap;
- if (!isset($dmap[$methName]['function']))
+ if(!isset($dmap[$methName]['function']))
{
// No such method
return new xmlrpcresp(0,
- $xmlrpcerr['unknown_method'],
- $xmlrpcstr['unknown_method']);
+ $GLOBALS['xmlrpcerr']['unknown_method'],
+ $GLOBALS['xmlrpcstr']['unknown_method']);
}
- // Check signature.
- if (isset($dmap[$methName]['signature']))
+ // Check signature
+ if(isset($dmap[$methName]['signature']))
{
$sig = $dmap[$methName]['signature'];
- list($ok, $errstr) = $this->verifySignature($m, $sig);
+ if (is_object($m))
+ {
+ list($ok, $errstr) = $this->verifySignature($m, $sig);
+ }
+ else
+ {
+ list($ok, $errstr) = $this->verifySignature($paramtypes, $sig);
+ }
if(!$ok)
{
// Didn't match.
return new xmlrpcresp(
0,
- $xmlrpcerr['incorrect_params'],
- $xmlrpcstr['incorrect_params'] . ": ${errstr}"
+ $GLOBALS['xmlrpcerr']['incorrect_params'],
+ $GLOBALS['xmlrpcstr']['incorrect_params'] . ": ${errstr}"
);
}
}
$func = $dmap[$methName]['function'];
+ // let the 'class::function' syntax be accepted in dispatch maps
+ if(is_string($func) && strpos($func, '::'))
+ {
+ $func = explode('::', $func);
+ }
+ // verify that function to be invoked is in fact callable
+ if(!is_callable($func))
+ {
+ error_log("XML-RPC: xmlrpc_server::execute: function $func registered as method handler is not callable");
+ return new xmlrpcresp(
+ 0,
+ $GLOBALS['xmlrpcerr']['server_error'],
+ $GLOBALS['xmlrpcstr']['server_error'] . ": no function matches method"
+ );
+ }
- if ($sysCall)
+ // If debug level is 3, we should catch all errors generated during
+ // processing of user function, and log them as part of response
+ if($this->debug > 2)
{
- return call_user_func($func, $this, $m);
+ $GLOBALS['_xmlrpcs_prev_ehandler'] = set_error_handler('_xmlrpcs_errorHandler');
+ }
+ if (is_object($m))
+ {
+ if($sysCall)
+ {
+ $r = call_user_func($func, $this, $m);
+ }
+ else
+ {
+ $r = call_user_func($func, $m);
+ }
+ if (!is_a($r, 'xmlrpcresp'))
+ {
+ error_log("XML-RPC: xmlrpc_server::execute: function $func registered as method handler does not return an xmlrpcresp object");
+ if (is_a($r, 'xmlrpcval'))
+ {
+ $r =& new xmlrpcresp($r);
+ }
+ else
+ {
+ $r =& new xmlrpcresp(
+ 0,
+ $GLOBALS['xmlrpcerr']['server_error'],
+ $GLOBALS['xmlrpcstr']['server_error'] . ": function does not return xmlrpcresp object"
+ );
+ }
+ }
}
else
{
- return call_user_func($func, $m);
+ // call a 'plain php' function
+ if($sysCall)
+ {
+ array_unshift($params, $this);
+ $r = call_user_func_array($func, $params);
+ }
+ else
+ {
+ // 3rd API convention for method-handling functions: EPI-style
+ if ($this->functions_parameters_type == 'epivals')
+ {
+ $r = call_user_func_array($func, array($methName, $params, $this->user_data));
+ // mimic EPI behaviour: if we get an array that looks like an error, make it
+ // an eror response
+ if (is_array($r) && array_key_exists('faultCode', $r) && array_key_exists('faultString', $r))
+ {
+ $r =& new xmlrpcresp(0, (integer)$r['faultCode'], (string)$r['faultString']);
+ }
+ else
+ {
+ // functions using EPI api should NOT return resp objects,
+ // so make sure we encode the return type correctly
+ $r =& new xmlrpcresp(php_xmlrpc_encode($r, array('extension_api')));
+ }
+ }
+ else
+ {
+ $r = call_user_func_array($func, $params);
+ }
+ }
+ // the return type can be either an xmlrpcresp object or a plain php value...
+ if (!is_a($r, 'xmlrpcresp'))
+ {
+ // what should we assume here about automatic encoding of datetimes
+ // and php classes instances???
+ $r =& new xmlrpcresp(php_xmlrpc_encode($r, array('auto_dates')));
+ }
}
+ if($this->debug > 2)
+ {
+ // note: restore the error handler we found before calling the
+ // user func, even if it has been changed inside the func itself
+ if($GLOBALS['_xmlrpcs_prev_ehandler'])
+ {
+ set_error_handler($GLOBALS['_xmlrpcs_prev_ehandler']);
+ }
+ else
+ {
+ restore_error_handler();
+ }
+ }
+ return $r;
}
- function echoInput()
+ /**
+ * add a string to the 'internal debug message' (separate from 'user debug message')
+ * @param string $strings
+ * @access private
+ */
+ function debugmsg($string)
{
- global $HTTP_RAW_POST_DATA;
+ $this->debug_info .= $string."\n";
+ }
- // a debugging routine: just echos back the input
- // packet as a string value
+ /**
+ * @access private
+ */
+ function xml_header($charset_encoding='')
+ {
+ if ($charset_encoding != '')
+ {
+ return "<?xml version=\"1.0\" encoding=\"$charset_encoding\"?" . ">\n";
+ }
+ else
+ {
+ return "<?xml version=\"1.0\"?" . ">\n";
+ }
+ }
- $r=new xmlrpcresp;
- $r->xv=new xmlrpcval( "'Aha said I: '" . $HTTP_RAW_POST_DATA, 'string');
+ /**
+ * A debugging routine: just echoes back the input packet as a string value
+ * DEPRECATED!
+ */
+ function echoInput()
+ {
+ $r=&new xmlrpcresp(new xmlrpcval( "'Aha said I: '" . $GLOBALS['HTTP_RAW_POST_DATA'], 'string'));
print $r->serialize();
}
}
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: media.php,v 1.4 2007-03-27 12:13:47 kimitake Exp $
- * $NucleusJP: media.php,v 1.8 2007/03/20 19:32:19 kmorimatsu Exp $
+ * @version $Id: media.php,v 1.4.2.1 2008-01-29 07:05:05 kimitake Exp $
+ * $NucleusJP: media.php,v 1.8.2.1 2007/09/07 07:36:44 kimitake Exp $
*
*/
--- /dev/null
+<?php
+/*
+ Note: based on NP_PingPong, adapt for the new ping mechanism
+
+ History
+ v1.0 - Initial version
+ v1.1 - Add JustPosted event support
+ v1.2 - JustPosted event handling in background
+ v1.3 - pinged variable support
+ v1.4 - language file support
+ v1.5 - remove arg1 in exec() call
+ */
+
+class NP_Ping extends NucleusPlugin {
+
+ function getName() { return 'Ping'; }
+
+ function getAuthor() { return 'admun (Edmond Hui)'; }
+ function getURL() { return 'http://edmondhui.homeip.net/nudn'; }
+ function getVersion() { return '1.5'; }
+
+ function getMinNucleusVersion() { return '330'; }
+
+ function getDescription() {
+ return _PING_DESC;
+ }
+
+ function supportsFeature($what) {
+ switch($what) {
+ case 'SqlTablePrefix':
+ return 1;
+ default:
+ return 0;
+ }
+ }
+
+ function init()
+ {
+ $language = ereg_replace( '[\\|/]', '', getLanguageName());
+ if (file_exists($this->getDirectory() . $language . '.php')) {
+ include_once($this->getDirectory() . $language . '.php');
+ }else {
+ include_once($this->getDirectory() . 'english.php');
+ }
+ }
+
+ function install() {
+ $this->createOption('pingpong_pingomatic',_PING_PINGOM,'yesno','yes'); // Default, http://pingomatic.com
+ $this->createOption('pingpong_weblogs',_PING_WEBLOGS,'yesno','no'); // http://weblogs.com
+ $this->createOption('pingpong_technorati',_PING_TECHNOR,'yesno','no'); // http://www.technorati.com
+ $this->createOption('pingpong_blogrolling',_PING_BLOGR,'yesno','no'); // http://www.blogrolling.com
+ $this->createOption('pingpong_blogs',_PING_BLOGS,'yesno','no'); // http://blo.gs
+ $this->createOption('pingpong_weblogues',_PING_WEBLOGUES,'yesno','no'); // http://weblogues.com/
+ $this->createOption('pingpong_bloggde',_PING_BLOGGDE,'yesno','no'); // http://blogg.de
+ $this->createOption('ping_background',_PING_BG,'yesno','yes');
+ }
+
+ function getEventList() {
+ return array('SendPing', 'JustPosted');
+ }
+
+ function event_JustPosted($data) {
+ global $DIR_PLUGINS, $DIR_NUCLEUS;
+
+ // exit is another plugin already send ping
+ if ($data['pinged'] == true) {
+ return;
+ }
+
+ if ($this->getOption('ping_background') == "yes") {
+ exec("php $DIR_PLUGINS/ping/ping.php " . $data['blogid'] . " &");
+ } else {
+ $this->sendPings($data['blogid']);
+
+ ACTIONLOG::add(INFO, 'NP_Ping: Sending ping (from foreground)');
+ }
+
+ // mark the ping has been sent
+ $data['pinged'] = true;
+ }
+
+ function event_SendPing($data) {
+ $this->sendPings($data);
+ }
+
+ function sendPings($data) {
+ if (!class_exists('xmlrpcmsg')) {
+ global $DIR_LIBS;
+ include($DIR_LIBS . 'xmlrpc.inc.php');
+ }
+
+ $this->myBlogId = $data['blogid'];
+
+ if ($this->getOption('pingpong_pingomatic')=='yes') {
+ echo _PINGING . "Ping-o-matic:<br/>";
+ echo $this->pingPingomatic();
+ echo "<br/>";
+ }
+
+ if ($this->getOption('pingpong_weblogs')=='yes') {
+ echo _PINGING . "Weblogs.com:<br/>";
+ echo $this->pingWeblogs();
+ echo "<br/>";
+ }
+
+ if ($this->getOption('pingpong_technorati')=='yes') {
+ echo _PINGING . "Technorati:<br/>";
+ echo $this->pingTechnorati();
+ echo "<br/>";
+ }
+
+ if ($this->getOption('pingpong_blogrolling')=='yes') {
+ echo _PINGING . "Blogrolling.com:<br/>";
+ echo $this->pingBlogRollingDotCom();
+ echo "<br/>";
+ }
+
+ if ($this->getOption('pingpong_blogs')=='yes') {
+ echo _PINGING . "Blog.gs:<br/>";
+ echo $this->pingBloGs();
+ echo "<br/>";
+ }
+
+ if ($this->getOption('pingpong_weblogues')=='yes') {
+ echo _PINGING . "Weblogues.com:<br/>";
+ echo $this->pingWebloguesDotCom();
+ echo "<br/>";
+ }
+
+ if ($this->getOption('pingpong_bloggde')=='yes') {
+ echo _PINGING . "Blog.de:<br/>";
+ echo $this->pingBloggDe();
+ echo "<br/>";
+ }
+ }
+
+ function pingPingomatic() {
+ $b = new BLOG($this->myBlogId);
+ $message = new xmlrpcmsg(
+ 'weblogUpdates.ping', array(
+ new xmlrpcval($b->getName(),'string'),
+ new xmlrpcval($b->getURL(),'string')
+ ));
+
+ $c = new xmlrpc_client('/', 'rpc.pingomatic.com', 80);
+ //$c->setDebug(1);
+
+ $r = $c->send($message,30); // 30 seconds timeout...
+ return $this->processPingResult($r);
+ }
+
+ function pingWeblogs() {
+ $b = new BLOG($this->myBlogId);
+ $message = new xmlrpcmsg(
+ 'weblogupdates.ping',array(
+ new xmlrpcval($b->getName(),'string'),
+ new xmlrpcval($b->getUrl(),'string')
+ ));
+
+ $c = new xmlrpc_client('/rpc2', 'rpc.weblogs.com', 80);
+ //$c->setdebug(1);
+
+ $r = $c->send($message,30); // 30 seconds timeout...
+ return $this->processPingResult($r);
+ }
+
+ function pingTechnorati() {
+ $b = new BLOG($this->myBlogId);
+ $message = new xmlrpcmsg(
+ 'weblogUpdates.ping', array(
+ new xmlrpcval($b->getName(),'string'),
+ new xmlrpcval($b->getURL(),'string')
+ ));
+
+ $c = new xmlrpc_client('/rpc/ping/', 'rpc.technorati.com', 80);
+ //$c->setDebug(1);
+
+ $r = $c->send($message,30); // 30 seconds timeout...
+ return $this->processPingResult($r);
+ }
+
+ function pingBlogRollingDotCom() {
+ $b = new BLOG($this->myBlogId);
+ $message = new xmlrpcmsg(
+ 'weblogUpdates.ping',
+ array(
+ new xmlrpcval($b->getName(),'string'), // your blog title
+ new xmlrpcval($b->getURL(),'string') // your blog url
+ ));
+
+ $c = new xmlrpc_client('/pinger/', 'rpc.blogrolling.com', 80);
+ //$c->setDebug(1);
+
+ $r = $c->send($message,30); // 30 seconds timeout...
+ return $this->processPingResult($r);
+ }
+
+ function pingBloGs() {
+ $b = new BLOG($this->myBlogId);
+ $message = new xmlrpcmsg(
+ 'weblogUpdates.extendedPing', array(
+ new xmlrpcval($b->getName(),'string'),
+ new xmlrpcval($b->getURL(),'string')
+ ));
+
+ $c = new xmlrpc_client('/', 'ping.blo.gs', 80);
+ //$c->setDebug(1);
+
+ $r = $c->send($message,30); // 30 seconds timeout...
+ return $this->processPingResult($r);
+ }
+
+ function pingWebloguesDotCom() {
+ $b = new BLOG($this->myBlogId);
+ $message = new xmlrpcmsg(
+ 'weblogUpdates.extendedPing',
+ array(
+ new xmlrpcval($b->getName(),'string'), // your blog title
+ new xmlrpcval($b->getURL(),'string') // your blog url
+ ));
+
+ $c = new xmlrpc_client('/RPC/', 'www.weblogues.com', 80);
+ //$c->setDebug(1);
+
+ $r = $c->send($message,30); // 30 seconds timeout...
+ return $this->processPingResult($r);
+ }
+
+ function pingBloggDe() {
+ $b = new BLOG($this->myBlogId);
+ $message = new xmlrpcmsg(
+ 'bloggUpdates.ping', array(
+ new xmlrpcval($b->getName(),'string'),
+ new xmlrpcval($b->getURL(),'string')
+ ));
+
+ $c = new xmlrpc_client('/', 'xmlrpc.blogg.de', 80);
+ //$c->setDebug(1);
+
+ $r = $c->send($message,30); // 30 seconds timeout...
+ return $this->processPingResult($r);
+ }
+
+ function processPingResult($r) {
+ global $php_errormsg;
+
+ if (($r == 0) && ($r->errno || $r->errstring)) {
+ return _PING_ERROR . " " . $r->errno . ' : ' . $r->errstring;
+ } elseif (($r == 0) && ($php_errormsg)) {
+ return _PING_PHP_ERROR . $php_errormsg;
+ } elseif ($r == 0) {
+ return _PING_PHP_PING_ERROR;
+ } elseif ($r->faultCode() != 0) {
+ return _PING_ERROR . ': ' . $r->faultString();
+ } else {
+ $r = $r->value(); // get response struct
+
+ // get values
+ $flerror = $r->structmem('flerror');
+ $flerror = $flerror->scalarval();
+
+ $message = $r->structmem('message');
+ $message = $message->scalarval();
+
+ if ($flerror != 0) {
+ return _PING_ERROR . ' (flerror=1): ' . $message;
+ }
+ else {
+ return _PING_SUCCESS . ': ' . $message;
+ }
+ }
+ }
+}
+
+?>
*
* Copyright 2005-2007 by Jeff MacMichael and Niels Leenheer
*
- * @version $Id: NP_SkinFiles.php,v 1.2 2007-03-22 09:24:07 kimitake Exp $
- * @version $NucleusJP: NP_SkinFiles.php,v 1.4 2007/02/04 06:28:46 kimitake Exp $
+ * @version $Id: NP_SkinFiles.php,v 1.2.2.1 2008-01-29 07:05:06 kimitake Exp $
+ * @version $NucleusJP: NP_SkinFiles.php,v 1.2 2007/03/22 09:24:07 kimitake Exp $
*
* ==========================================================================================
* This program is free software and open source software; you can redistribute
function getAuthor() { return 'Misc authors'; }
function getURL() { return 'http://www.nucleuscms.org/'; }
function getVersion() { return '2.02'; }
- function getDescription() { return 'A simple file manager for skins.'; }
+ function getDescription() { return _SKINFILES_DESC; }
function supportsFeature($what) {
switch($what)
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">\r
-<html xmlns="http://www.w3.org/1999/xhtml">\r
-<head>\r
- <title>Nothing Here</title>\r
-</head>\r
-<body>\r
-\r
-<h1>Nothing to see here</h1>\r
-\r
-</body>\r
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml">
+<head>
+ <title>Nothing Here</title>
+</head>
+<body>
+<h1>Nothing to see here</h1>
+</body>
</html>
\ No newline at end of file
--- /dev/null
+<?php
+ define('_PING_DESC', 'This plugin can be used to ping many blog tracking services. - Don\'t forget to enable the option \'Ping weblog listing service on update\' in your blog settings!');
+ define('_PING_PINGOM', 'Ping-o-matic');
+ define('_PING_WEBLOGS', 'weblogs.com');
+ define('_PING_TECHNOR', 'Technorati');
+ define('_PING_BLOGR', 'Blogrolling');
+ define('_PING_BLOGS', 'Blo.gs (no longer works?)');
+ define('_PING_WEBLOGUES', 'Weblogues (no longer works?)');
+ define('_PING_BLOGGDE', 'Blogg.de (not working??)');
+ define('_PING_BG', 'Ping from background when a future post first appears');
+ define('_PINGING', 'Pinging ');
+ define('_PING_ERROR', 'Error');
+ define('_PING_PHP_ERROR', 'PHP Error: ');
+ define('_PING_PHP_PING_ERROR', 'Error while trying to send ping. Sorry about that.');
+ define('_PING_SUCCESS', 'Success');
+?>
--- /dev/null
+<?php
+ define('_PING_DESC', '¤³¤Î¥×¥é¥°¥¤¥ó¤Ï°ìÅ٤˿¤¯¤Î¥Ö¥í¥°¥È¥é¥Ã¥¥ó¥°¥·¥¹¥Æ¥à¤Ë ping ¤òÁ÷¿®¤¹¤ë¤³¤È¤¬¤Ç¤¤Þ¤¹¡£- ¥Ö¥í¥°ÀßÄê¤Ç¡Ö¹¹¿·»þ¤Ëweblogs¥¢¥Ã¥×¥Ç¡¼¥ÈÄÌÃÎ¥µ¡¼¥Ó¥¹¤ØPing¤òÁ÷¤ê¤Þ¤¹¤«?¡×¤Î¥ª¥×¥·¥ç¥ó¤ò¡Ö¤Ï¤¤¡×¤Ë¤¹¤ë¤³¤È¤ò˺¤ì¤Ê¤¤¤è¤¦¤Ë¤·¤Æ¤¯¤À¤µ¤¤¡£');
+ define('_PING_PINGOM', 'Ping-o-matic');
+ define('_PING_WEBLOGS', 'weblogs.com');
+ define('_PING_TECHNOR', 'Technorati');
+ define('_PING_BLOGR', 'Blogrolling');
+ define('_PING_BLOGS', 'Blo.gs (¥µ¡¼¥Ó¥¹½ªÎ»¡©)');
+ define('_PING_WEBLOGUES', 'Weblogues (¥µ¡¼¥Ó¥¹½ªÎ»¡©)');
+ define('_PING_BLOGGDE', 'Blogg.de (¥µ¡¼¥Ó¥¹Ää»ßÃæ??)');
+ define('_PING_BG', '̤Íè¤ÎÆüÉդε»ö¤¬Í¸ú¤Ë¤Ê¤Ã¤¿¤È¤¥Ð¥Ã¥¯¥°¥é¥ó¥É¤Ç ping ¤òÁ÷¿®¤¹¤ë');
+ define('_PINGING', 'Ping Á÷¿®Ãæ ');
+ define('_PING_ERROR', '¥¨¥é¡¼');
+ define('_PING_PHP_ERROR', 'PHP ¥¨¥é¡¼: ');
+ define('_PING_PHP_PING_ERROR', '¿½¤·Ìõ¤¢¤ê¤Þ¤»¤ó¡£ping ¤òÁ÷¿®Ãæ¤Ë¥¨¥é¡¼¤¬È¯À¸¤·¤Þ¤·¤¿¡£');
+ define('_PING_SUCCESS', 'À®¸ù');
+?>
--- /dev/null
+<?php
+ define('_PING_DESC', 'このプラグインは一度に多くのブログトラッキングシステムに ping を送信することができます。- ブログ設定で「更新時にweblogsアップデート通知サービスへPingを送りますか?」のオプションを「はい」にすることを忘れないようにしてください。');
+ define('_PING_PINGOM', 'Ping-o-matic');
+ define('_PING_WEBLOGS', 'weblogs.com');
+ define('_PING_TECHNOR', 'Technorati');
+ define('_PING_BLOGR', 'Blogrolling');
+ define('_PING_BLOGS', 'Blo.gs (サービス終了?)');
+ define('_PING_WEBLOGUES', 'Weblogues (サービス終了?)');
+ define('_PING_BLOGGDE', 'Blogg.de (サービス停止中??)');
+ define('_PING_BG', '未来の日付の記事が有効になったときバックグランドで ping を送信する');
+ define('_PINGING', 'Ping 送信中 ');
+ define('_PING_ERROR', 'エラー');
+ define('_PING_PHP_ERROR', 'PHP エラー: ');
+ define('_PING_PHP_PING_ERROR', '申し訳ありません。ping を送信中にエラーが発生しました。');
+ define('_PING_SUCCESS', '成功');
+?>
--- /dev/null
+<?php
+require(dirname(__FILE__).'/../../../config.php');
+
+include($DIR_LIBS . 'PLUGINADMIN.php');
+
+// create a object of the plugin via Plugin Admin
+$oPluginAdmin = new PluginAdmin('Ping');
+ACTIONLOG::add(INFO, 'NP_Ping: Sending ping (from background)');
+
+$blogid = intval($argv[1]);
+if ($blogid > 0) {
+ $oPluginAdmin->plugin->sendPings($blogid);
+} else {
+ ACTIONLOG::add(WARNING, 'NP_Ping: invalid blogid, background ping abort');
+}
+?>
<?php
/*
- * @version $Id: english.php,v 1.2 2007-04-18 23:21:48 kimitake Exp $
- * @version $NucleusJP: english.php,v 1.3 2007/02/04 06:28:46 kimitake Exp $
+ * @version $Id: english.php,v 1.2.2.1 2008-01-29 07:05:07 kimitake Exp $
+ * @version $NucleusJP: english.php,v 1.2 2007/04/18 23:21:48 kimitake Exp $
*/
+define('_SKINFILES_DESC', 'A simple file manager for skins.');
+
define('_SKINFILES_TITLE', 'Skin Files');
define('_SKINFILES_TOOLTIP', 'Manage skin files');
*
* Copyright 2005-2007 by Jeff MacMichael and Niels Leenheer
*
- * @version $Id: index.php,v 1.2 2007-03-22 09:16:11 kimitake Exp $
- * @version $NucleusJP: index.php,v 1.6 2007/03/20 19:32:47 kmorimatsu Exp $
+ * @version $Id: index.php,v 1.2.2.1 2008-01-29 07:05:07 kimitake Exp $
+ * @version $NucleusJP: index.php,v 1.6.2.1 2007/09/07 07:08:01 kimitake Exp $
*
* ==========================================================================================
* This program is free software and open source software; you can redistribute
<?php
/*
- * @version $Id: japanese-euc.php,v 1.2 2007-03-22 09:16:11 kimitake Exp $
- * @version $NucleusJP: japanese-euc.php,v 1.3 2007/02/04 06:28:46 kimitake Exp $
+ * @version $Id: japanese-euc.php,v 1.2.2.1 2008-01-29 07:05:07 kimitake Exp $
+ * @version $NucleusJP: japanese-euc.php,v 1.2 2007/03/22 09:16:11 kimitake Exp $
*/
+define('_SKINFILES_DESC', '¥¹¥¥ó¤Î¤¿¤á¤Î´Ê°×¥Õ¥¡¥¤¥ë¥Þ¥Í¡¼¥¸¥ã');
+
define('_SKINFILES_TITLE', '¥¹¥¥ó¥Õ¥¡¥¤¥ë');
define('_SKINFILES_TOOLTIP', '¥¹¥¥ó¥Õ¥¡¥¤¥ë¤Î´ÉÍý');
<?php
/*
- * @version $Id: japanese-utf8.php,v 1.2 2007-03-22 09:16:11 kimitake Exp $
- * @version $NucleusJP: japanese-utf8.php,v 1.3 2007/02/04 06:28:46 kimitake Exp $
+ * @version $Id: japanese-utf8.php,v 1.2.2.1 2008-01-29 07:05:07 kimitake Exp $
+ * @version $NucleusJP: japanese-utf8.php,v 1.2 2007/03/22 09:16:11 kimitake Exp $
*/
+define('_SKINFILES_DESC', 'スキンのための簡易ファイルマネージャ');
+
define('_SKINFILES_TITLE', 'スキンファイル');
define('_SKINFILES_TOOLTIP', 'スキンファイルの管理');
/*
style definitions for the bookmarklet
- $Id: bookmarklet.css,v 1.4 2007-03-22 09:18:16 kimitake Exp $
- $NucleusJP: bookmarklet.css,v 1.6 2007/01/30 07:35:20 kimitake Exp $
+ $Id: bookmarklet.css,v 1.4.2.1 2008-01-29 07:05:07 kimitake Exp $
+ $NucleusJP: bookmarklet.css,v 1.4 2007/03/22 09:18:16 kimitake Exp $
*/
body {
.contentblock {
/*background: #ddd;*/
- height: 400px;
+ height: 450px;
overflow: auto; /* temporary removed, to make the select box work in Mozilla */
padding: 1px;
margin: 0px;
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">\r
-<html xmlns="http://www.w3.org/1999/xhtml">\r
-<head>\r
- <title>Nothing Here</title>\r
-</head>\r
-<body>\r
-\r
-<h1>Nothing to see here</h1>\r
-\r
-</body>\r
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml">
+<head>
+ <title>Nothing Here</title>
+</head>
+<body>
+
+<h1>Nothing to see here</h1>
+
+</body>
</html>
\ No newline at end of file
*
* @license http://nucleuscms.org/license.txt GNU General Public License
* @copyright Copyright (C) 2002-2007 The Nucleus Group
- * @version $Id: server.php,v 1.8 2007-03-27 12:14:05 kimitake Exp $
- * @version $NucleusJP: server.php,v 1.8 2007/03/20 19:33:25 kmorimatsu Exp $
+ * @version $Id: server.php,v 1.8.2.1 2008-01-29 07:05:07 kimitake Exp $
+ * @version $NucleusJP: server.php,v 1.8.2.1 2007/09/07 07:12:42 kimitake Exp $
*/
$CONF = array();
require("../../config.php"); // include Nucleus libs and code
-User-agent: *\r
-Disallow: action.php?\r
+User-agent: *
+Disallow: action.php?
-<div class="clearing"> </div>\r
-</div>\r
-</div>\r
-<!-- end wrapper divs -->\r
-\r
-<!-- page footer, copyrights, etc. -->\r
-<div id="footer">\r
-<div id="copyrights">\r
- <small>Copyright | <a href="http://nucleuscms.org"><%version%></a> | \r
- <a href="http://validator.w3.org/check?uri=referer">Valid XHTML 1.0 Strict</a> | \r
- <a href="http://jigsaw.w3.org/css-validator/">Valid CSS</a> | \r
- <a href="#top">Back to top</a></small>\r
-</div>\r
-</div>\r
-\r
-</body>\r
+<div class="clearing"> </div>
+</div>
+</div>
+<!-- end wrapper divs -->
+<!-- page footer, copyrights, etc. -->
+<div id="footer">
+<div id="copyrights">
+ <small>Copyright | <a href="http://nucleuscms.org"><%version%></a> |
+ <a href="http://validator.w3.org/check?uri=referer">Valid XHTML 1.0 Strict</a> |
+ <a href="http://jigsaw.w3.org/css-validator/">Valid CSS</a> |
+ <a href="#top">Back to top</a></small>
+</div>
+</div>
+</body>
</html>
\ No newline at end of file
-<body>\r
-\r
-<!-- page header -->\r
-<div id="header"><a name="top"></a>\r
-<h1>\r
- <%if(skintype,error)%>\r
- <a href="<%sitevar(url)%>" accesskey="1"><%sitevar(name)%></a>\r
- <%else%>\r
- <%if(skintype,member)%>\r
- <a href="<%sitevar(url)%>" accesskey="1"><%sitevar(name)%></a>\r
- <%else%>\r
- <a href="<%blogsetting(url)%>" accesskey="1"><%blogsetting(name)%></a>\r
- <%endif%>\r
- <%endif%>\r
-</h1>\r
-</div>\r
-\r
-<!-- begin wrapper divs -->\r
-<div id="mainwrapper">\r
+<body>
+<!-- page header -->
+<div id="header"><a name="top"></a>
+<h1>
+ <%if(skintype,error)%>
+ <a href="<%sitevar(url)%>" accesskey="1"><%sitevar(name)%></a>
+ <%else%>
+ <%if(skintype,member)%>
+ <a href="<%sitevar(url)%>" accesskey="1"><%sitevar(name)%></a>
+ <%else%>
+ <a href="<%blogsetting(url)%>" accesskey="1"><%blogsetting(name)%></a>
+ <%endif%>
+ <%endif%>
+</h1>
+</div>
+<!-- begin wrapper divs -->
+<div id="mainwrapper">
<div id="wrapper">
\ No newline at end of file
-/*Nice Titles*/\r
-.nicetitle {\r
- font-weight: bold;\r
- color: #3C3C3C;\r
- text-align: left;\r
- position: absolute;\r
- left: 0;\r
- top: 0;\r
- width: 25em;\r
- z-index: 20;\r
- max-width: 50%;\r
-}\r
-.nicetitle-content{\r
- overflow: hidden;\r
- background: white;\r
- border: 1px solid #333;\r
- padding: 5px;\r
- opacity: 0.9;\r
-}\r
-.nicetitle p{\r
- margin: 0;\r
- line-height: 120%;\r
-}\r
-.nicetitle p.destination {\r
- font-weight: normal;\r
- font-size: 10px;\r
- color: #5E7743;\r
-}\r
-div.nicetitle p span.accesskey {\r
- color: #FF7200;\r
+/*Nice Titles*/
+.nicetitle {
+ font-weight: bold;
+ color: #3C3C3C;
+ text-align: left;
+ position: absolute;
+ left: 0;
+ top: 0;
+ width: 25em;
+ z-index: 20;
+ max-width: 50%;
+}
+.nicetitle-content{
+ overflow: hidden;
+ background: white;
+ border: 1px solid #333;
+ padding: 5px;
+ opacity: 0.9;
+}
+.nicetitle p{
+ margin: 0;
+ line-height: 120%;
+}
+.nicetitle p.destination {
+ font-weight: normal;
+ font-size: 10px;
+ color: #5E7743;
+}
+div.nicetitle p span.accesskey {
+ color: #FF7200;
}
\ No newline at end of file
-// from http://www.kryogenix.org\r
-// by Scott Andrew - http://scottandrew.com\r
-// add an eventlistener to browsers that can do it somehow.\r
-function addEvent(obj, evType, fn)\r
- {\r
- if (obj.addEventListener)\r
- {\r
- obj.addEventListener(evType, fn, false);\r
- return true;\r
- }\r
- else if (obj.attachEvent)\r
- {\r
- var r = obj.attachEvent('on'+evType, fn);\r
- return r;\r
- }\r
- else\r
- {\r
- return false;\r
- }\r
- }\r
-\r
-function floatImages()\r
- {\r
- // adapted from http://www.dithered.com/javascript/browser_detect/\r
- //**************************************************************//\r
- // sniff user agent\r
- var userAgent = navigator.userAgent.toLowerCase();\r
-\r
- // if Mozilla 1.4 then quit\r
- if ((userAgent.indexOf('gecko') != -1) && (userAgent.indexOf('gecko/') + 14 == userAgent.length) && (parseFloat(userAgent.substring(userAgent.indexOf('rv:') + 3)) == '1.4')) return;\r
-\r
- // if Opera then quit\r
- if (document.all && window.Event) return;\r
- //**************************************************************//\r
-\r
- // check this browser can cope with what we want to do\r
- if (!document.getElementById) return;\r
- var blogDiv = document.getElementById('blog');\r
- if (!blogDiv) return;\r
- if (!blogDiv.offsetWidth) return;\r
-\r
- blogDiv.className = (blogDiv.offsetWidth >= 500) ? "float-images" : "block-images";\r
- }\r
-\r
-// Blockquote citations\r
-\r
-// Simon Willison's work:\r
-// http://simon.incutio.com/archive/2002/12/20/#blockquoteCitations\r
-\r
-// Also Dunstan Orchard's work:\r
-// http://1976design.com/blog/archive/2003/11/10/updates/\r
-function blockquoteCite()\r
- {\r
- if (!document.createElementNS)\r
- {\r
- document.createElementNS = function(ns, elt)\r
- {\r
- return document.createElement(elt);\r
- }\r
- }\r
- quotes = document.getElementsByTagName('blockquote');\r
- for (i = 0; i < quotes.length; i++)\r
- {\r
- var cite = quotes[i].getAttribute('cite');\r
- // value of cite attribute should only contain URI, not any other\r
- if ((cite) && (cite != ''))\r
- {\r
- newlink = document.createElementNS('http://www.w3.org/1999/xhtml', 'a');\r
- newlink.setAttribute('href', cite);\r
- newlink.className = 'cite-link';\r
- newlink.appendChild(document.createTextNode(cite));\r
- newdiv = document.createElementNS('http://www.w3.org/1999/xhtml', 'cite');\r
- newdiv.className = 'blockquote-cite';\r
- newdiv.appendChild(document.createTextNode('Source: '));\r
- newdiv.appendChild(newlink);\r
- quotes[i].appendChild(newdiv);\r
- quotes[i].removeAttribute('cite');\r
- }\r
- }\r
- }\r
-\r
-// Ins and Del tags citations\r
-function insdelCite()\r
- {\r
- if (!document.createElementNS)\r
- {\r
- document.createElementNS = function(ns, elt)\r
- {\r
- return document.createElement(elt);\r
- }\r
- }\r
- var insdel = new Array(2);\r
- insdel[0] = document.getElementsByTagName('ins');\r
- insdel[1] = document.getElementsByTagName('del');\r
- for (var i=0; i<insdel.length; i++)\r
- {\r
- if (insdel[i])\r
- {\r
- for (var id=0; id<insdel[i].length; id++)\r
- {\r
- var isdl = insdel[i][id].getAttribute('cite');\r
- if ((isdl) && (isdl != ""))\r
- {\r
- idlink = document.createElementNS('http://www.w3.org/1999/xhtml', 'a');\r
- idlink.setAttribute('href', isdl);\r
- idlink.className = 'cite-link ' + (i == 0 ? 'ins-cite' : 'del-cite');\r
- idlink.setAttribute('title','citation of ' + (i == 0 ? 'added' : 'deleted') + ' text');\r
- idlink.appendChild(document.createTextNode('#'));\r
- insdel[i][id].appendChild(idlink);\r
- insdel[i][id].removeAttribute('cite');\r
- }\r
- }\r
- }\r
- }\r
- }\r
-\r
-// Force IE not to show alternate text as tooltip\r
-function noAltTooltip()\r
- {\r
- images = document.getElementsByTagName('img');\r
- for (var i = 0; i < images.length; i++)\r
- {\r
- var title = images[i].getAttribute('title');\r
- var alt = images[i].getAttribute('alt');\r
- if ((document.all) && (alt) && (!title))\r
- {\r
- images[i].setAttribute('title', '');\r
- }\r
- }\r
- }\r
-\r
-// Nice Titles\r
-\r
-// original code by Stuart Langridge 2003-11\r
-// with additions to the code by other good people\r
-// http://www.kryogenix.org/code/browser/nicetitle/\r
-// thank you, sir\r
-\r
-// modified by Peter Janes 2003-03-25\r
-// http://peterjanes.ca/blog/archives/2003/03/25/nicetitles-for-ins-and-del\r
-// added in ins and del tags\r
-\r
-// modified by Dunstan Orchard 2003-11-18\r
-// http://1976design.com/blog/\r
-// added in accesskey information\r
-// tried ever-so-hard, but couldn't work out how to do what Ethan did\r
-\r
-// final genius touch by by Ethan Marcotte 2003-11-18\r
-// http://www.sidesh0w.com/\r
-// worked out how to delay showing the popups to make them more like the browser's own\r
-\r
-// set the namespace\r
-var XHTMLNS = 'http://www.w3.org/1999/xhtml';\r
-var CURRENT_NICE_TITLE;\r
-\r
-// browser sniff\r
-var browser = new Browser();\r
-\r
-// determine browser and version.\r
-function Browser()\r
- {\r
- var ua, s, i;\r
-\r
- this.isIE = false;\r
- this.isNS = false;\r
- this.version = null;\r
-\r
- ua = navigator.userAgent;\r
-\r
- s = 'MSIE';\r
- if ((i = ua.indexOf(s)) >= 0)\r
- {\r
- this.isIE = true;\r
- this.version = parseFloat(ua.substr(i + s.length));\r
- return;\r
- }\r
-\r
- s = 'Netscape6/';\r
- if ((i = ua.indexOf(s)) >= 0)\r
- {\r
- this.isNS = true;\r
- this.version = parseFloat(ua.substr(i + s.length));\r
- return;\r
- }\r
-\r
- // treat any other 'Gecko' browser as NS 6.1.\r
- s = 'Gecko';\r
- if ((i = ua.indexOf(s)) >= 0)\r
- {\r
- this.isNS = true;\r
- this.version = 6.1;\r
- return;\r
- }\r
- }\r
-\r
-// 2003-11-19 sidesh0w\r
-// set delay vars to emulate normal hover delay\r
-var delay;\r
-var interval = 0.60;\r
-\r
-// this function runs on window load\r
-// it runs through all the links on the page as starts listening for actions\r
-function makeNiceTitles()\r
- {\r
- if (!document.createElement || !document.getElementsByTagName) return;\r
- if (!document.createElementNS)\r
- {\r
- document.createElementNS = function(ns, elt)\r
- {\r
- return document.createElement(elt);\r
- }\r
- }\r
-\r
- // do regular links\r
- if (!document.links)\r
- {\r
- document.links = document.getElementsByTagName('a');\r
- }\r
- for (var ti=0; ti<document.links.length; ti++)\r
- {\r
- var lnk = document.links[ti];\r
- // * I added specific class names here..\r
- if (lnk.title)\r
- {\r
- lnk.setAttribute('nicetitle', lnk.title);\r
- lnk.removeAttribute('title');\r
- addEvent(lnk, 'mouseover', showDelay);\r
- addEvent(lnk, 'mouseout', hideNiceTitle);\r
- addEvent(lnk, 'focus', showDelay);\r
- addEvent(lnk, 'blur', hideNiceTitle);\r
- }\r
- }\r
-\r
- // 2003-03-25 Peter Janes\r
- // do ins and del tags\r
- var tags = new Array(2);\r
- tags[0] = document.getElementsByTagName('ins');\r
- tags[1] = document.getElementsByTagName('del');\r
- for (var tt=0; tt<tags.length; tt++)\r
- {\r
- if (tags[tt])\r
- {\r
- for (var ti=0; ti<tags[tt].length; ti++)\r
- {\r
- var tag = tags[tt][ti];\r
- if (tag.dateTime)\r
- {\r
- var strDate = tag.dateTime;\r
- // HTML/ISO8601 date: yyyy-mm-ddThh:mm:ssTZD (Z, -hh:mm, +hh:mm)\r
- var month = strDate.substring(5,7);\r
- var day = strDate.substring(8,10);\r
- if (month[0] == '0')\r
- {\r
- month = month[1];\r
- }\r
- if (day[0] == '0')\r
- {\r
- day = day[1];\r
- }\r
- var dtIns = new Date(strDate.substring(0,4), month-1, day, strDate.substring(11,13), strDate.substring(14,16), strDate.substring(17,19));\r
- tag.setAttribute('nicetitle', (tt == 0 ? 'Added' : 'Deleted') + ' on ' + dtIns.toString());\r
- addEvent(tag, 'mouseover', showDelay);\r
- addEvent(tag, 'mouseout', hideNiceTitle);\r
- addEvent(tag, 'focus', showDelay);\r
- addEvent(tag, 'blur', hideNiceTitle);\r
- }\r
- }\r
- }\r
- }\r
- }\r
-\r
-function findPosition(oLink)\r
- {\r
- if (oLink.offsetParent)\r
- {\r
- for (var posX = 0, posY = 0; oLink.offsetParent; oLink = oLink.offsetParent)\r
- {\r
- posX += oLink.offsetLeft;\r
- posY += oLink.offsetTop;\r
- }\r
- return [posX, posY];\r
- }\r
- else\r
- {\r
- return [oLink.x, oLink.y];\r
- }\r
- }\r
-\r
-function getParent(el, pTagName)\r
- {\r
- if (el == null)\r
- {\r
- return null;\r
- }\r
- // gecko bug, supposed to be uppercase\r
- else if (el.nodeType == 1 && el.tagName.toLowerCase() == pTagName.toLowerCase())\r
- {\r
- return el;\r
- }\r
- else\r
- {\r
- return getParent(el.parentNode, pTagName);\r
- }\r
- }\r
-\r
-// 2003-11-19 sidesh0w\r
-// trailerpark wrapper function\r
-function showDelay(e)\r
- {\r
- if (window.event && window.event.srcElement)\r
- {\r
- lnk = window.event.srcElement\r
- }\r
- else if (e && e.target)\r
- {\r
- lnk = e.target\r
- }\r
- if (!lnk) return;\r
-\r
- // lnk is a textnode or an elementnode that's not ins/del\r
- if (lnk.nodeType == 3 || (lnk.nodeType == 1 && lnk.tagName.toLowerCase() != 'ins' && lnk.tagName.toLowerCase() != 'del'))\r
- {\r
- // ascend parents until we hit a link\r
- lnk = getParent(lnk, 'a');\r
- }\r
-\r
- delay = setTimeout("showNiceTitle(lnk)", interval * 1000);\r
- }\r
-\r
-// build and show the nice titles\r
-function showNiceTitle(link)\r
- {\r
- if (CURRENT_NICE_TITLE) hideNiceTitle(CURRENT_NICE_TITLE);\r
- if (!document.getElementsByTagName) return;\r
-\r
- nicetitle = lnk.getAttribute('nicetitle');\r
-\r
- var d = document.createElementNS(XHTMLNS, 'div');\r
- d.className = 'nicetitle';\r
- var dc = document.createElementNS(XHTMLNS, 'div');\r
- dc.className = 'nicetitle-content';\r
- d.appendChild(dc);\r
- tnt = document.createTextNode(nicetitle);\r
- pat = document.createElementNS(XHTMLNS, 'p');\r
- pat.className = 'titletext';\r
- pat.appendChild(tnt);\r
-\r
- // 2003-11-18 Dunstan Orchard\r
- // added in accesskey info\r
- if (lnk.accessKey)\r
- {\r
- axs = document.createTextNode(' [' + lnk.accessKey + ']');\r
- axsk = document.createElementNS(XHTMLNS, 'span');\r
- axsk.className = 'accesskey';\r
- axsk.appendChild(axs);\r
- pat.appendChild(axsk);\r
- }\r
- dc.appendChild(pat);\r
-\r
- if (lnk.href)\r
- {\r
- tnd = document.createTextNode(lnk.href);\r
- pad = document.createElementNS(XHTMLNS, 'p');\r
- pad.className = 'destination';\r
- pad.appendChild(tnd);\r
- dc.appendChild(pad);\r
- }\r
-\r
- STD_WIDTH = 300;\r
-\r
- if (lnk.href)\r
- {\r
- h = lnk.href.length;\r
- }\r
- else\r
- {\r
- h = nicetitle.length;\r
- }\r
-\r
- if (nicetitle.length)\r
- {\r
- t = nicetitle.length;\r
- }\r
-\r
- h_pixels = h*6;\r
- t_pixels = t*10;\r
-\r
- if (h_pixels > STD_WIDTH)\r
- {\r
- w = h_pixels;\r
- }\r
- else if ((STD_WIDTH>t_pixels) && (t_pixels>h_pixels))\r
- {\r
- w = t_pixels;\r
- }\r
- else if ((STD_WIDTH>t_pixels) && (h_pixels>t_pixels))\r
- {\r
- w = h_pixels;\r
- }\r
- else\r
- {\r
- w = STD_WIDTH;\r
- }\r
-\r
- d.style.width = w + 'px';\r
-\r
- mpos = findPosition(lnk);\r
- mx = mpos[0];\r
- my = mpos[1];\r
-\r
- d.style.left = (mx+15) + 'px';\r
- d.style.top = (my+35) + 'px';\r
-\r
- if (window.innerWidth && ((mx+w) > window.innerWidth))\r
- {\r
- d.style.left = (window.innerWidth - w - 25) + 'px';\r
- }\r
- if (document.body.scrollWidth && ((mx+w) > document.body.scrollWidth))\r
- {\r
- d.style.left = (document.body.scrollWidth - w - 25) + 'px';\r
- }\r
-\r
- document.getElementsByTagName('body')[0].appendChild(d);\r
-\r
- CURRENT_NICE_TITLE = d;\r
- }\r
-\r
-function hideNiceTitle(e)\r
- {\r
- // 2003-11-19 sidesh0w\r
- // clearTimeout\r
- if (delay) clearTimeout(delay);\r
- if (!document.getElementsByTagName) return;\r
- if (CURRENT_NICE_TITLE)\r
- {\r
- document.getElementsByTagName('body')[0].removeChild(CURRENT_NICE_TITLE);\r
- CURRENT_NICE_TITLE = null;\r
- }\r
- }\r
-\r
-addEvent(window, "load", floatImages);\r
-addEvent(window, "resize", floatImages);\r
-addEvent(window, "load", blockquoteCite);\r
-addEvent(window, "load", insdelCite);\r
-addEvent(window, "load", noAltTooltip);\r
-addEvent(window, "load", makeNiceTitles);\r
-\r
+// from http://www.kryogenix.org
+// by Scott Andrew - http://scottandrew.com
+// add an eventlistener to browsers that can do it somehow.
+function addEvent(obj, evType, fn)
+ {
+ if (obj.addEventListener)
+ {
+ obj.addEventListener(evType, fn, false);
+ return true;
+ }
+ else if (obj.attachEvent)
+ {
+ var r = obj.attachEvent('on'+evType, fn);
+ return r;
+ }
+ else
+ {
+ return false;
+ }
+ }
+
+function floatImages()
+ {
+ // adapted from http://www.dithered.com/javascript/browser_detect/
+ //**************************************************************//
+ // sniff user agent
+ var userAgent = navigator.userAgent.toLowerCase();
+
+ // if Mozilla 1.4 then quit
+ if ((userAgent.indexOf('gecko') != -1) && (userAgent.indexOf('gecko/') + 14 == userAgent.length) && (parseFloat(userAgent.substring(userAgent.indexOf('rv:') + 3)) == '1.4')) return;
+
+ // if Opera then quit
+ if (document.all && window.Event) return;
+ //**************************************************************//
+
+ // check this browser can cope with what we want to do
+ if (!document.getElementById) return;
+ var blogDiv = document.getElementById('blog');
+ if (!blogDiv) return;
+ if (!blogDiv.offsetWidth) return;
+
+ blogDiv.className = (blogDiv.offsetWidth >= 500) ? "float-images" : "block-images";
+ }
+
+// Blockquote citations
+
+// Simon Willison's work:
+// http://simon.incutio.com/archive/2002/12/20/#blockquoteCitations
+
+// Also Dunstan Orchard's work:
+// http://1976design.com/blog/archive/2003/11/10/updates/
+function blockquoteCite()
+ {
+ if (!document.createElementNS)
+ {
+ document.createElementNS = function(ns, elt)
+ {
+ return document.createElement(elt);
+ }
+ }
+ quotes = document.getElementsByTagName('blockquote');
+ for (i = 0; i < quotes.length; i++)
+ {
+ var cite = quotes[i].getAttribute('cite');
+ // value of cite attribute should only contain URI, not any other
+ if ((cite) && (cite != ''))
+ {
+ newlink = document.createElementNS('http://www.w3.org/1999/xhtml', 'a');
+ newlink.setAttribute('href', cite);
+ newlink.className = 'cite-link';
+ newlink.appendChild(document.createTextNode(cite));
+ newdiv = document.createElementNS('http://www.w3.org/1999/xhtml', 'cite');
+ newdiv.className = 'blockquote-cite';
+ newdiv.appendChild(document.createTextNode('Source: '));
+ newdiv.appendChild(newlink);
+ quotes[i].appendChild(newdiv);
+ quotes[i].removeAttribute('cite');
+ }
+ }
+ }
+
+// Ins and Del tags citations
+function insdelCite()
+ {
+ if (!document.createElementNS)
+ {
+ document.createElementNS = function(ns, elt)
+ {
+ return document.createElement(elt);
+ }
+ }
+ var insdel = new Array(2);
+ insdel[0] = document.getElementsByTagName('ins');
+ insdel[1] = document.getElementsByTagName('del');
+ for (var i=0; i<insdel.length; i++)
+ {
+ if (insdel[i])
+ {
+ for (var id=0; id<insdel[i].length; id++)
+ {
+ var isdl = insdel[i][id].getAttribute('cite');
+ if ((isdl) && (isdl != ""))
+ {
+ idlink = document.createElementNS('http://www.w3.org/1999/xhtml', 'a');
+ idlink.setAttribute('href', isdl);
+ idlink.className = 'cite-link ' + (i == 0 ? 'ins-cite' : 'del-cite');
+ idlink.setAttribute('title','citation of ' + (i == 0 ? 'added' : 'deleted') + ' text');
+ idlink.appendChild(document.createTextNode('#'));
+ insdel[i][id].appendChild(idlink);
+ insdel[i][id].removeAttribute('cite');
+ }
+ }
+ }
+ }
+ }
+
+// Force IE not to show alternate text as tooltip
+function noAltTooltip()
+ {
+ images = document.getElementsByTagName('img');
+ for (var i = 0; i < images.length; i++)
+ {
+ var title = images[i].getAttribute('title');
+ var alt = images[i].getAttribute('alt');
+ if ((document.all) && (alt) && (!title))
+ {
+ images[i].setAttribute('title', '');
+ }
+ }
+ }
+
+// Nice Titles
+
+// original code by Stuart Langridge 2003-11
+// with additions to the code by other good people
+// http://www.kryogenix.org/code/browser/nicetitle/
+// thank you, sir
+
+// modified by Peter Janes 2003-03-25
+// http://peterjanes.ca/blog/archives/2003/03/25/nicetitles-for-ins-and-del
+// added in ins and del tags
+
+// modified by Dunstan Orchard 2003-11-18
+// http://1976design.com/blog/
+// added in accesskey information
+// tried ever-so-hard, but couldn't work out how to do what Ethan did
+
+// final genius touch by by Ethan Marcotte 2003-11-18
+// http://www.sidesh0w.com/
+// worked out how to delay showing the popups to make them more like the browser's own
+
+// set the namespace
+var XHTMLNS = 'http://www.w3.org/1999/xhtml';
+var CURRENT_NICE_TITLE;
+
+// browser sniff
+var browser = new Browser();
+
+// determine browser and version.
+function Browser()
+ {
+ var ua, s, i;
+
+ this.isIE = false;
+ this.isNS = false;
+ this.version = null;
+
+ ua = navigator.userAgent;
+
+ s = 'MSIE';
+ if ((i = ua.indexOf(s)) >= 0)
+ {
+ this.isIE = true;
+ this.version = parseFloat(ua.substr(i + s.length));
+ return;
+ }
+
+ s = 'Netscape6/';
+ if ((i = ua.indexOf(s)) >= 0)
+ {
+ this.isNS = true;
+ this.version = parseFloat(ua.substr(i + s.length));
+ return;
+ }
+
+ // treat any other 'Gecko' browser as NS 6.1.
+ s = 'Gecko';
+ if ((i = ua.indexOf(s)) >= 0)
+ {
+ this.isNS = true;
+ this.version = 6.1;
+ return;
+ }
+ }
+
+// 2003-11-19 sidesh0w
+// set delay vars to emulate normal hover delay
+var delay;
+var interval = 0.60;
+
+// this function runs on window load
+// it runs through all the links on the page as starts listening for actions
+function makeNiceTitles()
+ {
+ if (!document.createElement || !document.getElementsByTagName) return;
+ if (!document.createElementNS)
+ {
+ document.createElementNS = function(ns, elt)
+ {
+ return document.createElement(elt);
+ }
+ }
+
+ // do regular links
+ if (!document.links)
+ {
+ document.links = document.getElementsByTagName('a');
+ }
+ for (var ti=0; ti<document.links.length; ti++)
+ {
+ var lnk = document.links[ti];
+ // * I added specific class names here..
+ if (lnk.title)
+ {
+ lnk.setAttribute('nicetitle', lnk.title);
+ lnk.removeAttribute('title');
+ addEvent(lnk, 'mouseover', showDelay);
+ addEvent(lnk, 'mouseout', hideNiceTitle);
+ addEvent(lnk, 'focus', showDelay);
+ addEvent(lnk, 'blur', hideNiceTitle);
+ }
+ }
+
+ // 2003-03-25 Peter Janes
+ // do ins and del tags
+ var tags = new Array(2);
+ tags[0] = document.getElementsByTagName('ins');
+ tags[1] = document.getElementsByTagName('del');
+ for (var tt=0; tt<tags.length; tt++)
+ {
+ if (tags[tt])
+ {
+ for (var ti=0; ti<tags[tt].length; ti++)
+ {
+ var tag = tags[tt][ti];
+ if (tag.dateTime)
+ {
+ var strDate = tag.dateTime;
+ // HTML/ISO8601 date: yyyy-mm-ddThh:mm:ssTZD (Z, -hh:mm, +hh:mm)
+ var month = strDate.substring(5,7);
+ var day = strDate.substring(8,10);
+ if (month[0] == '0')
+ {
+ month = month[1];
+ }
+ if (day[0] == '0')
+ {
+ day = day[1];
+ }
+ var dtIns = new Date(strDate.substring(0,4), month-1, day, strDate.substring(11,13), strDate.substring(14,16), strDate.substring(17,19));
+ tag.setAttribute('nicetitle', (tt == 0 ? 'Added' : 'Deleted') + ' on ' + dtIns.toString());
+ addEvent(tag, 'mouseover', showDelay);
+ addEvent(tag, 'mouseout', hideNiceTitle);
+ addEvent(tag, 'focus', showDelay);
+ addEvent(tag, 'blur', hideNiceTitle);
+ }
+ }
+ }
+ }
+ }
+
+function findPosition(oLink)
+ {
+ if (oLink.offsetParent)
+ {
+ for (var posX = 0, posY = 0; oLink.offsetParent; oLink = oLink.offsetParent)
+ {
+ posX += oLink.offsetLeft;
+ posY += oLink.offsetTop;
+ }
+ return [posX, posY];
+ }
+ else
+ {
+ return [oLink.x, oLink.y];
+ }
+ }
+
+function getParent(el, pTagName)
+ {
+ if (el == null)
+ {
+ return null;
+ }
+ // gecko bug, supposed to be uppercase
+ else if (el.nodeType == 1 && el.tagName.toLowerCase() == pTagName.toLowerCase())
+ {
+ return el;
+ }
+ else
+ {
+ return getParent(el.parentNode, pTagName);
+ }
+ }
+
+// 2003-11-19 sidesh0w
+// trailerpark wrapper function
+function showDelay(e)
+ {
+ if (window.event && window.event.srcElement)
+ {
+ lnk = window.event.srcElement
+ }
+ else if (e && e.target)
+ {
+ lnk = e.target
+ }
+ if (!lnk) return;
+
+ // lnk is a textnode or an elementnode that's not ins/del
+ if (lnk.nodeType == 3 || (lnk.nodeType == 1 && lnk.tagName.toLowerCase() != 'ins' && lnk.tagName.toLowerCase() != 'del'))
+ {
+ // ascend parents until we hit a link
+ lnk = getParent(lnk, 'a');
+ }
+
+ delay = setTimeout("showNiceTitle(lnk)", interval * 1000);
+ }
+
+// build and show the nice titles
+function showNiceTitle(link)
+ {
+ if (CURRENT_NICE_TITLE) hideNiceTitle(CURRENT_NICE_TITLE);
+ if (!document.getElementsByTagName) return;
+
+ nicetitle = lnk.getAttribute('nicetitle');
+
+ var d = document.createElementNS(XHTMLNS, 'div');
+ d.className = 'nicetitle';
+ var dc = document.createElementNS(XHTMLNS, 'div');
+ dc.className = 'nicetitle-content';
+ d.appendChild(dc);
+ tnt = document.createTextNode(nicetitle);
+ pat = document.createElementNS(XHTMLNS, 'p');
+ pat.className = 'titletext';
+ pat.appendChild(tnt);
+
+ // 2003-11-18 Dunstan Orchard
+ // added in accesskey info
+ if (lnk.accessKey)
+ {
+ axs = document.createTextNode(' [' + lnk.accessKey + ']');
+ axsk = document.createElementNS(XHTMLNS, 'span');
+ axsk.className = 'accesskey';
+ axsk.appendChild(axs);
+ pat.appendChild(axsk);
+ }
+ dc.appendChild(pat);
+
+ if (lnk.href)
+ {
+ tnd = document.createTextNode(lnk.href);
+ pad = document.createElementNS(XHTMLNS, 'p');
+ pad.className = 'destination';
+ pad.appendChild(tnd);
+ dc.appendChild(pad);
+ }
+
+ STD_WIDTH = 300;
+
+ if (lnk.href)
+ {
+ h = lnk.href.length;
+ }
+ else
+ {
+ h = nicetitle.length;
+ }
+
+ if (nicetitle.length)
+ {
+ t = nicetitle.length;
+ }
+
+ h_pixels = h*6;
+ t_pixels = t*10;
+
+ if (h_pixels > STD_WIDTH)
+ {
+ w = h_pixels;
+ }
+ else if ((STD_WIDTH>t_pixels) && (t_pixels>h_pixels))
+ {
+ w = t_pixels;
+ }
+ else if ((STD_WIDTH>t_pixels) && (h_pixels>t_pixels))
+ {
+ w = h_pixels;
+ }
+ else
+ {
+ w = STD_WIDTH;
+ }
+
+ d.style.width = w + 'px';
+
+ mpos = findPosition(lnk);
+ mx = mpos[0];
+ my = mpos[1];
+
+ d.style.left = (mx+15) + 'px';
+ d.style.top = (my+35) + 'px';
+
+ if (window.innerWidth && ((mx+w) > window.innerWidth))
+ {
+ d.style.left = (window.innerWidth - w - 25) + 'px';
+ }
+ if (document.body.scrollWidth && ((mx+w) > document.body.scrollWidth))
+ {
+ d.style.left = (document.body.scrollWidth - w - 25) + 'px';
+ }
+
+ document.getElementsByTagName('body')[0].appendChild(d);
+
+ CURRENT_NICE_TITLE = d;
+ }
+
+function hideNiceTitle(e)
+ {
+ // 2003-11-19 sidesh0w
+ // clearTimeout
+ if (delay) clearTimeout(delay);
+ if (!document.getElementsByTagName) return;
+ if (CURRENT_NICE_TITLE)
+ {
+ document.getElementsByTagName('body')[0].removeChild(CURRENT_NICE_TITLE);
+ CURRENT_NICE_TITLE = null;
+ }
+ }
+
+addEvent(window, "load", floatImages);
+addEvent(window, "resize", floatImages);
+addEvent(window, "load", blockquoteCite);
+addEvent(window, "load", insdelCite);
+addEvent(window, "load", noAltTooltip);
+addEvent(window, "load", makeNiceTitles);
+
// I'm very poor in JavaScript. Please correct me if I'm wrong.
\ No newline at end of file
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">\r
-<html xml:lang="en" xmlns="http://www.w3.org/1999/xhtml">\r
-<head>\r
- <title>Nucleus CMS 3.2 - default skin</title>\r
- <link rel="stylesheet" type="text/css" href="../../nucleus/styles/manual.css" />\r
-</head>\r
-<body>\r
- <h1>Nucleus CMS 3.2 - default skin</h1>\r
-\r
- <p>Default Nucleus CMS 3.2 skin based on the Stanch skin contributed by <a href="http://www.stanch.net/">Stanch</a> with assistance from <a href="http://roelg.nl/">roel</a>.</p>\r
-\r
- <p>Default skin's skin/templates/includes tweaked by <a href="http://nupusi.com/">hcgtv</a>, CSS color scheme by <a href="http://smalltalking.com/">moraes</a>.</p>\r
-\r
- <br />\r
- <p>This skin has been tested on major modern browsers, such as Firefox 1.0, Internet Explorer 6.0, Opera 7.54 and Netscape 7.2. The skin is coded using valid XHTML 1.0 and valid CSS.</p>\r
-\r
- <p>If you want drop shadow effect for your images when you blog, you have to add 3 div's surrounding the image. Start with <div class="wrap1">, followed by <div class="wrap2">, and then <div class="wrap3">. Remember to close them with </div></div></div>. Please note also that the drop shadow has float:left style applied to it.</p>\r
-\r
- <p>On the comments page, you will notice that the owner (Nucleus administrator) has a different kind of styling to his/her comments, as opposed to the comments made by visitors. This is made possible using CSS. I have included short comments in the CSS file, I'm sure it is easy to understand, in case you want to remove this styling or you want to add styling for different members.</p>\r
-\r
- <br />\r
- <p>Default skin files:</p>\r
- <p>default_left.css - left side menu CSS code, change it in head.inc</p>\r
- <p>default_right.css - right side menu CSS code, default CSS in head.inc</p>\r
- <p>skinbackup.xml - backup of default skin, can be reimported just in case</p>\r
- <p>/images - background, header, footer and misc images</p>\r
-\r
- <br />\r
- <p>This skin makes use of includes for skin abstraction:</p>\r
- <p>head.inc - html header</p>\r
- <p>navigation.inc - navigation & page titles</p>\r
- <p>header.inc - page header</p>\r
- <p>sidebar.inc - page menu</p>\r
- <p>footer.inc - page footer</p>\r
-\r
- <br />\r
- <p>Extra files:</p>\r
- <p>nicetitles.js - tooltips javascript code, triggered by title="" attribute in links</p>\r
- <p>nicetitle.css - tooltips color and layout code</p>\r
- <p>favicon.ico - sample favorite icon, copy to site's root directory</p>\r
-\r
- <br />\r
- <p>The <a href="http://wiki.gednet.com/NPSkinFiles">NP_SkinFiles plugin</a> is recommended for maintenance of includes.</a></p>\r
- <p>Note: chmod 666 the .inc files in the /skins/default directory.</p>\r
-\r
- <br />\r
- <p>Tooltips courtesy of <a href="http://neo.dzygn.com/code/nicetitles">NiceTitles</a></p>\r
-\r
- <br />\r
- <h1>Nucleus CMS 3.2 - to stop the flow of tears</h1>\r
-\r
-</body>\r
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
+<html xml:lang="en" xmlns="http://www.w3.org/1999/xhtml">
+<head>
+ <title>Nucleus CMS 3.2 - default skin</title>
+ <link rel="stylesheet" type="text/css" href="../../nucleus/styles/manual.css" />
+</head>
+<body>
+ <h1>Nucleus CMS 3.2 - default skin</h1>
+
+ <p>Default Nucleus CMS 3.2 skin based on the Stanch skin contributed by <a href="http://www.stanch.net/">Stanch</a> with assistance from <a href="http://roelg.nl/">roel</a>.</p>
+
+ <p>Default skin's skin/templates/includes tweaked by <a href="http://nupusi.com/">hcgtv</a>, CSS color scheme by <a href="http://smalltalking.com/">moraes</a>.</p>
+
+ <br />
+ <p>This skin has been tested on major modern browsers, such as Firefox 1.0, Internet Explorer 6.0, Opera 7.54 and Netscape 7.2. The skin is coded using valid XHTML 1.0 and valid CSS.</p>
+
+ <p>If you want drop shadow effect for your images when you blog, you have to add 3 div's surrounding the image. Start with <div class="wrap1">, followed by <div class="wrap2">, and then <div class="wrap3">. Remember to close them with </div></div></div>. Please note also that the drop shadow has float:left style applied to it.</p>
+
+ <p>On the comments page, you will notice that the owner (Nucleus administrator) has a different kind of styling to his/her comments, as opposed to the comments made by visitors. This is made possible using CSS. I have included short comments in the CSS file, I'm sure it is easy to understand, in case you want to remove this styling or you want to add styling for different members.</p>
+
+ <br />
+ <p>Default skin files:</p>
+ <p>default_left.css - left side menu CSS code, change it in head.inc</p>
+ <p>default_right.css - right side menu CSS code, default CSS in head.inc</p>
+ <p>skinbackup.xml - backup of default skin, can be reimported just in case</p>
+ <p>/images - background, header, footer and misc images</p>
+
+ <br />
+ <p>This skin makes use of includes for skin abstraction:</p>
+ <p>head.inc - html header</p>
+ <p>navigation.inc - navigation & page titles</p>
+ <p>header.inc - page header</p>
+ <p>sidebar.inc - page menu</p>
+ <p>footer.inc - page footer</p>
+
+ <br />
+ <p>Extra files:</p>
+ <p>nicetitles.js - tooltips javascript code, triggered by title="" attribute in links</p>
+ <p>nicetitle.css - tooltips color and layout code</p>
+ <p>favicon.ico - sample favorite icon, copy to site's root directory</p>
+
+ <br />
+ <p>The <a href="http://wiki.gednet.com/NPSkinFiles">NP_SkinFiles plugin</a> is recommended for maintenance of includes.</a></p>
+ <p>Note: chmod 666 the .inc files in the /skins/default directory.</p>
+
+ <br />
+ <p>Tooltips courtesy of <a href="http://neo.dzygn.com/code/nicetitles">NiceTitles</a></p>
+
+ <br />
+ <h1>Nucleus CMS 3.2 - to stop the flow of tears</h1>
+
+</body>
</html>
\ No newline at end of file
-Nucleus skins directory\r
------------------------\r
-\r
-PLEASE NOTE: the skinbackup.xml or skindata.xml files in these directories are not where you should edit the skins. These files get generated by the Nucleus skin export function and are meant to distribute skins between Nucleus users.\r
-\r
+Nucleus skins directory
+-----------------------
+PLEASE NOTE: the skinbackup.xml or skindata.xml files in these directories are not where you should edit the skins. These files get generated by the Nucleus skin export function and are meant to distribute skins between Nucleus users.
To edit skins, open the Nucleus Admin Area, and select 'skins' in the left menu.
\ No newline at end of file